diff options
483 files changed, 19337 insertions, 6720 deletions
diff --git a/.bazelrc b/.bazelrc new file mode 100644 index 0000000..6659e7e --- /dev/null +++ b/.bazelrc @@ -0,0 +1,3 @@ +startup --windows_enable_symlinks
+build --enable_runfiles
+build --features=compiler_param_file
\ No newline at end of file diff --git a/.devcontainer/Dockerfile b/.devcontainer/Dockerfile new file mode 100644 index 0000000..ba27052 --- /dev/null +++ b/.devcontainer/Dockerfile @@ -0,0 +1,26 @@ +FROM mcr.microsoft.com/vscode/devcontainers/base:0-focal + +# ** [Optional] Uncomment this section to install additional packages. ** +# RUN apt-get update && export DEBIAN_FRONTEND=noninteractive \ +# && apt-get -y install --no-install-recommends <your-package-list-here> + +RUN apt update -y && apt install apt-transport-https curl gnupg python build-essential ca-certificates lsb-release -y && \ + curl -fsSL https://bazel.build/bazel-release.pub.gpg | gpg --dearmor -o /etc/apt/trusted.gpg.d/bazel.gpg && \ + curl -fsSL https://download.docker.com/linux/ubuntu/gpg | gpg --dearmor -o /usr/share/keyrings/docker-archive-keyring.gpg && \ + echo "deb [arch=amd64 signed-by=/usr/share/keyrings/docker-archive-keyring.gpg] https://download.docker.com/linux/ubuntu $(lsb_release -cs) stable" | tee /etc/apt/sources.list.d/docker.list && \ + echo "deb [arch=amd64] https://storage.googleapis.com/bazel-apt stable jdk1.8" | tee /etc/apt/sources.list.d/bazel.list && \ + apt update -y && apt install bazel docker-ce-cli -y + +ARG NONROOT_USER=vscode + +RUN echo "#!/bin/sh\n\ + SOCKET_GID=\$(stat -c '%g' /var/run/docker.sock) \n\ + if [ \"${SOCKET_GID}\" != '0' ]; then\n\ + if [ \"\$(cat /etc/group | grep :\${SOCKET_GID}:)\" = '' ]; then groupadd --gid \${SOCKET_GID} docker-host; fi \n\ + if [ \"\$(id ${NONROOT_USER} | grep -E \"groups=.*(=|,)\${SOCKET_GID}\(\")\" = '' ]; then usermod -aG \${SOCKET_GID} ${NONROOT_USER}; fi\n\ + fi\n\ + exec \"\$@\"" > /usr/local/share/docker-init.sh \ + && chmod +x /usr/local/share/docker-init.sh + +ENTRYPOINT [ "/usr/local/share/docker-init.sh" ] +CMD [ "sleep", "infinity" ]
\ No newline at end of file diff --git a/.devcontainer/devcontainer.json b/.devcontainer/devcontainer.json new file mode 100644 index 0000000..0ff8ae1 --- /dev/null +++ b/.devcontainer/devcontainer.json @@ -0,0 +1,32 @@ +// For format details, see https://aka.ms/devcontainer.json. For config options, see the README at: +// https://github.com/microsoft/vscode-dev-containers/tree/v0.191.1/containers/debian +{ + "name": "Ubuntu", + "build": { + "dockerfile": "Dockerfile", + // Update 'VARIANT' to pick an Debian version: bullseye, buster, stretch + "args": { "VARIANT": "focal" } + }, + + // Set *default* container specific settings.json values on container create. + "settings": {}, + + // Add the IDs of extensions you want installed when the container is created. + "extensions": [ + "" + ], + + // Use 'forwardPorts' to make a list of ports inside the container available locally. + // "forwardPorts": [], + + // Uncomment to use the Docker CLI from inside the container. See https://aka.ms/vscode-remote/samples/docker-from-docker. + "mounts": ["source=/var/run/docker.sock,target=/var/run/docker.sock,type=bind"], + + // Uncomment when using a ptrace-based debugger like C++, Go, and Rust + // "runArgs": [ "--cap-add=SYS_PTRACE", "--security-opt", "seccomp=unconfined" ], + + // Comment out connect as root instead. More info: https://aka.ms/vscode-remote/containers/non-root. + "remoteUser": "vscode", + "overrideCommand": false, + "runArgs": ["--init"], +}
\ No newline at end of file diff --git a/.github/workflows/bazel-build.yml b/.github/workflows/bazel-build.yml index 4e60e40..5f919c8 100644 --- a/.github/workflows/bazel-build.yml +++ b/.github/workflows/bazel-build.yml @@ -4,12 +4,7 @@ name: Build # Controls when the workflow will run
on:
- # Triggers the workflow on push or pull request events but only for the main branch
push:
- branches: [ main ]
- pull_request:
- branches: [ main ]
-
# Allows you to run this workflow manually from the Actions tab
workflow_dispatch:
# A workflow run is made up of one or more jobs that can run sequentially or in parallel
@@ -26,6 +21,23 @@ jobs: steps:
# Checks-out your repository under $GITHUB_WORKSPACE, so your job can access it
- uses: actions/checkout@v2
+
+ - uses: ilammy/msvc-dev-cmd@v1
+ if: matrix.os == 'windows-latest'
+
+ - name: Extract branch name
+ shell: bash
+ run: echo "##[set-output name=branch;]$(echo ${GITHUB_REF#refs/heads/})"
+ id: extract_branch
+
+ - uses: docker-practice/actions-setup-docker@master
+ if: matrix.os == 'ubuntu-latest'
+ - uses: docker/login-action@v1
+ if: matrix.os == 'ubuntu-latest'
+ with:
+ registry: ghcr.io
+ username: ${{ github.actor }}
+ password: ${{ secrets.GITHUB_TOKEN }}
- name: Setup Bazelisk
# You may pin to the exact commit or the version.
# uses: bazelbuild/setup-bazelisk@2351cf5a7584ce72638fbce7c22e5128a5fcd5b2
@@ -41,14 +53,27 @@ jobs: with:
path: "~/.cache/bazel"
key: bazel-${{ matrix.os }}
+ - name: Execute Bazel tests
+ shell: bash
+ run: |
+ bazel test //:tests
# Runs a set of commands using the runners shell
- name: Execute build script
shell: bash
run: |
- bazel build //:package
+ bazel build //:packages
- name: Bazel artifacts
uses: actions/upload-artifact@v2
with:
name: all-${{ matrix.os }}
- path: bazel-bin*/**/*
+ path: |
+ bazel-bin*/packages_*
+ bazel-bin*/packages_zip.zip
+ bazel-bin*/packages_tar.tar.gz
+
+ - name: Publish docker images
+ shell: bash
+ run: |
+ bazel run --define docker_repo=ghcr.io --define docker_tag=${{ steps.extract_branch.outputs.branch }} //:container_publish
+ if: matrix.os == 'ubuntu-latest'
diff --git a/.github/workflows/codeql-analysis.yml b/.github/workflows/codeql-analysis.yml new file mode 100644 index 0000000..d0005cd --- /dev/null +++ b/.github/workflows/codeql-analysis.yml @@ -0,0 +1,61 @@ +# For most projects, this workflow file will not need changing; you simply need +# to commit it to your repository. +# +# You may wish to alter this file to override the set of languages analyzed, +# or to provide custom queries or build logic. +# +# ******** NOTE ******** +# We have attempted to detect the languages in your repository. Please check +# the `language` matrix defined below to confirm you have the correct set of +# supported CodeQL languages. +# +name: "CodeQL" + +on: + push: + branches: [ main ] + pull_request: + # The branches below must be a subset of the branches above + branches: [ main ] + schedule: + - cron: '31 9 * * 6' + +jobs: + analyze: + name: Analyze + runs-on: ubuntu-latest + permissions: + actions: read + contents: read + security-events: write + + strategy: + fail-fast: false + matrix: + language: [ 'go' ] + # CodeQL supports [ 'cpp', 'csharp', 'go', 'java', 'javascript', 'python' ] + # Learn more: + # https://docs.github.com/en/free-pro-team@latest/github/finding-security-vulnerabilities-and-errors-in-your-code/configuring-code-scanning#changing-the-languages-that-are-analyzed + + steps: + - name: Checkout repository + uses: actions/checkout@v2 + + # Initializes the CodeQL tools for scanning. + - name: Initialize CodeQL + uses: github/codeql-action/init@v1 + with: + languages: ${{ matrix.language }} + # If you wish to specify custom queries, you can do so here or in a config file. + # By default, queries listed here will override any specified in a config file. + # Prefix the list here with "+" to use these queries and those in the config file. + # queries: ./path/to/local/query, your-org/your-repo/queries@main + + # Autobuild attempts to build any compiled languages (C/C++, C#, or Java). + # If this step fails, then you should remove it and run the build manually (see below) + # This is commented, because we don't use C/C++, C# or Java + # - name: Autobuild + # uses: github/codeql-action/autobuild@v1 + + - name: Perform CodeQL Analysis + uses: github/codeql-action/analyze@v1 @@ -1,4 +1,5 @@ bazel-*
-.bazelrc
.vscode
ratelimiter/target
+target/
+**/local*
\ No newline at end of file @@ -1,17 +1,69 @@ load("@bazel_gazelle//:def.bzl", "gazelle") -load("@bazel_tools//tools/build_defs/pkg:pkg.bzl", "pkg_tar") +load("@rules_pkg//:pkg.bzl", "pkg_zip", "pkg_tar") +load("@io_bazel_rules_docker//container:container.bzl", "container_bundle") +load("@io_bazel_rules_docker//contrib:push-all.bzl", "container_push") # gazelle:prefix github.com/discordnova/nova gazelle(name = "gazelle") +filegroup( + name = "binaries", + srcs = [ + "//novactl", + "//webhook", + "//gateway", + "//ratelimiter", + "//cache" + ] +) + +container_bundle( + name = "container_images", + + images = { + "$(docker_repo)/discordnova/nova/novactl:$(docker_tag)": "//novactl:image", + "$(docker_repo)/discordnova/nova/gateway:$(docker_tag)": "//gateway:image", + "$(docker_repo)/discordnova/nova/ratelimiter:$(docker_tag)": "//ratelimiter:image", + "$(docker_repo)/discordnova/nova/webhook:$(docker_tag)": "//webhook:image", + "$(docker_repo)/discordnova/nova/cache:$(docker_tag)": "//cache:image", + } +) + +container_push( + name = "container_publish", + bundle = ":container_images", + format = "OCI" +) + +test_suite( + name = "tests", + tests = [ + "//novactl:tests", + "//webhook:tests", + "//gateway:tests", + "//ratelimiter:tests" + ], +) + pkg_tar( - name = "package", + name = "packages_tar", extension = "tar.gz", - deps = [ - "//gateway:gateway_pkg", - "//novactl:novactl_pkg", - "//novalet:novalet_pkg", - "//ratelimiter:ratelimiter_pkg", - "//webhook:webhook_pkg", + srcs = [ + ":binaries" ], ) + +pkg_zip( + name = "packages_zip", + srcs = [ + ":binaries" + ], +) + +filegroup( + name = "packages", + srcs = [ + ":packages_zip", + ":packages_tar", + ], +)
\ No newline at end of file diff --git a/Cargo.lock b/Cargo.lock new file mode 100644 index 0000000..0696dd6 --- /dev/null +++ b/Cargo.lock @@ -0,0 +1,2325 @@ +# This file is automatically @generated by Cargo. +# It is not intended for manual editing. +version = 3 + +[[package]] +name = "aho-corasick" +version = "0.7.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e37cfd5e7657ada45f742d6e99ca5788580b5c529dc78faf11ece6dc702656f" +dependencies = [ + "memchr", +] + +[[package]] +name = "anyhow" +version = "1.0.43" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "28ae2b3dec75a406790005a200b1bd89785afc02517a00ca99ecfe093ee9e6cf" + +[[package]] +name = "arrayvec" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "23b62fc65de8e4e7f52534fb52b0f3ed04746ae267519eef2a83941e8085068b" + +[[package]] +name = "async-channel" +version = "1.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2114d64672151c0c5eaa5e131ec84a74f06e1e559830dabba01ca30605d66319" +dependencies = [ + "concurrent-queue", + "event-listener", + "futures-core", +] + +[[package]] +name = "async-stream" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "171374e7e3b2504e0e5236e3b59260560f9fe94bfe9ac39ba5e4e929c5590625" +dependencies = [ + "async-stream-impl", + "futures-core", +] + +[[package]] +name = "async-stream-impl" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "648ed8c8d2ce5409ccd57453d9d1b214b342a0d69376a6feda1fd6cae3299308" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "async-task" +version = "4.0.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e91831deabf0d6d7ec49552e489aed63b7456a7a3c46cff62adad428110b0af0" + +[[package]] +name = "async-trait" +version = "0.1.51" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "44318e776df68115a881de9a8fd1b9e53368d7a4a5ce4cc48517da3393233a5e" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "atomic-waker" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "065374052e7df7ee4047b1160cca5e1467a12351a40b3da123c870ba0b8eda2a" + +[[package]] +name = "atty" +version = "0.2.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d9b39be18770d11421cdb1b9947a45dd3f37e93092cbf377614828a319d5fee8" +dependencies = [ + "hermit-abi", + "libc", + "winapi", +] + +[[package]] +name = "autocfg" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cdb031dd78e28731d87d56cc8ffef4a8f36ca26c38fe2de700543e627f8a464a" + +[[package]] +name = "base64" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "904dfeac50f3cdaba28fc6f57fdcddb75f49ed61346676a78c4ffe55877802fd" + +[[package]] +name = "base64-url" +version = "1.4.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "44265cf903f576fcaa1c2f23b32ec2dadaa8ec9d6b7c6212704d72a417bfbeef" +dependencies = [ + "base64", +] + +[[package]] +name = "bitflags" +version = "1.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a" + +[[package]] +name = "block-buffer" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4152116fd6e9dadb291ae18fc1ec3575ed6d84c29642d97890f4b4a3417297e4" +dependencies = [ + "generic-array", +] + +[[package]] +name = "blocking" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c5e170dbede1f740736619b776d7251cb1b9095c435c34d8ca9f57fcd2f335e9" +dependencies = [ + "async-channel", + "async-task", + "atomic-waker", + "fastrand", + "futures-lite", + "once_cell", +] + +[[package]] +name = "bumpalo" +version = "3.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9c59e7af012c713f529e7a3ee57ce9b31ddd858d4b512923602f74608b009631" + +[[package]] +name = "byteorder" +version = "1.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610" + +[[package]] +name = "bytes" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c4872d67bab6358e59559027aa3b9157c53d9358c51423c17554809a8858e0f8" + +[[package]] +name = "cache" +version = "0.1.0" +dependencies = [ + "common", + "log", + "nats", + "redis", + "serde 1.0.130", + "serde_json", +] + +[[package]] +name = "cache-padded" +version = "1.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "631ae5198c9be5e753e5cc215e1bd73c2b466a3565173db433f52bb9d3e66dba" + +[[package]] +name = "cc" +version = "1.0.70" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d26a6ce4b6a484fa3edb70f7efa6fc430fd2b87285fe8b84304fd0936faa0dc0" + +[[package]] +name = "cfg-if" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd" + +[[package]] +name = "chrono" +version = "0.4.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "670ad68c9088c2a963aaa298cb369688cf3f9465ce5e2d4ca10e6e0098a1ce73" +dependencies = [ + "libc", + "num-integer", + "num-traits 0.2.14", + "serde 1.0.130", + "time", + "winapi", +] + +[[package]] +name = "combine" +version = "4.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a909e4d93292cd8e9c42e189f61681eff9d67b6541f96b8a1a737f23737bd001" +dependencies = [ + "bytes", + "memchr", +] + +[[package]] +name = "common" +version = "0.1.0" +dependencies = [ + "config", + "hyper", + "log", + "nats", + "pretty_env_logger", + "prometheus", + "serde 1.0.130", + "tokio", +] + +[[package]] +name = "concurrent-queue" +version = "1.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "30ed07550be01594c6026cff2a1d7fe9c8f683caa798e12b68694ac9e88286a3" +dependencies = [ + "cache-padded", +] + +[[package]] +name = "config" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1b1b9d958c2b1368a663f05538fc1b5975adce1e19f435acceae987aceeeb369" +dependencies = [ + "lazy_static", + "nom", + "rust-ini", + "serde 1.0.130", + "serde-hjson", + "serde_json", + "toml", + "yaml-rust", +] + +[[package]] +name = "core-foundation" +version = "0.9.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0a89e2ae426ea83155dccf10c0fa6b1463ef6d5fcb44cee0b224a408fa640a62" +dependencies = [ + "core-foundation-sys", + "libc", +] + +[[package]] +name = "core-foundation-sys" +version = "0.8.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ea221b5284a47e40033bf9b66f35f984ec0ea2931eb03505246cd27a963f981b" + +[[package]] +name = "cpufeatures" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "95059428f66df56b63431fdb4e1947ed2190586af5c5a8a8b71122bdf5a7f469" +dependencies = [ + "libc", +] + +[[package]] +name = "crossbeam-channel" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "06ed27e177f16d65f0f0c22a213e17c696ace5dd64b14258b52f9417ccb52db4" +dependencies = [ + "cfg-if", + "crossbeam-utils", +] + +[[package]] +name = "crossbeam-utils" +version = "0.8.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d82cfc11ce7f2c3faef78d8a684447b40d503d9681acebed6cb728d45940c4db" +dependencies = [ + "cfg-if", + "lazy_static", +] + +[[package]] +name = "curve25519-dalek" +version = "3.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b9fdf9972b2bd6af2d913799d9ebc165ea4d2e65878e329d9c6b372c4491b61" +dependencies = [ + "byteorder", + "digest", + "rand_core 0.5.1", + "subtle", + "zeroize", +] + +[[package]] +name = "data-encoding" +version = "2.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3ee2393c4a91429dffb4bedf19f4d6abf27d8a732c8ce4980305d782e5426d57" + +[[package]] +name = "digest" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d3dd60d1080a57a05ab032377049e0591415d2b31afd7028356dbf3cc6dcb066" +dependencies = [ + "generic-array", +] + +[[package]] +name = "dtoa" +version = "0.4.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56899898ce76aaf4a0f24d914c97ea6ed976d42fec6ad33fcbb0a1103e07b2b0" + +[[package]] +name = "ed25519" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4620d40f6d2601794401d6dd95a5cf69b6c157852539470eeda433a99b3c0efc" +dependencies = [ + "signature", +] + +[[package]] +name = "ed25519-dalek" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c762bae6dcaf24c4c84667b8579785430908723d5c889f469d76a41d59cc7a9d" +dependencies = [ + "curve25519-dalek", + "ed25519", + "sha2", + "zeroize", +] + +[[package]] +name = "either" +version = "1.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e78d4f1cc4ae33bbfc157ed5d5a5ef3bc29227303d595861deb238fcec4e9457" + +[[package]] +name = "enumflags2" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a8672257d642ffdd235f6e9c723c2326ac1253c8f3c022e7cfd2e57da55b1131" +dependencies = [ + "enumflags2_derive", + "serde 1.0.130", +] + +[[package]] +name = "enumflags2_derive" +version = "0.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "33526f770a27828ce7c2792fdb7cb240220237e0ff12933ed6c23957fc5dd7cf" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "env_logger" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "44533bbbb3bb3c1fa17d9f2e4e38bbbaf8396ba82193c4cb1b6445d711445d36" +dependencies = [ + "atty", + "humantime", + "log", + "regex", + "termcolor", +] + +[[package]] +name = "event-listener" +version = "2.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7531096570974c3a9dcf9e4b8e1cede1ec26cf5046219fb3b9d897503b9be59" + +[[package]] +name = "fastrand" +version = "1.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b394ed3d285a429378d3b384b9eb1285267e7df4b166df24b7a6939a04dc392e" +dependencies = [ + "instant", +] + +[[package]] +name = "fixedbitset" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "37ab347416e802de484e4d03c7316c48f1ecb56574dfd4a46a80f173ce1de04d" + +[[package]] +name = "fnv" +version = "1.0.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1" + +[[package]] +name = "form_urlencoded" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5fc25a87fa4fd2094bffb06925852034d90a17f0d1e05197d4956d3555752191" +dependencies = [ + "matches", + "percent-encoding", +] + +[[package]] +name = "futures" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a12aa0eb539080d55c3f2d45a67c3b58b6b0773c1a3ca2dfec66d58c97fd66ca" +dependencies = [ + "futures-channel", + "futures-core", + "futures-executor", + "futures-io", + "futures-sink", + "futures-task", + "futures-util", +] + +[[package]] +name = "futures-channel" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5da6ba8c3bb3c165d3c7319fc1cc8304facf1fb8db99c5de877183c08a273888" +dependencies = [ + "futures-core", + "futures-sink", +] + +[[package]] +name = "futures-core" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "88d1c26957f23603395cd326b0ffe64124b818f4449552f960d815cfba83a53d" + +[[package]] +name = "futures-executor" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "45025be030969d763025784f7f355043dc6bc74093e4ecc5000ca4dc50d8745c" +dependencies = [ + "futures-core", + "futures-task", + "futures-util", +] + +[[package]] +name = "futures-io" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "522de2a0fe3e380f1bc577ba0474108faf3f6b18321dbf60b3b9c39a75073377" + +[[package]] +name = "futures-lite" +version = "1.12.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7694489acd39452c77daa48516b894c153f192c3578d5a839b62c58099fcbf48" +dependencies = [ + "fastrand", + "futures-core", + "futures-io", + "memchr", + "parking", + "pin-project-lite", + "waker-fn", +] + +[[package]] +name = "futures-macro" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "18e4a4b95cea4b4ccbcf1c5675ca7c4ee4e9e75eb79944d07defde18068f79bb" +dependencies = [ + "autocfg", + "proc-macro-hack", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "futures-sink" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "36ea153c13024fe480590b3e3d4cad89a0cfacecc24577b68f86c6ced9c2bc11" + +[[package]] +name = "futures-task" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d3d00f4eddb73e498a54394f228cd55853bdf059259e8e7bc6e69d408892e99" + +[[package]] +name = "futures-util" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "36568465210a3a6ee45e1f165136d68671471a501e632e9a98d96872222b5481" +dependencies = [ + "autocfg", + "futures-channel", + "futures-core", + "futures-io", + "futures-macro", + "futures-sink", + "futures-task", + "memchr", + "pin-project-lite", + "pin-utils", + "proc-macro-hack", + "proc-macro-nested", + "slab", +] + +[[package]] +name = "gateway" +version = "0.1.0" +dependencies = [ + "common", + "enumflags2", + "futures", + "futures-util", + "log", + "num", + "num-derive", + "num-traits 0.2.14", + "serde 1.0.130", + "serde_json", + "serde_repr", + "tokio", + "tokio-tungstenite", + "url", +] + +[[package]] +name = "generic-array" +version = "0.14.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "501466ecc8a30d1d3b7fc9229b122b2ce8ed6e9d9223f1138d4babb253e51817" +dependencies = [ + "typenum", + "version_check", +] + +[[package]] +name = "getrandom" +version = "0.1.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8fc3cb4d91f53b50155bdcfd23f6a4c39ae1969c2ae85982b135750cccaf5fce" +dependencies = [ + "cfg-if", + "libc", + "wasi 0.9.0+wasi-snapshot-preview1", +] + +[[package]] +name = "getrandom" +version = "0.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7fcd999463524c52659517fe2cea98493cfe485d10565e7b0fb07dbba7ad2753" +dependencies = [ + "cfg-if", + "libc", + "wasi 0.10.0+wasi-snapshot-preview1", +] + +[[package]] +name = "h2" +version = "0.3.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d7f3675cfef6a30c8031cf9e6493ebdc3bb3272a3fea3923c4210d1830e6a472" +dependencies = [ + "bytes", + "fnv", + "futures-core", + "futures-sink", + "futures-util", + "http", + "indexmap", + "slab", + "tokio", + "tokio-util", + "tracing", +] + +[[package]] +name = "hashbrown" +version = "0.11.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ab5ef0d4909ef3724cc8cce6ccc8572c5c817592e9285f5464f8e86f8bd3726e" + +[[package]] +name = "heck" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6d621efb26863f0e9924c6ac577e8275e5e6b77455db64ffa6c65c904e9e132c" +dependencies = [ + "unicode-segmentation", +] + +[[package]] +name = "hermit-abi" +version = "0.1.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62b467343b94ba476dcb2500d242dadbb39557df889310ac77c5d99100aaac33" +dependencies = [ + "libc", +] + +[[package]] +name = "hex" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f24254aa9a54b5c858eaee2f5bccdb46aaf0e486a595ed5fd8f86ba55232a70" + +[[package]] +name = "http" +version = "0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "527e8c9ac747e28542699a951517aa9a6945af506cd1f2e1b53a576c17b6cc11" +dependencies = [ + "bytes", + "fnv", + "itoa", +] + +[[package]] +name = "http-body" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "399c583b2979440c60be0821a6199eca73bc3c8dcd9d070d75ac726e2c6186e5" +dependencies = [ + "bytes", + "http", + "pin-project-lite", +] + +[[package]] +name = "httparse" +version = "1.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "acd94fdbe1d4ff688b67b04eee2e17bd50995534a61539e45adfefb45e5e5503" + +[[package]] +name = "httpdate" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6456b8a6c8f33fee7d958fcd1b60d55b11940a79e63ae87013e6d22e26034440" + +[[package]] +name = "humantime" +version = "1.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "df004cfca50ef23c36850aaaa59ad52cc70d0e90243c3c7737a4dd32dc7a3c4f" +dependencies = [ + "quick-error", +] + +[[package]] +name = "hyper" +version = "0.14.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "13f67199e765030fa08fe0bd581af683f0d5bc04ea09c2b1102012c5fb90e7fd" +dependencies = [ + "bytes", + "futures-channel", + "futures-core", + "futures-util", + "h2", + "http", + "http-body", + "httparse", + "httpdate", + "itoa", + "pin-project-lite", + "socket2", + "tokio", + "tower-service", + "tracing", + "want", +] + +[[package]] +name = "hyper-timeout" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbb958482e8c7be4bc3cf272a766a2b0bf1a6755e7a6ae777f017a31d11b13b1" +dependencies = [ + "hyper", + "pin-project-lite", + "tokio", + "tokio-io-timeout", +] + +[[package]] +name = "idna" +version = "0.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "418a0a6fab821475f634efe3ccc45c013f742efe03d853e8d3355d5cb850ecf8" +dependencies = [ + "matches", + "unicode-bidi", + "unicode-normalization", +] + +[[package]] +name = "indexmap" +version = "1.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc633605454125dec4b66843673f01c7df2b89479b32e0ed634e43a91cff62a5" +dependencies = [ + "autocfg", + "hashbrown", +] + +[[package]] +name = "instant" +version = "0.1.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bee0328b1209d157ef001c94dd85b4f8f64139adb0eac2659f4b08382b2f474d" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "itertools" +version = "0.10.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "69ddb889f9d0d08a67338271fa9b62996bc788c7796a5c18cf057420aaed5eaf" +dependencies = [ + "either", +] + +[[package]] +name = "itoa" +version = "0.4.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b71991ff56294aa922b450139ee08b3bfc70982c6b2c7562771375cf73542dd4" + +[[package]] +name = "js-sys" +version = "0.3.53" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e4bf49d50e2961077d9c99f4b7997d770a1114f087c3c2e0069b36c13fc2979d" +dependencies = [ + "wasm-bindgen", +] + +[[package]] +name = "json" +version = "0.12.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "078e285eafdfb6c4b434e0d31e8cfcb5115b651496faca5749b88fafd4f23bfd" + +[[package]] +name = "lazy_static" +version = "1.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" + +[[package]] +name = "lexical-core" +version = "0.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6607c62aa161d23d17a9072cc5da0be67cdfc89d3afb1e8d9c842bebc2525ffe" +dependencies = [ + "arrayvec", + "bitflags", + "cfg-if", + "ryu", + "static_assertions", +] + +[[package]] +name = "libc" +version = "0.2.101" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3cb00336871be5ed2c8ed44b60ae9959dc5b9f08539422ed43f09e34ecaeba21" + +[[package]] +name = "libsodium-sys" +version = "0.2.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6b779387cd56adfbc02ea4a668e704f729be8d6a6abd2c27ca5ee537849a92fd" +dependencies = [ + "cc", + "libc", + "pkg-config", + "walkdir", +] + +[[package]] +name = "linked-hash-map" +version = "0.5.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7fb9b38af92608140b86b693604b9ffcc5824240a484d1ecd4795bacb2fe88f3" + +[[package]] +name = "lock_api" +version = "0.4.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "712a4d093c9976e24e7dbca41db895dabcbac38eb5f4045393d17a95bdfb1109" +dependencies = [ + "scopeguard", +] + +[[package]] +name = "log" +version = "0.4.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "matches" +version = "0.1.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a3e378b66a060d48947b590737b30a1be76706c8dd7b8ba0f2fe3989c68a853f" + +[[package]] +name = "memchr" +version = "2.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "308cc39be01b73d0d18f82a0e7b2a3df85245f84af96fdddc5d202d27e47b86a" + +[[package]] +name = "mio" +version = "0.7.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8c2bdb6314ec10835cd3293dd268473a835c02b7b352e788be788b3c6ca6bb16" +dependencies = [ + "libc", + "log", + "miow", + "ntapi", + "winapi", +] + +[[package]] +name = "miow" +version = "0.3.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b9f1c5b025cda876f66ef43a113f91ebc9f4ccef34843000e0adf6ebbab84e21" +dependencies = [ + "winapi", +] + +[[package]] +name = "multimap" +version = "0.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e5ce46fe64a9d73be07dcbe690a38ce1b293be448fd8ce1e6c1b8062c9f72c6a" + +[[package]] +name = "nats" +version = "0.15.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2a3097b182107db2cf690280d61f23f17ee31d49f3994ad152ee6a10261f77c3" +dependencies = [ + "base64", + "base64-url", + "blocking", + "chrono", + "crossbeam-channel", + "fastrand", + "itoa", + "json", + "libc", + "log", + "memchr", + "nkeys", + "nuid", + "once_cell", + "parking_lot", + "regex", + "rustls", + "rustls-native-certs", + "serde 1.0.130", + "serde_json", + "webpki", + "winapi", +] + +[[package]] +name = "nkeys" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c1a98f0a974ff737974b57ba1c71d2e0fe7ec18e5a828d4b8e02683171349dfa" +dependencies = [ + "byteorder", + "data-encoding", + "ed25519-dalek", + "log", + "rand 0.7.3", + "signatory", +] + +[[package]] +name = "nom" +version = "5.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffb4262d26ed83a1c0a33a38fe2bb15797329c85770da05e6b828ddb782627af" +dependencies = [ + "lexical-core", + "memchr", + "version_check", +] + +[[package]] +name = "nova" +version = "0.1.0" +dependencies = [ + "libc", +] + +[[package]] +name = "ntapi" +version = "0.3.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f6bb902e437b6d86e03cce10a7e2af662292c5dfef23b65899ea3ac9354ad44" +dependencies = [ + "winapi", +] + +[[package]] +name = "nuid" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7000c9392b545c4ba43e8abc086bf7d01cd2948690934c16980170b0549a2bd3" +dependencies = [ + "lazy_static", + "rand 0.8.4", +] + +[[package]] +name = "num" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "43db66d1170d347f9a065114077f7dccb00c1b9478c89384490a3425279a4606" +dependencies = [ + "num-bigint", + "num-complex", + "num-integer", + "num-iter", + "num-rational", + "num-traits 0.2.14", +] + +[[package]] +name = "num-bigint" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "74e768dff5fb39a41b3bcd30bb25cf989706c90d028d1ad71971987aa309d535" +dependencies = [ + "autocfg", + "num-integer", + "num-traits 0.2.14", +] + +[[package]] +name = "num-complex" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "26873667bbbb7c5182d4a37c1add32cdf09f841af72da53318fdb81543c15085" +dependencies = [ + "num-traits 0.2.14", +] + +[[package]] +name = "num-derive" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "876a53fff98e03a936a674b29568b0e605f06b29372c2489ff4de23f1949743d" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "num-integer" +version = "0.1.44" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d2cc698a63b549a70bc047073d2949cce27cd1c7b0a4a862d08a8031bc2801db" +dependencies = [ + "autocfg", + "num-traits 0.2.14", +] + +[[package]] +name = "num-iter" +version = "0.1.42" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2021c8337a54d21aca0d59a92577a029af9431cb59b909b03252b9c164fad59" +dependencies = [ + "autocfg", + "num-integer", + "num-traits 0.2.14", +] + +[[package]] +name = "num-rational" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d41702bd167c2df5520b384281bc111a4b5efcf7fbc4c9c222c815b07e0a6a6a" +dependencies = [ + "autocfg", + "num-bigint", + "num-integer", + "num-traits 0.2.14", +] + +[[package]] +name = "num-traits" +version = "0.1.43" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "92e5113e9fd4cc14ded8e499429f396a20f98c772a47cc8622a736e1ec843c31" +dependencies = [ + "num-traits 0.2.14", +] + +[[package]] +name = "num-traits" +version = "0.2.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9a64b1ec5cda2586e284722486d802acf1f7dbdc623e2bfc57e65ca1cd099290" +dependencies = [ + "autocfg", +] + +[[package]] +name = "num_cpus" +version = "1.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05499f3756671c15885fee9034446956fff3f243d6077b91e5767df161f766b3" +dependencies = [ + "hermit-abi", + "libc", +] + +[[package]] +name = "once_cell" +version = "1.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "692fcb63b64b1758029e0a96ee63e049ce8c5948587f2f7208df04625e5f6b56" + +[[package]] +name = "opaque-debug" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "624a8340c38c1b80fd549087862da4ba43e08858af025b236e509b6649fc13d5" + +[[package]] +name = "openssl-probe" +version = "0.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "28988d872ab76095a6e6ac88d99b54fd267702734fd7ffe610ca27f533ddb95a" + +[[package]] +name = "parking" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "427c3892f9e783d91cc128285287e70a59e206ca452770ece88a76f7a3eddd72" + +[[package]] +name = "parking_lot" +version = "0.11.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7d17b78036a60663b797adeaee46f5c9dfebb86948d1255007a1d6be0271ff99" +dependencies = [ + "instant", + "lock_api", + "parking_lot_core", +] + +[[package]] +name = "parking_lot_core" +version = "0.8.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d76e8e1493bcac0d2766c42737f34458f1c8c50c0d23bcb24ea953affb273216" +dependencies = [ + "cfg-if", + "instant", + "libc", + "redox_syscall", + "smallvec", + "winapi", +] + +[[package]] +name = "percent-encoding" +version = "2.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d4fd5641d01c8f18a23da7b6fe29298ff4b55afcccdf78973b24cf3175fee32e" + +[[package]] +name = "petgraph" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "467d164a6de56270bd7c4d070df81d07beace25012d5103ced4e9ff08d6afdb7" +dependencies = [ + "fixedbitset", + "indexmap", +] + +[[package]] +name = "pin-project" +version = "1.0.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "576bc800220cc65dac09e99e97b08b358cfab6e17078de8dc5fee223bd2d0c08" +dependencies = [ + "pin-project-internal", +] + +[[package]] +name = "pin-project-internal" +version = "1.0.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e8fe8163d14ce7f0cdac2e040116f22eac817edabff0be91e8aff7e9accf389" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "pin-project-lite" +version = "0.2.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8d31d11c69a6b52a174b42bdc0c30e5e11670f90788b2c471c31c1d17d449443" + +[[package]] +name = "pin-utils" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" + +[[package]] +name = "pkg-config" +version = "0.3.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3831453b3449ceb48b6d9c7ad7c96d5ea673e9b470a1dc578c2ce6521230884c" + +[[package]] +name = "ppv-lite86" +version = "0.2.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ac74c624d6b2d21f425f752262f42188365d7b8ff1aff74c82e45136510a4857" + +[[package]] +name = "pretty_env_logger" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "926d36b9553851b8b0005f1275891b392ee4d2d833852c417ed025477350fb9d" +dependencies = [ + "env_logger", + "log", +] + +[[package]] +name = "proc-macro-hack" +version = "0.5.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dbf0c48bc1d91375ae5c3cd81e3722dff1abcf81a30960240640d223f59fe0e5" + +[[package]] +name = "proc-macro-nested" +version = "0.1.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc881b2c22681370c6a780e47af9840ef841837bc98118431d4e1868bd0c1086" + +[[package]] +name = "proc-macro2" +version = "1.0.29" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b9f5105d4fdaab20335ca9565e106a5d9b82b6219b5ba735731124ac6711d23d" +dependencies = [ + "unicode-xid", +] + +[[package]] +name = "prometheus" +version = "0.12.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5986aa8d62380092d2f50f8b1cdba9cb9b6731ffd4b25b51fd126b6c3e05b99c" +dependencies = [ + "cfg-if", + "fnv", + "lazy_static", + "memchr", + "parking_lot", + "protobuf", + "thiserror", +] + +[[package]] +name = "prost" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "de5e2533f59d08fcf364fd374ebda0692a70bd6d7e66ef97f306f45c6c5d8020" +dependencies = [ + "bytes", + "prost-derive", +] + +[[package]] +name = "prost-build" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "355f634b43cdd80724ee7848f95770e7e70eefa6dcf14fea676216573b8fd603" +dependencies = [ + "bytes", + "heck", + "itertools", + "log", + "multimap", + "petgraph", + "prost", + "prost-types", + "tempfile", + "which", +] + +[[package]] +name = "prost-derive" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "600d2f334aa05acb02a755e217ef1ab6dea4d51b58b7846588b747edec04efba" +dependencies = [ + "anyhow", + "itertools", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "prost-types" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "603bbd6394701d13f3f25aada59c7de9d35a6a5887cfc156181234a44002771b" +dependencies = [ + "bytes", + "prost", +] + +[[package]] +name = "protobuf" +version = "2.25.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "23129d50f2c9355ced935fce8a08bd706ee2e7ce2b3b33bf61dace0e379ac63a" + +[[package]] +name = "quick-error" +version = "1.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a1d01941d82fa2ab50be1e79e6714289dd7cde78eba4c074bc5a4374f650dfe0" + +[[package]] +name = "quote" +version = "1.0.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c3d0b9745dc2debf507c8422de05d7226cc1f0644216dfdfead988f9b1ab32a7" +dependencies = [ + "proc-macro2", +] + +[[package]] +name = "rand" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6a6b1679d49b24bbfe0c803429aa1874472f50d9b363131f0e89fc356b544d03" +dependencies = [ + "getrandom 0.1.16", + "libc", + "rand_chacha 0.2.2", + "rand_core 0.5.1", + "rand_hc 0.2.0", +] + +[[package]] +name = "rand" +version = "0.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2e7573632e6454cf6b99d7aac4ccca54be06da05aca2ef7423d22d27d4d4bcd8" +dependencies = [ + "libc", + "rand_chacha 0.3.1", + "rand_core 0.6.3", + "rand_hc 0.3.1", +] + +[[package]] +name = "rand_chacha" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f4c8ed856279c9737206bf725bf36935d8666ead7aa69b52be55af369d193402" +dependencies = [ + "ppv-lite86", + "rand_core 0.5.1", +] + +[[package]] +name = "rand_chacha" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88" +dependencies = [ + "ppv-lite86", + "rand_core 0.6.3", +] + +[[package]] +name = "rand_core" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "90bde5296fc891b0cef12a6d03ddccc162ce7b2aff54160af9338f8d40df6d19" +dependencies = [ + "getrandom 0.1.16", +] + +[[package]] +name = "rand_core" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d34f1408f55294453790c48b2f1ebbb1c5b4b7563eb1f418bcfcfdbb06ebb4e7" +dependencies = [ + "getrandom 0.2.3", +] + +[[package]] +name = "rand_hc" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca3129af7b92a17112d59ad498c6f81eaf463253766b90396d39ea7a39d6613c" +dependencies = [ + "rand_core 0.5.1", +] + +[[package]] +name = "rand_hc" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d51e9f596de227fda2ea6c84607f5558e196eeaf43c986b724ba4fb8fdf497e7" +dependencies = [ + "rand_core 0.6.3", +] + +[[package]] +name = "redis" +version = "0.21.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "202c5bf92cad3d57605c366e644a7fbf305a83f19754fc66678c6265dcc9b8b4" +dependencies = [ + "async-trait", + "combine", + "dtoa", + "itoa", + "percent-encoding", + "sha1", + "url", +] + +[[package]] +name = "redox_syscall" +version = "0.2.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8383f39639269cde97d255a32bdb68c047337295414940c68bdd30c2e13203ff" +dependencies = [ + "bitflags", +] + +[[package]] +name = "regex" +version = "1.5.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d07a8629359eb56f1e2fb1652bb04212c072a87ba68546a04065d525673ac461" +dependencies = [ + "aho-corasick", + "memchr", + "regex-syntax", +] + +[[package]] +name = "regex-syntax" +version = "0.6.25" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f497285884f3fcff424ffc933e56d7cbca511def0c9831a7f9b5f6153e3cc89b" + +[[package]] +name = "remove_dir_all" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3acd125665422973a33ac9d3dd2df85edad0f4ae9b00dafb1a05e43a9f5ef8e7" +dependencies = [ + "winapi", +] + +[[package]] +name = "rest-ratelimiter" +version = "0.1.0" +dependencies = [ + "prost", + "tokio", + "tonic", + "tonic-build", +] + +[[package]] +name = "ring" +version = "0.16.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3053cf52e236a3ed746dfc745aa9cacf1b791d846bdaf412f60a8d7d6e17c8fc" +dependencies = [ + "cc", + "libc", + "once_cell", + "spin", + "untrusted", + "web-sys", + "winapi", +] + +[[package]] +name = "rust-ini" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3e52c148ef37f8c375d49d5a73aa70713125b7f19095948a923f80afdeb22ec2" + +[[package]] +name = "rustls" +version = "0.19.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "35edb675feee39aec9c99fa5ff985081995a06d594114ae14cbe797ad7b7a6d7" +dependencies = [ + "base64", + "log", + "ring", + "sct", + "webpki", +] + +[[package]] +name = "rustls-native-certs" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5a07b7c1885bd8ed3831c289b7870b13ef46fe0e856d288c30d9cc17d75a2092" +dependencies = [ + "openssl-probe", + "rustls", + "schannel", + "security-framework", +] + +[[package]] +name = "ryu" +version = "1.0.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "71d301d4193d031abdd79ff7e3dd721168a9572ef3fe51a1517aba235bd8f86e" + +[[package]] +name = "same-file" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "93fc1dc3aaa9bfed95e02e6eadabb4baf7e3078b0bd1b4d7b6b0b68378900502" +dependencies = [ + "winapi-util", +] + +[[package]] +name = "schannel" +version = "0.1.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8f05ba609c234e60bee0d547fe94a4c7e9da733d1c962cf6e59efa4cd9c8bc75" +dependencies = [ + "lazy_static", + "winapi", +] + +[[package]] +name = "scopeguard" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d29ab0c6d3fc0ee92fe66e2d99f700eab17a8d57d1c1d3b748380fb20baa78cd" + +[[package]] +name = "sct" +version = "0.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b362b83898e0e69f38515b82ee15aa80636befe47c3b6d3d89a911e78fc228ce" +dependencies = [ + "ring", + "untrusted", +] + +[[package]] +name = "security-framework" +version = "2.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "525bc1abfda2e1998d152c45cf13e696f76d0a4972310b22fac1658b05df7c87" +dependencies = [ + "bitflags", + "core-foundation", + "core-foundation-sys", + "libc", + "security-framework-sys", +] + +[[package]] +name = "security-framework-sys" +version = "2.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a9dd14d83160b528b7bfd66439110573efcfbe281b17fc2ca9f39f550d619c7e" +dependencies = [ + "core-foundation-sys", + "libc", +] + +[[package]] +name = "serde" +version = "0.8.23" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9dad3f759919b92c3068c696c15c3d17238234498bbdcc80f2c469606f948ac8" + +[[package]] +name = "serde" +version = "1.0.130" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f12d06de37cf59146fbdecab66aa99f9fe4f78722e3607577a5375d66bd0c913" +dependencies = [ + "serde_derive", +] + +[[package]] +name = "serde-hjson" +version = "0.9.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6a3a4e0ea8a88553209f6cc6cfe8724ecad22e1acf372793c27d995290fe74f8" +dependencies = [ + "lazy_static", + "num-traits 0.1.43", + "regex", + "serde 0.8.23", +] + +[[package]] +name = "serde_derive" +version = "1.0.130" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d7bc1a1ab1961464eae040d96713baa5a724a8152c1222492465b54322ec508b" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "serde_json" +version = "1.0.67" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a7f9e390c27c3c0ce8bc5d725f6e4d30a29d26659494aa4b17535f7522c5c950" +dependencies = [ + "itoa", + "ryu", + "serde 1.0.130", +] + +[[package]] +name = "serde_repr" +version = "0.1.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "98d0516900518c29efa217c298fa1f4e6c6ffc85ae29fd7f4ee48f176e1a9ed5" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "sha-1" +version = "0.9.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "99cd6713db3cf16b6c84e06321e049a9b9f699826e16096d23bbcc44d15d51a6" +dependencies = [ + "block-buffer", + "cfg-if", + "cpufeatures", + "digest", + "opaque-debug", +] + +[[package]] +name = "sha1" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2579985fda508104f7587689507983eadd6a6e84dd35d6d115361f530916fa0d" + +[[package]] +name = "sha2" +version = "0.9.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9204c41a1597a8c5af23c82d1c921cb01ec0a4c59e07a9c7306062829a3903f3" +dependencies = [ + "block-buffer", + "cfg-if", + "cpufeatures", + "digest", + "opaque-debug", +] + +[[package]] +name = "signal-hook-registry" +version = "1.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e51e73328dc4ac0c7ccbda3a494dfa03df1de2f46018127f60c693f2648455b0" +dependencies = [ + "libc", +] + +[[package]] +name = "signatory" +version = "0.21.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9eaebd4be561a7d8148803baa108092f85090189c4b8c3ffb81602b15b5c1771" +dependencies = [ + "getrandom 0.1.16", + "signature", + "subtle-encoding", + "zeroize", +] + +[[package]] +name = "signature" +version = "1.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c19772be3c4dd2ceaacf03cb41d5885f2a02c4d8804884918e3a258480803335" + +[[package]] +name = "slab" +version = "0.4.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c307a32c1c5c437f38c7fd45d753050587732ba8628319fbdf12a7e289ccc590" + +[[package]] +name = "smallvec" +version = "1.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fe0f37c9e8f3c5a4a66ad655a93c74daac4ad00c441533bf5c6e7990bb42604e" + +[[package]] +name = "socket2" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "765f090f0e423d2b55843402a07915add955e7d60657db13707a159727326cad" +dependencies = [ + "libc", + "winapi", +] + +[[package]] +name = "spin" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e63cff320ae2c57904679ba7cb63280a3dc4613885beafb148ee7bf9aa9042d" + +[[package]] +name = "static_assertions" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2eb9349b6444b326872e140eb1cf5e7c522154d69e7a0ffb0fb81c06b37543f" + +[[package]] +name = "subtle" +version = "2.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6bdef32e8150c2a081110b42772ffe7d7c9032b606bc226c8260fd97e0976601" + +[[package]] +name = "subtle-encoding" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7dcb1ed7b8330c5eed5441052651dd7a12c75e2ed88f2ec024ae1fa3a5e59945" +dependencies = [ + "zeroize", +] + +[[package]] +name = "syn" +version = "1.0.76" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c6f107db402c2c2055242dbf4d2af0e69197202e9faacbef9571bbe47f5a1b84" +dependencies = [ + "proc-macro2", + "quote", + "unicode-xid", +] + +[[package]] +name = "synstructure" +version = "0.12.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "474aaa926faa1603c40b7885a9eaea29b444d1cb2850cb7c0e37bb1a4182f4fa" +dependencies = [ + "proc-macro2", + "quote", + "syn", + "unicode-xid", +] + +[[package]] +name = "tempfile" +version = "3.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dac1c663cfc93810f88aed9b8941d48cabf856a1b111c29a40439018d870eb22" +dependencies = [ + "cfg-if", + "libc", + "rand 0.8.4", + "redox_syscall", + "remove_dir_all", + "winapi", +] + +[[package]] +name = "termcolor" +version = "1.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2dfed899f0eb03f32ee8c6a0aabdb8a7949659e3466561fc0adf54e26d88c5f4" +dependencies = [ + "winapi-util", +] + +[[package]] +name = "thiserror" +version = "1.0.29" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "602eca064b2d83369e2b2f34b09c70b605402801927c65c11071ac911d299b88" +dependencies = [ + "thiserror-impl", +] + +[[package]] +name = "thiserror-impl" +version = "1.0.29" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bad553cc2c78e8de258400763a647e80e6d1b31ee237275d756f6836d204494c" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "time" +version = "0.1.44" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6db9e6914ab8b1ae1c260a4ae7a49b6c5611b40328a735b21862567685e73255" +dependencies = [ + "libc", + "wasi 0.10.0+wasi-snapshot-preview1", + "winapi", +] + +[[package]] +name = "tinyvec" +version = "1.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "848a1e1181b9f6753b5e96a092749e29b11d19ede67dfbbd6c7dc7e0f49b5338" +dependencies = [ + "tinyvec_macros", +] + +[[package]] +name = "tinyvec_macros" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cda74da7e1a664f795bb1f8a87ec406fb89a02522cf6e50620d016add6dbbf5c" + +[[package]] +name = "tokio" +version = "1.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b4efe6fc2395938c8155973d7be49fe8d03a843726e285e100a8a383cc0154ce" +dependencies = [ + "autocfg", + "bytes", + "libc", + "memchr", + "mio", + "num_cpus", + "once_cell", + "parking_lot", + "pin-project-lite", + "signal-hook-registry", + "tokio-macros", + "winapi", +] + +[[package]] +name = "tokio-io-timeout" +version = "1.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "90c49f106be240de154571dd31fbe48acb10ba6c6dd6f6517ad603abffa42de9" +dependencies = [ + "pin-project-lite", + "tokio", +] + +[[package]] +name = "tokio-macros" +version = "1.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "54473be61f4ebe4efd09cec9bd5d16fa51d70ea0192213d754d2d500457db110" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "tokio-rustls" +version = "0.22.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc6844de72e57df1980054b38be3a9f4702aba4858be64dd700181a8a6d0e1b6" +dependencies = [ + "rustls", + "tokio", + "webpki", +] + +[[package]] +name = "tokio-stream" +version = "0.1.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7b2f3f698253f03119ac0102beaa64f67a67e08074d03a22d18784104543727f" +dependencies = [ + "futures-core", + "pin-project-lite", + "tokio", +] + +[[package]] +name = "tokio-tungstenite" +version = "0.15.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "511de3f85caf1c98983545490c3d09685fa8eb634e57eec22bb4db271f46cbd8" +dependencies = [ + "futures-util", + "log", + "pin-project", + "rustls", + "tokio", + "tokio-rustls", + "tungstenite", + "webpki", + "webpki-roots", +] + +[[package]] +name = "tokio-util" +version = "0.6.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "08d3725d3efa29485e87311c5b699de63cde14b00ed4d256b8318aa30ca452cd" +dependencies = [ + "bytes", + "futures-core", + "futures-sink", + "log", + "pin-project-lite", + "tokio", +] + +[[package]] +name = "toml" +version = "0.5.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a31142970826733df8241ef35dc040ef98c679ab14d7c3e54d827099b3acecaa" +dependencies = [ + "serde 1.0.130", +] + +[[package]] +name = "tonic" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "796c5e1cd49905e65dd8e700d4cb1dffcbfdb4fc9d017de08c1a537afd83627c" +dependencies = [ + "async-stream", + "async-trait", + "base64", + "bytes", + "futures-core", + "futures-util", + "h2", + "http", + "http-body", + "hyper", + "hyper-timeout", + "percent-encoding", + "pin-project", + "prost", + "prost-derive", + "tokio", + "tokio-stream", + "tokio-util", + "tower", + "tower-layer", + "tower-service", + "tracing", + "tracing-futures", +] + +[[package]] +name = "tonic-build" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "12b52d07035516c2b74337d2ac7746075e7dcae7643816c1b12c5ff8a7484c08" +dependencies = [ + "proc-macro2", + "prost-build", + "quote", + "syn", +] + +[[package]] +name = "tower" +version = "0.4.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f60422bc7fefa2f3ec70359b8ff1caff59d785877eb70595904605bcc412470f" +dependencies = [ + "futures-core", + "futures-util", + "indexmap", + "pin-project", + "rand 0.8.4", + "slab", + "tokio", + "tokio-stream", + "tokio-util", + "tower-layer", + "tower-service", + "tracing", +] + +[[package]] +name = "tower-layer" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "343bc9466d3fe6b0f960ef45960509f84480bf4fd96f92901afe7ff3df9d3a62" + +[[package]] +name = "tower-service" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "360dfd1d6d30e05fda32ace2c8c70e9c0a9da713275777f5a4dbb8a1893930c6" + +[[package]] +name = "tracing" +version = "0.1.26" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09adeb8c97449311ccd28a427f96fb563e7fd31aabf994189879d9da2394b89d" +dependencies = [ + "cfg-if", + "log", + "pin-project-lite", + "tracing-attributes", + "tracing-core", +] + +[[package]] +name = "tracing-attributes" +version = "0.1.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c42e6fa53307c8a17e4ccd4dc81cf5ec38db9209f59b222210375b54ee40d1e2" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "tracing-core" +version = "0.1.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2ca517f43f0fb96e0c3072ed5c275fe5eece87e8cb52f4a77b69226d3b1c9df8" +dependencies = [ + "lazy_static", +] + +[[package]] +name = "tracing-futures" +version = "0.2.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "97d095ae15e245a057c8e8451bab9b3ee1e1f68e9ba2b4fbc18d0ac5237835f2" +dependencies = [ + "pin-project", + "tracing", +] + +[[package]] +name = "try-lock" +version = "0.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "59547bce71d9c38b83d9c0e92b6066c4253371f15005def0c30d9657f50c7642" + +[[package]] +name = "tungstenite" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a0b2d8558abd2e276b0a8df5c05a2ec762609344191e5fd23e292c910e9165b5" +dependencies = [ + "base64", + "byteorder", + "bytes", + "http", + "httparse", + "log", + "rand 0.8.4", + "rustls", + "rustls-native-certs", + "sha-1", + "thiserror", + "url", + "utf-8", + "webpki", +] + +[[package]] +name = "typenum" +version = "1.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b63708a265f51345575b27fe43f9500ad611579e764c79edbc2037b1121959ec" + +[[package]] +name = "unicode-bidi" +version = "0.3.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "246f4c42e67e7a4e3c6106ff716a5d067d4132a642840b242e357e468a2a0085" + +[[package]] +name = "unicode-normalization" +version = "0.1.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d54590932941a9e9266f0832deed84ebe1bf2e4c9e4a3554d393d18f5e854bf9" +dependencies = [ + "tinyvec", +] + +[[package]] +name = "unicode-segmentation" +version = "1.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8895849a949e7845e06bd6dc1aa51731a103c42707010a5b591c0038fb73385b" + +[[package]] +name = "unicode-xid" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ccb82d61f80a663efe1f787a51b16b5a51e3314d6ac365b08639f52387b33f3" + +[[package]] +name = "untrusted" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a156c684c91ea7d62626509bce3cb4e1d9ed5c4d978f7b4352658f96a4c26b4a" + +[[package]] +name = "url" +version = "2.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a507c383b2d33b5fc35d1861e77e6b383d158b2da5e14fe51b83dfedf6fd578c" +dependencies = [ + "form_urlencoded", + "idna", + "matches", + "percent-encoding", +] + +[[package]] +name = "utf-8" +version = "0.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09cc8ee72d2a9becf2f2febe0205bbed8fc6615b7cb429ad062dc7b7ddd036a9" + +[[package]] +name = "version_check" +version = "0.9.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5fecdca9a5291cc2b8dcf7dc02453fee791a280f3743cb0905f8822ae463b3fe" + +[[package]] +name = "waker-fn" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9d5b2c62b4012a3e1eca5a7e077d13b3bf498c4073e33ccd58626607748ceeca" + +[[package]] +name = "walkdir" +version = "2.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "808cf2735cd4b6866113f648b791c6adc5714537bc222d9347bb203386ffda56" +dependencies = [ + "same-file", + "winapi", + "winapi-util", +] + +[[package]] +name = "want" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0" +dependencies = [ + "log", + "try-lock", +] + +[[package]] +name = "wasi" +version = "0.9.0+wasi-snapshot-preview1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cccddf32554fecc6acb585f82a32a72e28b48f8c4c1883ddfeeeaa96f7d8e519" + +[[package]] +name = "wasi" +version = "0.10.0+wasi-snapshot-preview1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1a143597ca7c7793eff794def352d41792a93c481eb1042423ff7ff72ba2c31f" + +[[package]] +name = "wasm-bindgen" +version = "0.2.76" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ce9b1b516211d33767048e5d47fa2a381ed8b76fc48d2ce4aa39877f9f183e0" +dependencies = [ + "cfg-if", + "wasm-bindgen-macro", +] + +[[package]] +name = "wasm-bindgen-backend" +version = "0.2.76" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cfe8dc78e2326ba5f845f4b5bf548401604fa20b1dd1d365fb73b6c1d6364041" +dependencies = [ + "bumpalo", + "lazy_static", + "log", + "proc-macro2", + "quote", + "syn", + "wasm-bindgen-shared", +] + +[[package]] +name = "wasm-bindgen-macro" +version = "0.2.76" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "44468aa53335841d9d6b6c023eaab07c0cd4bddbcfdee3e2bb1e8d2cb8069fef" +dependencies = [ + "quote", + "wasm-bindgen-macro-support", +] + +[[package]] +name = "wasm-bindgen-macro-support" +version = "0.2.76" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0195807922713af1e67dc66132c7328206ed9766af3858164fb583eedc25fbad" +dependencies = [ + "proc-macro2", + "quote", + "syn", + "wasm-bindgen-backend", + "wasm-bindgen-shared", +] + +[[package]] +name = "wasm-bindgen-shared" +version = "0.2.76" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "acdb075a845574a1fa5f09fd77e43f7747599301ea3417a9fbffdeedfc1f4a29" + +[[package]] +name = "web-sys" +version = "0.3.53" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "224b2f6b67919060055ef1a67807367c2066ed520c3862cc013d26cf893a783c" +dependencies = [ + "js-sys", + "wasm-bindgen", +] + +[[package]] +name = "webhook" +version = "0.1.0" +dependencies = [ + "common", + "config", + "hex", + "hyper", + "libsodium-sys", + "log", + "nats", + "serde 1.0.130", + "serde_json", + "tokio", +] + +[[package]] +name = "webpki" +version = "0.21.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b8e38c0608262c46d4a56202ebabdeb094cef7e560ca7a226c6bf055188aa4ea" +dependencies = [ + "ring", + "untrusted", +] + +[[package]] +name = "webpki-roots" +version = "0.21.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aabe153544e473b775453675851ecc86863d2a81d786d741f6b76778f2a48940" +dependencies = [ + "webpki", +] + +[[package]] +name = "which" +version = "4.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ea187a8ef279bc014ec368c27a920da2024d2a711109bfbe3440585d5cf27ad9" +dependencies = [ + "either", + "lazy_static", + "libc", +] + +[[package]] +name = "winapi" +version = "0.3.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419" +dependencies = [ + "winapi-i686-pc-windows-gnu", + "winapi-x86_64-pc-windows-gnu", +] + +[[package]] +name = "winapi-i686-pc-windows-gnu" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" + +[[package]] +name = "winapi-util" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "70ec6ce85bb158151cae5e5c87f95a8e97d2c0c4b001223f33a334e3ce5de178" +dependencies = [ + "winapi", +] + +[[package]] +name = "winapi-x86_64-pc-windows-gnu" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" + +[[package]] +name = "yaml-rust" +version = "0.4.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56c1936c4cc7a1c9ab21a1ebb602eb942ba868cbd44a99cb7cdc5892335e1c85" +dependencies = [ + "linked-hash-map", +] + +[[package]] +name = "zeroize" +version = "1.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "377db0846015f7ae377174787dd452e1c5f5a9050bc6f954911d01f116daa0cd" +dependencies = [ + "zeroize_derive", +] + +[[package]] +name = "zeroize_derive" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2c1e130bebaeab2f23886bf9acbaca14b092408c452543c857f66399cd6dab1" +dependencies = [ + "proc-macro2", + "quote", + "syn", + "synstructure", +] diff --git a/Cargo.toml b/Cargo.toml new file mode 100644 index 0000000..8bee6e4 --- /dev/null +++ b/Cargo.toml @@ -0,0 +1,53 @@ +[workspace]
+
+members = [
+ "webhook",
+ "ratelimiter",
+ "gateway",
+ "cache",
+ "common/rust"
+]
+
+[package]
+name = "nova"
+version = "0.1.0"
+edition = "2018"
+
+[[bin]]
+name = "nova"
+path = "src/main.rs"
+
+[dependencies]
+libc = "0.2.101"
+
+[package.metadata.raze]
+workspace_path = "//cargo"
+genmode = "Remote"
+default_gen_buildrs = true
+package_aliases_dir = "cargo"
+experimental_api = true
+
+[package.metadata.raze.crates.cpufeatures.'*']
+skipped_deps = ["libc-0.2.101"]
+additional_deps = ["@raze__libc__0_2_101//:libc"]
+
+[package.metadata.raze.crates.ring.'*']
+compile_data_attr = "glob([\"*/**\"])"
+skipped_deps = ["once_cell-1.8.0"]
+additional_deps = ["@raze__once_cell__1_8_0//:once_cell"]
+
+[package.metadata.raze.crates.flate2.'*']
+compile_data_attr = "glob([\"*/**\"])"
+skipped_deps = ["miniz_oxide-0.4.4"]
+additional_deps = ["@raze__miniz_oxide__0_4_4//:miniz_oxide"]
+
+
+[package.metadata.raze.crates.webpki.'*']
+compile_data_attr = "glob([\"*/**\"])"
+
+[package.metadata.raze.crates.libsodium-sys.'*']
+buildrs_additional_environment_variables = { PATH = "/usr/sbin:/usr/bin:/sbin:/bin", "NUM_JOBS" = "2" }
+compile_data_attr = "glob([\"*/**\"])"
+additional_build_file = "bazel/patch/BUILD_script_patch"
+gen_buildrs = false
+additional_deps = [":libsodium_sys_build_script"]
\ No newline at end of file diff --git a/ENVIRONMENT.md b/ENVIRONMENT.md deleted file mode 100644 index 16392db..0000000 --- a/ENVIRONMENT.md +++ /dev/null @@ -1,25 +0,0 @@ -# Developement environment - -Nova use Bazel as build manager. Bazel allows us to combine various languages (Rust, Go, ...) in a single pipeline while taking advantage of incremental compilation and remote compilation. - -However, some steps are to be follow to update programs dependencies. Nova use Gazelle to generate `BUILD` files of Go projects and Cargo-Raze to generate `BUILD` files of Rust projects. - -When you edit project dependencies, you must execute a command tu update these files. - -# Go - -To update dependencies of Go Project, execute : - -``` -bazel run //:gazelle -``` - -# Rust - -To update or create Rust project, use this comande in the folder of your project : - -``` -bazel run @cargo_raze//:raze -- --manifest-path=$(realpath Cargo.toml) -``` - -If this is a new project, make sure you have configured Cargo-Raze in your `Cargo.toml` and added it to sources in `WORKSPACE`. diff --git a/Makefile b/Makefile deleted file mode 100644 index 8495d91..0000000 --- a/Makefile +++ /dev/null @@ -1,9 +0,0 @@ - -# Updates the deps.bzl file using the go.mod -.PHONY: update-deps -gazelle-update-deps: - bazel run //:gazelle -- update-repos -from_file=go.mod -to_macro=deps.bzl%go_dependencies - -.PHONY: gazzle-sync -gazelle-sync: - bazel run //:gazelle @@ -1,32 +1,32 @@ -# Nova - -Nova is an open source Discord framework for creating high-performance app. - -Nova is built upon [Go](https://github.com/golang/go) and [Rust](https://github.com/rust-lang/rust) and uses [Bazel](https://github.com/bazelbuild/bazel) as a build system to maintain an effective, safe and production-ready solution. - -With Nova you can be sure to build reliable and efficient Discord bots. - -### Disclaimer - -Nova requires a good infrastructure to operate and may consume lot of resources. It's not made for small Discord Bots but for those who are present on many servers and want to ensure excellent performance. - ---- - -## Features - -- **Scalability** -- **High-Performance** -- **Reliability** -- **Production-ready** - -## Quick Start - -> SOON - -## Contributing - -If you wish to contribute to Nova, go to [CONTRIBUTING](). - -## License - -Nova is distributed under the Apache 2.0 license, see [LICENSE](LICENSE) for more information. +# Nova
+
+Nova is an open source Discord framework for creating high-performance app.
+
+Nova is built upon [Go](https://github.com/golang/go) and [Rust](https://github.com/rust-lang/rust) and uses [Bazel](https://github.com/bazelbuild/bazel) as a build system to maintain an effective, safe and production-ready solution.
+
+With Nova you can be sure to build reliable and efficient Discord bots.
+
+### Disclaimer
+
+Nova requires a good infrastructure to operate and may consume lot of resources. It's not made for small Discord Bots but for those who are present on many servers and want to ensure excellent performance.
+
+---
+
+## Features
+
+- **Scalability**
+- **High-Performance**
+- **Reliability**
+- **Production-ready**
+
+## Quick Start
+
+> SOON
+
+## Contributing
+
+If you wish to contribute to Nova, go to [CONTRIBUTING]().
+
+## License
+
+Nova is distributed under the Apache 2.0 license, see [LICENSE](LICENSE) for more information.
@@ -1,97 +1,79 @@ +workspace(name = "nova") + +#@unused load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive") -# Used to compile go files + http_archive( - name = "io_bazel_rules_go", - sha256 = "8e968b5fcea1d2d64071872b12737bbb5514524ee5f0a4f54f5920266c261acb", + name = "com_google_protobuf", + sha256 = "d0f5f605d0d656007ce6c8b5a82df3037e1d8fe8b121ed42e536f569dec16113", + strip_prefix = "protobuf-3.14.0", urls = [ - "https://mirror.bazel.build/github.com/bazelbuild/rules_go/releases/download/v0.28.0/rules_go-v0.28.0.zip", - "https://github.com/bazelbuild/rules_go/releases/download/v0.28.0/rules_go-v0.28.0.zip", + "https://mirror.bazel.build/github.com/protocolbuffers/protobuf/archive/v3.14.0.tar.gz", + "https://github.com/protocolbuffers/protobuf/archive/v3.14.0.tar.gz", ], ) -# Used to generate the go dependencies & build files http_archive( - name = "bazel_gazelle", - sha256 = "62ca106be173579c0a167deb23358fdfe71ffa1e4cfdddf5582af26520f1c66f", + name = "rules_pkg", + sha256 = "a89e203d3cf264e564fcb96b6e06dd70bc0557356eb48400ce4b5d97c2c3720d", urls = [ - "https://mirror.bazel.build/github.com/bazelbuild/bazel-gazelle/releases/download/v0.23.0/bazel-gazelle-v0.23.0.tar.gz", - "https://github.com/bazelbuild/bazel-gazelle/releases/download/v0.23.0/bazel-gazelle-v0.23.0.tar.gz", + "https://mirror.bazel.build/github.com/bazelbuild/rules_pkg/releases/download/0.5.1/rules_pkg-0.5.1.tar.gz", + "https://github.com/bazelbuild/rules_pkg/releases/download/0.5.1/rules_pkg-0.5.1.tar.gz", ], ) -# Used to compile Rust code http_archive( name = "rules_rust", - sha256 = "accb5a89cbe63d55dcdae85938e56ff3aa56f21eb847ed826a28a83db8500ae6", - strip_prefix = "rules_rust-9aa49569b2b0dacecc51c05cee52708b7255bd98", + sha256 = "531bdd470728b61ce41cf7604dc4f9a115983e455d46ac1d0c1632f613ab9fc3", + strip_prefix = "rules_rust-d8238877c0e552639d3e057aadd6bfcf37592408", urls = [ - # Main branch as of 2021-02-19 - "https://github.com/bazelbuild/rules_rust/archive/9aa49569b2b0dacecc51c05cee52708b7255bd98.tar.gz", + # `main` branch as of 2021-08-23 + "https://github.com/bazelbuild/rules_rust/archive/d8238877c0e552639d3e057aadd6bfcf37592408.tar.gz", ], ) -# Used to generate rust BUILD files http_archive( - name = "cargo_raze", - sha256 = "c664e258ea79e7e4ec2f2b57bca8b1c37f11c8d5748e02b8224810da969eb681", - strip_prefix = "cargo-raze-0.11.0", - url = "https://github.com/google/cargo-raze/archive/v0.11.0.tar.gz", + name = "io_bazel_rules_go", + sha256 = "8e968b5fcea1d2d64071872b12737bbb5514524ee5f0a4f54f5920266c261acb", + urls = [ + "https://mirror.bazel.build/github.com/bazelbuild/rules_go/releases/download/v0.28.0/rules_go-v0.28.0.zip", + "https://github.com/bazelbuild/rules_go/releases/download/v0.28.0/rules_go-v0.28.0.zip", + ], ) -# Used to generate the protobuf files for go http_archive( - name = "com_google_protobuf", - sha256 = "d0f5f605d0d656007ce6c8b5a82df3037e1d8fe8b121ed42e536f569dec16113", - strip_prefix = "protobuf-3.14.0", + name = "bazel_gazelle", + sha256 = "62ca106be173579c0a167deb23358fdfe71ffa1e4cfdddf5582af26520f1c66f", urls = [ - "https://mirror.bazel.build/github.com/protocolbuffers/protobuf/archive/v3.14.0.tar.gz", - "https://github.com/protocolbuffers/protobuf/archive/v3.14.0.tar.gz", + "https://mirror.bazel.build/github.com/bazelbuild/bazel-gazelle/releases/download/v0.23.0/bazel-gazelle-v0.23.0.tar.gz", + "https://github.com/bazelbuild/bazel-gazelle/releases/download/v0.23.0/bazel-gazelle-v0.23.0.tar.gz", ], ) -# golang configuration -load("@com_google_protobuf//:protobuf_deps.bzl", "protobuf_deps") - -protobuf_deps() - -load("@io_bazel_rules_go//go:deps.bzl", "go_register_toolchains", "go_rules_dependencies") - -go_register_toolchains(version = "1.16.5") - -go_rules_dependencies() - -load("@bazel_gazelle//:deps.bzl", "gazelle_dependencies", "go_repository") -load("//:deps.bzl", "go_dependencies") - -# gazelle:repository_macro deps.bzl%go_dependencies -go_dependencies() - -gazelle_dependencies() - -# needed to build the proto packages -go_repository( - name = "org_golang_google_grpc", - build_file_proto_mode = "disable", - importpath = "google.golang.org/grpc", - sum = "h1:2dTRdpdFEEhJYQD8EMLB61nnrzSCTbG38PhqdhvOltg=", - version = "v1.26.0", +http_archive( + name = "io_bazel_rules_docker", + sha256 = "1f4e59843b61981a96835dc4ac377ad4da9f8c334ebe5e0bb3f58f80c09735f4", + strip_prefix = "rules_docker-0.19.0", + urls = [ + "https://github.com/bazelbuild/rules_docker/releases/download/v0.19.0/rules_docker-v0.19.0.tar.gz", + ], ) -# rust environment -load("@cargo_raze//:repositories.bzl", "cargo_raze_repositories") +load("//bazel:utils.bzl", "get_toolchain_utils_protocolbuffers", "get_toolchain_utils_rules_pkg") + +get_toolchain_utils_protocolbuffers() -cargo_raze_repositories() +get_toolchain_utils_rules_pkg() -load("@cargo_raze//:transitive_deps.bzl", "cargo_raze_transitive_deps") +load("//bazel:rust.bzl", "load_rust_toolchains") -cargo_raze_transitive_deps() +load_rust_toolchains() -load("@rules_rust//rust:repositories.bzl", "rust_repositories") +load("//bazel:go.bzl", "load_golang_toolchains") -rust_repositories() +load_golang_toolchains() -# load for the ratelimiter project crates -load("//ratelimiter/cargo:crates.bzl", "raze_fetch_remote_crates") +load("//bazel:docker.bzl", "load_docker") -raze_fetch_remote_crates() +load_docker() diff --git a/bazel/BUILD b/bazel/BUILD new file mode 100644 index 0000000..dac72c2 --- /dev/null +++ b/bazel/BUILD @@ -0,0 +1,2 @@ +load("//bazel:docker.bzl", "images") +images()
\ No newline at end of file diff --git a/deps.bzl b/bazel/deps.bzl index 31b5618..cc5dbd0 100644 --- a/deps.bzl +++ b/bazel/deps.bzl @@ -13,7 +13,6 @@ def go_dependencies(): sum = "h1:fxAGrHZTgQ9w5QqVItgzwj235/uYZYgbXitB+dLupOk=", version = "v1.0.3", ) - go_repository( name = "com_github_afex_hystrix_go", importpath = "github.com/afex/hystrix-go", @@ -38,7 +37,6 @@ def go_dependencies(): sum = "h1:kFOfPq6dUM1hTo4JG6LR5AXSUEsOjtdm0kw0FtQtMJA=", version = "v0.0.0-20161002113705-648efa622239", ) - go_repository( name = "com_github_apache_thrift", importpath = "github.com/apache/thrift", @@ -69,7 +67,6 @@ def go_dependencies(): sum = "h1:0CwZNZbxp69SHPdPJAN/hZIm0C4OItdklCFmMRWYpio=", version = "v0.0.0-20160902184237-e75332964ef5", ) - go_repository( name = "com_github_aryann_difflib", importpath = "github.com/aryann/difflib", @@ -107,12 +104,6 @@ def go_dependencies(): version = "v0.1.0", ) go_repository( - name = "com_github_boz_go_throttle", - importpath = "github.com/boz/go-throttle", - sum = "h1:1fx+RA5lk1ZkzPAUP7DEgZnVHYxEcHO77vQO/V8z/2Q=", - version = "v0.0.0-20160922054636-fdc4eab740c1", - ) - go_repository( name = "com_github_burntsushi_toml", importpath = "github.com/BurntSushi/toml", sum = "h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=", @@ -250,7 +241,6 @@ def go_dependencies(): sum = "h1:QAUIPSaCu4G+POclxeqb3F+WPpdKqFGlw36+yOzGlrg=", version = "v1.12.0", ) - go_repository( name = "com_github_envoyproxy_go_control_plane", importpath = "github.com/envoyproxy/go-control-plane", @@ -275,7 +265,6 @@ def go_dependencies(): sum = "h1:BHsljHzVlRcyQhjrss6TZTdY2VfCqZPbv5k3iBFa2ZQ=", version = "v0.0.0-20150515145356-3f9db97f8568", ) - go_repository( name = "com_github_franela_goblin", importpath = "github.com/franela/goblin", @@ -330,7 +319,6 @@ def go_dependencies(): sum = "h1:BXyZu9t0VkbiHtqrsvdq39UDhGJTl1h55VW6CSC4aY4=", version = "v5.4.2", ) - go_repository( name = "com_github_go_kit_kit", importpath = "github.com/go-kit/kit", @@ -428,13 +416,6 @@ def go_dependencies(): version = "v0.1.0", ) go_repository( - name = "com_github_google_shlex", - importpath = "github.com/google/shlex", - sum = "h1:El6M4kTTCOh6aBiKaUGG7oYTSPP8MxqL4YI3kZKwcP4=", - version = "v0.0.0-20191202100458-e7afc7fbc510", - ) - - go_repository( name = "com_github_google_uuid", importpath = "github.com/google/uuid", sum = "h1:b4Gk+7WdP/d3HZH8EJsZpvV7EtDOgaZLtnaNGIu1adA=", @@ -461,8 +442,8 @@ def go_dependencies(): go_repository( name = "com_github_gorilla_websocket", importpath = "github.com/gorilla/websocket", - sum = "h1:+/TMaTYc4QFitKJxsQ7Yye35DkWvkdLcvGKqM+x0Ufc=", - version = "v1.4.2", + sum = "h1:Lh2aW+HnU2Nbe1gqD9SOJLJxW1jBMmQOktN2acDyJk8=", + version = "v0.0.0-20170926233335-4201258b820c", ) go_repository( name = "com_github_grpc_ecosystem_go_grpc_middleware", @@ -608,7 +589,6 @@ def go_dependencies(): sum = "h1:b6R2BslTbIEToALKP7LxUvijTsNI9TAe80pLWN2g/HU=", version = "v0.3.12", ) - go_repository( name = "com_github_inconshreveable_mousetrap", importpath = "github.com/inconshreveable/mousetrap", @@ -633,7 +613,6 @@ def go_dependencies(): sum = "h1:1jKYvbxEjfUl0fmqTCOfonvskHHXMjBySTLW4y9LFvc=", version = "v1.5.0", ) - go_repository( name = "com_github_jmespath_go_jmespath", importpath = "github.com/jmespath/go-jmespath", @@ -676,7 +655,6 @@ def go_dependencies(): sum = "h1:DowS9hvgyYSX4TO5NpyC606/Z4SxnNYbT+WX27or6Ck=", version = "v0.0.0-20201106050909-4977a11b4351", ) - go_repository( name = "com_github_kisielk_errcheck", importpath = "github.com/kisielk/errcheck", @@ -726,13 +704,6 @@ def go_dependencies(): version = "v0.2.0", ) go_repository( - name = "com_github_libgit2_git2go_v31", - importpath = "github.com/libgit2/git2go/v31", - sum = "h1:6GOd3965D9e/+gjxCwZF4eQ+vB9kKB4yKFqdQr6XZ2E=", - version = "v31.4.14", - ) - - go_repository( name = "com_github_lightstep_lightstep_tracer_common_golang_gogo", importpath = "github.com/lightstep/lightstep-tracer-common/golang/gogo", sum = "h1:143Bb8f8DuGWck/xpNUOckBVYfFbBTnLevfRZ1aVVqo=", @@ -756,7 +727,6 @@ def go_dependencies(): sum = "h1:92UTHpy8CDwaJ08GqLDzhhuixiBUUD1p3AU6PHddz4A=", version = "v1.2.0", ) - go_repository( name = "com_github_mattn_go_colorable", importpath = "github.com/mattn/go-colorable", @@ -787,7 +757,6 @@ def go_dependencies(): sum = "h1:FtSW/jqD+l4ba5iPBj9CODVtgfYAD8w2wS923g/cFDk=", version = "v0.4.16", ) - go_repository( name = "com_github_miekg_dns", importpath = "github.com/miekg/dns", @@ -884,7 +853,6 @@ def go_dependencies(): sum = "h1:fD57ERR4JtEqsWbfPhv4DMiApHyliiK5xCTNVSPiaAs=", version = "v0.0.0-20200227124842-a10e7caefd8e", ) - go_repository( name = "com_github_oklog_oklog", importpath = "github.com/oklog/oklog", @@ -1035,7 +1003,6 @@ def go_dependencies(): sum = "h1:YoJbenK9C67SkzkDfmQuVln04ygHj3vjZfd9FL+GmQQ=", version = "v0.0.0-20210428141323-04723f9f07d7", ) - go_repository( name = "com_github_rcrowley_go_metrics", importpath = "github.com/rcrowley/go-metrics", @@ -1096,7 +1063,6 @@ def go_dependencies(): sum = "h1:we8PVUC3FE2uYfodKH/nBHMSetSfHDR6scGdBi+erh0=", version = "v1.1.0", ) - go_repository( name = "com_github_shopify_sarama", importpath = "github.com/Shopify/sarama", @@ -1160,8 +1126,8 @@ def go_dependencies(): go_repository( name = "com_github_streadway_amqp", importpath = "github.com/streadway/amqp", - sum = "h1:kuuDrUJFZL1QYL9hUNuCxNObNzB0bV/ZG5jV3RWAQgo=", - version = "v1.0.0", + sum = "h1:WhxRHzgeVGETMlmVfqhRn8RIeeNoPr2Czh33I4Zdccw=", + version = "v0.0.0-20190827072141-edfb9018d271", ) go_repository( name = "com_github_streadway_handy", @@ -1193,7 +1159,6 @@ def go_dependencies(): sum = "h1:8n59tqmLmt8jyRsY44RPy2ixPDDw0FcVoAhlYeyz3Jw=", version = "v1.0.0", ) - go_repository( name = "com_github_urfave_cli", importpath = "github.com/urfave/cli", @@ -1212,7 +1177,6 @@ def go_dependencies(): sum = "h1:wUMzuKtKilRgBAD1sUb8gOwwRr2FGoBVumcjoOACClI=", version = "v0.3.0", ) - go_repository( name = "com_github_xiang90_probing", importpath = "github.com/xiang90/probing", @@ -1303,7 +1267,6 @@ def go_dependencies(): sum = "h1:dUUwHk2QECo/6vqA44rthZ8ie2QXMNeKRTHCNY2nXvo=", version = "v3.0.0-20200313102051-9f266ea9e77c", ) - go_repository( name = "io_etcd_go_bbolt", importpath = "go.etcd.io/bbolt", @@ -1347,10 +1310,16 @@ def go_dependencies(): version = "v0.0.0-20190819201941-24fa4b261c55", ) go_repository( + name = "org_golang_google_grpc", + importpath = "google.golang.org/grpc", + sum = "h1:2dTRdpdFEEhJYQD8EMLB61nnrzSCTbG38PhqdhvOltg=", + version = "v1.26.0", + ) + go_repository( name = "org_golang_google_protobuf", importpath = "google.golang.org/protobuf", - sum = "h1:bxAC2xTBsZGibn2RTntX0oH50xLsqy1OxA9tTL3p/lk=", - version = "v1.26.0", + sum = "h1:SnqbnDw1V7RiZcXPx5MEeqPv2s79L9i7BJUlG/+RurQ=", + version = "v1.27.1", ) go_repository( name = "org_golang_x_crypto", @@ -1406,7 +1375,6 @@ def go_dependencies(): sum = "h1:v+OssWQX+hTHEmOBgwxdZxK4zHq3yOs8F9J7mk0PY8E=", version = "v0.0.0-20201126162022-7de9c90e9dd1", ) - go_repository( name = "org_golang_x_text", importpath = "golang.org/x/text", diff --git a/bazel/docker.bzl b/bazel/docker.bzl new file mode 100644 index 0000000..7ec1674 --- /dev/null +++ b/bazel/docker.bzl @@ -0,0 +1,59 @@ +""" +""" +load("@io_bazel_rules_docker//toolchains/docker:toolchain.bzl", "toolchain_configure") +load("@io_bazel_rules_docker//repositories:repositories.bzl", "repositories") +load("@io_bazel_rules_docker//repositories:deps.bzl", "deps") +load("@io_bazel_rules_docker//container:container.bzl", "container_pull", "container_image") +load("@io_bazel_rules_docker//docker/package_managers:download_pkgs.bzl", "download_pkgs") +load("@io_bazel_rules_docker//docker/package_managers:install_pkgs.bzl", "install_pkgs") + +load( + "@io_bazel_rules_docker//go:image.bzl", + _go_image_repos = "repositories", +) +load( + "@io_bazel_rules_docker//rust:image.bzl", + _rust_image_repos = "repositories", +) + +def images(): + download_pkgs( + name = "download_base_pkgs", + image_tar = "@debian//image", + packages = ["libgcc-10-dev", "libc6"] + ) + install_pkgs( + name = "base_pkgs", + image_tar = "@debian//image", + installables_tar = ":download_base_pkgs.tar", + output_image_name = "distroless_base_with_libgcc" + ) + container_image( + name = "base", + base = ":base_pkgs.tar", + visibility = ["//visibility:public"], + ) + +def load_docker(): + """ + Loads all the docker credentials and pull the needed images + """ + toolchain_configure( + name = "docker_config" + ) + repositories() + deps() + _go_image_repos() + _rust_image_repos() + container_pull( + name = "distroless_debian10", + registry = "gcr.io", + repository = "distroless/base-debian10", + tag = "latest", + ) + container_pull( + name = "debian", + registry = "docker.io", + repository = "library/debian", + tag = "stable", + )
\ No newline at end of file diff --git a/bazel/go.bzl b/bazel/go.bzl new file mode 100644 index 0000000..62c9843 --- /dev/null +++ b/bazel/go.bzl @@ -0,0 +1,27 @@ +""" +Utilities used by the workspace to load the golang toolchain +""" +load("//bazel:deps.bzl", "go_dependencies") +load("@io_bazel_rules_go//go:deps.bzl", "go_register_toolchains", "go_rules_dependencies") +load("@bazel_gazelle//:deps.bzl", "gazelle_dependencies", "go_repository") + +def load_golang_toolchains(): + """ + Loads the golang toolchain + """ + + go_register_toolchains(version = "1.16.5") + go_rules_dependencies() + + # Used to generate the go dependencies & build files + go_dependencies() + gazelle_dependencies() + + # Fixes a bug with the protobuf generation + go_repository( + name = "org_golang_google_grpc", + build_file_proto_mode = "disable", + importpath = "google.golang.org/grpc", + sum = "h1:2dTRdpdFEEhJYQD8EMLB61nnrzSCTbG38PhqdhvOltg=", + version = "v1.26.0", + ) diff --git a/bazel/images.bzl b/bazel/images.bzl new file mode 100644 index 0000000..041c378 --- /dev/null +++ b/bazel/images.bzl @@ -0,0 +1,5 @@ +""" +""" + +def images(): +
\ No newline at end of file diff --git a/bazel/patch/BUILD b/bazel/patch/BUILD new file mode 100644 index 0000000..8bef599 --- /dev/null +++ b/bazel/patch/BUILD @@ -0,0 +1 @@ +exports_files(["libsodium_sys_build_script_script_.rs"])
\ No newline at end of file diff --git a/bazel/patch/BUILD_script_patch b/bazel/patch/BUILD_script_patch new file mode 100644 index 0000000..5578907 --- /dev/null +++ b/bazel/patch/BUILD_script_patch @@ -0,0 +1,69 @@ +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "libsodium_sys_build_script", + srcs = ["@nova//bazel/patch:libsodium_sys_build_script_script_.rs"], + build_script_env = { + "NUM_JOBS": "2", + "PATH": "/usr/sbin:/usr/bin:/sbin:/bin", + }, + data = glob(["**"]), + edition = "2015", + links = "sodium", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.7", + visibility = ["//visibility:private"], + deps = [ + "@raze__pkg_config__0_3_19//:pkg_config", + "@raze__walkdir__2_3_2//:walkdir", + ] + selects.with_or({ + # cfg(not(target_env = "msvc")) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__cc__1_0_70//:cc", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_env = "msvc") + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }), +) diff --git a/bazel/patch/libsodium_sys_build_script_script_.rs b/bazel/patch/libsodium_sys_build_script_script_.rs new file mode 100644 index 0000000..1b0b775 --- /dev/null +++ b/bazel/patch/libsodium_sys_build_script_script_.rs @@ -0,0 +1,407 @@ +#[cfg(not(windows))] +extern crate cc; + +#[cfg(target_env = "msvc")] +extern crate libc; + +extern crate pkg_config; +extern crate walkdir; + +use std::{ + env, + path::{Path, PathBuf}, +}; + +static VERSION: &str = "1.0.18"; + +fn main() { + println!("cargo:rerun-if-env-changed=SODIUM_LIB_DIR"); + println!("cargo:rerun-if-env-changed=SODIUM_SHARED"); + println!("cargo:rerun-if-env-changed=SODIUM_USE_PKG_CONFIG"); + + if cfg!(not(windows)) { + println!("cargo:rerun-if-env-changed=SODIUM_DISABLE_PIE"); + } + + if env::var("SODIUM_STATIC").is_ok() { + panic!("SODIUM_STATIC is deprecated. Use SODIUM_SHARED instead."); + } + + let lib_dir_isset = env::var("SODIUM_LIB_DIR").is_ok(); + let use_pkg_isset = if cfg!(feature = "use-pkg-config") { + true + } else { + env::var("SODIUM_USE_PKG_CONFIG").is_ok() + }; + let shared_isset = env::var("SODIUM_SHARED").is_ok(); + + if lib_dir_isset && use_pkg_isset { + panic!("SODIUM_LIB_DIR is incompatible with SODIUM_USE_PKG_CONFIG. Set the only one env variable"); + } + + if lib_dir_isset { + find_libsodium_env(); + } else if use_pkg_isset { + if shared_isset { + println!("cargo:warning=SODIUM_SHARED has no effect with SODIUM_USE_PKG_CONFIG"); + } + + find_libsodium_pkg(); + } else { + if shared_isset { + println!( + "cargo:warning=SODIUM_SHARED has no effect for building libsodium from source" + ); + } + + build_libsodium(); + } +} + +/* Must be called when SODIUM_LIB_DIR is set to any value +This function will set `cargo` flags. +*/ +fn find_libsodium_env() { + let lib_dir = env::var("SODIUM_LIB_DIR").unwrap(); // cannot fail + + println!("cargo:rustc-link-search=native={}", lib_dir); + let mode = if env::var("SODIUM_SHARED").is_ok() { + "dylib" + } else { + "static" + }; + let name = if cfg!(target_env = "msvc") { + "libsodium" + } else { + "sodium" + }; + println!("cargo:rustc-link-lib={}={}", mode, name); + println!( + "cargo:warning=Using unknown libsodium version. This crate is tested against \ + {} and may not be fully compatible with other versions.", + VERSION + ); +} + +/* Must be called when no SODIUM_USE_PKG_CONFIG env var is set +This function will set `cargo` flags. +*/ +#[cfg(target_env = "msvc")] +fn find_libsodium_pkg() { + panic!("SODIUM_USE_PKG_CONFIG is not supported on msvc"); +} + +/* Must be called when SODIUM_USE_PKG_CONFIG env var is set +This function will set `cargo` flags. +*/ +#[cfg(not(target_env = "msvc"))] +fn find_libsodium_pkg() { + match pkg_config::Config::new().probe("libsodium") { + Ok(lib) => { + if lib.version != VERSION { + println!( + "cargo:warning=Using libsodium version {}. This crate is tested against {} \ + and may not be fully compatible with {}.", + lib.version, VERSION, lib.version + ); + } + for lib_dir in &lib.link_paths { + println!("cargo:lib={}", lib_dir.to_str().unwrap()); + } + for include_dir in &lib.include_paths { + println!("cargo:include={}", include_dir.to_str().unwrap()); + } + } + Err(e) => { + panic!( + " +Failed to run pkg-config: +{:?} + +You can try fixing this by installing pkg-config: + + # On Ubuntu + sudo apt install pkg-config + # On Arch Linux + sudo pacman -S pkgconf + # On Fedora + sudo dnf install pkgconf-pkg-config + +", + e + ); + } + } +} + +#[cfg(windows)] +fn make_libsodium(_: &str, _: &Path, _: &Path) -> PathBuf { + // We don't build anything on windows, we simply linked to precompiled + // libs. + get_lib_dir() +} + +#[cfg(not(windows))] +fn make_libsodium(target: &str, source_dir: &Path, install_dir: &Path) -> PathBuf { + use std::{fs, process::Command, str}; + + // Decide on CC, CFLAGS and the --host configure argument + let build_compiler = cc::Build::new().get_compiler(); + let mut compiler = build_compiler.path().to_str().unwrap().to_string(); + let mut cflags = build_compiler.cflags_env().into_string().unwrap(); + let mut host_arg = format!("--host={}", target); + let mut cross_compiling = target != env::var("HOST").unwrap(); + if target.contains("-ios") { + // Determine Xcode directory path + let xcode_select_output = Command::new("xcode-select").arg("-p").output().unwrap(); + if !xcode_select_output.status.success() { + panic!("Failed to run xcode-select -p"); + } + let xcode_dir = str::from_utf8(&xcode_select_output.stdout) + .unwrap() + .trim() + .to_string(); + + // Determine SDK directory paths + let sdk_dir_simulator = Path::new(&xcode_dir) + .join("Platforms/iPhoneSimulator.platform/Developer/SDKs/iPhoneSimulator.sdk") + .to_str() + .unwrap() + .to_string(); + let sdk_dir_ios = Path::new(&xcode_dir) + .join("Platforms/iPhoneOS.platform/Developer/SDKs/iPhoneOS.sdk") + .to_str() + .unwrap() + .to_string(); + + // Min versions + let ios_simulator_version_min = "6.0.0"; + let ios_version_min = "6.0.0"; + + // Roughly based on `dist-build/ios.sh` in the libsodium sources + match &*target { + "aarch64-apple-ios" => { + cflags += " -arch arm64"; + cflags += &format!(" -isysroot {}", sdk_dir_ios); + cflags += &format!(" -mios-version-min={}", ios_version_min); + cflags += " -fembed-bitcode"; + host_arg = "--host=arm-apple-darwin10".to_string(); + } + "armv7-apple-ios" => { + cflags += " -arch armv7"; + cflags += &format!(" -isysroot {}", sdk_dir_ios); + cflags += &format!(" -mios-version-min={}", ios_version_min); + cflags += " -mthumb"; + host_arg = "--host=arm-apple-darwin10".to_string(); + } + "armv7s-apple-ios" => { + cflags += " -arch armv7s"; + cflags += &format!(" -isysroot {}", sdk_dir_ios); + cflags += &format!(" -mios-version-min={}", ios_version_min); + cflags += " -mthumb"; + host_arg = "--host=arm-apple-darwin10".to_string(); + } + "i386-apple-ios" => { + cflags += " -arch i386"; + cflags += &format!(" -isysroot {}", sdk_dir_simulator); + cflags += &format!(" -mios-simulator-version-min={}", ios_simulator_version_min); + host_arg = "--host=i686-apple-darwin10".to_string(); + } + "x86_64-apple-ios" => { + cflags += " -arch x86_64"; + cflags += &format!(" -isysroot {}", sdk_dir_simulator); + cflags += &format!(" -mios-simulator-version-min={}", ios_simulator_version_min); + host_arg = "--host=x86_64-apple-darwin10".to_string(); + } + _ => panic!("Unknown iOS build target: {}", target), + } + cross_compiling = true; + } else if target.contains("i686") { + compiler += " -m32 -maes"; + cflags += " -march=i686"; + } + + let help = if cross_compiling { + "***********************************************************\n\ + Possible missing dependencies.\n\ + See https://github.com/sodiumoxide/sodiumoxide#cross-compiling\n\ + ***********************************************************\n\n" + } else { + "" + }; + + // Run `./configure` + let prefix_arg = format!("--prefix={}", install_dir.to_str().unwrap()); + let libdir_arg = format!("--libdir={}/lib", install_dir.to_str().unwrap()); + let mut configure_cmd = Command::new(fs::canonicalize(source_dir.join("configure")).expect("Failed to find configure script! Did you clone the submodule at `libsodium-sys/libsodium`?")); + if !compiler.is_empty() { + configure_cmd.env("CC", &compiler); + } + if !cflags.is_empty() { + configure_cmd.env("CFLAGS", &cflags); + } + if env::var("SODIUM_DISABLE_PIE").is_ok() { + configure_cmd.arg("--disable-pie"); + } + let configure_status = configure_cmd + .current_dir(&source_dir) + .arg(&prefix_arg) + .arg(&libdir_arg) + .arg(&host_arg) + .arg("--enable-shared=no") + .status() + .unwrap_or_else(|error| { + panic!("Failed to run './configure': {}\n{}", error, help); + }); + if !configure_status.success() { + panic!( + "\nFailed to configure libsodium using {:?}\nCFLAGS={}\nCC={}\n{}\n", + configure_cmd, cflags, compiler, help + ); + } + + // Run `make check`, or `make all` if we're cross-compiling + let j_arg = format!("-j{}", env::var("NUM_JOBS").unwrap()); + let make_arg = if cross_compiling { "all" } else { "check" }; + let mut make_cmd = Command::new("make"); + let make_status = make_cmd + .current_dir(&source_dir) + .env("V", "1") + .arg(make_arg) + .arg(&j_arg) + .status() + .unwrap_or_else(|error| { + panic!("Failed to run 'make {}': {}\n{}", make_arg, error, help); + }); + if !make_status.success() { + panic!("\nFailed to build libsodium using {:?}\n{}", make_cmd, help); + } + + // Run `make install` + let mut install_cmd = Command::new("make"); + let install_status = install_cmd + .current_dir(&source_dir) + .arg("install") + .status() + .unwrap_or_else(|error| { + panic!("Failed to run 'make install': {}", error); + }); + if !install_status.success() { + panic!("\nFailed to install libsodium using {:?}", install_cmd); + } + + install_dir.join("lib") +} + +#[cfg(any(windows, target_env = "msvc"))] +fn get_crate_dir() -> PathBuf { + env::var("CARGO_MANIFEST_DIR").unwrap().into() +} + +#[cfg(target_env = "msvc")] +fn is_release_profile() -> bool { + env::var("PROFILE").unwrap() == "release" +} + +#[cfg(all(target_env = "msvc", target_pointer_width = "32"))] +fn get_lib_dir() -> PathBuf { + if is_release_profile() { + get_crate_dir().join("msvc/Win32/Release/v142/") + } else { + get_crate_dir().join("msvc/Win32/Debug/v142/") + } +} + +#[cfg(all(target_env = "msvc", target_pointer_width = "64"))] +fn get_lib_dir() -> PathBuf { + if is_release_profile() { + get_crate_dir().join("msvc/x64/Release/v142/") + } else { + get_crate_dir().join("msvc/x64/Debug/v142/") + } +} + +#[cfg(all(windows, not(target_env = "msvc"), target_pointer_width = "32"))] +fn get_lib_dir() -> PathBuf { + get_crate_dir().join("mingw/win32/") +} + +#[cfg(all(windows, not(target_env = "msvc"), target_pointer_width = "64"))] +fn get_lib_dir() -> PathBuf { + get_crate_dir().join("mingw/win64/") +} + +fn build_libsodium() { + use std::{ffi::OsStr, fs}; + + // Determine build target triple + let mut out_dir = PathBuf::from(env::var("OUT_DIR").unwrap()); + let target = env::var("TARGET").unwrap(); + let profile = env::var("PROFILE").unwrap(); + + // Avoid issues with paths containing spaces by falling back to using a tempfile. + // See https://github.com/jedisct1/libsodium/issues/207 + if out_dir.to_str().unwrap().contains(' ') { + out_dir = env::temp_dir() + .join("libsodium-sys") + .join(&target) + .join(&profile); + println!( + "cargo:warning=The path to the usual build directory contains spaces and hence \ + can't be used to build libsodium. Falling back to use {}. If running `cargo \ + clean`, ensure you also delete this fallback directory", + out_dir.display() + ); + } + + // Determine source and install dir + let install_dir = out_dir.join("installed"); + let source_dir = out_dir.join("source").join("libsodium"); + + // Create directories + fs::create_dir_all(&install_dir).unwrap(); + fs::create_dir_all(&source_dir).unwrap(); + + let paths = std::fs::read_dir("./libsodium").unwrap(); + + for path in paths { + println!("Name: {}", path.unwrap().path().display()) + } + + if !target.contains("msvc") { + // Copy sources into build directory + // Skip .git because it's marked read-only and that causes problems re-building + for entry in walkdir::WalkDir::new("libsodium") + .into_iter() + .filter_entry(|e| e.file_name() != OsStr::new(".git")) + .filter_map(Result::ok) + { + let outpath = out_dir.join("source").join(entry.path()); + if let Err(e) = if entry.file_type().is_dir() { + fs::create_dir_all(outpath) + } else { + fs::copy(entry.path(), outpath).map(|_| ()) + } { + panic!("Failed to copy sources into build directory: {}", e); + } + } + } + + let lib_dir = make_libsodium(&target, &source_dir, &install_dir); + + if target.contains("msvc") { + println!("cargo:rustc-link-lib=static=libsodium"); + } else { + println!("cargo:rustc-link-lib=static=sodium"); + } + + println!( + "cargo:rustc-link-search=native={}", + lib_dir.to_str().unwrap() + ); + + let include_dir = source_dir.join("src/libsodium/include"); + + println!("cargo:include={}", include_dir.to_str().unwrap()); + println!("cargo:lib={}", lib_dir.to_str().unwrap()); +} diff --git a/bazel/rust.bzl b/bazel/rust.bzl new file mode 100644 index 0000000..c8e21d5 --- /dev/null +++ b/bazel/rust.bzl @@ -0,0 +1,17 @@ +""" +Utilities used by the workspace to load the rust toolchain +""" +load("//cargo:crates.bzl", "raze_fetch_remote_crates") +load("@rules_rust//rust:repositories.bzl", "rust_repositories") + +def load_rust_toolchains(): + """ + A simple macro that loads the rust toolchain + """ + rust_repositories( + edition = "2018", + iso_date = "2021-09-09", + version = "nightly", + ) + + raze_fetch_remote_crates() diff --git a/bazel/utils.bzl b/bazel/utils.bzl new file mode 100644 index 0000000..c0143fd --- /dev/null +++ b/bazel/utils.bzl @@ -0,0 +1,17 @@ +""" +Loads the utilities for all the projects +""" +load("@com_google_protobuf//:protobuf_deps.bzl", "protobuf_deps") +load("@rules_pkg//:deps.bzl", "rules_pkg_dependencies") + +def get_toolchain_utils_protocolbuffers(): + """ + Loads protocolbuffers + """ + protobuf_deps() + +def get_toolchain_utils_rules_pkg(): + """ + Load the utilities for packaging the build results + """ + rules_pkg_dependencies() diff --git a/cache/BUILD b/cache/BUILD new file mode 100644 index 0000000..3b11f74 --- /dev/null +++ b/cache/BUILD @@ -0,0 +1,24 @@ +load("@rules_rust//rust:rust.bzl", "rust_binary", "rust_test") +load("//cargo:crates.bzl", "all_crate_deps") +load("@io_bazel_rules_docker//rust:image.bzl", "rust_image") + +test_suite(name = "tests") + +rust_binary( + name = "cache", + srcs = glob(["src/**"]), + deps = all_crate_deps() + ["//common/rust:common"], + visibility = ["//visibility:public"], +) + +rust_test( + name = "cache_test", + crate = ":webhook" +) + +rust_image( + name = "image", + binary = ":cache", + visibility = ["//visibility:public"], + base = "//bazel:base", +) diff --git a/cache/Cargo.toml b/cache/Cargo.toml new file mode 100644 index 0000000..8de5801 --- /dev/null +++ b/cache/Cargo.toml @@ -0,0 +1,14 @@ +[package] +name = "cache" +version = "0.1.0" +edition = "2018" + +# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html + +[dependencies] +common = { path = "../common/rust" } +nats = "0.15.2" +serde = { version = "1.0.8", features = ["derive"] } +log = { version = "0.4", features = ["std"] } +serde_json = { version = "1.0" } +redis = "*"
\ No newline at end of file diff --git a/cache/cargo/BUILD.bazel b/cache/cargo/BUILD.bazel new file mode 100644 index 0000000..1543954 --- /dev/null +++ b/cache/cargo/BUILD.bazel @@ -0,0 +1,58 @@ +""" +@generated +cargo-raze generated Bazel file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +package(default_visibility = ["//visibility:public"]) + +licenses([ + "notice", # See individual crates for specific licenses +]) + +# Aliased targets +alias( + name = "log", + actual = "@raze__log__0_4_14//:log", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "nats", + actual = "@raze__nats__0_15_2//:nats", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "redis", + actual = "@raze__redis__0_21_2//:redis", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde", + actual = "@raze__serde__1_0_130//:serde", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde_json", + actual = "@raze__serde_json__1_0_67//:serde_json", + tags = [ + "cargo-raze", + "manual", + ], +) diff --git a/cache/src/config.rs b/cache/src/config.rs new file mode 100644 index 0000000..37b1e73 --- /dev/null +++ b/cache/src/config.rs @@ -0,0 +1,4 @@ +use serde::Deserialize; + +#[derive(Debug, Deserialize, Clone, Default)] +pub struct CacheConfiguration {}
\ No newline at end of file diff --git a/cache/src/main.rs b/cache/src/main.rs new file mode 100644 index 0000000..9da8394 --- /dev/null +++ b/cache/src/main.rs @@ -0,0 +1,12 @@ +use common::config::Settings; +use log::info; + +use crate::config::CacheConfiguration; + +mod config; + + +fn main() { + let settings: Settings<CacheConfiguration> = Settings::new("cache").unwrap(); + info!("loaded configuration: {:?}", settings); +} diff --git a/cargo/BUILD.bazel b/cargo/BUILD.bazel new file mode 100644 index 0000000..27b7961 --- /dev/null +++ b/cargo/BUILD.bazel @@ -0,0 +1,30 @@ +""" +@generated +cargo-raze generated Bazel file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +package(default_visibility = ["//visibility:public"]) + +licenses([ + "notice", # See individual crates for specific licenses +]) + +# Aliased targets +alias( + name = "libc", + actual = "@raze__libc__0_2_101//:libc", + tags = [ + "cargo-raze", + "manual", + ], +) + +# Export file for Stardoc support +exports_files( + [ + "crates.bzl", + ], + visibility = ["//visibility:public"], +) diff --git a/cargo/crates.bzl b/cargo/crates.bzl new file mode 100644 index 0000000..6bfcdb6 --- /dev/null +++ b/cargo/crates.bzl @@ -0,0 +1,2569 @@ +""" +@generated +cargo-raze generated Bazel file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +load("@bazel_tools//tools/build_defs/repo:git.bzl", "new_git_repository") # buildifier: disable=load +load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive") # buildifier: disable=load +load("@bazel_tools//tools/build_defs/repo:utils.bzl", "maybe") # buildifier: disable=load + +# EXPERIMENTAL -- MAY CHANGE AT ANY TIME: A mapping of package names to a set of normal dependencies for the Rust targets of that package. +_DEPENDENCIES = { + "webhook": { + "config": "@raze__config__0_11_0//:config", + "hex": "@raze__hex__0_4_3//:hex", + "hyper": "@raze__hyper__0_14_12//:hyper", + "libsodium-sys": "@raze__libsodium_sys__0_2_7//:libsodium_sys", + "log": "@raze__log__0_4_14//:log", + "nats": "@raze__nats__0_15_2//:nats", + "serde": "@raze__serde__1_0_130//:serde", + "serde_json": "@raze__serde_json__1_0_67//:serde_json", + "tokio": "@raze__tokio__1_11_0//:tokio", + }, + "common/rust": { + "config": "@raze__config__0_11_0//:config", + "hyper": "@raze__hyper__0_14_12//:hyper", + "log": "@raze__log__0_4_14//:log", + "nats": "@raze__nats__0_15_2//:nats", + "pretty_env_logger": "@raze__pretty_env_logger__0_4_0//:pretty_env_logger", + "prometheus": "@raze__prometheus__0_12_0//:prometheus", + "serde": "@raze__serde__1_0_130//:serde", + "tokio": "@raze__tokio__1_11_0//:tokio", + }, + "ratelimiter": { + "prost": "@raze__prost__0_8_0//:prost", + "tokio": "@raze__tokio__1_11_0//:tokio", + "tonic": "@raze__tonic__0_5_2//:tonic", + }, + "gateway": { + "enumflags2": "@raze__enumflags2__0_7_1//:enumflags2", + "futures": "@raze__futures__0_3_17//:futures", + "futures-util": "@raze__futures_util__0_3_17//:futures_util", + "log": "@raze__log__0_4_14//:log", + "num": "@raze__num__0_4_0//:num", + "num-traits": "@raze__num_traits__0_2_14//:num_traits", + "serde": "@raze__serde__1_0_130//:serde", + "serde_json": "@raze__serde_json__1_0_67//:serde_json", + "tokio": "@raze__tokio__1_11_0//:tokio", + "tokio-tungstenite": "@raze__tokio_tungstenite__0_15_0//:tokio_tungstenite", + "url": "@raze__url__2_2_2//:url", + }, + "cache": { + "log": "@raze__log__0_4_14//:log", + "nats": "@raze__nats__0_15_2//:nats", + "redis": "@raze__redis__0_21_2//:redis", + "serde": "@raze__serde__1_0_130//:serde", + "serde_json": "@raze__serde_json__1_0_67//:serde_json", + }, + "": { + "libc": "@raze__libc__0_2_101//:libc", + }, +} + +# EXPERIMENTAL -- MAY CHANGE AT ANY TIME: A mapping of package names to a set of proc_macro dependencies for the Rust targets of that package. +_PROC_MACRO_DEPENDENCIES = { + "webhook": { + }, + "common/rust": { + }, + "ratelimiter": { + }, + "gateway": { + "num-derive": "@raze__num_derive__0_3_3//:num_derive", + "serde_repr": "@raze__serde_repr__0_1_7//:serde_repr", + }, + "cache": { + }, + "": { + }, +} + +# EXPERIMENTAL -- MAY CHANGE AT ANY TIME: A mapping of package names to a set of normal dev dependencies for the Rust targets of that package. +_DEV_DEPENDENCIES = { + "webhook": { + }, + "common/rust": { + }, + "ratelimiter": { + "tonic-build": "@raze__tonic_build__0_5_2//:tonic_build", + }, + "gateway": { + }, + "cache": { + }, + "": { + }, +} + +# EXPERIMENTAL -- MAY CHANGE AT ANY TIME: A mapping of package names to a set of proc_macro dev dependencies for the Rust targets of that package. +_DEV_PROC_MACRO_DEPENDENCIES = { + "webhook": { + }, + "common/rust": { + }, + "ratelimiter": { + }, + "gateway": { + }, + "cache": { + }, + "": { + }, +} + +def crate_deps(deps, package_name = None): + """EXPERIMENTAL -- MAY CHANGE AT ANY TIME: Finds the fully qualified label of the requested crates for the package where this macro is called. + + WARNING: This macro is part of an expeirmental API and is subject to change. + + Args: + deps (list): The desired list of crate targets. + package_name (str, optional): The package name of the set of dependencies to look up. + Defaults to `native.package_name()`. + Returns: + list: A list of labels to cargo-raze generated targets (str) + """ + + if not package_name: + package_name = native.package_name() + + # Join both sets of dependencies + dependencies = _flatten_dependency_maps([ + _DEPENDENCIES, + _PROC_MACRO_DEPENDENCIES, + _DEV_DEPENDENCIES, + _DEV_PROC_MACRO_DEPENDENCIES, + ]) + + if not deps: + return [] + + missing_crates = [] + crate_targets = [] + for crate_target in deps: + if crate_target not in dependencies[package_name]: + missing_crates.append(crate_target) + else: + crate_targets.append(dependencies[package_name][crate_target]) + + if missing_crates: + fail("Could not find crates `{}` among dependencies of `{}`. Available dependencies were `{}`".format( + missing_crates, + package_name, + dependencies[package_name], + )) + + return crate_targets + +def all_crate_deps(normal = False, normal_dev = False, proc_macro = False, proc_macro_dev = False, package_name = None): + """EXPERIMENTAL -- MAY CHANGE AT ANY TIME: Finds the fully qualified label of all requested direct crate dependencies \ + for the package where this macro is called. + + If no parameters are set, all normal dependencies are returned. Setting any one flag will + otherwise impact the contents of the returned list. + + Args: + normal (bool, optional): If True, normal dependencies are included in the + output list. Defaults to False. + normal_dev (bool, optional): If True, normla dev dependencies will be + included in the output list. Defaults to False. + proc_macro (bool, optional): If True, proc_macro dependencies are included + in the output list. Defaults to False. + proc_macro_dev (bool, optional): If True, dev proc_macro dependencies are + included in the output list. Defaults to False. + package_name (str, optional): The package name of the set of dependencies to look up. + Defaults to `native.package_name()`. + + Returns: + list: A list of labels to cargo-raze generated targets (str) + """ + + if not package_name: + package_name = native.package_name() + + # Determine the relevant maps to use + all_dependency_maps = [] + if normal: + all_dependency_maps.append(_DEPENDENCIES) + if normal_dev: + all_dependency_maps.append(_DEV_DEPENDENCIES) + if proc_macro: + all_dependency_maps.append(_PROC_MACRO_DEPENDENCIES) + if proc_macro_dev: + all_dependency_maps.append(_DEV_PROC_MACRO_DEPENDENCIES) + + # Default to always using normal dependencies + if not all_dependency_maps: + all_dependency_maps.append(_DEPENDENCIES) + + dependencies = _flatten_dependency_maps(all_dependency_maps) + + if not dependencies: + return [] + + return dependencies[package_name].values() + +def _flatten_dependency_maps(all_dependency_maps): + """Flatten a list of dependency maps into one dictionary. + + Dependency maps have the following structure: + + ```python + DEPENDENCIES_MAP = { + # The first key in the map is a Bazel package + # name of the workspace this file is defined in. + "package_name": { + + # An alias to a crate target. # The label of the crate target the + # Aliases are only crate names. # alias refers to. + "alias": "@full//:label", + } + } + ``` + + Args: + all_dependency_maps (list): A list of dicts as described above + + Returns: + dict: A dictionary as described above + """ + dependencies = {} + + for dep_map in all_dependency_maps: + for pkg_name in dep_map: + if pkg_name not in dependencies: + # Add a non-frozen dict to the collection of dependencies + dependencies.setdefault(pkg_name, dict(dep_map[pkg_name].items())) + continue + + duplicate_crate_aliases = [key for key in dependencies[pkg_name] if key in dep_map[pkg_name]] + if duplicate_crate_aliases: + fail("There should be no duplicate crate aliases: {}".format(duplicate_crate_aliases)) + + dependencies[pkg_name].update(dep_map[pkg_name]) + + return dependencies + +def raze_fetch_remote_crates(): + """This function defines a collection of repos and should be called in a WORKSPACE file""" + maybe( + http_archive, + name = "raze__aho_corasick__0_7_18", + url = "https://crates.io/api/v1/crates/aho-corasick/0.7.18/download", + type = "tar.gz", + sha256 = "1e37cfd5e7657ada45f742d6e99ca5788580b5c529dc78faf11ece6dc702656f", + strip_prefix = "aho-corasick-0.7.18", + build_file = Label("//cargo/remote:BUILD.aho-corasick-0.7.18.bazel"), + ) + + maybe( + http_archive, + name = "raze__anyhow__1_0_43", + url = "https://crates.io/api/v1/crates/anyhow/1.0.43/download", + type = "tar.gz", + sha256 = "28ae2b3dec75a406790005a200b1bd89785afc02517a00ca99ecfe093ee9e6cf", + strip_prefix = "anyhow-1.0.43", + build_file = Label("//cargo/remote:BUILD.anyhow-1.0.43.bazel"), + ) + + maybe( + http_archive, + name = "raze__arrayvec__0_5_2", + url = "https://crates.io/api/v1/crates/arrayvec/0.5.2/download", + type = "tar.gz", + sha256 = "23b62fc65de8e4e7f52534fb52b0f3ed04746ae267519eef2a83941e8085068b", + strip_prefix = "arrayvec-0.5.2", + build_file = Label("//cargo/remote:BUILD.arrayvec-0.5.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__async_channel__1_6_1", + url = "https://crates.io/api/v1/crates/async-channel/1.6.1/download", + type = "tar.gz", + sha256 = "2114d64672151c0c5eaa5e131ec84a74f06e1e559830dabba01ca30605d66319", + strip_prefix = "async-channel-1.6.1", + build_file = Label("//cargo/remote:BUILD.async-channel-1.6.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__async_stream__0_3_2", + url = "https://crates.io/api/v1/crates/async-stream/0.3.2/download", + type = "tar.gz", + sha256 = "171374e7e3b2504e0e5236e3b59260560f9fe94bfe9ac39ba5e4e929c5590625", + strip_prefix = "async-stream-0.3.2", + build_file = Label("//cargo/remote:BUILD.async-stream-0.3.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__async_stream_impl__0_3_2", + url = "https://crates.io/api/v1/crates/async-stream-impl/0.3.2/download", + type = "tar.gz", + sha256 = "648ed8c8d2ce5409ccd57453d9d1b214b342a0d69376a6feda1fd6cae3299308", + strip_prefix = "async-stream-impl-0.3.2", + build_file = Label("//cargo/remote:BUILD.async-stream-impl-0.3.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__async_task__4_0_3", + url = "https://crates.io/api/v1/crates/async-task/4.0.3/download", + type = "tar.gz", + sha256 = "e91831deabf0d6d7ec49552e489aed63b7456a7a3c46cff62adad428110b0af0", + strip_prefix = "async-task-4.0.3", + build_file = Label("//cargo/remote:BUILD.async-task-4.0.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__async_trait__0_1_51", + url = "https://crates.io/api/v1/crates/async-trait/0.1.51/download", + type = "tar.gz", + sha256 = "44318e776df68115a881de9a8fd1b9e53368d7a4a5ce4cc48517da3393233a5e", + strip_prefix = "async-trait-0.1.51", + build_file = Label("//cargo/remote:BUILD.async-trait-0.1.51.bazel"), + ) + + maybe( + http_archive, + name = "raze__atomic_waker__1_0_0", + url = "https://crates.io/api/v1/crates/atomic-waker/1.0.0/download", + type = "tar.gz", + sha256 = "065374052e7df7ee4047b1160cca5e1467a12351a40b3da123c870ba0b8eda2a", + strip_prefix = "atomic-waker-1.0.0", + build_file = Label("//cargo/remote:BUILD.atomic-waker-1.0.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__atty__0_2_14", + url = "https://crates.io/api/v1/crates/atty/0.2.14/download", + type = "tar.gz", + sha256 = "d9b39be18770d11421cdb1b9947a45dd3f37e93092cbf377614828a319d5fee8", + strip_prefix = "atty-0.2.14", + build_file = Label("//cargo/remote:BUILD.atty-0.2.14.bazel"), + ) + + maybe( + http_archive, + name = "raze__autocfg__1_0_1", + url = "https://crates.io/api/v1/crates/autocfg/1.0.1/download", + type = "tar.gz", + sha256 = "cdb031dd78e28731d87d56cc8ffef4a8f36ca26c38fe2de700543e627f8a464a", + strip_prefix = "autocfg-1.0.1", + build_file = Label("//cargo/remote:BUILD.autocfg-1.0.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__base64__0_13_0", + url = "https://crates.io/api/v1/crates/base64/0.13.0/download", + type = "tar.gz", + sha256 = "904dfeac50f3cdaba28fc6f57fdcddb75f49ed61346676a78c4ffe55877802fd", + strip_prefix = "base64-0.13.0", + build_file = Label("//cargo/remote:BUILD.base64-0.13.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__base64_url__1_4_10", + url = "https://crates.io/api/v1/crates/base64-url/1.4.10/download", + type = "tar.gz", + sha256 = "44265cf903f576fcaa1c2f23b32ec2dadaa8ec9d6b7c6212704d72a417bfbeef", + strip_prefix = "base64-url-1.4.10", + build_file = Label("//cargo/remote:BUILD.base64-url-1.4.10.bazel"), + ) + + maybe( + http_archive, + name = "raze__bitflags__1_3_2", + url = "https://crates.io/api/v1/crates/bitflags/1.3.2/download", + type = "tar.gz", + sha256 = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a", + strip_prefix = "bitflags-1.3.2", + build_file = Label("//cargo/remote:BUILD.bitflags-1.3.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__block_buffer__0_9_0", + url = "https://crates.io/api/v1/crates/block-buffer/0.9.0/download", + type = "tar.gz", + sha256 = "4152116fd6e9dadb291ae18fc1ec3575ed6d84c29642d97890f4b4a3417297e4", + strip_prefix = "block-buffer-0.9.0", + build_file = Label("//cargo/remote:BUILD.block-buffer-0.9.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__blocking__1_0_2", + url = "https://crates.io/api/v1/crates/blocking/1.0.2/download", + type = "tar.gz", + sha256 = "c5e170dbede1f740736619b776d7251cb1b9095c435c34d8ca9f57fcd2f335e9", + strip_prefix = "blocking-1.0.2", + build_file = Label("//cargo/remote:BUILD.blocking-1.0.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__bumpalo__3_7_0", + url = "https://crates.io/api/v1/crates/bumpalo/3.7.0/download", + type = "tar.gz", + sha256 = "9c59e7af012c713f529e7a3ee57ce9b31ddd858d4b512923602f74608b009631", + strip_prefix = "bumpalo-3.7.0", + build_file = Label("//cargo/remote:BUILD.bumpalo-3.7.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__byteorder__1_4_3", + url = "https://crates.io/api/v1/crates/byteorder/1.4.3/download", + type = "tar.gz", + sha256 = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610", + strip_prefix = "byteorder-1.4.3", + build_file = Label("//cargo/remote:BUILD.byteorder-1.4.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__bytes__1_1_0", + url = "https://crates.io/api/v1/crates/bytes/1.1.0/download", + type = "tar.gz", + sha256 = "c4872d67bab6358e59559027aa3b9157c53d9358c51423c17554809a8858e0f8", + strip_prefix = "bytes-1.1.0", + build_file = Label("//cargo/remote:BUILD.bytes-1.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__cache_padded__1_1_1", + url = "https://crates.io/api/v1/crates/cache-padded/1.1.1/download", + type = "tar.gz", + sha256 = "631ae5198c9be5e753e5cc215e1bd73c2b466a3565173db433f52bb9d3e66dba", + strip_prefix = "cache-padded-1.1.1", + build_file = Label("//cargo/remote:BUILD.cache-padded-1.1.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__cc__1_0_70", + url = "https://crates.io/api/v1/crates/cc/1.0.70/download", + type = "tar.gz", + sha256 = "d26a6ce4b6a484fa3edb70f7efa6fc430fd2b87285fe8b84304fd0936faa0dc0", + strip_prefix = "cc-1.0.70", + build_file = Label("//cargo/remote:BUILD.cc-1.0.70.bazel"), + ) + + maybe( + http_archive, + name = "raze__cfg_if__1_0_0", + url = "https://crates.io/api/v1/crates/cfg-if/1.0.0/download", + type = "tar.gz", + sha256 = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd", + strip_prefix = "cfg-if-1.0.0", + build_file = Label("//cargo/remote:BUILD.cfg-if-1.0.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__chrono__0_4_19", + url = "https://crates.io/api/v1/crates/chrono/0.4.19/download", + type = "tar.gz", + sha256 = "670ad68c9088c2a963aaa298cb369688cf3f9465ce5e2d4ca10e6e0098a1ce73", + strip_prefix = "chrono-0.4.19", + build_file = Label("//cargo/remote:BUILD.chrono-0.4.19.bazel"), + ) + + maybe( + http_archive, + name = "raze__combine__4_6_1", + url = "https://crates.io/api/v1/crates/combine/4.6.1/download", + type = "tar.gz", + sha256 = "a909e4d93292cd8e9c42e189f61681eff9d67b6541f96b8a1a737f23737bd001", + strip_prefix = "combine-4.6.1", + build_file = Label("//cargo/remote:BUILD.combine-4.6.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__concurrent_queue__1_2_2", + url = "https://crates.io/api/v1/crates/concurrent-queue/1.2.2/download", + type = "tar.gz", + sha256 = "30ed07550be01594c6026cff2a1d7fe9c8f683caa798e12b68694ac9e88286a3", + strip_prefix = "concurrent-queue-1.2.2", + build_file = Label("//cargo/remote:BUILD.concurrent-queue-1.2.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__config__0_11_0", + url = "https://crates.io/api/v1/crates/config/0.11.0/download", + type = "tar.gz", + sha256 = "1b1b9d958c2b1368a663f05538fc1b5975adce1e19f435acceae987aceeeb369", + strip_prefix = "config-0.11.0", + build_file = Label("//cargo/remote:BUILD.config-0.11.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__core_foundation__0_9_1", + url = "https://crates.io/api/v1/crates/core-foundation/0.9.1/download", + type = "tar.gz", + sha256 = "0a89e2ae426ea83155dccf10c0fa6b1463ef6d5fcb44cee0b224a408fa640a62", + strip_prefix = "core-foundation-0.9.1", + build_file = Label("//cargo/remote:BUILD.core-foundation-0.9.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__core_foundation_sys__0_8_2", + url = "https://crates.io/api/v1/crates/core-foundation-sys/0.8.2/download", + type = "tar.gz", + sha256 = "ea221b5284a47e40033bf9b66f35f984ec0ea2931eb03505246cd27a963f981b", + strip_prefix = "core-foundation-sys-0.8.2", + build_file = Label("//cargo/remote:BUILD.core-foundation-sys-0.8.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__cpufeatures__0_2_1", + url = "https://crates.io/api/v1/crates/cpufeatures/0.2.1/download", + type = "tar.gz", + sha256 = "95059428f66df56b63431fdb4e1947ed2190586af5c5a8a8b71122bdf5a7f469", + strip_prefix = "cpufeatures-0.2.1", + build_file = Label("//cargo/remote:BUILD.cpufeatures-0.2.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__crossbeam_channel__0_5_1", + url = "https://crates.io/api/v1/crates/crossbeam-channel/0.5.1/download", + type = "tar.gz", + sha256 = "06ed27e177f16d65f0f0c22a213e17c696ace5dd64b14258b52f9417ccb52db4", + strip_prefix = "crossbeam-channel-0.5.1", + build_file = Label("//cargo/remote:BUILD.crossbeam-channel-0.5.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__crossbeam_utils__0_8_5", + url = "https://crates.io/api/v1/crates/crossbeam-utils/0.8.5/download", + type = "tar.gz", + sha256 = "d82cfc11ce7f2c3faef78d8a684447b40d503d9681acebed6cb728d45940c4db", + strip_prefix = "crossbeam-utils-0.8.5", + build_file = Label("//cargo/remote:BUILD.crossbeam-utils-0.8.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__curve25519_dalek__3_2_0", + url = "https://crates.io/api/v1/crates/curve25519-dalek/3.2.0/download", + type = "tar.gz", + sha256 = "0b9fdf9972b2bd6af2d913799d9ebc165ea4d2e65878e329d9c6b372c4491b61", + strip_prefix = "curve25519-dalek-3.2.0", + build_file = Label("//cargo/remote:BUILD.curve25519-dalek-3.2.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__data_encoding__2_3_2", + url = "https://crates.io/api/v1/crates/data-encoding/2.3.2/download", + type = "tar.gz", + sha256 = "3ee2393c4a91429dffb4bedf19f4d6abf27d8a732c8ce4980305d782e5426d57", + strip_prefix = "data-encoding-2.3.2", + build_file = Label("//cargo/remote:BUILD.data-encoding-2.3.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__digest__0_9_0", + url = "https://crates.io/api/v1/crates/digest/0.9.0/download", + type = "tar.gz", + sha256 = "d3dd60d1080a57a05ab032377049e0591415d2b31afd7028356dbf3cc6dcb066", + strip_prefix = "digest-0.9.0", + build_file = Label("//cargo/remote:BUILD.digest-0.9.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__dtoa__0_4_8", + url = "https://crates.io/api/v1/crates/dtoa/0.4.8/download", + type = "tar.gz", + sha256 = "56899898ce76aaf4a0f24d914c97ea6ed976d42fec6ad33fcbb0a1103e07b2b0", + strip_prefix = "dtoa-0.4.8", + build_file = Label("//cargo/remote:BUILD.dtoa-0.4.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__ed25519__1_2_0", + url = "https://crates.io/api/v1/crates/ed25519/1.2.0/download", + type = "tar.gz", + sha256 = "4620d40f6d2601794401d6dd95a5cf69b6c157852539470eeda433a99b3c0efc", + strip_prefix = "ed25519-1.2.0", + build_file = Label("//cargo/remote:BUILD.ed25519-1.2.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__ed25519_dalek__1_0_1", + url = "https://crates.io/api/v1/crates/ed25519-dalek/1.0.1/download", + type = "tar.gz", + sha256 = "c762bae6dcaf24c4c84667b8579785430908723d5c889f469d76a41d59cc7a9d", + strip_prefix = "ed25519-dalek-1.0.1", + build_file = Label("//cargo/remote:BUILD.ed25519-dalek-1.0.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__either__1_6_1", + url = "https://crates.io/api/v1/crates/either/1.6.1/download", + type = "tar.gz", + sha256 = "e78d4f1cc4ae33bbfc157ed5d5a5ef3bc29227303d595861deb238fcec4e9457", + strip_prefix = "either-1.6.1", + build_file = Label("//cargo/remote:BUILD.either-1.6.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__enumflags2__0_7_1", + url = "https://crates.io/api/v1/crates/enumflags2/0.7.1/download", + type = "tar.gz", + sha256 = "a8672257d642ffdd235f6e9c723c2326ac1253c8f3c022e7cfd2e57da55b1131", + strip_prefix = "enumflags2-0.7.1", + build_file = Label("//cargo/remote:BUILD.enumflags2-0.7.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__enumflags2_derive__0_7_0", + url = "https://crates.io/api/v1/crates/enumflags2_derive/0.7.0/download", + type = "tar.gz", + sha256 = "33526f770a27828ce7c2792fdb7cb240220237e0ff12933ed6c23957fc5dd7cf", + strip_prefix = "enumflags2_derive-0.7.0", + build_file = Label("//cargo/remote:BUILD.enumflags2_derive-0.7.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__env_logger__0_7_1", + url = "https://crates.io/api/v1/crates/env_logger/0.7.1/download", + type = "tar.gz", + sha256 = "44533bbbb3bb3c1fa17d9f2e4e38bbbaf8396ba82193c4cb1b6445d711445d36", + strip_prefix = "env_logger-0.7.1", + build_file = Label("//cargo/remote:BUILD.env_logger-0.7.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__event_listener__2_5_1", + url = "https://crates.io/api/v1/crates/event-listener/2.5.1/download", + type = "tar.gz", + sha256 = "f7531096570974c3a9dcf9e4b8e1cede1ec26cf5046219fb3b9d897503b9be59", + strip_prefix = "event-listener-2.5.1", + build_file = Label("//cargo/remote:BUILD.event-listener-2.5.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__fastrand__1_5_0", + url = "https://crates.io/api/v1/crates/fastrand/1.5.0/download", + type = "tar.gz", + sha256 = "b394ed3d285a429378d3b384b9eb1285267e7df4b166df24b7a6939a04dc392e", + strip_prefix = "fastrand-1.5.0", + build_file = Label("//cargo/remote:BUILD.fastrand-1.5.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__fixedbitset__0_2_0", + url = "https://crates.io/api/v1/crates/fixedbitset/0.2.0/download", + type = "tar.gz", + sha256 = "37ab347416e802de484e4d03c7316c48f1ecb56574dfd4a46a80f173ce1de04d", + strip_prefix = "fixedbitset-0.2.0", + build_file = Label("//cargo/remote:BUILD.fixedbitset-0.2.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__fnv__1_0_7", + url = "https://crates.io/api/v1/crates/fnv/1.0.7/download", + type = "tar.gz", + sha256 = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1", + strip_prefix = "fnv-1.0.7", + build_file = Label("//cargo/remote:BUILD.fnv-1.0.7.bazel"), + ) + + maybe( + http_archive, + name = "raze__form_urlencoded__1_0_1", + url = "https://crates.io/api/v1/crates/form_urlencoded/1.0.1/download", + type = "tar.gz", + sha256 = "5fc25a87fa4fd2094bffb06925852034d90a17f0d1e05197d4956d3555752191", + strip_prefix = "form_urlencoded-1.0.1", + build_file = Label("//cargo/remote:BUILD.form_urlencoded-1.0.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures__0_3_17", + url = "https://crates.io/api/v1/crates/futures/0.3.17/download", + type = "tar.gz", + sha256 = "a12aa0eb539080d55c3f2d45a67c3b58b6b0773c1a3ca2dfec66d58c97fd66ca", + strip_prefix = "futures-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_channel__0_3_17", + url = "https://crates.io/api/v1/crates/futures-channel/0.3.17/download", + type = "tar.gz", + sha256 = "5da6ba8c3bb3c165d3c7319fc1cc8304facf1fb8db99c5de877183c08a273888", + strip_prefix = "futures-channel-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-channel-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_core__0_3_17", + url = "https://crates.io/api/v1/crates/futures-core/0.3.17/download", + type = "tar.gz", + sha256 = "88d1c26957f23603395cd326b0ffe64124b818f4449552f960d815cfba83a53d", + strip_prefix = "futures-core-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-core-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_executor__0_3_17", + url = "https://crates.io/api/v1/crates/futures-executor/0.3.17/download", + type = "tar.gz", + sha256 = "45025be030969d763025784f7f355043dc6bc74093e4ecc5000ca4dc50d8745c", + strip_prefix = "futures-executor-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-executor-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_io__0_3_17", + url = "https://crates.io/api/v1/crates/futures-io/0.3.17/download", + type = "tar.gz", + sha256 = "522de2a0fe3e380f1bc577ba0474108faf3f6b18321dbf60b3b9c39a75073377", + strip_prefix = "futures-io-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-io-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_lite__1_12_0", + url = "https://crates.io/api/v1/crates/futures-lite/1.12.0/download", + type = "tar.gz", + sha256 = "7694489acd39452c77daa48516b894c153f192c3578d5a839b62c58099fcbf48", + strip_prefix = "futures-lite-1.12.0", + build_file = Label("//cargo/remote:BUILD.futures-lite-1.12.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_macro__0_3_17", + url = "https://crates.io/api/v1/crates/futures-macro/0.3.17/download", + type = "tar.gz", + sha256 = "18e4a4b95cea4b4ccbcf1c5675ca7c4ee4e9e75eb79944d07defde18068f79bb", + strip_prefix = "futures-macro-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-macro-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_sink__0_3_17", + url = "https://crates.io/api/v1/crates/futures-sink/0.3.17/download", + type = "tar.gz", + sha256 = "36ea153c13024fe480590b3e3d4cad89a0cfacecc24577b68f86c6ced9c2bc11", + strip_prefix = "futures-sink-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-sink-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_task__0_3_17", + url = "https://crates.io/api/v1/crates/futures-task/0.3.17/download", + type = "tar.gz", + sha256 = "1d3d00f4eddb73e498a54394f228cd55853bdf059259e8e7bc6e69d408892e99", + strip_prefix = "futures-task-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-task-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__futures_util__0_3_17", + url = "https://crates.io/api/v1/crates/futures-util/0.3.17/download", + type = "tar.gz", + sha256 = "36568465210a3a6ee45e1f165136d68671471a501e632e9a98d96872222b5481", + strip_prefix = "futures-util-0.3.17", + build_file = Label("//cargo/remote:BUILD.futures-util-0.3.17.bazel"), + ) + + maybe( + http_archive, + name = "raze__generic_array__0_14_4", + url = "https://crates.io/api/v1/crates/generic-array/0.14.4/download", + type = "tar.gz", + sha256 = "501466ecc8a30d1d3b7fc9229b122b2ce8ed6e9d9223f1138d4babb253e51817", + strip_prefix = "generic-array-0.14.4", + build_file = Label("//cargo/remote:BUILD.generic-array-0.14.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__getrandom__0_1_16", + url = "https://crates.io/api/v1/crates/getrandom/0.1.16/download", + type = "tar.gz", + sha256 = "8fc3cb4d91f53b50155bdcfd23f6a4c39ae1969c2ae85982b135750cccaf5fce", + strip_prefix = "getrandom-0.1.16", + build_file = Label("//cargo/remote:BUILD.getrandom-0.1.16.bazel"), + ) + + maybe( + http_archive, + name = "raze__getrandom__0_2_3", + url = "https://crates.io/api/v1/crates/getrandom/0.2.3/download", + type = "tar.gz", + sha256 = "7fcd999463524c52659517fe2cea98493cfe485d10565e7b0fb07dbba7ad2753", + strip_prefix = "getrandom-0.2.3", + build_file = Label("//cargo/remote:BUILD.getrandom-0.2.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__h2__0_3_4", + url = "https://crates.io/api/v1/crates/h2/0.3.4/download", + type = "tar.gz", + sha256 = "d7f3675cfef6a30c8031cf9e6493ebdc3bb3272a3fea3923c4210d1830e6a472", + strip_prefix = "h2-0.3.4", + build_file = Label("//cargo/remote:BUILD.h2-0.3.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__hashbrown__0_11_2", + url = "https://crates.io/api/v1/crates/hashbrown/0.11.2/download", + type = "tar.gz", + sha256 = "ab5ef0d4909ef3724cc8cce6ccc8572c5c817592e9285f5464f8e86f8bd3726e", + strip_prefix = "hashbrown-0.11.2", + build_file = Label("//cargo/remote:BUILD.hashbrown-0.11.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__heck__0_3_3", + url = "https://crates.io/api/v1/crates/heck/0.3.3/download", + type = "tar.gz", + sha256 = "6d621efb26863f0e9924c6ac577e8275e5e6b77455db64ffa6c65c904e9e132c", + strip_prefix = "heck-0.3.3", + build_file = Label("//cargo/remote:BUILD.heck-0.3.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__hermit_abi__0_1_19", + url = "https://crates.io/api/v1/crates/hermit-abi/0.1.19/download", + type = "tar.gz", + sha256 = "62b467343b94ba476dcb2500d242dadbb39557df889310ac77c5d99100aaac33", + strip_prefix = "hermit-abi-0.1.19", + build_file = Label("//cargo/remote:BUILD.hermit-abi-0.1.19.bazel"), + ) + + maybe( + http_archive, + name = "raze__hex__0_4_3", + url = "https://crates.io/api/v1/crates/hex/0.4.3/download", + type = "tar.gz", + sha256 = "7f24254aa9a54b5c858eaee2f5bccdb46aaf0e486a595ed5fd8f86ba55232a70", + strip_prefix = "hex-0.4.3", + build_file = Label("//cargo/remote:BUILD.hex-0.4.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__http__0_2_4", + url = "https://crates.io/api/v1/crates/http/0.2.4/download", + type = "tar.gz", + sha256 = "527e8c9ac747e28542699a951517aa9a6945af506cd1f2e1b53a576c17b6cc11", + strip_prefix = "http-0.2.4", + build_file = Label("//cargo/remote:BUILD.http-0.2.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__http_body__0_4_3", + url = "https://crates.io/api/v1/crates/http-body/0.4.3/download", + type = "tar.gz", + sha256 = "399c583b2979440c60be0821a6199eca73bc3c8dcd9d070d75ac726e2c6186e5", + strip_prefix = "http-body-0.4.3", + build_file = Label("//cargo/remote:BUILD.http-body-0.4.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__httparse__1_5_1", + url = "https://crates.io/api/v1/crates/httparse/1.5.1/download", + type = "tar.gz", + sha256 = "acd94fdbe1d4ff688b67b04eee2e17bd50995534a61539e45adfefb45e5e5503", + strip_prefix = "httparse-1.5.1", + build_file = Label("//cargo/remote:BUILD.httparse-1.5.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__httpdate__1_0_1", + url = "https://crates.io/api/v1/crates/httpdate/1.0.1/download", + type = "tar.gz", + sha256 = "6456b8a6c8f33fee7d958fcd1b60d55b11940a79e63ae87013e6d22e26034440", + strip_prefix = "httpdate-1.0.1", + build_file = Label("//cargo/remote:BUILD.httpdate-1.0.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__humantime__1_3_0", + url = "https://crates.io/api/v1/crates/humantime/1.3.0/download", + type = "tar.gz", + sha256 = "df004cfca50ef23c36850aaaa59ad52cc70d0e90243c3c7737a4dd32dc7a3c4f", + strip_prefix = "humantime-1.3.0", + build_file = Label("//cargo/remote:BUILD.humantime-1.3.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__hyper__0_14_12", + url = "https://crates.io/api/v1/crates/hyper/0.14.12/download", + type = "tar.gz", + sha256 = "13f67199e765030fa08fe0bd581af683f0d5bc04ea09c2b1102012c5fb90e7fd", + strip_prefix = "hyper-0.14.12", + build_file = Label("//cargo/remote:BUILD.hyper-0.14.12.bazel"), + ) + + maybe( + http_archive, + name = "raze__hyper_timeout__0_4_1", + url = "https://crates.io/api/v1/crates/hyper-timeout/0.4.1/download", + type = "tar.gz", + sha256 = "bbb958482e8c7be4bc3cf272a766a2b0bf1a6755e7a6ae777f017a31d11b13b1", + strip_prefix = "hyper-timeout-0.4.1", + build_file = Label("//cargo/remote:BUILD.hyper-timeout-0.4.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__idna__0_2_3", + url = "https://crates.io/api/v1/crates/idna/0.2.3/download", + type = "tar.gz", + sha256 = "418a0a6fab821475f634efe3ccc45c013f742efe03d853e8d3355d5cb850ecf8", + strip_prefix = "idna-0.2.3", + build_file = Label("//cargo/remote:BUILD.idna-0.2.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__indexmap__1_7_0", + url = "https://crates.io/api/v1/crates/indexmap/1.7.0/download", + type = "tar.gz", + sha256 = "bc633605454125dec4b66843673f01c7df2b89479b32e0ed634e43a91cff62a5", + strip_prefix = "indexmap-1.7.0", + build_file = Label("//cargo/remote:BUILD.indexmap-1.7.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__instant__0_1_10", + url = "https://crates.io/api/v1/crates/instant/0.1.10/download", + type = "tar.gz", + sha256 = "bee0328b1209d157ef001c94dd85b4f8f64139adb0eac2659f4b08382b2f474d", + strip_prefix = "instant-0.1.10", + build_file = Label("//cargo/remote:BUILD.instant-0.1.10.bazel"), + ) + + maybe( + http_archive, + name = "raze__itertools__0_10_1", + url = "https://crates.io/api/v1/crates/itertools/0.10.1/download", + type = "tar.gz", + sha256 = "69ddb889f9d0d08a67338271fa9b62996bc788c7796a5c18cf057420aaed5eaf", + strip_prefix = "itertools-0.10.1", + build_file = Label("//cargo/remote:BUILD.itertools-0.10.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__itoa__0_4_8", + url = "https://crates.io/api/v1/crates/itoa/0.4.8/download", + type = "tar.gz", + sha256 = "b71991ff56294aa922b450139ee08b3bfc70982c6b2c7562771375cf73542dd4", + strip_prefix = "itoa-0.4.8", + build_file = Label("//cargo/remote:BUILD.itoa-0.4.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__js_sys__0_3_53", + url = "https://crates.io/api/v1/crates/js-sys/0.3.53/download", + type = "tar.gz", + sha256 = "e4bf49d50e2961077d9c99f4b7997d770a1114f087c3c2e0069b36c13fc2979d", + strip_prefix = "js-sys-0.3.53", + build_file = Label("//cargo/remote:BUILD.js-sys-0.3.53.bazel"), + ) + + maybe( + http_archive, + name = "raze__json__0_12_4", + url = "https://crates.io/api/v1/crates/json/0.12.4/download", + type = "tar.gz", + sha256 = "078e285eafdfb6c4b434e0d31e8cfcb5115b651496faca5749b88fafd4f23bfd", + strip_prefix = "json-0.12.4", + build_file = Label("//cargo/remote:BUILD.json-0.12.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__lazy_static__1_4_0", + url = "https://crates.io/api/v1/crates/lazy_static/1.4.0/download", + type = "tar.gz", + sha256 = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646", + strip_prefix = "lazy_static-1.4.0", + build_file = Label("//cargo/remote:BUILD.lazy_static-1.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__lexical_core__0_7_6", + url = "https://crates.io/api/v1/crates/lexical-core/0.7.6/download", + type = "tar.gz", + sha256 = "6607c62aa161d23d17a9072cc5da0be67cdfc89d3afb1e8d9c842bebc2525ffe", + strip_prefix = "lexical-core-0.7.6", + build_file = Label("//cargo/remote:BUILD.lexical-core-0.7.6.bazel"), + ) + + maybe( + http_archive, + name = "raze__libc__0_2_101", + url = "https://crates.io/api/v1/crates/libc/0.2.101/download", + type = "tar.gz", + sha256 = "3cb00336871be5ed2c8ed44b60ae9959dc5b9f08539422ed43f09e34ecaeba21", + strip_prefix = "libc-0.2.101", + build_file = Label("//cargo/remote:BUILD.libc-0.2.101.bazel"), + ) + + maybe( + http_archive, + name = "raze__libsodium_sys__0_2_7", + url = "https://crates.io/api/v1/crates/libsodium-sys/0.2.7/download", + type = "tar.gz", + sha256 = "6b779387cd56adfbc02ea4a668e704f729be8d6a6abd2c27ca5ee537849a92fd", + strip_prefix = "libsodium-sys-0.2.7", + build_file = Label("//cargo/remote:BUILD.libsodium-sys-0.2.7.bazel"), + ) + + maybe( + http_archive, + name = "raze__linked_hash_map__0_5_4", + url = "https://crates.io/api/v1/crates/linked-hash-map/0.5.4/download", + type = "tar.gz", + sha256 = "7fb9b38af92608140b86b693604b9ffcc5824240a484d1ecd4795bacb2fe88f3", + strip_prefix = "linked-hash-map-0.5.4", + build_file = Label("//cargo/remote:BUILD.linked-hash-map-0.5.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__lock_api__0_4_5", + url = "https://crates.io/api/v1/crates/lock_api/0.4.5/download", + type = "tar.gz", + sha256 = "712a4d093c9976e24e7dbca41db895dabcbac38eb5f4045393d17a95bdfb1109", + strip_prefix = "lock_api-0.4.5", + build_file = Label("//cargo/remote:BUILD.lock_api-0.4.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__log__0_4_14", + url = "https://crates.io/api/v1/crates/log/0.4.14/download", + type = "tar.gz", + sha256 = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710", + strip_prefix = "log-0.4.14", + build_file = Label("//cargo/remote:BUILD.log-0.4.14.bazel"), + ) + + maybe( + http_archive, + name = "raze__matches__0_1_9", + url = "https://crates.io/api/v1/crates/matches/0.1.9/download", + type = "tar.gz", + sha256 = "a3e378b66a060d48947b590737b30a1be76706c8dd7b8ba0f2fe3989c68a853f", + strip_prefix = "matches-0.1.9", + build_file = Label("//cargo/remote:BUILD.matches-0.1.9.bazel"), + ) + + maybe( + http_archive, + name = "raze__memchr__2_4_1", + url = "https://crates.io/api/v1/crates/memchr/2.4.1/download", + type = "tar.gz", + sha256 = "308cc39be01b73d0d18f82a0e7b2a3df85245f84af96fdddc5d202d27e47b86a", + strip_prefix = "memchr-2.4.1", + build_file = Label("//cargo/remote:BUILD.memchr-2.4.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__mio__0_7_13", + url = "https://crates.io/api/v1/crates/mio/0.7.13/download", + type = "tar.gz", + sha256 = "8c2bdb6314ec10835cd3293dd268473a835c02b7b352e788be788b3c6ca6bb16", + strip_prefix = "mio-0.7.13", + build_file = Label("//cargo/remote:BUILD.mio-0.7.13.bazel"), + ) + + maybe( + http_archive, + name = "raze__miow__0_3_7", + url = "https://crates.io/api/v1/crates/miow/0.3.7/download", + type = "tar.gz", + sha256 = "b9f1c5b025cda876f66ef43a113f91ebc9f4ccef34843000e0adf6ebbab84e21", + strip_prefix = "miow-0.3.7", + build_file = Label("//cargo/remote:BUILD.miow-0.3.7.bazel"), + ) + + maybe( + http_archive, + name = "raze__multimap__0_8_3", + url = "https://crates.io/api/v1/crates/multimap/0.8.3/download", + type = "tar.gz", + sha256 = "e5ce46fe64a9d73be07dcbe690a38ce1b293be448fd8ce1e6c1b8062c9f72c6a", + strip_prefix = "multimap-0.8.3", + build_file = Label("//cargo/remote:BUILD.multimap-0.8.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__nats__0_15_2", + url = "https://crates.io/api/v1/crates/nats/0.15.2/download", + type = "tar.gz", + sha256 = "2a3097b182107db2cf690280d61f23f17ee31d49f3994ad152ee6a10261f77c3", + strip_prefix = "nats-0.15.2", + build_file = Label("//cargo/remote:BUILD.nats-0.15.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__nkeys__0_1_0", + url = "https://crates.io/api/v1/crates/nkeys/0.1.0/download", + type = "tar.gz", + sha256 = "c1a98f0a974ff737974b57ba1c71d2e0fe7ec18e5a828d4b8e02683171349dfa", + strip_prefix = "nkeys-0.1.0", + build_file = Label("//cargo/remote:BUILD.nkeys-0.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__nom__5_1_2", + url = "https://crates.io/api/v1/crates/nom/5.1.2/download", + type = "tar.gz", + sha256 = "ffb4262d26ed83a1c0a33a38fe2bb15797329c85770da05e6b828ddb782627af", + strip_prefix = "nom-5.1.2", + build_file = Label("//cargo/remote:BUILD.nom-5.1.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__ntapi__0_3_6", + url = "https://crates.io/api/v1/crates/ntapi/0.3.6/download", + type = "tar.gz", + sha256 = "3f6bb902e437b6d86e03cce10a7e2af662292c5dfef23b65899ea3ac9354ad44", + strip_prefix = "ntapi-0.3.6", + build_file = Label("//cargo/remote:BUILD.ntapi-0.3.6.bazel"), + ) + + maybe( + http_archive, + name = "raze__nuid__0_3_0", + url = "https://crates.io/api/v1/crates/nuid/0.3.0/download", + type = "tar.gz", + sha256 = "7000c9392b545c4ba43e8abc086bf7d01cd2948690934c16980170b0549a2bd3", + strip_prefix = "nuid-0.3.0", + build_file = Label("//cargo/remote:BUILD.nuid-0.3.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__num__0_4_0", + url = "https://crates.io/api/v1/crates/num/0.4.0/download", + type = "tar.gz", + sha256 = "43db66d1170d347f9a065114077f7dccb00c1b9478c89384490a3425279a4606", + strip_prefix = "num-0.4.0", + build_file = Label("//cargo/remote:BUILD.num-0.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_bigint__0_4_2", + url = "https://crates.io/api/v1/crates/num-bigint/0.4.2/download", + type = "tar.gz", + sha256 = "74e768dff5fb39a41b3bcd30bb25cf989706c90d028d1ad71971987aa309d535", + strip_prefix = "num-bigint-0.4.2", + build_file = Label("//cargo/remote:BUILD.num-bigint-0.4.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_complex__0_4_0", + url = "https://crates.io/api/v1/crates/num-complex/0.4.0/download", + type = "tar.gz", + sha256 = "26873667bbbb7c5182d4a37c1add32cdf09f841af72da53318fdb81543c15085", + strip_prefix = "num-complex-0.4.0", + build_file = Label("//cargo/remote:BUILD.num-complex-0.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_derive__0_3_3", + url = "https://crates.io/api/v1/crates/num-derive/0.3.3/download", + type = "tar.gz", + sha256 = "876a53fff98e03a936a674b29568b0e605f06b29372c2489ff4de23f1949743d", + strip_prefix = "num-derive-0.3.3", + build_file = Label("//cargo/remote:BUILD.num-derive-0.3.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_integer__0_1_44", + url = "https://crates.io/api/v1/crates/num-integer/0.1.44/download", + type = "tar.gz", + sha256 = "d2cc698a63b549a70bc047073d2949cce27cd1c7b0a4a862d08a8031bc2801db", + strip_prefix = "num-integer-0.1.44", + build_file = Label("//cargo/remote:BUILD.num-integer-0.1.44.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_iter__0_1_42", + url = "https://crates.io/api/v1/crates/num-iter/0.1.42/download", + type = "tar.gz", + sha256 = "b2021c8337a54d21aca0d59a92577a029af9431cb59b909b03252b9c164fad59", + strip_prefix = "num-iter-0.1.42", + build_file = Label("//cargo/remote:BUILD.num-iter-0.1.42.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_rational__0_4_0", + url = "https://crates.io/api/v1/crates/num-rational/0.4.0/download", + type = "tar.gz", + sha256 = "d41702bd167c2df5520b384281bc111a4b5efcf7fbc4c9c222c815b07e0a6a6a", + strip_prefix = "num-rational-0.4.0", + build_file = Label("//cargo/remote:BUILD.num-rational-0.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_traits__0_1_43", + url = "https://crates.io/api/v1/crates/num-traits/0.1.43/download", + type = "tar.gz", + sha256 = "92e5113e9fd4cc14ded8e499429f396a20f98c772a47cc8622a736e1ec843c31", + strip_prefix = "num-traits-0.1.43", + build_file = Label("//cargo/remote:BUILD.num-traits-0.1.43.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_traits__0_2_14", + url = "https://crates.io/api/v1/crates/num-traits/0.2.14/download", + type = "tar.gz", + sha256 = "9a64b1ec5cda2586e284722486d802acf1f7dbdc623e2bfc57e65ca1cd099290", + strip_prefix = "num-traits-0.2.14", + build_file = Label("//cargo/remote:BUILD.num-traits-0.2.14.bazel"), + ) + + maybe( + http_archive, + name = "raze__num_cpus__1_13_0", + url = "https://crates.io/api/v1/crates/num_cpus/1.13.0/download", + type = "tar.gz", + sha256 = "05499f3756671c15885fee9034446956fff3f243d6077b91e5767df161f766b3", + strip_prefix = "num_cpus-1.13.0", + build_file = Label("//cargo/remote:BUILD.num_cpus-1.13.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__once_cell__1_8_0", + url = "https://crates.io/api/v1/crates/once_cell/1.8.0/download", + type = "tar.gz", + sha256 = "692fcb63b64b1758029e0a96ee63e049ce8c5948587f2f7208df04625e5f6b56", + strip_prefix = "once_cell-1.8.0", + build_file = Label("//cargo/remote:BUILD.once_cell-1.8.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__opaque_debug__0_3_0", + url = "https://crates.io/api/v1/crates/opaque-debug/0.3.0/download", + type = "tar.gz", + sha256 = "624a8340c38c1b80fd549087862da4ba43e08858af025b236e509b6649fc13d5", + strip_prefix = "opaque-debug-0.3.0", + build_file = Label("//cargo/remote:BUILD.opaque-debug-0.3.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__openssl_probe__0_1_4", + url = "https://crates.io/api/v1/crates/openssl-probe/0.1.4/download", + type = "tar.gz", + sha256 = "28988d872ab76095a6e6ac88d99b54fd267702734fd7ffe610ca27f533ddb95a", + strip_prefix = "openssl-probe-0.1.4", + build_file = Label("//cargo/remote:BUILD.openssl-probe-0.1.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__parking__2_0_0", + url = "https://crates.io/api/v1/crates/parking/2.0.0/download", + type = "tar.gz", + sha256 = "427c3892f9e783d91cc128285287e70a59e206ca452770ece88a76f7a3eddd72", + strip_prefix = "parking-2.0.0", + build_file = Label("//cargo/remote:BUILD.parking-2.0.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__parking_lot__0_11_2", + url = "https://crates.io/api/v1/crates/parking_lot/0.11.2/download", + type = "tar.gz", + sha256 = "7d17b78036a60663b797adeaee46f5c9dfebb86948d1255007a1d6be0271ff99", + strip_prefix = "parking_lot-0.11.2", + build_file = Label("//cargo/remote:BUILD.parking_lot-0.11.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__parking_lot_core__0_8_5", + url = "https://crates.io/api/v1/crates/parking_lot_core/0.8.5/download", + type = "tar.gz", + sha256 = "d76e8e1493bcac0d2766c42737f34458f1c8c50c0d23bcb24ea953affb273216", + strip_prefix = "parking_lot_core-0.8.5", + build_file = Label("//cargo/remote:BUILD.parking_lot_core-0.8.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__percent_encoding__2_1_0", + url = "https://crates.io/api/v1/crates/percent-encoding/2.1.0/download", + type = "tar.gz", + sha256 = "d4fd5641d01c8f18a23da7b6fe29298ff4b55afcccdf78973b24cf3175fee32e", + strip_prefix = "percent-encoding-2.1.0", + build_file = Label("//cargo/remote:BUILD.percent-encoding-2.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__petgraph__0_5_1", + url = "https://crates.io/api/v1/crates/petgraph/0.5.1/download", + type = "tar.gz", + sha256 = "467d164a6de56270bd7c4d070df81d07beace25012d5103ced4e9ff08d6afdb7", + strip_prefix = "petgraph-0.5.1", + build_file = Label("//cargo/remote:BUILD.petgraph-0.5.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__pin_project__1_0_8", + url = "https://crates.io/api/v1/crates/pin-project/1.0.8/download", + type = "tar.gz", + sha256 = "576bc800220cc65dac09e99e97b08b358cfab6e17078de8dc5fee223bd2d0c08", + strip_prefix = "pin-project-1.0.8", + build_file = Label("//cargo/remote:BUILD.pin-project-1.0.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__pin_project_internal__1_0_8", + url = "https://crates.io/api/v1/crates/pin-project-internal/1.0.8/download", + type = "tar.gz", + sha256 = "6e8fe8163d14ce7f0cdac2e040116f22eac817edabff0be91e8aff7e9accf389", + strip_prefix = "pin-project-internal-1.0.8", + build_file = Label("//cargo/remote:BUILD.pin-project-internal-1.0.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__pin_project_lite__0_2_7", + url = "https://crates.io/api/v1/crates/pin-project-lite/0.2.7/download", + type = "tar.gz", + sha256 = "8d31d11c69a6b52a174b42bdc0c30e5e11670f90788b2c471c31c1d17d449443", + strip_prefix = "pin-project-lite-0.2.7", + build_file = Label("//cargo/remote:BUILD.pin-project-lite-0.2.7.bazel"), + ) + + maybe( + http_archive, + name = "raze__pin_utils__0_1_0", + url = "https://crates.io/api/v1/crates/pin-utils/0.1.0/download", + type = "tar.gz", + sha256 = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184", + strip_prefix = "pin-utils-0.1.0", + build_file = Label("//cargo/remote:BUILD.pin-utils-0.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__pkg_config__0_3_19", + url = "https://crates.io/api/v1/crates/pkg-config/0.3.19/download", + type = "tar.gz", + sha256 = "3831453b3449ceb48b6d9c7ad7c96d5ea673e9b470a1dc578c2ce6521230884c", + strip_prefix = "pkg-config-0.3.19", + build_file = Label("//cargo/remote:BUILD.pkg-config-0.3.19.bazel"), + ) + + maybe( + http_archive, + name = "raze__ppv_lite86__0_2_10", + url = "https://crates.io/api/v1/crates/ppv-lite86/0.2.10/download", + type = "tar.gz", + sha256 = "ac74c624d6b2d21f425f752262f42188365d7b8ff1aff74c82e45136510a4857", + strip_prefix = "ppv-lite86-0.2.10", + build_file = Label("//cargo/remote:BUILD.ppv-lite86-0.2.10.bazel"), + ) + + maybe( + http_archive, + name = "raze__pretty_env_logger__0_4_0", + url = "https://crates.io/api/v1/crates/pretty_env_logger/0.4.0/download", + type = "tar.gz", + sha256 = "926d36b9553851b8b0005f1275891b392ee4d2d833852c417ed025477350fb9d", + strip_prefix = "pretty_env_logger-0.4.0", + build_file = Label("//cargo/remote:BUILD.pretty_env_logger-0.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__proc_macro_hack__0_5_19", + url = "https://crates.io/api/v1/crates/proc-macro-hack/0.5.19/download", + type = "tar.gz", + sha256 = "dbf0c48bc1d91375ae5c3cd81e3722dff1abcf81a30960240640d223f59fe0e5", + strip_prefix = "proc-macro-hack-0.5.19", + build_file = Label("//cargo/remote:BUILD.proc-macro-hack-0.5.19.bazel"), + ) + + maybe( + http_archive, + name = "raze__proc_macro_nested__0_1_7", + url = "https://crates.io/api/v1/crates/proc-macro-nested/0.1.7/download", + type = "tar.gz", + sha256 = "bc881b2c22681370c6a780e47af9840ef841837bc98118431d4e1868bd0c1086", + strip_prefix = "proc-macro-nested-0.1.7", + build_file = Label("//cargo/remote:BUILD.proc-macro-nested-0.1.7.bazel"), + ) + + maybe( + http_archive, + name = "raze__proc_macro2__1_0_29", + url = "https://crates.io/api/v1/crates/proc-macro2/1.0.29/download", + type = "tar.gz", + sha256 = "b9f5105d4fdaab20335ca9565e106a5d9b82b6219b5ba735731124ac6711d23d", + strip_prefix = "proc-macro2-1.0.29", + build_file = Label("//cargo/remote:BUILD.proc-macro2-1.0.29.bazel"), + ) + + maybe( + http_archive, + name = "raze__prometheus__0_12_0", + url = "https://crates.io/api/v1/crates/prometheus/0.12.0/download", + type = "tar.gz", + sha256 = "5986aa8d62380092d2f50f8b1cdba9cb9b6731ffd4b25b51fd126b6c3e05b99c", + strip_prefix = "prometheus-0.12.0", + build_file = Label("//cargo/remote:BUILD.prometheus-0.12.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__prost__0_8_0", + url = "https://crates.io/api/v1/crates/prost/0.8.0/download", + type = "tar.gz", + sha256 = "de5e2533f59d08fcf364fd374ebda0692a70bd6d7e66ef97f306f45c6c5d8020", + strip_prefix = "prost-0.8.0", + build_file = Label("//cargo/remote:BUILD.prost-0.8.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__prost_build__0_8_0", + url = "https://crates.io/api/v1/crates/prost-build/0.8.0/download", + type = "tar.gz", + sha256 = "355f634b43cdd80724ee7848f95770e7e70eefa6dcf14fea676216573b8fd603", + strip_prefix = "prost-build-0.8.0", + build_file = Label("//cargo/remote:BUILD.prost-build-0.8.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__prost_derive__0_8_0", + url = "https://crates.io/api/v1/crates/prost-derive/0.8.0/download", + type = "tar.gz", + sha256 = "600d2f334aa05acb02a755e217ef1ab6dea4d51b58b7846588b747edec04efba", + strip_prefix = "prost-derive-0.8.0", + build_file = Label("//cargo/remote:BUILD.prost-derive-0.8.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__prost_types__0_8_0", + url = "https://crates.io/api/v1/crates/prost-types/0.8.0/download", + type = "tar.gz", + sha256 = "603bbd6394701d13f3f25aada59c7de9d35a6a5887cfc156181234a44002771b", + strip_prefix = "prost-types-0.8.0", + build_file = Label("//cargo/remote:BUILD.prost-types-0.8.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__protobuf__2_25_1", + url = "https://crates.io/api/v1/crates/protobuf/2.25.1/download", + type = "tar.gz", + sha256 = "23129d50f2c9355ced935fce8a08bd706ee2e7ce2b3b33bf61dace0e379ac63a", + strip_prefix = "protobuf-2.25.1", + build_file = Label("//cargo/remote:BUILD.protobuf-2.25.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__quick_error__1_2_3", + url = "https://crates.io/api/v1/crates/quick-error/1.2.3/download", + type = "tar.gz", + sha256 = "a1d01941d82fa2ab50be1e79e6714289dd7cde78eba4c074bc5a4374f650dfe0", + strip_prefix = "quick-error-1.2.3", + build_file = Label("//cargo/remote:BUILD.quick-error-1.2.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__quote__1_0_9", + url = "https://crates.io/api/v1/crates/quote/1.0.9/download", + type = "tar.gz", + sha256 = "c3d0b9745dc2debf507c8422de05d7226cc1f0644216dfdfead988f9b1ab32a7", + strip_prefix = "quote-1.0.9", + build_file = Label("//cargo/remote:BUILD.quote-1.0.9.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand__0_7_3", + url = "https://crates.io/api/v1/crates/rand/0.7.3/download", + type = "tar.gz", + sha256 = "6a6b1679d49b24bbfe0c803429aa1874472f50d9b363131f0e89fc356b544d03", + strip_prefix = "rand-0.7.3", + build_file = Label("//cargo/remote:BUILD.rand-0.7.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand__0_8_4", + url = "https://crates.io/api/v1/crates/rand/0.8.4/download", + type = "tar.gz", + sha256 = "2e7573632e6454cf6b99d7aac4ccca54be06da05aca2ef7423d22d27d4d4bcd8", + strip_prefix = "rand-0.8.4", + build_file = Label("//cargo/remote:BUILD.rand-0.8.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand_chacha__0_2_2", + url = "https://crates.io/api/v1/crates/rand_chacha/0.2.2/download", + type = "tar.gz", + sha256 = "f4c8ed856279c9737206bf725bf36935d8666ead7aa69b52be55af369d193402", + strip_prefix = "rand_chacha-0.2.2", + build_file = Label("//cargo/remote:BUILD.rand_chacha-0.2.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand_chacha__0_3_1", + url = "https://crates.io/api/v1/crates/rand_chacha/0.3.1/download", + type = "tar.gz", + sha256 = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88", + strip_prefix = "rand_chacha-0.3.1", + build_file = Label("//cargo/remote:BUILD.rand_chacha-0.3.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand_core__0_5_1", + url = "https://crates.io/api/v1/crates/rand_core/0.5.1/download", + type = "tar.gz", + sha256 = "90bde5296fc891b0cef12a6d03ddccc162ce7b2aff54160af9338f8d40df6d19", + strip_prefix = "rand_core-0.5.1", + build_file = Label("//cargo/remote:BUILD.rand_core-0.5.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand_core__0_6_3", + url = "https://crates.io/api/v1/crates/rand_core/0.6.3/download", + type = "tar.gz", + sha256 = "d34f1408f55294453790c48b2f1ebbb1c5b4b7563eb1f418bcfcfdbb06ebb4e7", + strip_prefix = "rand_core-0.6.3", + build_file = Label("//cargo/remote:BUILD.rand_core-0.6.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand_hc__0_2_0", + url = "https://crates.io/api/v1/crates/rand_hc/0.2.0/download", + type = "tar.gz", + sha256 = "ca3129af7b92a17112d59ad498c6f81eaf463253766b90396d39ea7a39d6613c", + strip_prefix = "rand_hc-0.2.0", + build_file = Label("//cargo/remote:BUILD.rand_hc-0.2.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__rand_hc__0_3_1", + url = "https://crates.io/api/v1/crates/rand_hc/0.3.1/download", + type = "tar.gz", + sha256 = "d51e9f596de227fda2ea6c84607f5558e196eeaf43c986b724ba4fb8fdf497e7", + strip_prefix = "rand_hc-0.3.1", + build_file = Label("//cargo/remote:BUILD.rand_hc-0.3.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__redis__0_21_2", + url = "https://crates.io/api/v1/crates/redis/0.21.2/download", + type = "tar.gz", + sha256 = "202c5bf92cad3d57605c366e644a7fbf305a83f19754fc66678c6265dcc9b8b4", + strip_prefix = "redis-0.21.2", + build_file = Label("//cargo/remote:BUILD.redis-0.21.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__redox_syscall__0_2_10", + url = "https://crates.io/api/v1/crates/redox_syscall/0.2.10/download", + type = "tar.gz", + sha256 = "8383f39639269cde97d255a32bdb68c047337295414940c68bdd30c2e13203ff", + strip_prefix = "redox_syscall-0.2.10", + build_file = Label("//cargo/remote:BUILD.redox_syscall-0.2.10.bazel"), + ) + + maybe( + http_archive, + name = "raze__regex__1_5_4", + url = "https://crates.io/api/v1/crates/regex/1.5.4/download", + type = "tar.gz", + sha256 = "d07a8629359eb56f1e2fb1652bb04212c072a87ba68546a04065d525673ac461", + strip_prefix = "regex-1.5.4", + build_file = Label("//cargo/remote:BUILD.regex-1.5.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__regex_syntax__0_6_25", + url = "https://crates.io/api/v1/crates/regex-syntax/0.6.25/download", + type = "tar.gz", + sha256 = "f497285884f3fcff424ffc933e56d7cbca511def0c9831a7f9b5f6153e3cc89b", + strip_prefix = "regex-syntax-0.6.25", + build_file = Label("//cargo/remote:BUILD.regex-syntax-0.6.25.bazel"), + ) + + maybe( + http_archive, + name = "raze__remove_dir_all__0_5_3", + url = "https://crates.io/api/v1/crates/remove_dir_all/0.5.3/download", + type = "tar.gz", + sha256 = "3acd125665422973a33ac9d3dd2df85edad0f4ae9b00dafb1a05e43a9f5ef8e7", + strip_prefix = "remove_dir_all-0.5.3", + build_file = Label("//cargo/remote:BUILD.remove_dir_all-0.5.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__ring__0_16_20", + url = "https://crates.io/api/v1/crates/ring/0.16.20/download", + type = "tar.gz", + sha256 = "3053cf52e236a3ed746dfc745aa9cacf1b791d846bdaf412f60a8d7d6e17c8fc", + strip_prefix = "ring-0.16.20", + build_file = Label("//cargo/remote:BUILD.ring-0.16.20.bazel"), + ) + + maybe( + http_archive, + name = "raze__rust_ini__0_13_0", + url = "https://crates.io/api/v1/crates/rust-ini/0.13.0/download", + type = "tar.gz", + sha256 = "3e52c148ef37f8c375d49d5a73aa70713125b7f19095948a923f80afdeb22ec2", + strip_prefix = "rust-ini-0.13.0", + build_file = Label("//cargo/remote:BUILD.rust-ini-0.13.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__rustls__0_19_1", + url = "https://crates.io/api/v1/crates/rustls/0.19.1/download", + type = "tar.gz", + sha256 = "35edb675feee39aec9c99fa5ff985081995a06d594114ae14cbe797ad7b7a6d7", + strip_prefix = "rustls-0.19.1", + build_file = Label("//cargo/remote:BUILD.rustls-0.19.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__rustls_native_certs__0_5_0", + url = "https://crates.io/api/v1/crates/rustls-native-certs/0.5.0/download", + type = "tar.gz", + sha256 = "5a07b7c1885bd8ed3831c289b7870b13ef46fe0e856d288c30d9cc17d75a2092", + strip_prefix = "rustls-native-certs-0.5.0", + build_file = Label("//cargo/remote:BUILD.rustls-native-certs-0.5.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__ryu__1_0_5", + url = "https://crates.io/api/v1/crates/ryu/1.0.5/download", + type = "tar.gz", + sha256 = "71d301d4193d031abdd79ff7e3dd721168a9572ef3fe51a1517aba235bd8f86e", + strip_prefix = "ryu-1.0.5", + build_file = Label("//cargo/remote:BUILD.ryu-1.0.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__same_file__1_0_6", + url = "https://crates.io/api/v1/crates/same-file/1.0.6/download", + type = "tar.gz", + sha256 = "93fc1dc3aaa9bfed95e02e6eadabb4baf7e3078b0bd1b4d7b6b0b68378900502", + strip_prefix = "same-file-1.0.6", + build_file = Label("//cargo/remote:BUILD.same-file-1.0.6.bazel"), + ) + + maybe( + http_archive, + name = "raze__schannel__0_1_19", + url = "https://crates.io/api/v1/crates/schannel/0.1.19/download", + type = "tar.gz", + sha256 = "8f05ba609c234e60bee0d547fe94a4c7e9da733d1c962cf6e59efa4cd9c8bc75", + strip_prefix = "schannel-0.1.19", + build_file = Label("//cargo/remote:BUILD.schannel-0.1.19.bazel"), + ) + + maybe( + http_archive, + name = "raze__scopeguard__1_1_0", + url = "https://crates.io/api/v1/crates/scopeguard/1.1.0/download", + type = "tar.gz", + sha256 = "d29ab0c6d3fc0ee92fe66e2d99f700eab17a8d57d1c1d3b748380fb20baa78cd", + strip_prefix = "scopeguard-1.1.0", + build_file = Label("//cargo/remote:BUILD.scopeguard-1.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__sct__0_6_1", + url = "https://crates.io/api/v1/crates/sct/0.6.1/download", + type = "tar.gz", + sha256 = "b362b83898e0e69f38515b82ee15aa80636befe47c3b6d3d89a911e78fc228ce", + strip_prefix = "sct-0.6.1", + build_file = Label("//cargo/remote:BUILD.sct-0.6.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__security_framework__2_4_2", + url = "https://crates.io/api/v1/crates/security-framework/2.4.2/download", + type = "tar.gz", + sha256 = "525bc1abfda2e1998d152c45cf13e696f76d0a4972310b22fac1658b05df7c87", + strip_prefix = "security-framework-2.4.2", + build_file = Label("//cargo/remote:BUILD.security-framework-2.4.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__security_framework_sys__2_4_2", + url = "https://crates.io/api/v1/crates/security-framework-sys/2.4.2/download", + type = "tar.gz", + sha256 = "a9dd14d83160b528b7bfd66439110573efcfbe281b17fc2ca9f39f550d619c7e", + strip_prefix = "security-framework-sys-2.4.2", + build_file = Label("//cargo/remote:BUILD.security-framework-sys-2.4.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__serde__0_8_23", + url = "https://crates.io/api/v1/crates/serde/0.8.23/download", + type = "tar.gz", + sha256 = "9dad3f759919b92c3068c696c15c3d17238234498bbdcc80f2c469606f948ac8", + strip_prefix = "serde-0.8.23", + build_file = Label("//cargo/remote:BUILD.serde-0.8.23.bazel"), + ) + + maybe( + http_archive, + name = "raze__serde__1_0_130", + url = "https://crates.io/api/v1/crates/serde/1.0.130/download", + type = "tar.gz", + sha256 = "f12d06de37cf59146fbdecab66aa99f9fe4f78722e3607577a5375d66bd0c913", + strip_prefix = "serde-1.0.130", + build_file = Label("//cargo/remote:BUILD.serde-1.0.130.bazel"), + ) + + maybe( + http_archive, + name = "raze__serde_hjson__0_9_1", + url = "https://crates.io/api/v1/crates/serde-hjson/0.9.1/download", + type = "tar.gz", + sha256 = "6a3a4e0ea8a88553209f6cc6cfe8724ecad22e1acf372793c27d995290fe74f8", + strip_prefix = "serde-hjson-0.9.1", + build_file = Label("//cargo/remote:BUILD.serde-hjson-0.9.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__serde_derive__1_0_130", + url = "https://crates.io/api/v1/crates/serde_derive/1.0.130/download", + type = "tar.gz", + sha256 = "d7bc1a1ab1961464eae040d96713baa5a724a8152c1222492465b54322ec508b", + strip_prefix = "serde_derive-1.0.130", + build_file = Label("//cargo/remote:BUILD.serde_derive-1.0.130.bazel"), + ) + + maybe( + http_archive, + name = "raze__serde_json__1_0_67", + url = "https://crates.io/api/v1/crates/serde_json/1.0.67/download", + type = "tar.gz", + sha256 = "a7f9e390c27c3c0ce8bc5d725f6e4d30a29d26659494aa4b17535f7522c5c950", + strip_prefix = "serde_json-1.0.67", + build_file = Label("//cargo/remote:BUILD.serde_json-1.0.67.bazel"), + ) + + maybe( + http_archive, + name = "raze__serde_repr__0_1_7", + url = "https://crates.io/api/v1/crates/serde_repr/0.1.7/download", + type = "tar.gz", + sha256 = "98d0516900518c29efa217c298fa1f4e6c6ffc85ae29fd7f4ee48f176e1a9ed5", + strip_prefix = "serde_repr-0.1.7", + build_file = Label("//cargo/remote:BUILD.serde_repr-0.1.7.bazel"), + ) + + maybe( + http_archive, + name = "raze__sha_1__0_9_8", + url = "https://crates.io/api/v1/crates/sha-1/0.9.8/download", + type = "tar.gz", + sha256 = "99cd6713db3cf16b6c84e06321e049a9b9f699826e16096d23bbcc44d15d51a6", + strip_prefix = "sha-1-0.9.8", + build_file = Label("//cargo/remote:BUILD.sha-1-0.9.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__sha1__0_6_0", + url = "https://crates.io/api/v1/crates/sha1/0.6.0/download", + type = "tar.gz", + sha256 = "2579985fda508104f7587689507983eadd6a6e84dd35d6d115361f530916fa0d", + strip_prefix = "sha1-0.6.0", + build_file = Label("//cargo/remote:BUILD.sha1-0.6.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__sha2__0_9_6", + url = "https://crates.io/api/v1/crates/sha2/0.9.6/download", + type = "tar.gz", + sha256 = "9204c41a1597a8c5af23c82d1c921cb01ec0a4c59e07a9c7306062829a3903f3", + strip_prefix = "sha2-0.9.6", + build_file = Label("//cargo/remote:BUILD.sha2-0.9.6.bazel"), + ) + + maybe( + http_archive, + name = "raze__signal_hook_registry__1_4_0", + url = "https://crates.io/api/v1/crates/signal-hook-registry/1.4.0/download", + type = "tar.gz", + sha256 = "e51e73328dc4ac0c7ccbda3a494dfa03df1de2f46018127f60c693f2648455b0", + strip_prefix = "signal-hook-registry-1.4.0", + build_file = Label("//cargo/remote:BUILD.signal-hook-registry-1.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__signatory__0_21_0", + url = "https://crates.io/api/v1/crates/signatory/0.21.0/download", + type = "tar.gz", + sha256 = "9eaebd4be561a7d8148803baa108092f85090189c4b8c3ffb81602b15b5c1771", + strip_prefix = "signatory-0.21.0", + build_file = Label("//cargo/remote:BUILD.signatory-0.21.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__signature__1_3_1", + url = "https://crates.io/api/v1/crates/signature/1.3.1/download", + type = "tar.gz", + sha256 = "c19772be3c4dd2ceaacf03cb41d5885f2a02c4d8804884918e3a258480803335", + strip_prefix = "signature-1.3.1", + build_file = Label("//cargo/remote:BUILD.signature-1.3.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__slab__0_4_4", + url = "https://crates.io/api/v1/crates/slab/0.4.4/download", + type = "tar.gz", + sha256 = "c307a32c1c5c437f38c7fd45d753050587732ba8628319fbdf12a7e289ccc590", + strip_prefix = "slab-0.4.4", + build_file = Label("//cargo/remote:BUILD.slab-0.4.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__smallvec__1_6_1", + url = "https://crates.io/api/v1/crates/smallvec/1.6.1/download", + type = "tar.gz", + sha256 = "fe0f37c9e8f3c5a4a66ad655a93c74daac4ad00c441533bf5c6e7990bb42604e", + strip_prefix = "smallvec-1.6.1", + build_file = Label("//cargo/remote:BUILD.smallvec-1.6.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__socket2__0_4_1", + url = "https://crates.io/api/v1/crates/socket2/0.4.1/download", + type = "tar.gz", + sha256 = "765f090f0e423d2b55843402a07915add955e7d60657db13707a159727326cad", + strip_prefix = "socket2-0.4.1", + build_file = Label("//cargo/remote:BUILD.socket2-0.4.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__spin__0_5_2", + url = "https://crates.io/api/v1/crates/spin/0.5.2/download", + type = "tar.gz", + sha256 = "6e63cff320ae2c57904679ba7cb63280a3dc4613885beafb148ee7bf9aa9042d", + strip_prefix = "spin-0.5.2", + build_file = Label("//cargo/remote:BUILD.spin-0.5.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__static_assertions__1_1_0", + url = "https://crates.io/api/v1/crates/static_assertions/1.1.0/download", + type = "tar.gz", + sha256 = "a2eb9349b6444b326872e140eb1cf5e7c522154d69e7a0ffb0fb81c06b37543f", + strip_prefix = "static_assertions-1.1.0", + build_file = Label("//cargo/remote:BUILD.static_assertions-1.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__subtle__2_4_1", + url = "https://crates.io/api/v1/crates/subtle/2.4.1/download", + type = "tar.gz", + sha256 = "6bdef32e8150c2a081110b42772ffe7d7c9032b606bc226c8260fd97e0976601", + strip_prefix = "subtle-2.4.1", + build_file = Label("//cargo/remote:BUILD.subtle-2.4.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__subtle_encoding__0_5_1", + url = "https://crates.io/api/v1/crates/subtle-encoding/0.5.1/download", + type = "tar.gz", + sha256 = "7dcb1ed7b8330c5eed5441052651dd7a12c75e2ed88f2ec024ae1fa3a5e59945", + strip_prefix = "subtle-encoding-0.5.1", + build_file = Label("//cargo/remote:BUILD.subtle-encoding-0.5.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__syn__1_0_76", + url = "https://crates.io/api/v1/crates/syn/1.0.76/download", + type = "tar.gz", + sha256 = "c6f107db402c2c2055242dbf4d2af0e69197202e9faacbef9571bbe47f5a1b84", + strip_prefix = "syn-1.0.76", + build_file = Label("//cargo/remote:BUILD.syn-1.0.76.bazel"), + ) + + maybe( + http_archive, + name = "raze__synstructure__0_12_5", + url = "https://crates.io/api/v1/crates/synstructure/0.12.5/download", + type = "tar.gz", + sha256 = "474aaa926faa1603c40b7885a9eaea29b444d1cb2850cb7c0e37bb1a4182f4fa", + strip_prefix = "synstructure-0.12.5", + build_file = Label("//cargo/remote:BUILD.synstructure-0.12.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__tempfile__3_2_0", + url = "https://crates.io/api/v1/crates/tempfile/3.2.0/download", + type = "tar.gz", + sha256 = "dac1c663cfc93810f88aed9b8941d48cabf856a1b111c29a40439018d870eb22", + strip_prefix = "tempfile-3.2.0", + build_file = Label("//cargo/remote:BUILD.tempfile-3.2.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__termcolor__1_1_2", + url = "https://crates.io/api/v1/crates/termcolor/1.1.2/download", + type = "tar.gz", + sha256 = "2dfed899f0eb03f32ee8c6a0aabdb8a7949659e3466561fc0adf54e26d88c5f4", + strip_prefix = "termcolor-1.1.2", + build_file = Label("//cargo/remote:BUILD.termcolor-1.1.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__thiserror__1_0_29", + url = "https://crates.io/api/v1/crates/thiserror/1.0.29/download", + type = "tar.gz", + sha256 = "602eca064b2d83369e2b2f34b09c70b605402801927c65c11071ac911d299b88", + strip_prefix = "thiserror-1.0.29", + build_file = Label("//cargo/remote:BUILD.thiserror-1.0.29.bazel"), + ) + + maybe( + http_archive, + name = "raze__thiserror_impl__1_0_29", + url = "https://crates.io/api/v1/crates/thiserror-impl/1.0.29/download", + type = "tar.gz", + sha256 = "bad553cc2c78e8de258400763a647e80e6d1b31ee237275d756f6836d204494c", + strip_prefix = "thiserror-impl-1.0.29", + build_file = Label("//cargo/remote:BUILD.thiserror-impl-1.0.29.bazel"), + ) + + maybe( + http_archive, + name = "raze__time__0_1_44", + url = "https://crates.io/api/v1/crates/time/0.1.44/download", + type = "tar.gz", + sha256 = "6db9e6914ab8b1ae1c260a4ae7a49b6c5611b40328a735b21862567685e73255", + strip_prefix = "time-0.1.44", + build_file = Label("//cargo/remote:BUILD.time-0.1.44.bazel"), + ) + + maybe( + http_archive, + name = "raze__tinyvec__1_3_1", + url = "https://crates.io/api/v1/crates/tinyvec/1.3.1/download", + type = "tar.gz", + sha256 = "848a1e1181b9f6753b5e96a092749e29b11d19ede67dfbbd6c7dc7e0f49b5338", + strip_prefix = "tinyvec-1.3.1", + build_file = Label("//cargo/remote:BUILD.tinyvec-1.3.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__tinyvec_macros__0_1_0", + url = "https://crates.io/api/v1/crates/tinyvec_macros/0.1.0/download", + type = "tar.gz", + sha256 = "cda74da7e1a664f795bb1f8a87ec406fb89a02522cf6e50620d016add6dbbf5c", + strip_prefix = "tinyvec_macros-0.1.0", + build_file = Label("//cargo/remote:BUILD.tinyvec_macros-0.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__tokio__1_11_0", + url = "https://crates.io/api/v1/crates/tokio/1.11.0/download", + type = "tar.gz", + sha256 = "b4efe6fc2395938c8155973d7be49fe8d03a843726e285e100a8a383cc0154ce", + strip_prefix = "tokio-1.11.0", + build_file = Label("//cargo/remote:BUILD.tokio-1.11.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__tokio_io_timeout__1_1_1", + url = "https://crates.io/api/v1/crates/tokio-io-timeout/1.1.1/download", + type = "tar.gz", + sha256 = "90c49f106be240de154571dd31fbe48acb10ba6c6dd6f6517ad603abffa42de9", + strip_prefix = "tokio-io-timeout-1.1.1", + build_file = Label("//cargo/remote:BUILD.tokio-io-timeout-1.1.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__tokio_macros__1_3_0", + url = "https://crates.io/api/v1/crates/tokio-macros/1.3.0/download", + type = "tar.gz", + sha256 = "54473be61f4ebe4efd09cec9bd5d16fa51d70ea0192213d754d2d500457db110", + strip_prefix = "tokio-macros-1.3.0", + build_file = Label("//cargo/remote:BUILD.tokio-macros-1.3.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__tokio_rustls__0_22_0", + url = "https://crates.io/api/v1/crates/tokio-rustls/0.22.0/download", + type = "tar.gz", + sha256 = "bc6844de72e57df1980054b38be3a9f4702aba4858be64dd700181a8a6d0e1b6", + strip_prefix = "tokio-rustls-0.22.0", + build_file = Label("//cargo/remote:BUILD.tokio-rustls-0.22.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__tokio_stream__0_1_7", + url = "https://crates.io/api/v1/crates/tokio-stream/0.1.7/download", + type = "tar.gz", + sha256 = "7b2f3f698253f03119ac0102beaa64f67a67e08074d03a22d18784104543727f", + strip_prefix = "tokio-stream-0.1.7", + build_file = Label("//cargo/remote:BUILD.tokio-stream-0.1.7.bazel"), + ) + + maybe( + http_archive, + name = "raze__tokio_tungstenite__0_15_0", + url = "https://crates.io/api/v1/crates/tokio-tungstenite/0.15.0/download", + type = "tar.gz", + sha256 = "511de3f85caf1c98983545490c3d09685fa8eb634e57eec22bb4db271f46cbd8", + strip_prefix = "tokio-tungstenite-0.15.0", + build_file = Label("//cargo/remote:BUILD.tokio-tungstenite-0.15.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__tokio_util__0_6_8", + url = "https://crates.io/api/v1/crates/tokio-util/0.6.8/download", + type = "tar.gz", + sha256 = "08d3725d3efa29485e87311c5b699de63cde14b00ed4d256b8318aa30ca452cd", + strip_prefix = "tokio-util-0.6.8", + build_file = Label("//cargo/remote:BUILD.tokio-util-0.6.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__toml__0_5_8", + url = "https://crates.io/api/v1/crates/toml/0.5.8/download", + type = "tar.gz", + sha256 = "a31142970826733df8241ef35dc040ef98c679ab14d7c3e54d827099b3acecaa", + strip_prefix = "toml-0.5.8", + build_file = Label("//cargo/remote:BUILD.toml-0.5.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__tonic__0_5_2", + url = "https://crates.io/api/v1/crates/tonic/0.5.2/download", + type = "tar.gz", + sha256 = "796c5e1cd49905e65dd8e700d4cb1dffcbfdb4fc9d017de08c1a537afd83627c", + strip_prefix = "tonic-0.5.2", + build_file = Label("//cargo/remote:BUILD.tonic-0.5.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__tonic_build__0_5_2", + url = "https://crates.io/api/v1/crates/tonic-build/0.5.2/download", + type = "tar.gz", + sha256 = "12b52d07035516c2b74337d2ac7746075e7dcae7643816c1b12c5ff8a7484c08", + strip_prefix = "tonic-build-0.5.2", + build_file = Label("//cargo/remote:BUILD.tonic-build-0.5.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__tower__0_4_8", + url = "https://crates.io/api/v1/crates/tower/0.4.8/download", + type = "tar.gz", + sha256 = "f60422bc7fefa2f3ec70359b8ff1caff59d785877eb70595904605bcc412470f", + strip_prefix = "tower-0.4.8", + build_file = Label("//cargo/remote:BUILD.tower-0.4.8.bazel"), + ) + + maybe( + http_archive, + name = "raze__tower_layer__0_3_1", + url = "https://crates.io/api/v1/crates/tower-layer/0.3.1/download", + type = "tar.gz", + sha256 = "343bc9466d3fe6b0f960ef45960509f84480bf4fd96f92901afe7ff3df9d3a62", + strip_prefix = "tower-layer-0.3.1", + build_file = Label("//cargo/remote:BUILD.tower-layer-0.3.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__tower_service__0_3_1", + url = "https://crates.io/api/v1/crates/tower-service/0.3.1/download", + type = "tar.gz", + sha256 = "360dfd1d6d30e05fda32ace2c8c70e9c0a9da713275777f5a4dbb8a1893930c6", + strip_prefix = "tower-service-0.3.1", + build_file = Label("//cargo/remote:BUILD.tower-service-0.3.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__tracing__0_1_26", + url = "https://crates.io/api/v1/crates/tracing/0.1.26/download", + type = "tar.gz", + sha256 = "09adeb8c97449311ccd28a427f96fb563e7fd31aabf994189879d9da2394b89d", + strip_prefix = "tracing-0.1.26", + build_file = Label("//cargo/remote:BUILD.tracing-0.1.26.bazel"), + ) + + maybe( + http_archive, + name = "raze__tracing_attributes__0_1_15", + url = "https://crates.io/api/v1/crates/tracing-attributes/0.1.15/download", + type = "tar.gz", + sha256 = "c42e6fa53307c8a17e4ccd4dc81cf5ec38db9209f59b222210375b54ee40d1e2", + strip_prefix = "tracing-attributes-0.1.15", + build_file = Label("//cargo/remote:BUILD.tracing-attributes-0.1.15.bazel"), + ) + + maybe( + http_archive, + name = "raze__tracing_core__0_1_19", + url = "https://crates.io/api/v1/crates/tracing-core/0.1.19/download", + type = "tar.gz", + sha256 = "2ca517f43f0fb96e0c3072ed5c275fe5eece87e8cb52f4a77b69226d3b1c9df8", + strip_prefix = "tracing-core-0.1.19", + build_file = Label("//cargo/remote:BUILD.tracing-core-0.1.19.bazel"), + ) + + maybe( + http_archive, + name = "raze__tracing_futures__0_2_5", + url = "https://crates.io/api/v1/crates/tracing-futures/0.2.5/download", + type = "tar.gz", + sha256 = "97d095ae15e245a057c8e8451bab9b3ee1e1f68e9ba2b4fbc18d0ac5237835f2", + strip_prefix = "tracing-futures-0.2.5", + build_file = Label("//cargo/remote:BUILD.tracing-futures-0.2.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__try_lock__0_2_3", + url = "https://crates.io/api/v1/crates/try-lock/0.2.3/download", + type = "tar.gz", + sha256 = "59547bce71d9c38b83d9c0e92b6066c4253371f15005def0c30d9657f50c7642", + strip_prefix = "try-lock-0.2.3", + build_file = Label("//cargo/remote:BUILD.try-lock-0.2.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__tungstenite__0_14_0", + url = "https://crates.io/api/v1/crates/tungstenite/0.14.0/download", + type = "tar.gz", + sha256 = "a0b2d8558abd2e276b0a8df5c05a2ec762609344191e5fd23e292c910e9165b5", + strip_prefix = "tungstenite-0.14.0", + build_file = Label("//cargo/remote:BUILD.tungstenite-0.14.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__typenum__1_14_0", + url = "https://crates.io/api/v1/crates/typenum/1.14.0/download", + type = "tar.gz", + sha256 = "b63708a265f51345575b27fe43f9500ad611579e764c79edbc2037b1121959ec", + strip_prefix = "typenum-1.14.0", + build_file = Label("//cargo/remote:BUILD.typenum-1.14.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__unicode_bidi__0_3_6", + url = "https://crates.io/api/v1/crates/unicode-bidi/0.3.6/download", + type = "tar.gz", + sha256 = "246f4c42e67e7a4e3c6106ff716a5d067d4132a642840b242e357e468a2a0085", + strip_prefix = "unicode-bidi-0.3.6", + build_file = Label("//cargo/remote:BUILD.unicode-bidi-0.3.6.bazel"), + ) + + maybe( + http_archive, + name = "raze__unicode_normalization__0_1_19", + url = "https://crates.io/api/v1/crates/unicode-normalization/0.1.19/download", + type = "tar.gz", + sha256 = "d54590932941a9e9266f0832deed84ebe1bf2e4c9e4a3554d393d18f5e854bf9", + strip_prefix = "unicode-normalization-0.1.19", + build_file = Label("//cargo/remote:BUILD.unicode-normalization-0.1.19.bazel"), + ) + + maybe( + http_archive, + name = "raze__unicode_segmentation__1_8_0", + url = "https://crates.io/api/v1/crates/unicode-segmentation/1.8.0/download", + type = "tar.gz", + sha256 = "8895849a949e7845e06bd6dc1aa51731a103c42707010a5b591c0038fb73385b", + strip_prefix = "unicode-segmentation-1.8.0", + build_file = Label("//cargo/remote:BUILD.unicode-segmentation-1.8.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__unicode_xid__0_2_2", + url = "https://crates.io/api/v1/crates/unicode-xid/0.2.2/download", + type = "tar.gz", + sha256 = "8ccb82d61f80a663efe1f787a51b16b5a51e3314d6ac365b08639f52387b33f3", + strip_prefix = "unicode-xid-0.2.2", + build_file = Label("//cargo/remote:BUILD.unicode-xid-0.2.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__untrusted__0_7_1", + url = "https://crates.io/api/v1/crates/untrusted/0.7.1/download", + type = "tar.gz", + sha256 = "a156c684c91ea7d62626509bce3cb4e1d9ed5c4d978f7b4352658f96a4c26b4a", + strip_prefix = "untrusted-0.7.1", + build_file = Label("//cargo/remote:BUILD.untrusted-0.7.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__url__2_2_2", + url = "https://crates.io/api/v1/crates/url/2.2.2/download", + type = "tar.gz", + sha256 = "a507c383b2d33b5fc35d1861e77e6b383d158b2da5e14fe51b83dfedf6fd578c", + strip_prefix = "url-2.2.2", + build_file = Label("//cargo/remote:BUILD.url-2.2.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__utf_8__0_7_6", + url = "https://crates.io/api/v1/crates/utf-8/0.7.6/download", + type = "tar.gz", + sha256 = "09cc8ee72d2a9becf2f2febe0205bbed8fc6615b7cb429ad062dc7b7ddd036a9", + strip_prefix = "utf-8-0.7.6", + build_file = Label("//cargo/remote:BUILD.utf-8-0.7.6.bazel"), + ) + + maybe( + http_archive, + name = "raze__version_check__0_9_3", + url = "https://crates.io/api/v1/crates/version_check/0.9.3/download", + type = "tar.gz", + sha256 = "5fecdca9a5291cc2b8dcf7dc02453fee791a280f3743cb0905f8822ae463b3fe", + strip_prefix = "version_check-0.9.3", + build_file = Label("//cargo/remote:BUILD.version_check-0.9.3.bazel"), + ) + + maybe( + http_archive, + name = "raze__waker_fn__1_1_0", + url = "https://crates.io/api/v1/crates/waker-fn/1.1.0/download", + type = "tar.gz", + sha256 = "9d5b2c62b4012a3e1eca5a7e077d13b3bf498c4073e33ccd58626607748ceeca", + strip_prefix = "waker-fn-1.1.0", + build_file = Label("//cargo/remote:BUILD.waker-fn-1.1.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__walkdir__2_3_2", + url = "https://crates.io/api/v1/crates/walkdir/2.3.2/download", + type = "tar.gz", + sha256 = "808cf2735cd4b6866113f648b791c6adc5714537bc222d9347bb203386ffda56", + strip_prefix = "walkdir-2.3.2", + build_file = Label("//cargo/remote:BUILD.walkdir-2.3.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__want__0_3_0", + url = "https://crates.io/api/v1/crates/want/0.3.0/download", + type = "tar.gz", + sha256 = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0", + strip_prefix = "want-0.3.0", + build_file = Label("//cargo/remote:BUILD.want-0.3.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__wasi__0_10_0_wasi_snapshot_preview1", + url = "https://crates.io/api/v1/crates/wasi/0.10.0+wasi-snapshot-preview1/download", + type = "tar.gz", + sha256 = "1a143597ca7c7793eff794def352d41792a93c481eb1042423ff7ff72ba2c31f", + strip_prefix = "wasi-0.10.0+wasi-snapshot-preview1", + build_file = Label("//cargo/remote:BUILD.wasi-0.10.0+wasi-snapshot-preview1.bazel"), + ) + + maybe( + http_archive, + name = "raze__wasi__0_9_0_wasi_snapshot_preview1", + url = "https://crates.io/api/v1/crates/wasi/0.9.0+wasi-snapshot-preview1/download", + type = "tar.gz", + sha256 = "cccddf32554fecc6acb585f82a32a72e28b48f8c4c1883ddfeeeaa96f7d8e519", + strip_prefix = "wasi-0.9.0+wasi-snapshot-preview1", + build_file = Label("//cargo/remote:BUILD.wasi-0.9.0+wasi-snapshot-preview1.bazel"), + ) + + maybe( + http_archive, + name = "raze__wasm_bindgen__0_2_76", + url = "https://crates.io/api/v1/crates/wasm-bindgen/0.2.76/download", + type = "tar.gz", + sha256 = "8ce9b1b516211d33767048e5d47fa2a381ed8b76fc48d2ce4aa39877f9f183e0", + strip_prefix = "wasm-bindgen-0.2.76", + build_file = Label("//cargo/remote:BUILD.wasm-bindgen-0.2.76.bazel"), + ) + + maybe( + http_archive, + name = "raze__wasm_bindgen_backend__0_2_76", + url = "https://crates.io/api/v1/crates/wasm-bindgen-backend/0.2.76/download", + type = "tar.gz", + sha256 = "cfe8dc78e2326ba5f845f4b5bf548401604fa20b1dd1d365fb73b6c1d6364041", + strip_prefix = "wasm-bindgen-backend-0.2.76", + build_file = Label("//cargo/remote:BUILD.wasm-bindgen-backend-0.2.76.bazel"), + ) + + maybe( + http_archive, + name = "raze__wasm_bindgen_macro__0_2_76", + url = "https://crates.io/api/v1/crates/wasm-bindgen-macro/0.2.76/download", + type = "tar.gz", + sha256 = "44468aa53335841d9d6b6c023eaab07c0cd4bddbcfdee3e2bb1e8d2cb8069fef", + strip_prefix = "wasm-bindgen-macro-0.2.76", + build_file = Label("//cargo/remote:BUILD.wasm-bindgen-macro-0.2.76.bazel"), + ) + + maybe( + http_archive, + name = "raze__wasm_bindgen_macro_support__0_2_76", + url = "https://crates.io/api/v1/crates/wasm-bindgen-macro-support/0.2.76/download", + type = "tar.gz", + sha256 = "0195807922713af1e67dc66132c7328206ed9766af3858164fb583eedc25fbad", + strip_prefix = "wasm-bindgen-macro-support-0.2.76", + build_file = Label("//cargo/remote:BUILD.wasm-bindgen-macro-support-0.2.76.bazel"), + ) + + maybe( + http_archive, + name = "raze__wasm_bindgen_shared__0_2_76", + url = "https://crates.io/api/v1/crates/wasm-bindgen-shared/0.2.76/download", + type = "tar.gz", + sha256 = "acdb075a845574a1fa5f09fd77e43f7747599301ea3417a9fbffdeedfc1f4a29", + strip_prefix = "wasm-bindgen-shared-0.2.76", + build_file = Label("//cargo/remote:BUILD.wasm-bindgen-shared-0.2.76.bazel"), + ) + + maybe( + http_archive, + name = "raze__web_sys__0_3_53", + url = "https://crates.io/api/v1/crates/web-sys/0.3.53/download", + type = "tar.gz", + sha256 = "224b2f6b67919060055ef1a67807367c2066ed520c3862cc013d26cf893a783c", + strip_prefix = "web-sys-0.3.53", + build_file = Label("//cargo/remote:BUILD.web-sys-0.3.53.bazel"), + ) + + maybe( + http_archive, + name = "raze__webpki__0_21_4", + url = "https://crates.io/api/v1/crates/webpki/0.21.4/download", + type = "tar.gz", + sha256 = "b8e38c0608262c46d4a56202ebabdeb094cef7e560ca7a226c6bf055188aa4ea", + strip_prefix = "webpki-0.21.4", + build_file = Label("//cargo/remote:BUILD.webpki-0.21.4.bazel"), + ) + + maybe( + http_archive, + name = "raze__webpki_roots__0_21_1", + url = "https://crates.io/api/v1/crates/webpki-roots/0.21.1/download", + type = "tar.gz", + sha256 = "aabe153544e473b775453675851ecc86863d2a81d786d741f6b76778f2a48940", + strip_prefix = "webpki-roots-0.21.1", + build_file = Label("//cargo/remote:BUILD.webpki-roots-0.21.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__which__4_2_2", + url = "https://crates.io/api/v1/crates/which/4.2.2/download", + type = "tar.gz", + sha256 = "ea187a8ef279bc014ec368c27a920da2024d2a711109bfbe3440585d5cf27ad9", + strip_prefix = "which-4.2.2", + build_file = Label("//cargo/remote:BUILD.which-4.2.2.bazel"), + ) + + maybe( + http_archive, + name = "raze__winapi__0_3_9", + url = "https://crates.io/api/v1/crates/winapi/0.3.9/download", + type = "tar.gz", + sha256 = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419", + strip_prefix = "winapi-0.3.9", + build_file = Label("//cargo/remote:BUILD.winapi-0.3.9.bazel"), + ) + + maybe( + http_archive, + name = "raze__winapi_i686_pc_windows_gnu__0_4_0", + url = "https://crates.io/api/v1/crates/winapi-i686-pc-windows-gnu/0.4.0/download", + type = "tar.gz", + sha256 = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6", + strip_prefix = "winapi-i686-pc-windows-gnu-0.4.0", + build_file = Label("//cargo/remote:BUILD.winapi-i686-pc-windows-gnu-0.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__winapi_util__0_1_5", + url = "https://crates.io/api/v1/crates/winapi-util/0.1.5/download", + type = "tar.gz", + sha256 = "70ec6ce85bb158151cae5e5c87f95a8e97d2c0c4b001223f33a334e3ce5de178", + strip_prefix = "winapi-util-0.1.5", + build_file = Label("//cargo/remote:BUILD.winapi-util-0.1.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__winapi_x86_64_pc_windows_gnu__0_4_0", + url = "https://crates.io/api/v1/crates/winapi-x86_64-pc-windows-gnu/0.4.0/download", + type = "tar.gz", + sha256 = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f", + strip_prefix = "winapi-x86_64-pc-windows-gnu-0.4.0", + build_file = Label("//cargo/remote:BUILD.winapi-x86_64-pc-windows-gnu-0.4.0.bazel"), + ) + + maybe( + http_archive, + name = "raze__yaml_rust__0_4_5", + url = "https://crates.io/api/v1/crates/yaml-rust/0.4.5/download", + type = "tar.gz", + sha256 = "56c1936c4cc7a1c9ab21a1ebb602eb942ba868cbd44a99cb7cdc5892335e1c85", + strip_prefix = "yaml-rust-0.4.5", + build_file = Label("//cargo/remote:BUILD.yaml-rust-0.4.5.bazel"), + ) + + maybe( + http_archive, + name = "raze__zeroize__1_4_1", + url = "https://crates.io/api/v1/crates/zeroize/1.4.1/download", + type = "tar.gz", + sha256 = "377db0846015f7ae377174787dd452e1c5f5a9050bc6f954911d01f116daa0cd", + strip_prefix = "zeroize-1.4.1", + build_file = Label("//cargo/remote:BUILD.zeroize-1.4.1.bazel"), + ) + + maybe( + http_archive, + name = "raze__zeroize_derive__1_1_0", + url = "https://crates.io/api/v1/crates/zeroize_derive/1.1.0/download", + type = "tar.gz", + sha256 = "a2c1e130bebaeab2f23886bf9acbaca14b092408c452543c857f66399cd6dab1", + strip_prefix = "zeroize_derive-1.1.0", + build_file = Label("//cargo/remote:BUILD.zeroize_derive-1.1.0.bazel"), + ) diff --git a/cargo/remote/BUILD.aho-corasick-0.7.18.bazel b/cargo/remote/BUILD.aho-corasick-0.7.18.bazel new file mode 100644 index 0000000..9281fdc --- /dev/null +++ b/cargo/remote/BUILD.aho-corasick-0.7.18.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "unencumbered", # Unlicense from expression "Unlicense OR MIT" +]) + +# Generated Targets + +rust_library( + name = "aho_corasick", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.18", + # buildifier: leave-alone + deps = [ + "@raze__memchr__2_4_1//:memchr", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.anyhow-1.0.42.bazel b/cargo/remote/BUILD.anyhow-1.0.43.bazel index 44213d9..65e94d6 100644 --- a/ratelimiter/cargo/remote/BUILD.anyhow-1.0.42.bazel +++ b/cargo/remote/BUILD.anyhow-1.0.43.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -55,7 +55,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "1.0.42", + version = "1.0.43", visibility = ["//visibility:private"], deps = [ ], @@ -79,7 +79,7 @@ rust_library( "cargo-raze", "manual", ], - version = "1.0.42", + version = "1.0.43", # buildifier: leave-alone deps = [ ":anyhow_build_script", diff --git a/cargo/remote/BUILD.arrayvec-0.5.2.bazel b/cargo/remote/BUILD.arrayvec-0.5.2.bazel new file mode 100644 index 0000000..d0c7099 --- /dev/null +++ b/cargo/remote/BUILD.arrayvec-0.5.2.bazel @@ -0,0 +1,62 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "arraystring" with type "bench" omitted + +# Unsupported target "extend" with type "bench" omitted + +rust_library( + name = "arrayvec", + srcs = glob(["**/*.rs"]), + crate_features = [ + "array-sizes-33-128", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.2", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "serde" with type "test" omitted + +# Unsupported target "tests" with type "test" omitted diff --git a/cargo/remote/BUILD.async-channel-1.6.1.bazel b/cargo/remote/BUILD.async-channel-1.6.1.bazel new file mode 100644 index 0000000..b06a8e5 --- /dev/null +++ b/cargo/remote/BUILD.async-channel-1.6.1.bazel @@ -0,0 +1,60 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "async_channel", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.6.1", + # buildifier: leave-alone + deps = [ + "@raze__concurrent_queue__1_2_2//:concurrent_queue", + "@raze__event_listener__2_5_1//:event_listener", + "@raze__futures_core__0_3_17//:futures_core", + ], +) + +# Unsupported target "bounded" with type "test" omitted + +# Unsupported target "unbounded" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.async-stream-0.3.2.bazel b/cargo/remote/BUILD.async-stream-0.3.2.bazel index 7ee01d1..bfffc1a 100644 --- a/ratelimiter/cargo/remote/BUILD.async-stream-0.3.2.bazel +++ b/cargo/remote/BUILD.async-stream-0.3.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -54,7 +54,7 @@ rust_library( version = "0.3.2", # buildifier: leave-alone deps = [ - "@raze__futures_core__0_3_16//:futures_core", + "@raze__futures_core__0_3_17//:futures_core", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.async-stream-impl-0.3.2.bazel b/cargo/remote/BUILD.async-stream-impl-0.3.2.bazel index e8023d3..1db7cf6 100644 --- a/ratelimiter/cargo/remote/BUILD.async-stream-impl-0.3.2.bazel +++ b/cargo/remote/BUILD.async-stream-impl-0.3.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -49,8 +49,8 @@ rust_library( version = "0.3.2", # buildifier: leave-alone deps = [ - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__quote__1_0_9//:quote", - "@raze__syn__1_0_74//:syn", + "@raze__syn__1_0_76//:syn", ], ) diff --git a/cargo/remote/BUILD.async-task-4.0.3.bazel b/cargo/remote/BUILD.async-task-4.0.3.bazel new file mode 100644 index 0000000..76cc6f2 --- /dev/null +++ b/cargo/remote/BUILD.async-task-4.0.3.bazel @@ -0,0 +1,79 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +# Unsupported target "spawn" with type "bench" omitted + +# Unsupported target "spawn" with type "example" omitted + +# Unsupported target "spawn-local" with type "example" omitted + +# Unsupported target "spawn-on-thread" with type "example" omitted + +rust_library( + name = "async_task", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "4.0.3", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "basic" with type "test" omitted + +# Unsupported target "cancel" with type "test" omitted + +# Unsupported target "join" with type "test" omitted + +# Unsupported target "panic" with type "test" omitted + +# Unsupported target "ready" with type "test" omitted + +# Unsupported target "waker_panic" with type "test" omitted + +# Unsupported target "waker_pending" with type "test" omitted + +# Unsupported target "waker_ready" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.async-trait-0.1.51.bazel b/cargo/remote/BUILD.async-trait-0.1.51.bazel index 6e70425..7d20725 100644 --- a/ratelimiter/cargo/remote/BUILD.async-trait-0.1.51.bazel +++ b/cargo/remote/BUILD.async-trait-0.1.51.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -79,9 +79,9 @@ rust_library( # buildifier: leave-alone deps = [ ":async_trait_build_script", - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__quote__1_0_9//:quote", - "@raze__syn__1_0_74//:syn", + "@raze__syn__1_0_76//:syn", ], ) diff --git a/cargo/remote/BUILD.atomic-waker-1.0.0.bazel b/cargo/remote/BUILD.atomic-waker-1.0.0.bazel new file mode 100644 index 0000000..069765f --- /dev/null +++ b/cargo/remote/BUILD.atomic-waker-1.0.0.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "atomic_waker", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.0", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "basic" with type "test" omitted diff --git a/cargo/remote/BUILD.atty-0.2.14.bazel b/cargo/remote/BUILD.atty-0.2.14.bazel new file mode 100644 index 0000000..2ee1f01 --- /dev/null +++ b/cargo/remote/BUILD.atty-0.2.14.bazel @@ -0,0 +1,89 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +# Unsupported target "atty" with type "example" omitted + +rust_library( + name = "atty", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.14", + # buildifier: leave-alone + deps = [ + ] + selects.with_or({ + # cfg(unix) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + ], + "//conditions:default": [], + }), +) diff --git a/ratelimiter/cargo/remote/BUILD.autocfg-1.0.1.bazel b/cargo/remote/BUILD.autocfg-1.0.1.bazel index 08c749f..57b1043 100644 --- a/ratelimiter/cargo/remote/BUILD.autocfg-1.0.1.bazel +++ b/cargo/remote/BUILD.autocfg-1.0.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.base64-0.13.0.bazel b/cargo/remote/BUILD.base64-0.13.0.bazel index 12f2331..775e92b 100644 --- a/ratelimiter/cargo/remote/BUILD.base64-0.13.0.bazel +++ b/cargo/remote/BUILD.base64-0.13.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.base64-url-1.4.10.bazel b/cargo/remote/BUILD.base64-url-1.4.10.bazel new file mode 100644 index 0000000..3981181 --- /dev/null +++ b/cargo/remote/BUILD.base64-url-1.4.10.bazel @@ -0,0 +1,54 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +rust_library( + name = "base64_url", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.4.10", + # buildifier: leave-alone + deps = [ + "@raze__base64__0_13_0//:base64", + ], +) diff --git a/gateway/lib/BUILD.bazel b/cargo/remote/BUILD.bazel index e69de29..e69de29 100644 --- a/gateway/lib/BUILD.bazel +++ b/cargo/remote/BUILD.bazel diff --git a/cargo/remote/BUILD.bitflags-1.3.2.bazel b/cargo/remote/BUILD.bitflags-1.3.2.bazel new file mode 100644 index 0000000..6b27aa9 --- /dev/null +++ b/cargo/remote/BUILD.bitflags-1.3.2.bazel @@ -0,0 +1,58 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "bitflags", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.3.2", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "basic" with type "test" omitted + +# Unsupported target "compile" with type "test" omitted diff --git a/cargo/remote/BUILD.block-buffer-0.9.0.bazel b/cargo/remote/BUILD.block-buffer-0.9.0.bazel new file mode 100644 index 0000000..be446cf --- /dev/null +++ b/cargo/remote/BUILD.block-buffer-0.9.0.bazel @@ -0,0 +1,54 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "block_buffer", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.0", + # buildifier: leave-alone + deps = [ + "@raze__generic_array__0_14_4//:generic_array", + ], +) diff --git a/cargo/remote/BUILD.blocking-1.0.2.bazel b/cargo/remote/BUILD.blocking-1.0.2.bazel new file mode 100644 index 0000000..f2a1233 --- /dev/null +++ b/cargo/remote/BUILD.blocking-1.0.2.bazel @@ -0,0 +1,63 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +# Unsupported target "ls" with type "example" omitted + +rust_library( + name = "blocking", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.2", + # buildifier: leave-alone + deps = [ + "@raze__async_channel__1_6_1//:async_channel", + "@raze__async_task__4_0_3//:async_task", + "@raze__atomic_waker__1_0_0//:atomic_waker", + "@raze__fastrand__1_5_0//:fastrand", + "@raze__futures_lite__1_12_0//:futures_lite", + "@raze__once_cell__1_8_0//:once_cell", + ], +) + +# Unsupported target "unblock" with type "test" omitted diff --git a/cargo/remote/BUILD.bumpalo-3.7.0.bazel b/cargo/remote/BUILD.bumpalo-3.7.0.bazel new file mode 100644 index 0000000..01f3bb1 --- /dev/null +++ b/cargo/remote/BUILD.bumpalo-3.7.0.bazel @@ -0,0 +1,80 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "benches" with type "bench" omitted + +rust_library( + name = "bumpalo", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "3.7.0", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "alloc_fill" with type "test" omitted + +# Unsupported target "alloc_try_with" with type "test" omitted + +# Unsupported target "alloc_with" with type "test" omitted + +# Unsupported target "allocator_api" with type "test" omitted + +# Unsupported target "quickchecks" with type "test" omitted + +# Unsupported target "readme_up_to_date" with type "test" omitted + +# Unsupported target "string" with type "test" omitted + +# Unsupported target "tests" with type "test" omitted + +# Unsupported target "try_alloc" with type "test" omitted + +# Unsupported target "try_alloc_try_with" with type "test" omitted + +# Unsupported target "try_alloc_with" with type "test" omitted + +# Unsupported target "vec" with type "test" omitted diff --git a/cargo/remote/BUILD.byteorder-1.4.3.bazel b/cargo/remote/BUILD.byteorder-1.4.3.bazel new file mode 100644 index 0000000..aed08c1 --- /dev/null +++ b/cargo/remote/BUILD.byteorder-1.4.3.bazel @@ -0,0 +1,58 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "unencumbered", # Unlicense from expression "Unlicense OR MIT" +]) + +# Generated Targets + +# Unsupported target "bench" with type "bench" omitted + +rust_library( + name = "byteorder", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "i128", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.4.3", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.bytes-1.0.1.bazel b/cargo/remote/BUILD.bytes-1.1.0.bazel index 769c982..079fb17 100644 --- a/ratelimiter/cargo/remote/BUILD.bytes-1.0.1.bazel +++ b/cargo/remote/BUILD.bytes-1.1.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -54,7 +54,7 @@ rust_library( "cargo-raze", "manual", ], - version = "1.0.1", + version = "1.1.0", # buildifier: leave-alone deps = [ ], diff --git a/cargo/remote/BUILD.cache-padded-1.1.1.bazel b/cargo/remote/BUILD.cache-padded-1.1.1.bazel new file mode 100644 index 0000000..2e67e03 --- /dev/null +++ b/cargo/remote/BUILD.cache-padded-1.1.1.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "cache_padded", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.1.1", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "padding" with type "test" omitted diff --git a/cargo/remote/BUILD.cc-1.0.70.bazel b/cargo/remote/BUILD.cc-1.0.70.bazel new file mode 100644 index 0000000..e5591d1 --- /dev/null +++ b/cargo/remote/BUILD.cc-1.0.70.bazel @@ -0,0 +1,85 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_binary( + # Prefix bin name to disambiguate from (probable) collision with lib name + # N.B.: The exact form of this is subject to change. + name = "cargo_bin_gcc_shim", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/bin/gcc-shim.rs", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.70", + # buildifier: leave-alone + deps = [ + ":cc", + ], +) + +rust_library( + name = "cc", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.70", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "cc_env" with type "test" omitted + +# Unsupported target "cflags" with type "test" omitted + +# Unsupported target "cxxflags" with type "test" omitted + +# Unsupported target "test" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.cfg-if-1.0.0.bazel b/cargo/remote/BUILD.cfg-if-1.0.0.bazel index 64b30f5..d4f4088 100644 --- a/ratelimiter/cargo/remote/BUILD.cfg-if-1.0.0.bazel +++ b/cargo/remote/BUILD.cfg-if-1.0.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.chrono-0.4.19.bazel b/cargo/remote/BUILD.chrono-0.4.19.bazel new file mode 100644 index 0000000..487a0e6 --- /dev/null +++ b/cargo/remote/BUILD.chrono-0.4.19.bazel @@ -0,0 +1,90 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "chrono" with type "bench" omitted + +# Unsupported target "serde" with type "bench" omitted + +rust_library( + name = "chrono", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "clock", + "default", + "libc", + "oldtime", + "serde", + "std", + "time", + "winapi", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.19", + # buildifier: leave-alone + deps = [ + "@raze__libc__0_2_101//:libc", + "@raze__num_integer__0_1_44//:num_integer", + "@raze__num_traits__0_2_14//:num_traits", + "@raze__serde__1_0_130//:serde", + "@raze__time__0_1_44//:time", + ] + selects.with_or({ + # cfg(all(target_arch = "wasm32", not(any(target_os = "emscripten", target_os = "wasi")))) + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + ], + "//conditions:default": [], + }), +) + +# Unsupported target "wasm" with type "test" omitted diff --git a/cargo/remote/BUILD.combine-4.6.1.bazel b/cargo/remote/BUILD.combine-4.6.1.bazel new file mode 100644 index 0000000..6a52e24 --- /dev/null +++ b/cargo/remote/BUILD.combine-4.6.1.bazel @@ -0,0 +1,82 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +# Unsupported target "http" with type "bench" omitted + +# Unsupported target "json" with type "bench" omitted + +# Unsupported target "mp4" with type "bench" omitted + +# Unsupported target "async" with type "example" omitted + +# Unsupported target "date" with type "example" omitted + +# Unsupported target "ini" with type "example" omitted + +# Unsupported target "number" with type "example" omitted + +# Unsupported target "readme" with type "example" omitted + +rust_library( + name = "combine", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "bytes", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "4.6.1", + # buildifier: leave-alone + deps = [ + "@raze__bytes__1_1_0//:bytes", + "@raze__memchr__2_4_1//:memchr", + ], +) + +# Unsupported target "async" with type "test" omitted + +# Unsupported target "buffered_stream" with type "test" omitted + +# Unsupported target "parser" with type "test" omitted + +# Unsupported target "parser_macro" with type "test" omitted diff --git a/cargo/remote/BUILD.concurrent-queue-1.2.2.bazel b/cargo/remote/BUILD.concurrent-queue-1.2.2.bazel new file mode 100644 index 0000000..c935c70 --- /dev/null +++ b/cargo/remote/BUILD.concurrent-queue-1.2.2.bazel @@ -0,0 +1,60 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "concurrent_queue", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.2.2", + # buildifier: leave-alone + deps = [ + "@raze__cache_padded__1_1_1//:cache_padded", + ], +) + +# Unsupported target "bounded" with type "test" omitted + +# Unsupported target "single" with type "test" omitted + +# Unsupported target "unbounded" with type "test" omitted diff --git a/cargo/remote/BUILD.config-0.11.0.bazel b/cargo/remote/BUILD.config-0.11.0.bazel new file mode 100644 index 0000000..8d6fe5f --- /dev/null +++ b/cargo/remote/BUILD.config-0.11.0.bazel @@ -0,0 +1,99 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "config", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "hjson", + "ini", + "json", + "rust-ini", + "serde-hjson", + "serde_json", + "toml", + "yaml", + "yaml-rust", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.11.0", + # buildifier: leave-alone + deps = [ + "@raze__lazy_static__1_4_0//:lazy_static", + "@raze__nom__5_1_2//:nom", + "@raze__rust_ini__0_13_0//:rust_ini", + "@raze__serde__1_0_130//:serde", + "@raze__serde_hjson__0_9_1//:serde_hjson", + "@raze__serde_json__1_0_67//:serde_json", + "@raze__toml__0_5_8//:toml", + "@raze__yaml_rust__0_4_5//:yaml_rust", + ], +) + +# Unsupported target "datetime" with type "test" omitted + +# Unsupported target "defaults" with type "test" omitted + +# Unsupported target "empty" with type "test" omitted + +# Unsupported target "env" with type "test" omitted + +# Unsupported target "errors" with type "test" omitted + +# Unsupported target "file" with type "test" omitted + +# Unsupported target "file_hjson" with type "test" omitted + +# Unsupported target "file_ini" with type "test" omitted + +# Unsupported target "file_json" with type "test" omitted + +# Unsupported target "file_toml" with type "test" omitted + +# Unsupported target "file_yaml" with type "test" omitted + +# Unsupported target "get" with type "test" omitted + +# Unsupported target "merge" with type "test" omitted + +# Unsupported target "set" with type "test" omitted diff --git a/cargo/remote/BUILD.core-foundation-0.9.1.bazel b/cargo/remote/BUILD.core-foundation-0.9.1.bazel new file mode 100644 index 0000000..ac970a7 --- /dev/null +++ b/cargo/remote/BUILD.core-foundation-0.9.1.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "core_foundation", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.1", + # buildifier: leave-alone + deps = [ + "@raze__core_foundation_sys__0_8_2//:core_foundation_sys", + "@raze__libc__0_2_101//:libc", + ], +) + +# Unsupported target "use_macro_outside_crate" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.bitflags-1.2.1.bazel b/cargo/remote/BUILD.core-foundation-sys-0.8.2.bazel index 3864b8f..c34cd53 100644 --- a/ratelimiter/cargo/remote/BUILD.bitflags-1.2.1.bazel +++ b/cargo/remote/BUILD.core-foundation-sys-0.8.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -37,12 +37,11 @@ load( ) cargo_build_script( - name = "bitflags_build_script", + name = "core_foundation_sys_build_script", srcs = glob(["**/*.rs"]), build_script_env = { }, crate_features = [ - "default", ], crate_root = "build.rs", data = glob(["**"]), @@ -54,17 +53,16 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "1.2.1", + version = "0.8.2", visibility = ["//visibility:private"], deps = [ ], ) rust_library( - name = "bitflags", + name = "core_foundation_sys", srcs = glob(["**/*.rs"]), crate_features = [ - "default", ], crate_root = "src/lib.rs", crate_type = "lib", @@ -77,9 +75,9 @@ rust_library( "cargo-raze", "manual", ], - version = "1.2.1", + version = "0.8.2", # buildifier: leave-alone deps = [ - ":bitflags_build_script", + ":core_foundation_sys_build_script", ], ) diff --git a/cargo/remote/BUILD.cpufeatures-0.2.1.bazel b/cargo/remote/BUILD.cpufeatures-0.2.1.bazel new file mode 100644 index 0000000..676666d --- /dev/null +++ b/cargo/remote/BUILD.cpufeatures-0.2.1.bazel @@ -0,0 +1,74 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "cpufeatures", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.1", + # buildifier: leave-alone + deps = [ + "@raze__libc__0_2_101//:libc", + ] + selects.with_or({ + # aarch64-apple-darwin + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(all(target_arch = "aarch64", target_os = "linux")) + ( + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "aarch64" with type "test" omitted + +# Unsupported target "x86" with type "test" omitted diff --git a/cargo/remote/BUILD.crossbeam-channel-0.5.1.bazel b/cargo/remote/BUILD.crossbeam-channel-0.5.1.bazel new file mode 100644 index 0000000..8e5635f --- /dev/null +++ b/cargo/remote/BUILD.crossbeam-channel-0.5.1.bazel @@ -0,0 +1,94 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "crossbeam" with type "bench" omitted + +# Unsupported target "fibonacci" with type "example" omitted + +# Unsupported target "matching" with type "example" omitted + +# Unsupported target "stopwatch" with type "example" omitted + +rust_library( + name = "crossbeam_channel", + srcs = glob(["**/*.rs"]), + crate_features = [ + "crossbeam-utils", + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.1", + # buildifier: leave-alone + deps = [ + "@raze__cfg_if__1_0_0//:cfg_if", + "@raze__crossbeam_utils__0_8_5//:crossbeam_utils", + ], +) + +# Unsupported target "after" with type "test" omitted + +# Unsupported target "array" with type "test" omitted + +# Unsupported target "golang" with type "test" omitted + +# Unsupported target "iter" with type "test" omitted + +# Unsupported target "list" with type "test" omitted + +# Unsupported target "mpsc" with type "test" omitted + +# Unsupported target "never" with type "test" omitted + +# Unsupported target "ready" with type "test" omitted + +# Unsupported target "same_channel" with type "test" omitted + +# Unsupported target "select" with type "test" omitted + +# Unsupported target "select_macro" with type "test" omitted + +# Unsupported target "thread_locals" with type "test" omitted + +# Unsupported target "tick" with type "test" omitted + +# Unsupported target "zero" with type "test" omitted diff --git a/cargo/remote/BUILD.crossbeam-utils-0.8.5.bazel b/cargo/remote/BUILD.crossbeam-utils-0.8.5.bazel new file mode 100644 index 0000000..f6a25b1 --- /dev/null +++ b/cargo/remote/BUILD.crossbeam-utils-0.8.5.bazel @@ -0,0 +1,103 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "crossbeam_utils_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "lazy_static", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.8.5", + visibility = ["//visibility:private"], + deps = [ + ], +) + +# Unsupported target "atomic_cell" with type "bench" omitted + +rust_library( + name = "crossbeam_utils", + srcs = glob(["**/*.rs"]), + crate_features = [ + "lazy_static", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.8.5", + # buildifier: leave-alone + deps = [ + ":crossbeam_utils_build_script", + "@raze__cfg_if__1_0_0//:cfg_if", + "@raze__lazy_static__1_4_0//:lazy_static", + ], +) + +# Unsupported target "atomic_cell" with type "test" omitted + +# Unsupported target "cache_padded" with type "test" omitted + +# Unsupported target "parker" with type "test" omitted + +# Unsupported target "sharded_lock" with type "test" omitted + +# Unsupported target "thread" with type "test" omitted + +# Unsupported target "wait_group" with type "test" omitted diff --git a/cargo/remote/BUILD.curve25519-dalek-3.2.0.bazel b/cargo/remote/BUILD.curve25519-dalek-3.2.0.bazel new file mode 100644 index 0000000..9d7d35a --- /dev/null +++ b/cargo/remote/BUILD.curve25519-dalek-3.2.0.bazel @@ -0,0 +1,61 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # BSD-3-Clause from expression "BSD-3-Clause" +]) + +# Generated Targets + +# Unsupported target "dalek_benchmarks" with type "bench" omitted + +rust_library( + name = "curve25519_dalek", + srcs = glob(["**/*.rs"]), + crate_features = [ + "u64_backend", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "3.2.0", + # buildifier: leave-alone + deps = [ + "@raze__byteorder__1_4_3//:byteorder", + "@raze__digest__0_9_0//:digest", + "@raze__rand_core__0_5_1//:rand_core", + "@raze__subtle__2_4_1//:subtle", + "@raze__zeroize__1_4_1//:zeroize", + ], +) diff --git a/cargo/remote/BUILD.data-encoding-2.3.2.bazel b/cargo/remote/BUILD.data-encoding-2.3.2.bazel new file mode 100644 index 0000000..c36271b --- /dev/null +++ b/cargo/remote/BUILD.data-encoding-2.3.2.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +rust_library( + name = "data_encoding", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.3.2", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.digest-0.9.0.bazel b/cargo/remote/BUILD.digest-0.9.0.bazel new file mode 100644 index 0000000..e074f16 --- /dev/null +++ b/cargo/remote/BUILD.digest-0.9.0.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "digest", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.0", + # buildifier: leave-alone + deps = [ + "@raze__generic_array__0_14_4//:generic_array", + ], +) diff --git a/cargo/remote/BUILD.dtoa-0.4.8.bazel b/cargo/remote/BUILD.dtoa-0.4.8.bazel new file mode 100644 index 0000000..21cce7a --- /dev/null +++ b/cargo/remote/BUILD.dtoa-0.4.8.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "bench" with type "bench" omitted + +rust_library( + name = "dtoa", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.8", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "test" with type "test" omitted diff --git a/cargo/remote/BUILD.ed25519-1.2.0.bazel b/cargo/remote/BUILD.ed25519-1.2.0.bazel new file mode 100644 index 0000000..8db1a8b --- /dev/null +++ b/cargo/remote/BUILD.ed25519-1.2.0.bazel @@ -0,0 +1,54 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "ed25519", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.2.0", + # buildifier: leave-alone + deps = [ + "@raze__signature__1_3_1//:signature", + ], +) diff --git a/cargo/remote/BUILD.ed25519-dalek-1.0.1.bazel b/cargo/remote/BUILD.ed25519-dalek-1.0.1.bazel new file mode 100644 index 0000000..cacb3a8 --- /dev/null +++ b/cargo/remote/BUILD.ed25519-dalek-1.0.1.bazel @@ -0,0 +1,62 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # BSD-3-Clause from expression "BSD-3-Clause" +]) + +# Generated Targets + +# Unsupported target "ed25519_benchmarks" with type "bench" omitted + +rust_library( + name = "ed25519_dalek", + srcs = glob(["**/*.rs"]), + crate_features = [ + "u64_backend", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.1", + # buildifier: leave-alone + deps = [ + "@raze__curve25519_dalek__3_2_0//:curve25519_dalek", + "@raze__ed25519__1_2_0//:ed25519", + "@raze__sha2__0_9_6//:sha2", + "@raze__zeroize__1_4_1//:zeroize", + ], +) + +# Unsupported target "ed25519" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.either-1.6.1.bazel b/cargo/remote/BUILD.either-1.6.1.bazel index a62f1bf..29a576b 100644 --- a/ratelimiter/cargo/remote/BUILD.either-1.6.1.bazel +++ b/cargo/remote/BUILD.either-1.6.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.enumflags2-0.7.1.bazel b/cargo/remote/BUILD.enumflags2-0.7.1.bazel new file mode 100644 index 0000000..9d5e1a5 --- /dev/null +++ b/cargo/remote/BUILD.enumflags2-0.7.1.bazel @@ -0,0 +1,60 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "from_iterator" with type "bench" omitted + +rust_library( + name = "enumflags2", + srcs = glob(["**/*.rs"]), + crate_features = [ + "serde", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + proc_macro_deps = [ + "@raze__enumflags2_derive__0_7_0//:enumflags2_derive", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.1", + # buildifier: leave-alone + deps = [ + "@raze__serde__1_0_130//:serde", + ], +) diff --git a/cargo/remote/BUILD.enumflags2_derive-0.7.0.bazel b/cargo/remote/BUILD.enumflags2_derive-0.7.0.bazel new file mode 100644 index 0000000..26d8952 --- /dev/null +++ b/cargo/remote/BUILD.enumflags2_derive-0.7.0.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "enumflags2_derive", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.0", + # buildifier: leave-alone + deps = [ + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + ], +) diff --git a/cargo/remote/BUILD.env_logger-0.7.1.bazel b/cargo/remote/BUILD.env_logger-0.7.1.bazel new file mode 100644 index 0000000..c1e8a18 --- /dev/null +++ b/cargo/remote/BUILD.env_logger-0.7.1.bazel @@ -0,0 +1,83 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "custom_default_format" with type "example" omitted + +# Unsupported target "custom_format" with type "example" omitted + +# Unsupported target "custom_logger" with type "example" omitted + +# Unsupported target "default" with type "example" omitted + +# Unsupported target "direct_logger" with type "example" omitted + +# Unsupported target "filters_from_code" with type "example" omitted + +rust_library( + name = "env_logger", + srcs = glob(["**/*.rs"]), + crate_features = [ + "atty", + "default", + "humantime", + "regex", + "termcolor", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.1", + # buildifier: leave-alone + deps = [ + "@raze__atty__0_2_14//:atty", + "@raze__humantime__1_3_0//:humantime", + "@raze__log__0_4_14//:log", + "@raze__regex__1_5_4//:regex", + "@raze__termcolor__1_1_2//:termcolor", + ], +) + +# Unsupported target "init-twice-retains-filter" with type "test" omitted + +# Unsupported target "log-in-log" with type "test" omitted + +# Unsupported target "log_tls_dtors" with type "test" omitted + +# Unsupported target "regexp_filter" with type "test" omitted diff --git a/cargo/remote/BUILD.event-listener-2.5.1.bazel b/cargo/remote/BUILD.event-listener-2.5.1.bazel new file mode 100644 index 0000000..504b992 --- /dev/null +++ b/cargo/remote/BUILD.event-listener-2.5.1.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +# Unsupported target "mutex" with type "example" omitted + +rust_library( + name = "event_listener", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.5.1", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "notify" with type "test" omitted diff --git a/cargo/remote/BUILD.fastrand-1.5.0.bazel b/cargo/remote/BUILD.fastrand-1.5.0.bazel new file mode 100644 index 0000000..3085f85 --- /dev/null +++ b/cargo/remote/BUILD.fastrand-1.5.0.bazel @@ -0,0 +1,68 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +# Unsupported target "bench" with type "bench" omitted + +rust_library( + name = "fastrand", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.5.0", + # buildifier: leave-alone + deps = [ + ] + selects.with_or({ + # cfg(target_arch = "wasm32") + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + "@raze__instant__0_1_10//:instant", + ], + "//conditions:default": [], + }), +) + +# Unsupported target "smoke" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.fixedbitset-0.2.0.bazel b/cargo/remote/BUILD.fixedbitset-0.2.0.bazel index 8bd7afc..260256f 100644 --- a/ratelimiter/cargo/remote/BUILD.fixedbitset-0.2.0.bazel +++ b/cargo/remote/BUILD.fixedbitset-0.2.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.fnv-1.0.7.bazel b/cargo/remote/BUILD.fnv-1.0.7.bazel index 8701e25..647cde9 100644 --- a/ratelimiter/cargo/remote/BUILD.fnv-1.0.7.bazel +++ b/cargo/remote/BUILD.fnv-1.0.7.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.form_urlencoded-1.0.1.bazel b/cargo/remote/BUILD.form_urlencoded-1.0.1.bazel new file mode 100644 index 0000000..dd8028b --- /dev/null +++ b/cargo/remote/BUILD.form_urlencoded-1.0.1.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "form_urlencoded", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.1", + # buildifier: leave-alone + deps = [ + "@raze__matches__0_1_9//:matches", + "@raze__percent_encoding__2_1_0//:percent_encoding", + ], +) diff --git a/cargo/remote/BUILD.futures-0.3.17.bazel b/cargo/remote/BUILD.futures-0.3.17.bazel new file mode 100644 index 0000000..f1d3795 --- /dev/null +++ b/cargo/remote/BUILD.futures-0.3.17.bazel @@ -0,0 +1,174 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "futures", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "async-await", + "default", + "executor", + "futures-executor", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.17", + # buildifier: leave-alone + deps = [ + "@raze__futures_channel__0_3_17//:futures_channel", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_executor__0_3_17//:futures_executor", + "@raze__futures_io__0_3_17//:futures_io", + "@raze__futures_sink__0_3_17//:futures_sink", + "@raze__futures_task__0_3_17//:futures_task", + "@raze__futures_util__0_3_17//:futures_util", + ], +) + +# Unsupported target "_require_features" with type "test" omitted + +# Unsupported target "async_await_macros" with type "test" omitted + +# Unsupported target "auto_traits" with type "test" omitted + +# Unsupported target "compat" with type "test" omitted + +# Unsupported target "eager_drop" with type "test" omitted + +# Unsupported target "eventual" with type "test" omitted + +# Unsupported target "future_abortable" with type "test" omitted + +# Unsupported target "future_basic_combinators" with type "test" omitted + +# Unsupported target "future_fuse" with type "test" omitted + +# Unsupported target "future_inspect" with type "test" omitted + +# Unsupported target "future_join_all" with type "test" omitted + +# Unsupported target "future_obj" with type "test" omitted + +# Unsupported target "future_select_all" with type "test" omitted + +# Unsupported target "future_select_ok" with type "test" omitted + +# Unsupported target "future_shared" with type "test" omitted + +# Unsupported target "future_try_flatten_stream" with type "test" omitted + +# Unsupported target "future_try_join_all" with type "test" omitted + +# Unsupported target "io_buf_reader" with type "test" omitted + +# Unsupported target "io_buf_writer" with type "test" omitted + +# Unsupported target "io_cursor" with type "test" omitted + +# Unsupported target "io_lines" with type "test" omitted + +# Unsupported target "io_read" with type "test" omitted + +# Unsupported target "io_read_exact" with type "test" omitted + +# Unsupported target "io_read_line" with type "test" omitted + +# Unsupported target "io_read_to_end" with type "test" omitted + +# Unsupported target "io_read_to_string" with type "test" omitted + +# Unsupported target "io_read_until" with type "test" omitted + +# Unsupported target "io_window" with type "test" omitted + +# Unsupported target "io_write" with type "test" omitted + +# Unsupported target "lock_mutex" with type "test" omitted + +# Unsupported target "macro_comma_support" with type "test" omitted + +# Unsupported target "object_safety" with type "test" omitted + +# Unsupported target "oneshot" with type "test" omitted + +# Unsupported target "ready_queue" with type "test" omitted + +# Unsupported target "recurse" with type "test" omitted + +# Unsupported target "sink" with type "test" omitted + +# Unsupported target "sink_fanout" with type "test" omitted + +# Unsupported target "stream" with type "test" omitted + +# Unsupported target "stream_abortable" with type "test" omitted + +# Unsupported target "stream_buffer_unordered" with type "test" omitted + +# Unsupported target "stream_catch_unwind" with type "test" omitted + +# Unsupported target "stream_futures_ordered" with type "test" omitted + +# Unsupported target "stream_futures_unordered" with type "test" omitted + +# Unsupported target "stream_into_async_read" with type "test" omitted + +# Unsupported target "stream_peekable" with type "test" omitted + +# Unsupported target "stream_select_all" with type "test" omitted + +# Unsupported target "stream_select_next_some" with type "test" omitted + +# Unsupported target "stream_split" with type "test" omitted + +# Unsupported target "stream_try_stream" with type "test" omitted + +# Unsupported target "stream_unfold" with type "test" omitted + +# Unsupported target "task_arc_wake" with type "test" omitted + +# Unsupported target "task_atomic_waker" with type "test" omitted + +# Unsupported target "test_macro" with type "test" omitted + +# Unsupported target "try_join" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.futures-channel-0.3.16.bazel b/cargo/remote/BUILD.futures-channel-0.3.17.bazel index 2dbc03c..27abf44 100644 --- a/ratelimiter/cargo/remote/BUILD.futures-channel-0.3.16.bazel +++ b/cargo/remote/BUILD.futures-channel-0.3.17.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -44,6 +44,8 @@ cargo_build_script( crate_features = [ "alloc", "default", + "futures-sink", + "sink", "std", ], crate_root = "build.rs", @@ -56,7 +58,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.3.17", visibility = ["//visibility:private"], deps = [ ], @@ -70,6 +72,8 @@ rust_library( crate_features = [ "alloc", "default", + "futures-sink", + "sink", "std", ], crate_root = "src/lib.rs", @@ -83,11 +87,12 @@ rust_library( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.3.17", # buildifier: leave-alone deps = [ ":futures_channel_build_script", - "@raze__futures_core__0_3_16//:futures_core", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_sink__0_3_17//:futures_sink", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.futures-core-0.3.16.bazel b/cargo/remote/BUILD.futures-core-0.3.17.bazel index 0604b9f..e71e740 100644 --- a/ratelimiter/cargo/remote/BUILD.futures-core-0.3.16.bazel +++ b/cargo/remote/BUILD.futures-core-0.3.17.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -56,7 +56,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.3.17", visibility = ["//visibility:private"], deps = [ ], @@ -81,7 +81,7 @@ rust_library( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.3.17", # buildifier: leave-alone deps = [ ":futures_core_build_script", diff --git a/cargo/remote/BUILD.futures-executor-0.3.17.bazel b/cargo/remote/BUILD.futures-executor-0.3.17.bazel new file mode 100644 index 0000000..19b0d1c --- /dev/null +++ b/cargo/remote/BUILD.futures-executor-0.3.17.bazel @@ -0,0 +1,61 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "thread_notify" with type "bench" omitted + +rust_library( + name = "futures_executor", + srcs = glob(["**/*.rs"]), + crate_features = [ + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.17", + # buildifier: leave-alone + deps = [ + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_task__0_3_17//:futures_task", + "@raze__futures_util__0_3_17//:futures_util", + ], +) + +# Unsupported target "local_pool" with type "test" omitted diff --git a/cargo/remote/BUILD.futures-io-0.3.17.bazel b/cargo/remote/BUILD.futures-io-0.3.17.bazel new file mode 100644 index 0000000..b9041ca --- /dev/null +++ b/cargo/remote/BUILD.futures-io-0.3.17.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "futures_io", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.17", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.futures-lite-1.12.0.bazel b/cargo/remote/BUILD.futures-lite-1.12.0.bazel new file mode 100644 index 0000000..acc029f --- /dev/null +++ b/cargo/remote/BUILD.futures-lite-1.12.0.bazel @@ -0,0 +1,68 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "futures_lite", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "default", + "fastrand", + "futures-io", + "memchr", + "parking", + "std", + "waker-fn", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.12.0", + # buildifier: leave-alone + deps = [ + "@raze__fastrand__1_5_0//:fastrand", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_io__0_3_17//:futures_io", + "@raze__memchr__2_4_1//:memchr", + "@raze__parking__2_0_0//:parking", + "@raze__pin_project_lite__0_2_7//:pin_project_lite", + "@raze__waker_fn__1_1_0//:waker_fn", + ], +) diff --git a/cargo/remote/BUILD.futures-macro-0.3.17.bazel b/cargo/remote/BUILD.futures-macro-0.3.17.bazel new file mode 100644 index 0000000..7666146 --- /dev/null +++ b/cargo/remote/BUILD.futures-macro-0.3.17.bazel @@ -0,0 +1,90 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "futures_macro_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.17", + visibility = ["//visibility:private"], + deps = [ + "@raze__autocfg__1_0_1//:autocfg", + ], +) + +rust_library( + name = "futures_macro", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + proc_macro_deps = [ + "@raze__proc_macro_hack__0_5_19//:proc_macro_hack", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.17", + # buildifier: leave-alone + deps = [ + ":futures_macro_build_script", + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.futures-sink-0.3.16.bazel b/cargo/remote/BUILD.futures-sink-0.3.17.bazel index 6d9b102..0cf3e5f 100644 --- a/ratelimiter/cargo/remote/BUILD.futures-sink-0.3.16.bazel +++ b/cargo/remote/BUILD.futures-sink-0.3.17.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -49,7 +49,7 @@ rust_library( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.3.17", # buildifier: leave-alone deps = [ ], diff --git a/ratelimiter/cargo/remote/BUILD.futures-task-0.3.16.bazel b/cargo/remote/BUILD.futures-task-0.3.17.bazel index 3b68682..377be5d 100644 --- a/ratelimiter/cargo/remote/BUILD.futures-task-0.3.16.bazel +++ b/cargo/remote/BUILD.futures-task-0.3.17.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -43,6 +43,7 @@ cargo_build_script( }, crate_features = [ "alloc", + "std", ], crate_root = "build.rs", data = glob(["**"]), @@ -54,7 +55,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.3.17", visibility = ["//visibility:private"], deps = [ ], @@ -65,6 +66,7 @@ rust_library( srcs = glob(["**/*.rs"]), crate_features = [ "alloc", + "std", ], crate_root = "src/lib.rs", crate_type = "lib", @@ -77,7 +79,7 @@ rust_library( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.3.17", # buildifier: leave-alone deps = [ ":futures_task_build_script", diff --git a/cargo/remote/BUILD.futures-util-0.3.17.bazel b/cargo/remote/BUILD.futures-util-0.3.17.bazel new file mode 100644 index 0000000..0fe5551 --- /dev/null +++ b/cargo/remote/BUILD.futures-util-0.3.17.bazel @@ -0,0 +1,132 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "futures_util_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "alloc", + "async-await", + "async-await-macro", + "channel", + "default", + "futures-channel", + "futures-io", + "futures-macro", + "futures-sink", + "io", + "memchr", + "proc-macro-hack", + "proc-macro-nested", + "sink", + "slab", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.17", + visibility = ["//visibility:private"], + deps = [ + "@raze__autocfg__1_0_1//:autocfg", + ], +) + +# Unsupported target "futures_unordered" with type "bench" omitted + +rust_library( + name = "futures_util", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "async-await", + "async-await-macro", + "channel", + "default", + "futures-channel", + "futures-io", + "futures-macro", + "futures-sink", + "io", + "memchr", + "proc-macro-hack", + "proc-macro-nested", + "sink", + "slab", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + proc_macro_deps = [ + "@raze__futures_macro__0_3_17//:futures_macro", + "@raze__proc_macro_hack__0_5_19//:proc_macro_hack", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.17", + # buildifier: leave-alone + deps = [ + ":futures_util_build_script", + "@raze__futures_channel__0_3_17//:futures_channel", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_io__0_3_17//:futures_io", + "@raze__futures_sink__0_3_17//:futures_sink", + "@raze__futures_task__0_3_17//:futures_task", + "@raze__memchr__2_4_1//:memchr", + "@raze__pin_project_lite__0_2_7//:pin_project_lite", + "@raze__pin_utils__0_1_0//:pin_utils", + "@raze__proc_macro_nested__0_1_7//:proc_macro_nested", + "@raze__slab__0_4_4//:slab", + ], +) diff --git a/cargo/remote/BUILD.generic-array-0.14.4.bazel b/cargo/remote/BUILD.generic-array-0.14.4.bazel new file mode 100644 index 0000000..a2c2385 --- /dev/null +++ b/cargo/remote/BUILD.generic-array-0.14.4.bazel @@ -0,0 +1,97 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "generic_array_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.14.4", + visibility = ["//visibility:private"], + deps = [ + "@raze__version_check__0_9_3//:version_check", + ], +) + +rust_library( + name = "generic_array", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.14.4", + # buildifier: leave-alone + deps = [ + ":generic_array_build_script", + "@raze__typenum__1_14_0//:typenum", + ], +) + +# Unsupported target "arr" with type "test" omitted + +# Unsupported target "generics" with type "test" omitted + +# Unsupported target "hex" with type "test" omitted + +# Unsupported target "import_name" with type "test" omitted + +# Unsupported target "iter" with type "test" omitted + +# Unsupported target "mod" with type "test" omitted diff --git a/cargo/remote/BUILD.getrandom-0.1.16.bazel b/cargo/remote/BUILD.getrandom-0.1.16.bazel new file mode 100644 index 0000000..e4bf679 --- /dev/null +++ b/cargo/remote/BUILD.getrandom-0.1.16.bazel @@ -0,0 +1,166 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "getrandom_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.16", + visibility = ["//visibility:private"], + deps = [ + ] + selects.with_or({ + # cfg(target_os = "wasi") + ( + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(unix) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # wasm32-unknown-unknown + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "mod" with type "bench" omitted + +rust_library( + name = "getrandom", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.16", + # buildifier: leave-alone + deps = [ + ":getrandom_build_script", + "@raze__cfg_if__1_0_0//:cfg_if", + ] + selects.with_or({ + # cfg(target_os = "wasi") + ( + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + "@raze__wasi__0_9_0_wasi_snapshot_preview1//:wasi", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(unix) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }) + selects.with_or({ + # wasm32-unknown-unknown + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "common" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.getrandom-0.2.3.bazel b/cargo/remote/BUILD.getrandom-0.2.3.bazel index 7f20c88..ac6f855 100644 --- a/ratelimiter/cargo/remote/BUILD.getrandom-0.2.3.bazel +++ b/cargo/remote/BUILD.getrandom-0.2.3.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -67,7 +67,7 @@ rust_library( ( "@rules_rust//rust/platform:wasm32-wasi", ): [ - "@raze__wasi__0_10_2_wasi_snapshot_preview1//:wasi", + "@raze__wasi__0_10_0_wasi_snapshot_preview1//:wasi", ], "//conditions:default": [], }) + selects.with_or({ @@ -90,7 +90,7 @@ rust_library( "@rules_rust//rust/platform:x86_64-unknown-freebsd", "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", ): [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ], "//conditions:default": [], }), diff --git a/ratelimiter/cargo/remote/BUILD.h2-0.3.3.bazel b/cargo/remote/BUILD.h2-0.3.4.bazel index 1789d39..63a1c6a 100644 --- a/ratelimiter/cargo/remote/BUILD.h2-0.3.3.bazel +++ b/cargo/remote/BUILD.h2-0.3.4.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -52,19 +52,19 @@ rust_library( "cargo-raze", "manual", ], - version = "0.3.3", + version = "0.3.4", # buildifier: leave-alone deps = [ - "@raze__bytes__1_0_1//:bytes", + "@raze__bytes__1_1_0//:bytes", "@raze__fnv__1_0_7//:fnv", - "@raze__futures_core__0_3_16//:futures_core", - "@raze__futures_sink__0_3_16//:futures_sink", - "@raze__futures_util__0_3_16//:futures_util", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_sink__0_3_17//:futures_sink", + "@raze__futures_util__0_3_17//:futures_util", "@raze__http__0_2_4//:http", "@raze__indexmap__1_7_0//:indexmap", "@raze__slab__0_4_4//:slab", - "@raze__tokio__1_9_0//:tokio", - "@raze__tokio_util__0_6_7//:tokio_util", + "@raze__tokio__1_11_0//:tokio", + "@raze__tokio_util__0_6_8//:tokio_util", "@raze__tracing__0_1_26//:tracing", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.hashbrown-0.11.2.bazel b/cargo/remote/BUILD.hashbrown-0.11.2.bazel index 757f51a..b5fc418 100644 --- a/ratelimiter/cargo/remote/BUILD.hashbrown-0.11.2.bazel +++ b/cargo/remote/BUILD.hashbrown-0.11.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.heck-0.3.3.bazel b/cargo/remote/BUILD.heck-0.3.3.bazel index 2bcfebc..45ff7e4 100644 --- a/ratelimiter/cargo/remote/BUILD.heck-0.3.3.bazel +++ b/cargo/remote/BUILD.heck-0.3.3.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.hermit-abi-0.1.19.bazel b/cargo/remote/BUILD.hermit-abi-0.1.19.bazel index 4f44c88..b2b6fcf 100644 --- a/ratelimiter/cargo/remote/BUILD.hermit-abi-0.1.19.bazel +++ b/cargo/remote/BUILD.hermit-abi-0.1.19.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -50,6 +50,6 @@ rust_library( version = "0.1.19", # buildifier: leave-alone deps = [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ], ) diff --git a/cargo/remote/BUILD.hex-0.4.3.bazel b/cargo/remote/BUILD.hex-0.4.3.bazel new file mode 100644 index 0000000..a0bb458 --- /dev/null +++ b/cargo/remote/BUILD.hex-0.4.3.bazel @@ -0,0 +1,62 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "hex" with type "bench" omitted + +rust_library( + name = "hex", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.3", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "serde" with type "test" omitted + +# Unsupported target "version-number" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.http-0.2.4.bazel b/cargo/remote/BUILD.http-0.2.4.bazel index a5494c5..86c5210 100644 --- a/ratelimiter/cargo/remote/BUILD.http-0.2.4.bazel +++ b/cargo/remote/BUILD.http-0.2.4.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -59,9 +59,9 @@ rust_library( version = "0.2.4", # buildifier: leave-alone deps = [ - "@raze__bytes__1_0_1//:bytes", + "@raze__bytes__1_1_0//:bytes", "@raze__fnv__1_0_7//:fnv", - "@raze__itoa__0_4_7//:itoa", + "@raze__itoa__0_4_8//:itoa", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.http-body-0.4.2.bazel b/cargo/remote/BUILD.http-body-0.4.3.bazel index 8c21693..624d388 100644 --- a/ratelimiter/cargo/remote/BUILD.http-body-0.4.2.bazel +++ b/cargo/remote/BUILD.http-body-0.4.3.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -46,10 +46,10 @@ rust_library( "cargo-raze", "manual", ], - version = "0.4.2", + version = "0.4.3", # buildifier: leave-alone deps = [ - "@raze__bytes__1_0_1//:bytes", + "@raze__bytes__1_1_0//:bytes", "@raze__http__0_2_4//:http", "@raze__pin_project_lite__0_2_7//:pin_project_lite", ], diff --git a/ratelimiter/cargo/remote/BUILD.httparse-1.4.1.bazel b/cargo/remote/BUILD.httparse-1.5.1.bazel index b50bcc7..8ff7d31 100644 --- a/ratelimiter/cargo/remote/BUILD.httparse-1.4.1.bazel +++ b/cargo/remote/BUILD.httparse-1.5.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -55,7 +55,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "1.4.1", + version = "1.5.1", visibility = ["//visibility:private"], deps = [ ], @@ -81,7 +81,7 @@ rust_library( "cargo-raze", "manual", ], - version = "1.4.1", + version = "1.5.1", # buildifier: leave-alone deps = [ ":httparse_build_script", diff --git a/ratelimiter/cargo/remote/BUILD.httpdate-1.0.1.bazel b/cargo/remote/BUILD.httpdate-1.0.1.bazel index 78c4eff..11e9fdf 100644 --- a/ratelimiter/cargo/remote/BUILD.httpdate-1.0.1.bazel +++ b/cargo/remote/BUILD.httpdate-1.0.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.humantime-1.3.0.bazel b/cargo/remote/BUILD.humantime-1.3.0.bazel new file mode 100644 index 0000000..2b426bb --- /dev/null +++ b/cargo/remote/BUILD.humantime-1.3.0.bazel @@ -0,0 +1,58 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "datetime_format" with type "bench" omitted + +# Unsupported target "datetime_parse" with type "bench" omitted + +rust_library( + name = "humantime", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.3.0", + # buildifier: leave-alone + deps = [ + "@raze__quick_error__1_2_3//:quick_error", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.hyper-0.14.11.bazel b/cargo/remote/BUILD.hyper-0.14.12.bazel index bbbc129..9c30cc9 100644 --- a/ratelimiter/cargo/remote/BUILD.hyper-0.14.11.bazel +++ b/cargo/remote/BUILD.hyper-0.14.12.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -103,22 +103,22 @@ rust_library( "cargo-raze", "manual", ], - version = "0.14.11", + version = "0.14.12", # buildifier: leave-alone deps = [ - "@raze__bytes__1_0_1//:bytes", - "@raze__futures_channel__0_3_16//:futures_channel", - "@raze__futures_core__0_3_16//:futures_core", - "@raze__futures_util__0_3_16//:futures_util", - "@raze__h2__0_3_3//:h2", + "@raze__bytes__1_1_0//:bytes", + "@raze__futures_channel__0_3_17//:futures_channel", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_util__0_3_17//:futures_util", + "@raze__h2__0_3_4//:h2", "@raze__http__0_2_4//:http", - "@raze__http_body__0_4_2//:http_body", - "@raze__httparse__1_4_1//:httparse", + "@raze__http_body__0_4_3//:http_body", + "@raze__httparse__1_5_1//:httparse", "@raze__httpdate__1_0_1//:httpdate", - "@raze__itoa__0_4_7//:itoa", + "@raze__itoa__0_4_8//:itoa", "@raze__pin_project_lite__0_2_7//:pin_project_lite", "@raze__socket2__0_4_1//:socket2", - "@raze__tokio__1_9_0//:tokio", + "@raze__tokio__1_11_0//:tokio", "@raze__tower_service__0_3_1//:tower_service", "@raze__tracing__0_1_26//:tracing", "@raze__want__0_3_0//:want", diff --git a/ratelimiter/cargo/remote/BUILD.hyper-timeout-0.4.1.bazel b/cargo/remote/BUILD.hyper-timeout-0.4.1.bazel index b8f221c..9fc071f 100644 --- a/ratelimiter/cargo/remote/BUILD.hyper-timeout-0.4.1.bazel +++ b/cargo/remote/BUILD.hyper-timeout-0.4.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -51,9 +51,9 @@ rust_library( version = "0.4.1", # buildifier: leave-alone deps = [ - "@raze__hyper__0_14_11//:hyper", + "@raze__hyper__0_14_12//:hyper", "@raze__pin_project_lite__0_2_7//:pin_project_lite", - "@raze__tokio__1_9_0//:tokio", + "@raze__tokio__1_11_0//:tokio", "@raze__tokio_io_timeout__1_1_1//:tokio_io_timeout", ], ) diff --git a/cargo/remote/BUILD.idna-0.2.3.bazel b/cargo/remote/BUILD.idna-0.2.3.bazel new file mode 100644 index 0000000..f38a5ec --- /dev/null +++ b/cargo/remote/BUILD.idna-0.2.3.bazel @@ -0,0 +1,62 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "all" with type "bench" omitted + +rust_library( + name = "idna", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.3", + # buildifier: leave-alone + deps = [ + "@raze__matches__0_1_9//:matches", + "@raze__unicode_bidi__0_3_6//:unicode_bidi", + "@raze__unicode_normalization__0_1_19//:unicode_normalization", + ], +) + +# Unsupported target "tests" with type "test" omitted + +# Unsupported target "unit" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.indexmap-1.7.0.bazel b/cargo/remote/BUILD.indexmap-1.7.0.bazel index 1b221c3..a8bfcae 100644 --- a/ratelimiter/cargo/remote/BUILD.indexmap-1.7.0.bazel +++ b/cargo/remote/BUILD.indexmap-1.7.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.instant-0.1.10.bazel b/cargo/remote/BUILD.instant-0.1.10.bazel new file mode 100644 index 0000000..11b0c15 --- /dev/null +++ b/cargo/remote/BUILD.instant-0.1.10.bazel @@ -0,0 +1,65 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # BSD-3-Clause from expression "BSD-3-Clause" +]) + +# Generated Targets + +rust_library( + name = "instant", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.10", + # buildifier: leave-alone + deps = [ + "@raze__cfg_if__1_0_0//:cfg_if", + ] + selects.with_or({ + # wasm32-unknown-unknown + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "wasm" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.itertools-0.10.1.bazel b/cargo/remote/BUILD.itertools-0.10.1.bazel index b873c00..4b5e5db 100644 --- a/ratelimiter/cargo/remote/BUILD.itertools-0.10.1.bazel +++ b/cargo/remote/BUILD.itertools-0.10.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.itoa-0.4.7.bazel b/cargo/remote/BUILD.itoa-0.4.8.bazel index 0d435c9..41b4d7d 100644 --- a/ratelimiter/cargo/remote/BUILD.itoa-0.4.7.bazel +++ b/cargo/remote/BUILD.itoa-0.4.8.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -50,7 +50,7 @@ rust_library( "cargo-raze", "manual", ], - version = "0.4.7", + version = "0.4.8", # buildifier: leave-alone deps = [ ], diff --git a/cargo/remote/BUILD.js-sys-0.3.53.bazel b/cargo/remote/BUILD.js-sys-0.3.53.bazel new file mode 100644 index 0000000..1566973 --- /dev/null +++ b/cargo/remote/BUILD.js-sys-0.3.53.bazel @@ -0,0 +1,68 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "js_sys", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.53", + # buildifier: leave-alone + deps = [ + "@raze__wasm_bindgen__0_2_76//:wasm_bindgen", + ] + selects.with_or({ + # cfg(target_arch = "wasm32") + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "headless" with type "test" omitted + +# Unsupported target "wasm" with type "test" omitted diff --git a/cargo/remote/BUILD.json-0.12.4.bazel b/cargo/remote/BUILD.json-0.12.4.bazel new file mode 100644 index 0000000..245f20d --- /dev/null +++ b/cargo/remote/BUILD.json-0.12.4.bazel @@ -0,0 +1,69 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "log" with type "bench" omitted + +rust_library( + name = "json", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.12.4", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "customgen" with type "test" omitted + +# Unsupported target "json_checker" with type "test" omitted + +# Unsupported target "number" with type "test" omitted + +# Unsupported target "parse" with type "test" omitted + +# Unsupported target "print_dec" with type "test" omitted + +# Unsupported target "stringify" with type "test" omitted + +# Unsupported target "value" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.lazy_static-1.4.0.bazel b/cargo/remote/BUILD.lazy_static-1.4.0.bazel index 36800bb..5ae4622 100644 --- a/ratelimiter/cargo/remote/BUILD.lazy_static-1.4.0.bazel +++ b/cargo/remote/BUILD.lazy_static-1.4.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.lexical-core-0.7.6.bazel b/cargo/remote/BUILD.lexical-core-0.7.6.bazel new file mode 100644 index 0000000..f289e23 --- /dev/null +++ b/cargo/remote/BUILD.lexical-core-0.7.6.bazel @@ -0,0 +1,102 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "lexical_core_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "arrayvec", + "correct", + "default", + "ryu", + "static_assertions", + "std", + "table", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.6", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "lexical_core", + srcs = glob(["**/*.rs"]), + crate_features = [ + "arrayvec", + "correct", + "default", + "ryu", + "static_assertions", + "std", + "table", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.6", + # buildifier: leave-alone + deps = [ + ":lexical_core_build_script", + "@raze__arrayvec__0_5_2//:arrayvec", + "@raze__bitflags__1_3_2//:bitflags", + "@raze__cfg_if__1_0_0//:cfg_if", + "@raze__ryu__1_0_5//:ryu", + "@raze__static_assertions__1_1_0//:static_assertions", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.libc-0.2.98.bazel b/cargo/remote/BUILD.libc-0.2.101.bazel index 46485fc..b70a856 100644 --- a/ratelimiter/cargo/remote/BUILD.libc-0.2.98.bazel +++ b/cargo/remote/BUILD.libc-0.2.101.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -55,7 +55,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "0.2.98", + version = "0.2.101", visibility = ["//visibility:private"], deps = [ ], @@ -79,7 +79,7 @@ rust_library( "cargo-raze", "manual", ], - version = "0.2.98", + version = "0.2.101", # buildifier: leave-alone deps = [ ":libc_build_script", diff --git a/cargo/remote/BUILD.libsodium-sys-0.2.7.bazel b/cargo/remote/BUILD.libsodium-sys-0.2.7.bazel new file mode 100644 index 0000000..c577512 --- /dev/null +++ b/cargo/remote/BUILD.libsodium-sys-0.2.7.bazel @@ -0,0 +1,165 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "build-script-build" with type "custom-build" omitted + +rust_library( + name = "libsodium_sys", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + compile_data = glob(["*/**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.7", + # buildifier: leave-alone + deps = [ + ":libsodium_sys_build_script", + "@raze__libc__0_2_101//:libc", + ] + selects.with_or({ + # cfg(not(target_env = "msvc")) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_env = "msvc") + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "test" with type "test" omitted + +# Additional content from bazel/patch/BUILD_script_patch +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "libsodium_sys_build_script", + srcs = ["@nova//bazel/patch:libsodium_sys_build_script_script_.rs"], + build_script_env = { + "NUM_JOBS": "2", + "PATH": "/usr/sbin:/usr/bin:/sbin:/bin", + }, + data = glob(["**"]), + edition = "2015", + links = "sodium", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.7", + visibility = ["//visibility:private"], + deps = [ + "@raze__pkg_config__0_3_19//:pkg_config", + "@raze__walkdir__2_3_2//:walkdir", + ] + selects.with_or({ + # cfg(not(target_env = "msvc")) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__cc__1_0_70//:cc", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_env = "msvc") + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }), +) diff --git a/cargo/remote/BUILD.linked-hash-map-0.5.4.bazel b/cargo/remote/BUILD.linked-hash-map-0.5.4.bazel new file mode 100644 index 0000000..5b92ab1 --- /dev/null +++ b/cargo/remote/BUILD.linked-hash-map-0.5.4.bazel @@ -0,0 +1,59 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "linked_hash_map", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.4", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "heapsize" with type "test" omitted + +# Unsupported target "serde" with type "test" omitted + +# Unsupported target "test" with type "test" omitted diff --git a/cargo/remote/BUILD.lock_api-0.4.5.bazel b/cargo/remote/BUILD.lock_api-0.4.5.bazel new file mode 100644 index 0000000..9c3f6df --- /dev/null +++ b/cargo/remote/BUILD.lock_api-0.4.5.bazel @@ -0,0 +1,54 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "lock_api", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.5", + # buildifier: leave-alone + deps = [ + "@raze__scopeguard__1_1_0//:scopeguard", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.log-0.4.14.bazel b/cargo/remote/BUILD.log-0.4.14.bazel index 5630e25..9b05671 100644 --- a/ratelimiter/cargo/remote/BUILD.log-0.4.14.bazel +++ b/cargo/remote/BUILD.log-0.4.14.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -42,6 +42,7 @@ cargo_build_script( build_script_env = { }, crate_features = [ + "std", ], crate_root = "build.rs", data = glob(["**"]), @@ -65,6 +66,7 @@ rust_library( name = "log", srcs = glob(["**/*.rs"]), crate_features = [ + "std", ], crate_root = "src/lib.rs", crate_type = "lib", diff --git a/cargo/remote/BUILD.matches-0.1.9.bazel b/cargo/remote/BUILD.matches-0.1.9.bazel new file mode 100644 index 0000000..e33429f --- /dev/null +++ b/cargo/remote/BUILD.matches-0.1.9.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +rust_library( + name = "matches", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.9", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "macro_use_one" with type "test" omitted + +# Unsupported target "use_star" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.memchr-2.4.0.bazel b/cargo/remote/BUILD.memchr-2.4.1.bazel index b9029d1..ec524cf 100644 --- a/ratelimiter/cargo/remote/BUILD.memchr-2.4.0.bazel +++ b/cargo/remote/BUILD.memchr-2.4.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -44,6 +44,7 @@ cargo_build_script( crate_features = [ "default", "std", + "use_std", ], crate_root = "build.rs", data = glob(["**"]), @@ -55,7 +56,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "2.4.0", + version = "2.4.1", visibility = ["//visibility:private"], deps = [ ], @@ -67,6 +68,7 @@ rust_library( crate_features = [ "default", "std", + "use_std", ], crate_root = "src/lib.rs", crate_type = "lib", @@ -79,7 +81,7 @@ rust_library( "cargo-raze", "manual", ], - version = "2.4.0", + version = "2.4.1", # buildifier: leave-alone deps = [ ":memchr_build_script", diff --git a/ratelimiter/cargo/remote/BUILD.mio-0.7.13.bazel b/cargo/remote/BUILD.mio-0.7.13.bazel index dcbdab7..573afde 100644 --- a/ratelimiter/cargo/remote/BUILD.mio-0.7.13.bazel +++ b/cargo/remote/BUILD.mio-0.7.13.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -84,7 +84,7 @@ rust_library( "@rules_rust//rust/platform:x86_64-unknown-freebsd", "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", ): [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ], "//conditions:default": [], }) + selects.with_or({ diff --git a/ratelimiter/cargo/remote/BUILD.miow-0.3.7.bazel b/cargo/remote/BUILD.miow-0.3.7.bazel index c40d56c..bb0cfa6 100644 --- a/ratelimiter/cargo/remote/BUILD.miow-0.3.7.bazel +++ b/cargo/remote/BUILD.miow-0.3.7.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.multimap-0.8.3.bazel b/cargo/remote/BUILD.multimap-0.8.3.bazel index bb9dd4a..b720afa 100644 --- a/ratelimiter/cargo/remote/BUILD.multimap-0.8.3.bazel +++ b/cargo/remote/BUILD.multimap-0.8.3.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.nats-0.15.2.bazel b/cargo/remote/BUILD.nats-0.15.2.bazel new file mode 100644 index 0000000..2012fac --- /dev/null +++ b/cargo/remote/BUILD.nats-0.15.2.bazel @@ -0,0 +1,131 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "nats_bench" with type "bench" omitted + +# Unsupported target "async_nats_bench" with type "example" omitted + +# Unsupported target "nats-box" with type "example" omitted + +# Unsupported target "nats_bench" with type "example" omitted + +# Unsupported target "serde-json" with type "example" omitted + +rust_library( + name = "nats", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.15.2", + # buildifier: leave-alone + deps = [ + "@raze__base64__0_13_0//:base64", + "@raze__base64_url__1_4_10//:base64_url", + "@raze__blocking__1_0_2//:blocking", + "@raze__chrono__0_4_19//:chrono", + "@raze__crossbeam_channel__0_5_1//:crossbeam_channel", + "@raze__fastrand__1_5_0//:fastrand", + "@raze__itoa__0_4_8//:itoa", + "@raze__json__0_12_4//:json", + "@raze__log__0_4_14//:log", + "@raze__memchr__2_4_1//:memchr", + "@raze__nkeys__0_1_0//:nkeys", + "@raze__nuid__0_3_0//:nuid", + "@raze__once_cell__1_8_0//:once_cell", + "@raze__parking_lot__0_11_2//:parking_lot", + "@raze__regex__1_5_4//:regex", + "@raze__rustls__0_19_1//:rustls", + "@raze__rustls_native_certs__0_5_0//:rustls_native_certs", + "@raze__serde__1_0_130//:serde", + "@raze__serde_json__1_0_67//:serde_json", + "@raze__webpki__0_21_4//:webpki", + ] + selects.with_or({ + # cfg(unix) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + ], + "//conditions:default": [], + }), +) + +# Unsupported target "auth_nkey" with type "test" omitted + +# Unsupported target "auth_tls" with type "test" omitted + +# Unsupported target "auth_user_pass" with type "test" omitted + +# Unsupported target "connect" with type "test" omitted + +# Unsupported target "drop" with type "test" omitted + +# Unsupported target "jetstream" with type "test" omitted + +# Unsupported target "reconnection" with type "test" omitted diff --git a/cargo/remote/BUILD.nkeys-0.1.0.bazel b/cargo/remote/BUILD.nkeys-0.1.0.bazel new file mode 100644 index 0000000..7095ac5 --- /dev/null +++ b/cargo/remote/BUILD.nkeys-0.1.0.bazel @@ -0,0 +1,89 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0" +]) + +# Generated Targets + +rust_binary( + # Prefix bin name to disambiguate from (probable) collision with lib name + # N.B.: The exact form of this is subject to change. + name = "cargo_bin_nk", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/bin/nk/main.rs", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.0", + # buildifier: leave-alone + deps = [ + ":nkeys", + "@raze__byteorder__1_4_3//:byteorder", + "@raze__data_encoding__2_3_2//:data_encoding", + "@raze__ed25519_dalek__1_0_1//:ed25519_dalek", + "@raze__log__0_4_14//:log", + "@raze__rand__0_7_3//:rand", + "@raze__signatory__0_21_0//:signatory", + ], +) + +rust_library( + name = "nkeys", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.0", + # buildifier: leave-alone + deps = [ + "@raze__byteorder__1_4_3//:byteorder", + "@raze__data_encoding__2_3_2//:data_encoding", + "@raze__ed25519_dalek__1_0_1//:ed25519_dalek", + "@raze__log__0_4_14//:log", + "@raze__rand__0_7_3//:rand", + "@raze__signatory__0_21_0//:signatory", + ], +) diff --git a/cargo/remote/BUILD.nom-5.1.2.bazel b/cargo/remote/BUILD.nom-5.1.2.bazel new file mode 100644 index 0000000..874d8e0 --- /dev/null +++ b/cargo/remote/BUILD.nom-5.1.2.bazel @@ -0,0 +1,150 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "nom_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "alloc", + "default", + "lexical", + "lexical-core", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "5.1.2", + visibility = ["//visibility:private"], + deps = [ + "@raze__version_check__0_9_3//:version_check", + ], +) + +# Unsupported target "arithmetic" with type "bench" omitted + +# Unsupported target "http" with type "bench" omitted + +# Unsupported target "ini" with type "bench" omitted + +# Unsupported target "ini_complete" with type "bench" omitted + +# Unsupported target "ini_str" with type "bench" omitted + +# Unsupported target "json" with type "bench" omitted + +# Unsupported target "json" with type "example" omitted + +# Unsupported target "s_expression" with type "example" omitted + +# Unsupported target "string" with type "example" omitted + +rust_library( + name = "nom", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "default", + "lexical", + "lexical-core", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "5.1.2", + # buildifier: leave-alone + deps = [ + ":nom_build_script", + "@raze__lexical_core__0_7_6//:lexical_core", + "@raze__memchr__2_4_1//:memchr", + ], +) + +# Unsupported target "arithmetic" with type "test" omitted + +# Unsupported target "arithmetic_ast" with type "test" omitted + +# Unsupported target "blockbuf-arithmetic" with type "test" omitted + +# Unsupported target "css" with type "test" omitted + +# Unsupported target "custom_errors" with type "test" omitted + +# Unsupported target "escaped" with type "test" omitted + +# Unsupported target "float" with type "test" omitted + +# Unsupported target "inference" with type "test" omitted + +# Unsupported target "ini" with type "test" omitted + +# Unsupported target "ini_str" with type "test" omitted + +# Unsupported target "issues" with type "test" omitted + +# Unsupported target "json" with type "test" omitted + +# Unsupported target "mp4" with type "test" omitted + +# Unsupported target "multiline" with type "test" omitted + +# Unsupported target "named_args" with type "test" omitted + +# Unsupported target "overflow" with type "test" omitted + +# Unsupported target "reborrow_fold" with type "test" omitted + +# Unsupported target "test1" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.ntapi-0.3.6.bazel b/cargo/remote/BUILD.ntapi-0.3.6.bazel index d14fa66..1d1269d 100644 --- a/ratelimiter/cargo/remote/BUILD.ntapi-0.3.6.bazel +++ b/cargo/remote/BUILD.ntapi-0.3.6.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.nuid-0.3.0.bazel b/cargo/remote/BUILD.nuid-0.3.0.bazel new file mode 100644 index 0000000..ec1a17c --- /dev/null +++ b/cargo/remote/BUILD.nuid-0.3.0.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "nuid", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.0", + # buildifier: leave-alone + deps = [ + "@raze__lazy_static__1_4_0//:lazy_static", + "@raze__rand__0_8_4//:rand", + ], +) diff --git a/cargo/remote/BUILD.num-0.4.0.bazel b/cargo/remote/BUILD.num-0.4.0.bazel new file mode 100644 index 0000000..8409859 --- /dev/null +++ b/cargo/remote/BUILD.num-0.4.0.bazel @@ -0,0 +1,62 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "num", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "num-bigint", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.0", + # buildifier: leave-alone + deps = [ + "@raze__num_bigint__0_4_2//:num_bigint", + "@raze__num_complex__0_4_0//:num_complex", + "@raze__num_integer__0_1_44//:num_integer", + "@raze__num_iter__0_1_42//:num_iter", + "@raze__num_rational__0_4_0//:num_rational", + "@raze__num_traits__0_2_14//:num_traits", + ], +) diff --git a/cargo/remote/BUILD.num-bigint-0.4.2.bazel b/cargo/remote/BUILD.num-bigint-0.4.2.bazel new file mode 100644 index 0000000..eb2b157 --- /dev/null +++ b/cargo/remote/BUILD.num-bigint-0.4.2.bazel @@ -0,0 +1,112 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "num_bigint_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.2", + visibility = ["//visibility:private"], + deps = [ + "@raze__autocfg__1_0_1//:autocfg", + ], +) + +# Unsupported target "bigint" with type "bench" omitted + +# Unsupported target "factorial" with type "bench" omitted + +# Unsupported target "gcd" with type "bench" omitted + +# Unsupported target "roots" with type "bench" omitted + +# Unsupported target "shootout-pidigits" with type "bench" omitted + +rust_library( + name = "num_bigint", + srcs = glob(["**/*.rs"]), + crate_features = [ + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.2", + # buildifier: leave-alone + deps = [ + ":num_bigint_build_script", + "@raze__num_integer__0_1_44//:num_integer", + "@raze__num_traits__0_2_14//:num_traits", + ], +) + +# Unsupported target "bigint" with type "test" omitted + +# Unsupported target "bigint_bitwise" with type "test" omitted + +# Unsupported target "bigint_scalar" with type "test" omitted + +# Unsupported target "biguint" with type "test" omitted + +# Unsupported target "biguint_scalar" with type "test" omitted + +# Unsupported target "modpow" with type "test" omitted + +# Unsupported target "roots" with type "test" omitted diff --git a/cargo/remote/BUILD.num-complex-0.4.0.bazel b/cargo/remote/BUILD.num-complex-0.4.0.bazel new file mode 100644 index 0000000..4e32b7b --- /dev/null +++ b/cargo/remote/BUILD.num-complex-0.4.0.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "num_complex", + srcs = glob(["**/*.rs"]), + crate_features = [ + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.0", + # buildifier: leave-alone + deps = [ + "@raze__num_traits__0_2_14//:num_traits", + ], +) diff --git a/cargo/remote/BUILD.num-derive-0.3.3.bazel b/cargo/remote/BUILD.num-derive-0.3.3.bazel new file mode 100644 index 0000000..d2afb67 --- /dev/null +++ b/cargo/remote/BUILD.num-derive-0.3.3.bazel @@ -0,0 +1,74 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "num_derive", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.3", + # buildifier: leave-alone + deps = [ + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + ], +) + +# Unsupported target "empty_enum" with type "test" omitted + +# Unsupported target "issue-6" with type "test" omitted + +# Unsupported target "issue-9" with type "test" omitted + +# Unsupported target "newtype" with type "test" omitted + +# Unsupported target "newtype-2015" with type "test" omitted + +# Unsupported target "num_derive_without_num" with type "test" omitted + +# Unsupported target "trivial" with type "test" omitted + +# Unsupported target "trivial-2015" with type "test" omitted + +# Unsupported target "with_custom_values" with type "test" omitted diff --git a/cargo/remote/BUILD.num-integer-0.1.44.bazel b/cargo/remote/BUILD.num-integer-0.1.44.bazel new file mode 100644 index 0000000..8f9a78e --- /dev/null +++ b/cargo/remote/BUILD.num-integer-0.1.44.bazel @@ -0,0 +1,99 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "num_integer_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "i128", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.44", + visibility = ["//visibility:private"], + deps = [ + "@raze__autocfg__1_0_1//:autocfg", + ], +) + +# Unsupported target "average" with type "bench" omitted + +# Unsupported target "gcd" with type "bench" omitted + +# Unsupported target "roots" with type "bench" omitted + +rust_library( + name = "num_integer", + srcs = glob(["**/*.rs"]), + crate_features = [ + "i128", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.44", + # buildifier: leave-alone + deps = [ + ":num_integer_build_script", + "@raze__num_traits__0_2_14//:num_traits", + ], +) + +# Unsupported target "average" with type "test" omitted + +# Unsupported target "roots" with type "test" omitted diff --git a/cargo/remote/BUILD.num-iter-0.1.42.bazel b/cargo/remote/BUILD.num-iter-0.1.42.bazel new file mode 100644 index 0000000..ecf8946 --- /dev/null +++ b/cargo/remote/BUILD.num-iter-0.1.42.bazel @@ -0,0 +1,90 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "num_iter_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "i128", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.42", + visibility = ["//visibility:private"], + deps = [ + "@raze__autocfg__1_0_1//:autocfg", + ], +) + +rust_library( + name = "num_iter", + srcs = glob(["**/*.rs"]), + crate_features = [ + "i128", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.42", + # buildifier: leave-alone + deps = [ + ":num_iter_build_script", + "@raze__num_integer__0_1_44//:num_integer", + "@raze__num_traits__0_2_14//:num_traits", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.futures-util-0.3.16.bazel b/cargo/remote/BUILD.num-rational-0.4.0.bazel index 56e3ed4..6d9ef28 100644 --- a/ratelimiter/cargo/remote/BUILD.futures-util-0.3.16.bazel +++ b/cargo/remote/BUILD.num-rational-0.4.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -37,12 +37,14 @@ load( ) cargo_build_script( - name = "futures_util_build_script", + name = "num_rational_build_script", srcs = glob(["**/*.rs"]), build_script_env = { }, crate_features = [ - "alloc", + "num-bigint", + "num-bigint-std", + "std", ], crate_root = "build.rs", data = glob(["**"]), @@ -54,20 +56,20 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.4.0", visibility = ["//visibility:private"], deps = [ "@raze__autocfg__1_0_1//:autocfg", ], ) -# Unsupported target "futures_unordered" with type "bench" omitted - rust_library( - name = "futures_util", + name = "num_rational", srcs = glob(["**/*.rs"]), crate_features = [ - "alloc", + "num-bigint", + "num-bigint-std", + "std", ], crate_root = "src/lib.rs", crate_type = "lib", @@ -80,13 +82,12 @@ rust_library( "cargo-raze", "manual", ], - version = "0.3.16", + version = "0.4.0", # buildifier: leave-alone deps = [ - ":futures_util_build_script", - "@raze__futures_core__0_3_16//:futures_core", - "@raze__futures_task__0_3_16//:futures_task", - "@raze__pin_project_lite__0_2_7//:pin_project_lite", - "@raze__pin_utils__0_1_0//:pin_utils", + ":num_rational_build_script", + "@raze__num_bigint__0_4_2//:num_bigint", + "@raze__num_integer__0_1_44//:num_integer", + "@raze__num_traits__0_2_14//:num_traits", ], ) diff --git a/cargo/remote/BUILD.num-traits-0.1.43.bazel b/cargo/remote/BUILD.num-traits-0.1.43.bazel new file mode 100644 index 0000000..ffc2e39 --- /dev/null +++ b/cargo/remote/BUILD.num-traits-0.1.43.bazel @@ -0,0 +1,54 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "num_traits", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.43", + # buildifier: leave-alone + deps = [ + "@raze__num_traits__0_2_14//:num_traits", + ], +) diff --git a/cargo/remote/BUILD.num-traits-0.2.14.bazel b/cargo/remote/BUILD.num-traits-0.2.14.bazel new file mode 100644 index 0000000..dc9a697 --- /dev/null +++ b/cargo/remote/BUILD.num-traits-0.2.14.bazel @@ -0,0 +1,92 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "num_traits_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "default", + "i128", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.14", + visibility = ["//visibility:private"], + deps = [ + "@raze__autocfg__1_0_1//:autocfg", + ], +) + +rust_library( + name = "num_traits", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "i128", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.14", + # buildifier: leave-alone + deps = [ + ":num_traits_build_script", + ], +) + +# Unsupported target "cast" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.num_cpus-1.13.0.bazel b/cargo/remote/BUILD.num_cpus-1.13.0.bazel index a8b1877..293aeb1 100644 --- a/ratelimiter/cargo/remote/BUILD.num_cpus-1.13.0.bazel +++ b/cargo/remote/BUILD.num_cpus-1.13.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -51,6 +51,6 @@ rust_library( version = "1.13.0", # buildifier: leave-alone deps = [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ], ) diff --git a/cargo/remote/BUILD.once_cell-1.8.0.bazel b/cargo/remote/BUILD.once_cell-1.8.0.bazel new file mode 100644 index 0000000..531038f --- /dev/null +++ b/cargo/remote/BUILD.once_cell-1.8.0.bazel @@ -0,0 +1,73 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "bench" with type "example" omitted + +# Unsupported target "bench_acquire" with type "example" omitted + +# Unsupported target "bench_vs_lazy_static" with type "example" omitted + +# Unsupported target "lazy_static" with type "example" omitted + +# Unsupported target "reentrant_init_deadlocks" with type "example" omitted + +# Unsupported target "regex" with type "example" omitted + +# Unsupported target "test_synchronization" with type "example" omitted + +rust_library( + name = "once_cell", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "default", + "race", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.8.0", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "it" with type "test" omitted diff --git a/cargo/remote/BUILD.opaque-debug-0.3.0.bazel b/cargo/remote/BUILD.opaque-debug-0.3.0.bazel new file mode 100644 index 0000000..3541e91 --- /dev/null +++ b/cargo/remote/BUILD.opaque-debug-0.3.0.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "opaque_debug", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.0", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "mod" with type "test" omitted diff --git a/cargo/remote/BUILD.openssl-probe-0.1.4.bazel b/cargo/remote/BUILD.openssl-probe-0.1.4.bazel new file mode 100644 index 0000000..dd5d283 --- /dev/null +++ b/cargo/remote/BUILD.openssl-probe-0.1.4.bazel @@ -0,0 +1,53 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "openssl_probe", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.4", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.parking-2.0.0.bazel b/cargo/remote/BUILD.parking-2.0.0.bazel new file mode 100644 index 0000000..6530323 --- /dev/null +++ b/cargo/remote/BUILD.parking-2.0.0.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "parking", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.0.0", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "parking" with type "test" omitted diff --git a/cargo/remote/BUILD.parking_lot-0.11.2.bazel b/cargo/remote/BUILD.parking_lot-0.11.2.bazel new file mode 100644 index 0000000..2232081 --- /dev/null +++ b/cargo/remote/BUILD.parking_lot-0.11.2.bazel @@ -0,0 +1,59 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "parking_lot", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.11.2", + # buildifier: leave-alone + deps = [ + "@raze__instant__0_1_10//:instant", + "@raze__lock_api__0_4_5//:lock_api", + "@raze__parking_lot_core__0_8_5//:parking_lot_core", + ], +) + +# Unsupported target "issue_203" with type "test" omitted diff --git a/cargo/remote/BUILD.parking_lot_core-0.8.5.bazel b/cargo/remote/BUILD.parking_lot_core-0.8.5.bazel new file mode 100644 index 0000000..1ce9abf --- /dev/null +++ b/cargo/remote/BUILD.parking_lot_core-0.8.5.bazel @@ -0,0 +1,150 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "parking_lot_core_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.8.5", + visibility = ["//visibility:private"], + deps = [ + ] + selects.with_or({ + # cfg(unix) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + ], + "//conditions:default": [], + }), +) + +rust_library( + name = "parking_lot_core", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.8.5", + # buildifier: leave-alone + deps = [ + ":parking_lot_core_build_script", + "@raze__cfg_if__1_0_0//:cfg_if", + "@raze__instant__0_1_10//:instant", + "@raze__smallvec__1_6_1//:smallvec", + ] + selects.with_or({ + # cfg(unix) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + ], + "//conditions:default": [], + }), +) diff --git a/ratelimiter/cargo/remote/BUILD.percent-encoding-2.1.0.bazel b/cargo/remote/BUILD.percent-encoding-2.1.0.bazel index 8590f7f..0221fbe 100644 --- a/ratelimiter/cargo/remote/BUILD.percent-encoding-2.1.0.bazel +++ b/cargo/remote/BUILD.percent-encoding-2.1.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.petgraph-0.5.1.bazel b/cargo/remote/BUILD.petgraph-0.5.1.bazel index 9a87d2d..0be98f7 100644 --- a/ratelimiter/cargo/remote/BUILD.petgraph-0.5.1.bazel +++ b/cargo/remote/BUILD.petgraph-0.5.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.pin-project-1.0.8.bazel b/cargo/remote/BUILD.pin-project-1.0.8.bazel index d7a04f7..ace40ef 100644 --- a/ratelimiter/cargo/remote/BUILD.pin-project-1.0.8.bazel +++ b/cargo/remote/BUILD.pin-project-1.0.8.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.pin-project-internal-1.0.8.bazel b/cargo/remote/BUILD.pin-project-internal-1.0.8.bazel index f58e889..46de660 100644 --- a/ratelimiter/cargo/remote/BUILD.pin-project-internal-1.0.8.bazel +++ b/cargo/remote/BUILD.pin-project-internal-1.0.8.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -49,8 +49,8 @@ rust_library( version = "1.0.8", # buildifier: leave-alone deps = [ - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__quote__1_0_9//:quote", - "@raze__syn__1_0_74//:syn", + "@raze__syn__1_0_76//:syn", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.pin-project-lite-0.2.7.bazel b/cargo/remote/BUILD.pin-project-lite-0.2.7.bazel index 2be2f37..8f9e6af 100644 --- a/ratelimiter/cargo/remote/BUILD.pin-project-lite-0.2.7.bazel +++ b/cargo/remote/BUILD.pin-project-lite-0.2.7.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.pin-utils-0.1.0.bazel b/cargo/remote/BUILD.pin-utils-0.1.0.bazel index be0d7d2..94c36d3 100644 --- a/ratelimiter/cargo/remote/BUILD.pin-utils-0.1.0.bazel +++ b/cargo/remote/BUILD.pin-utils-0.1.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.pkg-config-0.3.19.bazel b/cargo/remote/BUILD.pkg-config-0.3.19.bazel new file mode 100644 index 0000000..5c9a7b2 --- /dev/null +++ b/cargo/remote/BUILD.pkg-config-0.3.19.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "pkg_config", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.19", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "test" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.ppv-lite86-0.2.10.bazel b/cargo/remote/BUILD.ppv-lite86-0.2.10.bazel index e86f4d4..24a3f6f 100644 --- a/ratelimiter/cargo/remote/BUILD.ppv-lite86-0.2.10.bazel +++ b/cargo/remote/BUILD.ppv-lite86-0.2.10.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.pretty_env_logger-0.4.0.bazel b/cargo/remote/BUILD.pretty_env_logger-0.4.0.bazel new file mode 100644 index 0000000..ec43539 --- /dev/null +++ b/cargo/remote/BUILD.pretty_env_logger-0.4.0.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "pretty_env_logger", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.0", + # buildifier: leave-alone + deps = [ + "@raze__env_logger__0_7_1//:env_logger", + "@raze__log__0_4_14//:log", + ], +) diff --git a/cargo/remote/BUILD.proc-macro-hack-0.5.19.bazel b/cargo/remote/BUILD.proc-macro-hack-0.5.19.bazel new file mode 100644 index 0000000..8711c6c --- /dev/null +++ b/cargo/remote/BUILD.proc-macro-hack-0.5.19.bazel @@ -0,0 +1,85 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "proc_macro_hack_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.19", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "proc_macro_hack", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.19", + # buildifier: leave-alone + deps = [ + ":proc_macro_hack_build_script", + ], +) + +# Unsupported target "compiletest" with type "test" omitted diff --git a/cargo/remote/BUILD.proc-macro-nested-0.1.7.bazel b/cargo/remote/BUILD.proc-macro-nested-0.1.7.bazel new file mode 100644 index 0000000..82f19cb --- /dev/null +++ b/cargo/remote/BUILD.proc-macro-nested-0.1.7.bazel @@ -0,0 +1,83 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "proc_macro_nested_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.7", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "proc_macro_nested", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.7", + # buildifier: leave-alone + deps = [ + ":proc_macro_nested_build_script", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.proc-macro2-1.0.28.bazel b/cargo/remote/BUILD.proc-macro2-1.0.29.bazel index aa67d4c..df8e530 100644 --- a/ratelimiter/cargo/remote/BUILD.proc-macro2-1.0.28.bazel +++ b/cargo/remote/BUILD.proc-macro2-1.0.29.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -55,7 +55,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "1.0.28", + version = "1.0.29", visibility = ["//visibility:private"], deps = [ ], @@ -79,7 +79,7 @@ rust_library( "cargo-raze", "manual", ], - version = "1.0.28", + version = "1.0.29", # buildifier: leave-alone deps = [ ":proc_macro2_build_script", diff --git a/cargo/remote/BUILD.prometheus-0.12.0.bazel b/cargo/remote/BUILD.prometheus-0.12.0.bazel new file mode 100644 index 0000000..d448c8a --- /dev/null +++ b/cargo/remote/BUILD.prometheus-0.12.0.bazel @@ -0,0 +1,146 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "prometheus_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "default", + "protobuf", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.12.0", + visibility = ["//visibility:private"], + deps = [ + ] + selects.with_or({ + # cfg(target_os = "linux") + ( + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "atomic" with type "bench" omitted + +# Unsupported target "counter" with type "bench" omitted + +# Unsupported target "desc" with type "bench" omitted + +# Unsupported target "gauge" with type "bench" omitted + +# Unsupported target "histogram" with type "bench" omitted + +# Unsupported target "text_encoder" with type "bench" omitted + +# Unsupported target "example_custom_registry" with type "example" omitted + +# Unsupported target "example_edition_2018" with type "example" omitted + +# Unsupported target "example_embed" with type "example" omitted + +# Unsupported target "example_hyper" with type "example" omitted + +# Unsupported target "example_int_metrics" with type "example" omitted + +# Unsupported target "example_process_collector" with type "example" omitted + +# Unsupported target "example_push" with type "example" omitted + +rust_library( + name = "prometheus", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "default", + "protobuf", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.12.0", + # buildifier: leave-alone + deps = [ + ":prometheus_build_script", + "@raze__cfg_if__1_0_0//:cfg_if", + "@raze__fnv__1_0_7//:fnv", + "@raze__lazy_static__1_4_0//:lazy_static", + "@raze__memchr__2_4_1//:memchr", + "@raze__parking_lot__0_11_2//:parking_lot", + "@raze__protobuf__2_25_1//:protobuf", + "@raze__thiserror__1_0_29//:thiserror", + ] + selects.with_or({ + # cfg(target_os = "linux") + ( + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }), +) diff --git a/ratelimiter/cargo/remote/BUILD.prost-0.8.0.bazel b/cargo/remote/BUILD.prost-0.8.0.bazel index 8fef5a6..6d99ea1 100644 --- a/ratelimiter/cargo/remote/BUILD.prost-0.8.0.bazel +++ b/cargo/remote/BUILD.prost-0.8.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -57,6 +57,6 @@ rust_library( version = "0.8.0", # buildifier: leave-alone deps = [ - "@raze__bytes__1_0_1//:bytes", + "@raze__bytes__1_1_0//:bytes", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.prost-build-0.8.0.bazel b/cargo/remote/BUILD.prost-build-0.8.0.bazel index 13030d4..998d95e 100644 --- a/ratelimiter/cargo/remote/BUILD.prost-build-0.8.0.bazel +++ b/cargo/remote/BUILD.prost-build-0.8.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -80,7 +80,7 @@ rust_library( # buildifier: leave-alone deps = [ ":prost_build_build_script", - "@raze__bytes__1_0_1//:bytes", + "@raze__bytes__1_1_0//:bytes", "@raze__heck__0_3_3//:heck", "@raze__itertools__0_10_1//:itertools", "@raze__log__0_4_14//:log", diff --git a/ratelimiter/cargo/remote/BUILD.prost-derive-0.8.0.bazel b/cargo/remote/BUILD.prost-derive-0.8.0.bazel index c716cd5..e573303 100644 --- a/ratelimiter/cargo/remote/BUILD.prost-derive-0.8.0.bazel +++ b/cargo/remote/BUILD.prost-derive-0.8.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -49,10 +49,10 @@ rust_library( version = "0.8.0", # buildifier: leave-alone deps = [ - "@raze__anyhow__1_0_42//:anyhow", + "@raze__anyhow__1_0_43//:anyhow", "@raze__itertools__0_10_1//:itertools", - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__quote__1_0_9//:quote", - "@raze__syn__1_0_74//:syn", + "@raze__syn__1_0_76//:syn", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.prost-types-0.8.0.bazel b/cargo/remote/BUILD.prost-types-0.8.0.bazel index 125311c..97de85a 100644 --- a/ratelimiter/cargo/remote/BUILD.prost-types-0.8.0.bazel +++ b/cargo/remote/BUILD.prost-types-0.8.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -49,7 +49,7 @@ rust_library( version = "0.8.0", # buildifier: leave-alone deps = [ - "@raze__bytes__1_0_1//:bytes", + "@raze__bytes__1_1_0//:bytes", "@raze__prost__0_8_0//:prost", ], ) diff --git a/cargo/remote/BUILD.protobuf-2.25.1.bazel b/cargo/remote/BUILD.protobuf-2.25.1.bazel new file mode 100644 index 0000000..d28e555 --- /dev/null +++ b/cargo/remote/BUILD.protobuf-2.25.1.bazel @@ -0,0 +1,87 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "protobuf_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.25.1", + visibility = ["//visibility:private"], + deps = [ + ], +) + +# Unsupported target "coded_input_stream" with type "bench" omitted + +# Unsupported target "coded_output_stream" with type "bench" omitted + +rust_library( + name = "protobuf", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.25.1", + # buildifier: leave-alone + deps = [ + ":protobuf_build_script", + ], +) diff --git a/cargo/remote/BUILD.quick-error-1.2.3.bazel b/cargo/remote/BUILD.quick-error-1.2.3.bazel new file mode 100644 index 0000000..cb3f9f6 --- /dev/null +++ b/cargo/remote/BUILD.quick-error-1.2.3.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "context" with type "example" omitted + +rust_library( + name = "quick_error", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.2.3", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.quote-1.0.9.bazel b/cargo/remote/BUILD.quote-1.0.9.bazel index 6f26555..746a01b 100644 --- a/ratelimiter/cargo/remote/BUILD.quote-1.0.9.bazel +++ b/cargo/remote/BUILD.quote-1.0.9.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -51,7 +51,7 @@ rust_library( version = "1.0.9", # buildifier: leave-alone deps = [ - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", ], ) diff --git a/cargo/remote/BUILD.rand-0.7.3.bazel b/cargo/remote/BUILD.rand-0.7.3.bazel new file mode 100644 index 0000000..398b8d8 --- /dev/null +++ b/cargo/remote/BUILD.rand-0.7.3.bazel @@ -0,0 +1,100 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "generators" with type "bench" omitted + +# Unsupported target "misc" with type "bench" omitted + +# Unsupported target "seq" with type "bench" omitted + +# Unsupported target "weighted" with type "bench" omitted + +# Unsupported target "monte-carlo" with type "example" omitted + +# Unsupported target "monty-hall" with type "example" omitted + +rust_library( + name = "rand", + srcs = glob(["**/*.rs"]), + aliases = { + "@raze__getrandom__0_1_16//:getrandom": "getrandom_package", + }, + crate_features = [ + "alloc", + "default", + "getrandom", + "getrandom_package", + "libc", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.3", + # buildifier: leave-alone + deps = [ + "@raze__getrandom__0_1_16//:getrandom", + "@raze__rand_chacha__0_2_2//:rand_chacha", + "@raze__rand_core__0_5_1//:rand_core", + ] + selects.with_or({ + # cfg(unix) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }), +) diff --git a/ratelimiter/cargo/remote/BUILD.rand-0.8.4.bazel b/cargo/remote/BUILD.rand-0.8.4.bazel index 2bde5c0..4124443 100644 --- a/ratelimiter/cargo/remote/BUILD.rand-0.8.4.bazel +++ b/cargo/remote/BUILD.rand-0.8.4.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -82,7 +82,7 @@ rust_library( "@rules_rust//rust/platform:x86_64-unknown-freebsd", "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", ): [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ], "//conditions:default": [], }), diff --git a/cargo/remote/BUILD.rand_chacha-0.2.2.bazel b/cargo/remote/BUILD.rand_chacha-0.2.2.bazel new file mode 100644 index 0000000..d21fc71 --- /dev/null +++ b/cargo/remote/BUILD.rand_chacha-0.2.2.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "rand_chacha", + srcs = glob(["**/*.rs"]), + crate_features = [ + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.2", + # buildifier: leave-alone + deps = [ + "@raze__ppv_lite86__0_2_10//:ppv_lite86", + "@raze__rand_core__0_5_1//:rand_core", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.rand_chacha-0.3.1.bazel b/cargo/remote/BUILD.rand_chacha-0.3.1.bazel index 0334e7c..ff704e8 100644 --- a/ratelimiter/cargo/remote/BUILD.rand_chacha-0.3.1.bazel +++ b/cargo/remote/BUILD.rand_chacha-0.3.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.rand_core-0.5.1.bazel b/cargo/remote/BUILD.rand_core-0.5.1.bazel new file mode 100644 index 0000000..5fd89e2 --- /dev/null +++ b/cargo/remote/BUILD.rand_core-0.5.1.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "rand_core", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "getrandom", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.1", + # buildifier: leave-alone + deps = [ + "@raze__getrandom__0_1_16//:getrandom", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.rand_core-0.6.3.bazel b/cargo/remote/BUILD.rand_core-0.6.3.bazel index 36457aa..2faad90 100644 --- a/ratelimiter/cargo/remote/BUILD.rand_core-0.6.3.bazel +++ b/cargo/remote/BUILD.rand_core-0.6.3.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.rand_hc-0.2.0.bazel b/cargo/remote/BUILD.rand_hc-0.2.0.bazel new file mode 100644 index 0000000..12fa787 --- /dev/null +++ b/cargo/remote/BUILD.rand_hc-0.2.0.bazel @@ -0,0 +1,54 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "rand_hc", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.0", + # buildifier: leave-alone + deps = [ + "@raze__rand_core__0_5_1//:rand_core", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.rand_hc-0.3.1.bazel b/cargo/remote/BUILD.rand_hc-0.3.1.bazel index fca28c0..e039352 100644 --- a/ratelimiter/cargo/remote/BUILD.rand_hc-0.3.1.bazel +++ b/cargo/remote/BUILD.rand_hc-0.3.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.redis-0.21.2.bazel b/cargo/remote/BUILD.redis-0.21.2.bazel new file mode 100644 index 0000000..6305a27 --- /dev/null +++ b/cargo/remote/BUILD.redis-0.21.2.bazel @@ -0,0 +1,106 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # BSD-3-Clause from expression "BSD-3-Clause" +]) + +# Generated Targets + +# Unsupported target "bench_basic" with type "bench" omitted + +# Unsupported target "bench_cluster" with type "bench" omitted + +# Unsupported target "async-await" with type "example" omitted + +# Unsupported target "async-connection-loss" with type "example" omitted + +# Unsupported target "async-multiplexed" with type "example" omitted + +# Unsupported target "async-pub-sub" with type "example" omitted + +# Unsupported target "async-scan" with type "example" omitted + +# Unsupported target "basic" with type "example" omitted + +# Unsupported target "geospatial" with type "example" omitted + +# Unsupported target "streams" with type "example" omitted + +rust_library( + name = "redis", + srcs = glob(["**/*.rs"]), + crate_features = [ + "acl", + "default", + "geospatial", + "script", + "sha1", + "streams", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + proc_macro_deps = [ + "@raze__async_trait__0_1_51//:async_trait", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.21.2", + # buildifier: leave-alone + deps = [ + "@raze__combine__4_6_1//:combine", + "@raze__dtoa__0_4_8//:dtoa", + "@raze__itoa__0_4_8//:itoa", + "@raze__percent_encoding__2_1_0//:percent_encoding", + "@raze__sha1__0_6_0//:sha1", + "@raze__url__2_2_2//:url", + ], +) + +# Unsupported target "parser" with type "test" omitted + +# Unsupported target "test_acl" with type "test" omitted + +# Unsupported target "test_async" with type "test" omitted + +# Unsupported target "test_async_async_std" with type "test" omitted + +# Unsupported target "test_basic" with type "test" omitted + +# Unsupported target "test_cluster" with type "test" omitted + +# Unsupported target "test_geospatial" with type "test" omitted + +# Unsupported target "test_streams" with type "test" omitted + +# Unsupported target "test_types" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.redox_syscall-0.2.10.bazel b/cargo/remote/BUILD.redox_syscall-0.2.10.bazel index 094ddf9..3400261 100644 --- a/ratelimiter/cargo/remote/BUILD.redox_syscall-0.2.10.bazel +++ b/cargo/remote/BUILD.redox_syscall-0.2.10.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -58,6 +58,6 @@ rust_library( version = "0.2.10", # buildifier: leave-alone deps = [ - "@raze__bitflags__1_2_1//:bitflags", + "@raze__bitflags__1_3_2//:bitflags", ], ) diff --git a/cargo/remote/BUILD.regex-1.5.4.bazel b/cargo/remote/BUILD.regex-1.5.4.bazel new file mode 100644 index 0000000..6378e12 --- /dev/null +++ b/cargo/remote/BUILD.regex-1.5.4.bazel @@ -0,0 +1,103 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "shootout-regex-dna" with type "example" omitted + +# Unsupported target "shootout-regex-dna-bytes" with type "example" omitted + +# Unsupported target "shootout-regex-dna-cheat" with type "example" omitted + +# Unsupported target "shootout-regex-dna-replace" with type "example" omitted + +# Unsupported target "shootout-regex-dna-single" with type "example" omitted + +# Unsupported target "shootout-regex-dna-single-cheat" with type "example" omitted + +rust_library( + name = "regex", + srcs = glob(["**/*.rs"]), + crate_features = [ + "aho-corasick", + "default", + "memchr", + "perf", + "perf-cache", + "perf-dfa", + "perf-inline", + "perf-literal", + "std", + "unicode", + "unicode-age", + "unicode-bool", + "unicode-case", + "unicode-gencat", + "unicode-perl", + "unicode-script", + "unicode-segment", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.5.4", + # buildifier: leave-alone + deps = [ + "@raze__aho_corasick__0_7_18//:aho_corasick", + "@raze__memchr__2_4_1//:memchr", + "@raze__regex_syntax__0_6_25//:regex_syntax", + ], +) + +# Unsupported target "backtrack" with type "test" omitted + +# Unsupported target "backtrack-bytes" with type "test" omitted + +# Unsupported target "backtrack-utf8bytes" with type "test" omitted + +# Unsupported target "crates-regex" with type "test" omitted + +# Unsupported target "default" with type "test" omitted + +# Unsupported target "default-bytes" with type "test" omitted + +# Unsupported target "nfa" with type "test" omitted + +# Unsupported target "nfa-bytes" with type "test" omitted + +# Unsupported target "nfa-utf8bytes" with type "test" omitted diff --git a/cargo/remote/BUILD.regex-syntax-0.6.25.bazel b/cargo/remote/BUILD.regex-syntax-0.6.25.bazel new file mode 100644 index 0000000..54de346 --- /dev/null +++ b/cargo/remote/BUILD.regex-syntax-0.6.25.bazel @@ -0,0 +1,64 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "bench" with type "bench" omitted + +rust_library( + name = "regex_syntax", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "unicode", + "unicode-age", + "unicode-bool", + "unicode-case", + "unicode-gencat", + "unicode-perl", + "unicode-script", + "unicode-segment", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.6.25", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.remove_dir_all-0.5.3.bazel b/cargo/remote/BUILD.remove_dir_all-0.5.3.bazel index 3bf03e6..c78ef80 100644 --- a/ratelimiter/cargo/remote/BUILD.remove_dir_all-0.5.3.bazel +++ b/cargo/remote/BUILD.remove_dir_all-0.5.3.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.ring-0.16.20.bazel b/cargo/remote/BUILD.ring-0.16.20.bazel new file mode 100644 index 0000000..feef50e --- /dev/null +++ b/cargo/remote/BUILD.ring-0.16.20.bazel @@ -0,0 +1,309 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "restricted", # no license +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "ring_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "alloc", + "default", + "dev_urandom_fallback", + "once_cell", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + links = "ring-asm", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.16.20", + visibility = ["//visibility:private"], + deps = [ + "@raze__cc__1_0_70//:cc", + ] + selects.with_or({ + # cfg(all(target_arch = "wasm32", target_vendor = "unknown", target_os = "unknown", target_env = "")) + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + ): [ + "@raze__web_sys__0_3_53//:web_sys", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(target_arch = "x86", target_arch = "x86_64", all(any(target_arch = "aarch64", target_arch = "arm"), any(target_os = "android", target_os = "fuchsia", target_os = "linux")))) + ( + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(target_os = "android", target_os = "linux")) + ( + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(target_os = "dragonfly", target_os = "freebsd", target_os = "illumos", target_os = "netbsd", target_os = "openbsd", target_os = "solaris")) + ( + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(unix, windows)) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_arch = "wasm32") + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_os = "windows") + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + ], + "//conditions:default": [], + }), +) + +rust_library( + name = "ring", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "alloc", + "default", + "dev_urandom_fallback", + "once_cell", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + compile_data = glob(["*/**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.16.20", + # buildifier: leave-alone + deps = [ + ":ring_build_script", + "@raze__once_cell__1_8_0//:once_cell", + "@raze__untrusted__0_7_1//:untrusted", + ] + selects.with_or({ + # cfg(all(target_arch = "wasm32", target_vendor = "unknown", target_os = "unknown", target_env = "")) + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + ): [ + "@raze__web_sys__0_3_53//:web_sys", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(target_arch = "x86", target_arch = "x86_64", all(any(target_arch = "aarch64", target_arch = "arm"), any(target_os = "android", target_os = "fuchsia", target_os = "linux")))) + ( + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__spin__0_5_2//:spin", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(target_os = "android", target_os = "linux")) + ( + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__libc__0_2_101//:libc", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(target_os = "dragonfly", target_os = "freebsd", target_os = "illumos", target_os = "netbsd", target_os = "openbsd", target_os = "solaris")) + ( + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(any(unix, windows)) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_arch = "wasm32") + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_os = "windows") + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + ], + "//conditions:default": [], + }), +) + +# Unsupported target "aead_tests" with type "test" omitted + +# Unsupported target "agreement_tests" with type "test" omitted + +# Unsupported target "constant_time_tests" with type "test" omitted + +# Unsupported target "digest_tests" with type "test" omitted + +# Unsupported target "ecdsa_tests" with type "test" omitted + +# Unsupported target "ed25519_tests" with type "test" omitted + +# Unsupported target "hkdf_tests" with type "test" omitted + +# Unsupported target "hmac_tests" with type "test" omitted + +# Unsupported target "pbkdf2_tests" with type "test" omitted + +# Unsupported target "quic_tests" with type "test" omitted + +# Unsupported target "rand_tests" with type "test" omitted + +# Unsupported target "rsa_tests" with type "test" omitted + +# Unsupported target "signature_tests" with type "test" omitted diff --git a/cargo/remote/BUILD.rust-ini-0.13.0.bazel b/cargo/remote/BUILD.rust-ini-0.13.0.bazel new file mode 100644 index 0000000..9a942ee --- /dev/null +++ b/cargo/remote/BUILD.rust-ini-0.13.0.bazel @@ -0,0 +1,64 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +# Unsupported target "test" with type "example" omitted + +alias( + name = "rust_ini", + actual = ":ini", + tags = [ + "cargo-raze", + "manual", + ], +) + +rust_library( + name = "ini", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.13.0", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.rustls-0.19.1.bazel b/cargo/remote/BUILD.rustls-0.19.1.bazel new file mode 100644 index 0000000..3cc63a9 --- /dev/null +++ b/cargo/remote/BUILD.rustls-0.19.1.bazel @@ -0,0 +1,79 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR (ISC OR MIT)" +]) + +# Generated Targets + +# Unsupported target "benchmarks" with type "bench" omitted + +# Unsupported target "bench" with type "example" omitted + +# Unsupported target "bogo_shim" with type "example" omitted + +# Unsupported target "limitedclient" with type "example" omitted + +# Unsupported target "simple_0rtt_client" with type "example" omitted + +# Unsupported target "simpleclient" with type "example" omitted + +# Unsupported target "trytls_shim" with type "example" omitted + +rust_library( + name = "rustls", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "log", + "logging", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.19.1", + # buildifier: leave-alone + deps = [ + "@raze__base64__0_13_0//:base64", + "@raze__log__0_4_14//:log", + "@raze__ring__0_16_20//:ring", + "@raze__sct__0_6_1//:sct", + "@raze__webpki__0_21_4//:webpki", + ], +) + +# Unsupported target "api" with type "test" omitted + +# Unsupported target "benchmarks" with type "test" omitted diff --git a/cargo/remote/BUILD.rustls-native-certs-0.5.0.bazel b/cargo/remote/BUILD.rustls-native-certs-0.5.0.bazel new file mode 100644 index 0000000..49077cd --- /dev/null +++ b/cargo/remote/BUILD.rustls-native-certs-0.5.0.bazel @@ -0,0 +1,103 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR (ISC OR MIT)" +]) + +# Generated Targets + +# Unsupported target "google" with type "example" omitted + +rust_library( + name = "rustls_native_certs", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "default", + "rustls", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.0", + # buildifier: leave-alone + deps = [ + "@raze__rustls__0_19_1//:rustls", + ] + selects.with_or({ + # cfg(all(unix, not(target_os = "macos"))) + ( + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:arm-unknown-linux-gnueabi", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:powerpc-unknown-linux-gnu", + "@rules_rust//rust/platform:s390x-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__openssl_probe__0_1_4//:openssl_probe", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(target_os = "macos") + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-darwin", + ): [ + "@raze__security_framework__2_4_2//:security_framework", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__schannel__0_1_19//:schannel", + ], + "//conditions:default": [], + }), +) + +# Unsupported target "compare_mozilla" with type "test" omitted + +# Unsupported target "smoketests" with type "test" omitted diff --git a/cargo/remote/BUILD.ryu-1.0.5.bazel b/cargo/remote/BUILD.ryu-1.0.5.bazel new file mode 100644 index 0000000..f9d1a6e --- /dev/null +++ b/cargo/remote/BUILD.ryu-1.0.5.bazel @@ -0,0 +1,101 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR BSL-1.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "ryu_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.5", + visibility = ["//visibility:private"], + deps = [ + ], +) + +# Unsupported target "bench" with type "bench" omitted + +# Unsupported target "upstream_benchmark" with type "example" omitted + +rust_library( + name = "ryu", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.5", + # buildifier: leave-alone + deps = [ + ":ryu_build_script", + ], +) + +# Unsupported target "common_test" with type "test" omitted + +# Unsupported target "d2s_table_test" with type "test" omitted + +# Unsupported target "d2s_test" with type "test" omitted + +# Unsupported target "exhaustive" with type "test" omitted + +# Unsupported target "f2s_test" with type "test" omitted + +# Unsupported target "s2d_test" with type "test" omitted + +# Unsupported target "s2f_test" with type "test" omitted diff --git a/cargo/remote/BUILD.same-file-1.0.6.bazel b/cargo/remote/BUILD.same-file-1.0.6.bazel new file mode 100644 index 0000000..b4e035c --- /dev/null +++ b/cargo/remote/BUILD.same-file-1.0.6.bazel @@ -0,0 +1,68 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "unencumbered", # Unlicense from expression "Unlicense OR MIT" +]) + +# Generated Targets + +# Unsupported target "is_same_file" with type "example" omitted + +# Unsupported target "is_stderr" with type "example" omitted + +rust_library( + name = "same_file", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.6", + # buildifier: leave-alone + deps = [ + ] + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi_util__0_1_5//:winapi_util", + ], + "//conditions:default": [], + }), +) diff --git a/cargo/remote/BUILD.schannel-0.1.19.bazel b/cargo/remote/BUILD.schannel-0.1.19.bazel new file mode 100644 index 0000000..95946d6 --- /dev/null +++ b/cargo/remote/BUILD.schannel-0.1.19.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +rust_library( + name = "schannel", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.19", + # buildifier: leave-alone + deps = [ + "@raze__lazy_static__1_4_0//:lazy_static", + "@raze__winapi__0_3_9//:winapi", + ], +) diff --git a/cargo/remote/BUILD.scopeguard-1.1.0.bazel b/cargo/remote/BUILD.scopeguard-1.1.0.bazel new file mode 100644 index 0000000..2b93721 --- /dev/null +++ b/cargo/remote/BUILD.scopeguard-1.1.0.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "readme" with type "example" omitted + +rust_library( + name = "scopeguard", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.1.0", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.sct-0.6.1.bazel b/cargo/remote/BUILD.sct-0.6.1.bazel new file mode 100644 index 0000000..af21d62 --- /dev/null +++ b/cargo/remote/BUILD.sct-0.6.1.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR (ISC OR MIT)" +]) + +# Generated Targets + +rust_library( + name = "sct", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.6.1", + # buildifier: leave-alone + deps = [ + "@raze__ring__0_16_20//:ring", + "@raze__untrusted__0_7_1//:untrusted", + ], +) diff --git a/cargo/remote/BUILD.security-framework-2.4.2.bazel b/cargo/remote/BUILD.security-framework-2.4.2.bazel new file mode 100644 index 0000000..ca08f2b --- /dev/null +++ b/cargo/remote/BUILD.security-framework-2.4.2.bazel @@ -0,0 +1,66 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "client" with type "example" omitted + +# Unsupported target "find_internet_password" with type "example" omitted + +# Unsupported target "set_internet_password" with type "example" omitted + +rust_library( + name = "security_framework", + srcs = glob(["**/*.rs"]), + crate_features = [ + "OSX_10_9", + "default", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.4.2", + # buildifier: leave-alone + deps = [ + "@raze__bitflags__1_3_2//:bitflags", + "@raze__core_foundation__0_9_1//:core_foundation", + "@raze__core_foundation_sys__0_8_2//:core_foundation_sys", + "@raze__libc__0_2_101//:libc", + "@raze__security_framework_sys__2_4_2//:security_framework_sys", + ], +) diff --git a/cargo/remote/BUILD.security-framework-sys-2.4.2.bazel b/cargo/remote/BUILD.security-framework-sys-2.4.2.bazel new file mode 100644 index 0000000..329b304 --- /dev/null +++ b/cargo/remote/BUILD.security-framework-sys-2.4.2.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "security_framework_sys", + srcs = glob(["**/*.rs"]), + crate_features = [ + "OSX_10_9", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.4.2", + # buildifier: leave-alone + deps = [ + "@raze__core_foundation_sys__0_8_2//:core_foundation_sys", + "@raze__libc__0_2_101//:libc", + ], +) diff --git a/cargo/remote/BUILD.serde-0.8.23.bazel b/cargo/remote/BUILD.serde-0.8.23.bazel new file mode 100644 index 0000000..2854dbe --- /dev/null +++ b/cargo/remote/BUILD.serde-0.8.23.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "serde", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.8.23", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.serde-1.0.130.bazel b/cargo/remote/BUILD.serde-1.0.130.bazel new file mode 100644 index 0000000..6cfd392 --- /dev/null +++ b/cargo/remote/BUILD.serde-1.0.130.bazel @@ -0,0 +1,94 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "serde_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "default", + "derive", + "serde_derive", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.130", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "serde", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "derive", + "serde_derive", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + proc_macro_deps = [ + "@raze__serde_derive__1_0_130//:serde_derive", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.130", + # buildifier: leave-alone + deps = [ + ":serde_build_script", + ], +) diff --git a/cargo/remote/BUILD.serde-hjson-0.9.1.bazel b/cargo/remote/BUILD.serde-hjson-0.9.1.bazel new file mode 100644 index 0000000..cca7f07 --- /dev/null +++ b/cargo/remote/BUILD.serde-hjson-0.9.1.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +rust_library( + name = "serde_hjson", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.1", + # buildifier: leave-alone + deps = [ + "@raze__lazy_static__1_4_0//:lazy_static", + "@raze__num_traits__0_1_43//:num_traits", + "@raze__regex__1_5_4//:regex", + "@raze__serde__0_8_23//:serde", + ], +) diff --git a/cargo/remote/BUILD.serde_derive-1.0.130.bazel b/cargo/remote/BUILD.serde_derive-1.0.130.bazel new file mode 100644 index 0000000..1309021 --- /dev/null +++ b/cargo/remote/BUILD.serde_derive-1.0.130.bazel @@ -0,0 +1,88 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "serde_derive_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "default", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.130", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "serde_derive", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.130", + # buildifier: leave-alone + deps = [ + ":serde_derive_build_script", + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + ], +) diff --git a/cargo/remote/BUILD.serde_json-1.0.67.bazel b/cargo/remote/BUILD.serde_json-1.0.67.bazel new file mode 100644 index 0000000..e0ba4f0 --- /dev/null +++ b/cargo/remote/BUILD.serde_json-1.0.67.bazel @@ -0,0 +1,90 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "serde_json_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "default", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.67", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "serde_json", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.67", + # buildifier: leave-alone + deps = [ + ":serde_json_build_script", + "@raze__itoa__0_4_8//:itoa", + "@raze__ryu__1_0_5//:ryu", + "@raze__serde__1_0_130//:serde", + ], +) diff --git a/cargo/remote/BUILD.serde_repr-0.1.7.bazel b/cargo/remote/BUILD.serde_repr-0.1.7.bazel new file mode 100644 index 0000000..b61dcb5 --- /dev/null +++ b/cargo/remote/BUILD.serde_repr-0.1.7.bazel @@ -0,0 +1,60 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "serde_repr", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.7", + # buildifier: leave-alone + deps = [ + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + ], +) + +# Unsupported target "compiletest" with type "test" omitted + +# Unsupported target "test" with type "test" omitted diff --git a/cargo/remote/BUILD.sha-1-0.9.8.bazel b/cargo/remote/BUILD.sha-1-0.9.8.bazel new file mode 100644 index 0000000..6e3d958 --- /dev/null +++ b/cargo/remote/BUILD.sha-1-0.9.8.bazel @@ -0,0 +1,98 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "lib" with type "bench" omitted + +# Unsupported target "sha1sum" with type "example" omitted + +alias( + name = "sha_1", + actual = ":sha1", + tags = [ + "cargo-raze", + "manual", + ], +) + +rust_library( + name = "sha1", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.8", + # buildifier: leave-alone + deps = [ + "@raze__block_buffer__0_9_0//:block_buffer", + "@raze__cfg_if__1_0_0//:cfg_if", + "@raze__digest__0_9_0//:digest", + "@raze__opaque_debug__0_3_0//:opaque_debug", + ] + selects.with_or({ + # cfg(any(target_arch = "aarch64", target_arch = "x86", target_arch = "x86_64")) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__cpufeatures__0_2_1//:cpufeatures", + ], + "//conditions:default": [], + }), +) + +# Unsupported target "lib" with type "test" omitted diff --git a/cargo/remote/BUILD.sha1-0.6.0.bazel b/cargo/remote/BUILD.sha1-0.6.0.bazel new file mode 100644 index 0000000..ff6989f --- /dev/null +++ b/cargo/remote/BUILD.sha1-0.6.0.bazel @@ -0,0 +1,53 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # BSD-3-Clause from expression "BSD-3-Clause" +]) + +# Generated Targets + +rust_library( + name = "sha1", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.6.0", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.sha2-0.9.6.bazel b/cargo/remote/BUILD.sha2-0.9.6.bazel new file mode 100644 index 0000000..9ebd0ed --- /dev/null +++ b/cargo/remote/BUILD.sha2-0.9.6.bazel @@ -0,0 +1,91 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "sha256" with type "bench" omitted + +# Unsupported target "sha512" with type "bench" omitted + +# Unsupported target "sha256sum" with type "example" omitted + +# Unsupported target "sha512sum" with type "example" omitted + +rust_library( + name = "sha2", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.6", + # buildifier: leave-alone + deps = [ + "@raze__block_buffer__0_9_0//:block_buffer", + "@raze__cfg_if__1_0_0//:cfg_if", + "@raze__digest__0_9_0//:digest", + "@raze__opaque_debug__0_3_0//:opaque_debug", + ] + selects.with_or({ + # cfg(any(target_arch = "aarch64", target_arch = "x86_64", target_arch = "x86")) + ( + "@rules_rust//rust/platform:aarch64-apple-darwin", + "@rules_rust//rust/platform:aarch64-apple-ios", + "@rules_rust//rust/platform:aarch64-linux-android", + "@rules_rust//rust/platform:aarch64-unknown-linux-gnu", + "@rules_rust//rust/platform:i686-apple-darwin", + "@rules_rust//rust/platform:i686-linux-android", + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:i686-unknown-freebsd", + "@rules_rust//rust/platform:i686-unknown-linux-gnu", + "@rules_rust//rust/platform:x86_64-apple-darwin", + "@rules_rust//rust/platform:x86_64-apple-ios", + "@rules_rust//rust/platform:x86_64-linux-android", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-unknown-freebsd", + "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", + ): [ + "@raze__cpufeatures__0_2_1//:cpufeatures", + ], + "//conditions:default": [], + }), +) + +# Unsupported target "lib" with type "test" omitted diff --git a/cargo/remote/BUILD.signal-hook-registry-1.4.0.bazel b/cargo/remote/BUILD.signal-hook-registry-1.4.0.bazel new file mode 100644 index 0000000..cf5369a --- /dev/null +++ b/cargo/remote/BUILD.signal-hook-registry-1.4.0.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "signal_hook_registry", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.4.0", + # buildifier: leave-alone + deps = [ + "@raze__libc__0_2_101//:libc", + ], +) + +# Unsupported target "unregister_signal" with type "test" omitted diff --git a/cargo/remote/BUILD.signatory-0.21.0.bazel b/cargo/remote/BUILD.signatory-0.21.0.bazel new file mode 100644 index 0000000..7ce28a3 --- /dev/null +++ b/cargo/remote/BUILD.signatory-0.21.0.bazel @@ -0,0 +1,63 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "signatory", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "default", + "encoding", + "getrandom", + "std", + "subtle-encoding", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.21.0", + # buildifier: leave-alone + deps = [ + "@raze__getrandom__0_1_16//:getrandom", + "@raze__signature__1_3_1//:signature", + "@raze__subtle_encoding__0_5_1//:subtle_encoding", + "@raze__zeroize__1_4_1//:zeroize", + ], +) diff --git a/cargo/remote/BUILD.signature-1.3.1.bazel b/cargo/remote/BUILD.signature-1.3.1.bazel new file mode 100644 index 0000000..8244a6d --- /dev/null +++ b/cargo/remote/BUILD.signature-1.3.1.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "signature", + srcs = glob(["**/*.rs"]), + crate_features = [ + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.3.1", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "signature_derive" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.slab-0.4.4.bazel b/cargo/remote/BUILD.slab-0.4.4.bazel index 8f2b4e1..6bd848e 100644 --- a/ratelimiter/cargo/remote/BUILD.slab-0.4.4.bazel +++ b/cargo/remote/BUILD.slab-0.4.4.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.smallvec-1.6.1.bazel b/cargo/remote/BUILD.smallvec-1.6.1.bazel new file mode 100644 index 0000000..8e7e2be --- /dev/null +++ b/cargo/remote/BUILD.smallvec-1.6.1.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "bench" with type "bench" omitted + +rust_library( + name = "smallvec", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.6.1", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "macro" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.socket2-0.4.1.bazel b/cargo/remote/BUILD.socket2-0.4.1.bazel index bf725df..cad64d8 100644 --- a/ratelimiter/cargo/remote/BUILD.socket2-0.4.1.bazel +++ b/cargo/remote/BUILD.socket2-0.4.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -71,7 +71,7 @@ rust_library( "@rules_rust//rust/platform:x86_64-unknown-freebsd", "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", ): [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ], "//conditions:default": [], }) + selects.with_or({ diff --git a/cargo/remote/BUILD.spin-0.5.2.bazel b/cargo/remote/BUILD.spin-0.5.2.bazel new file mode 100644 index 0000000..54893d1 --- /dev/null +++ b/cargo/remote/BUILD.spin-0.5.2.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +# Unsupported target "debug" with type "example" omitted + +rust_library( + name = "spin", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.2", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.static_assertions-1.1.0.bazel b/cargo/remote/BUILD.static_assertions-1.1.0.bazel new file mode 100644 index 0000000..803ede3 --- /dev/null +++ b/cargo/remote/BUILD.static_assertions-1.1.0.bazel @@ -0,0 +1,53 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "static_assertions", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.1.0", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.subtle-2.4.1.bazel b/cargo/remote/BUILD.subtle-2.4.1.bazel new file mode 100644 index 0000000..e9e4f15 --- /dev/null +++ b/cargo/remote/BUILD.subtle-2.4.1.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # BSD-3-Clause from expression "BSD-3-Clause" +]) + +# Generated Targets + +rust_library( + name = "subtle", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.4.1", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "mod" with type "test" omitted diff --git a/cargo/remote/BUILD.subtle-encoding-0.5.1.bazel b/cargo/remote/BUILD.subtle-encoding-0.5.1.bazel new file mode 100644 index 0000000..4644385 --- /dev/null +++ b/cargo/remote/BUILD.subtle-encoding-0.5.1.bazel @@ -0,0 +1,59 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "subtle_encoding", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "base64", + "hex", + "std", + "zeroize", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.1", + # buildifier: leave-alone + deps = [ + "@raze__zeroize__1_4_1//:zeroize", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.syn-1.0.74.bazel b/cargo/remote/BUILD.syn-1.0.76.bazel index 4464362..5127852 100644 --- a/ratelimiter/cargo/remote/BUILD.syn-1.0.74.bazel +++ b/cargo/remote/BUILD.syn-1.0.76.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -64,7 +64,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "1.0.74", + version = "1.0.76", visibility = ["//visibility:private"], deps = [ ], @@ -101,11 +101,11 @@ rust_library( "cargo-raze", "manual", ], - version = "1.0.74", + version = "1.0.76", # buildifier: leave-alone deps = [ ":syn_build_script", - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__quote__1_0_9//:quote", "@raze__unicode_xid__0_2_2//:unicode_xid", ], diff --git a/cargo/remote/BUILD.synstructure-0.12.5.bazel b/cargo/remote/BUILD.synstructure-0.12.5.bazel new file mode 100644 index 0000000..50873b0 --- /dev/null +++ b/cargo/remote/BUILD.synstructure-0.12.5.bazel @@ -0,0 +1,59 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +rust_library( + name = "synstructure", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "proc-macro", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.12.5", + # buildifier: leave-alone + deps = [ + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + "@raze__unicode_xid__0_2_2//:unicode_xid", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.tempfile-3.2.0.bazel b/cargo/remote/BUILD.tempfile-3.2.0.bazel index 6a4e0d3..a1e8a67 100644 --- a/ratelimiter/cargo/remote/BUILD.tempfile-3.2.0.bazel +++ b/cargo/remote/BUILD.tempfile-3.2.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -74,7 +74,7 @@ rust_library( "@rules_rust//rust/platform:x86_64-unknown-freebsd", "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", ): [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ], "//conditions:default": [], }) + selects.with_or({ diff --git a/cargo/remote/BUILD.termcolor-1.1.2.bazel b/cargo/remote/BUILD.termcolor-1.1.2.bazel new file mode 100644 index 0000000..d3aa978 --- /dev/null +++ b/cargo/remote/BUILD.termcolor-1.1.2.bazel @@ -0,0 +1,64 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "unencumbered", # Unlicense from expression "Unlicense OR MIT" +]) + +# Generated Targets + +rust_library( + name = "termcolor", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.1.2", + # buildifier: leave-alone + deps = [ + ] + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi_util__0_1_5//:winapi_util", + ], + "//conditions:default": [], + }), +) diff --git a/cargo/remote/BUILD.thiserror-1.0.29.bazel b/cargo/remote/BUILD.thiserror-1.0.29.bazel new file mode 100644 index 0000000..a9e47d3 --- /dev/null +++ b/cargo/remote/BUILD.thiserror-1.0.29.bazel @@ -0,0 +1,80 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "thiserror", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + proc_macro_deps = [ + "@raze__thiserror_impl__1_0_29//:thiserror_impl", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.29", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "compiletest" with type "test" omitted + +# Unsupported target "test_backtrace" with type "test" omitted + +# Unsupported target "test_display" with type "test" omitted + +# Unsupported target "test_error" with type "test" omitted + +# Unsupported target "test_expr" with type "test" omitted + +# Unsupported target "test_from" with type "test" omitted + +# Unsupported target "test_generics" with type "test" omitted + +# Unsupported target "test_lints" with type "test" omitted + +# Unsupported target "test_option" with type "test" omitted + +# Unsupported target "test_path" with type "test" omitted + +# Unsupported target "test_source" with type "test" omitted + +# Unsupported target "test_transparent" with type "test" omitted diff --git a/cargo/remote/BUILD.thiserror-impl-1.0.29.bazel b/cargo/remote/BUILD.thiserror-impl-1.0.29.bazel new file mode 100644 index 0000000..6492e1f --- /dev/null +++ b/cargo/remote/BUILD.thiserror-impl-1.0.29.bazel @@ -0,0 +1,56 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "thiserror_impl", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.0.29", + # buildifier: leave-alone + deps = [ + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + ], +) diff --git a/cargo/remote/BUILD.time-0.1.44.bazel b/cargo/remote/BUILD.time-0.1.44.bazel new file mode 100644 index 0000000..980ab5f --- /dev/null +++ b/cargo/remote/BUILD.time-0.1.44.bazel @@ -0,0 +1,73 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "time", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.44", + # buildifier: leave-alone + deps = [ + "@raze__libc__0_2_101//:libc", + ] + selects.with_or({ + # cfg(target_os = "wasi") + ( + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + "@raze__wasi__0_10_0_wasi_snapshot_preview1//:wasi", + ], + "//conditions:default": [], + }) + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + ], + "//conditions:default": [], + }), +) diff --git a/cargo/remote/BUILD.tinyvec-1.3.1.bazel b/cargo/remote/BUILD.tinyvec-1.3.1.bazel new file mode 100644 index 0000000..a5f5f38 --- /dev/null +++ b/cargo/remote/BUILD.tinyvec-1.3.1.bazel @@ -0,0 +1,63 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Zlib from expression "Zlib OR (Apache-2.0 OR MIT)" +]) + +# Generated Targets + +# Unsupported target "macros" with type "bench" omitted + +rust_library( + name = "tinyvec", + srcs = glob(["**/*.rs"]), + crate_features = [ + "alloc", + "default", + "tinyvec_macros", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.3.1", + # buildifier: leave-alone + deps = [ + "@raze__tinyvec_macros__0_1_0//:tinyvec_macros", + ], +) + +# Unsupported target "arrayvec" with type "test" omitted + +# Unsupported target "tinyvec" with type "test" omitted diff --git a/cargo/remote/BUILD.tinyvec_macros-0.1.0.bazel b/cargo/remote/BUILD.tinyvec_macros-0.1.0.bazel new file mode 100644 index 0000000..dee1d60 --- /dev/null +++ b/cargo/remote/BUILD.tinyvec_macros-0.1.0.bazel @@ -0,0 +1,53 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR (Apache-2.0 OR Zlib)" +]) + +# Generated Targets + +rust_library( + name = "tinyvec_macros", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.0", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.tokio-1.9.0.bazel b/cargo/remote/BUILD.tokio-1.11.0.bazel index b5e9bb5..a4d8b6a 100644 --- a/ratelimiter/cargo/remote/BUILD.tokio-1.9.0.bazel +++ b/cargo/remote/BUILD.tokio-1.11.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -44,6 +44,8 @@ cargo_build_script( crate_features = [ "bytes", "default", + "fs", + "full", "io-std", "io-util", "libc", @@ -52,8 +54,13 @@ cargo_build_script( "mio", "net", "num_cpus", + "once_cell", + "parking_lot", + "process", "rt", "rt-multi-thread", + "signal", + "signal-hook-registry", "sync", "time", "tokio-macros", @@ -69,7 +76,7 @@ cargo_build_script( "cargo-raze", "manual", ], - version = "1.9.0", + version = "1.11.0", visibility = ["//visibility:private"], deps = [ "@raze__autocfg__1_0_1//:autocfg", @@ -114,6 +121,8 @@ rust_library( crate_features = [ "bytes", "default", + "fs", + "full", "io-std", "io-util", "libc", @@ -122,8 +131,13 @@ rust_library( "mio", "net", "num_cpus", + "once_cell", + "parking_lot", + "process", "rt", "rt-multi-thread", + "signal", + "signal-hook-registry", "sync", "time", "tokio-macros", @@ -143,14 +157,16 @@ rust_library( "cargo-raze", "manual", ], - version = "1.9.0", + version = "1.11.0", # buildifier: leave-alone deps = [ ":tokio_build_script", - "@raze__bytes__1_0_1//:bytes", - "@raze__memchr__2_4_0//:memchr", + "@raze__bytes__1_1_0//:bytes", + "@raze__memchr__2_4_1//:memchr", "@raze__mio__0_7_13//:mio", "@raze__num_cpus__1_13_0//:num_cpus", + "@raze__once_cell__1_8_0//:once_cell", + "@raze__parking_lot__0_11_2//:parking_lot", "@raze__pin_project_lite__0_2_7//:pin_project_lite", ] + selects.with_or({ # cfg(unix) @@ -172,7 +188,8 @@ rust_library( "@rules_rust//rust/platform:x86_64-unknown-freebsd", "@rules_rust//rust/platform:x86_64-unknown-linux-gnu", ): [ - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", + "@raze__signal_hook_registry__1_4_0//:signal_hook_registry", ], "//conditions:default": [], }) + selects.with_or({ @@ -201,8 +218,6 @@ rust_library( # Unsupported target "fs_file" with type "test" omitted -# Unsupported target "fs_file_mocked" with type "test" omitted - # Unsupported target "fs_link" with type "test" omitted # Unsupported target "io_async_fd" with type "test" omitted @@ -223,6 +238,8 @@ rust_library( # Unsupported target "io_driver_drop" with type "test" omitted +# Unsupported target "io_fill_buf" with type "test" omitted + # Unsupported target "io_lines" with type "test" omitted # Unsupported target "io_mem_stream" with type "test" omitted @@ -273,12 +290,16 @@ rust_library( # Unsupported target "no_rt" with type "test" omitted +# Unsupported target "process_arg0" with type "test" omitted + # Unsupported target "process_issue_2174" with type "test" omitted # Unsupported target "process_issue_42" with type "test" omitted # Unsupported target "process_kill_on_drop" with type "test" omitted +# Unsupported target "process_raw_handle" with type "test" omitted + # Unsupported target "process_smoke" with type "test" omitted # Unsupported target "rt_basic" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.tokio-io-timeout-1.1.1.bazel b/cargo/remote/BUILD.tokio-io-timeout-1.1.1.bazel index f3e77dd..33a8951 100644 --- a/ratelimiter/cargo/remote/BUILD.tokio-io-timeout-1.1.1.bazel +++ b/cargo/remote/BUILD.tokio-io-timeout-1.1.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -50,6 +50,6 @@ rust_library( # buildifier: leave-alone deps = [ "@raze__pin_project_lite__0_2_7//:pin_project_lite", - "@raze__tokio__1_9_0//:tokio", + "@raze__tokio__1_11_0//:tokio", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.tokio-macros-1.3.0.bazel b/cargo/remote/BUILD.tokio-macros-1.3.0.bazel index e7509e9..6ed6ee2 100644 --- a/ratelimiter/cargo/remote/BUILD.tokio-macros-1.3.0.bazel +++ b/cargo/remote/BUILD.tokio-macros-1.3.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -49,8 +49,8 @@ rust_library( version = "1.3.0", # buildifier: leave-alone deps = [ - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__quote__1_0_9//:quote", - "@raze__syn__1_0_74//:syn", + "@raze__syn__1_0_76//:syn", ], ) diff --git a/cargo/remote/BUILD.tokio-rustls-0.22.0.bazel b/cargo/remote/BUILD.tokio-rustls-0.22.0.bazel new file mode 100644 index 0000000..26d9a2a --- /dev/null +++ b/cargo/remote/BUILD.tokio-rustls-0.22.0.bazel @@ -0,0 +1,62 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "tokio_rustls", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.22.0", + # buildifier: leave-alone + deps = [ + "@raze__rustls__0_19_1//:rustls", + "@raze__tokio__1_11_0//:tokio", + "@raze__webpki__0_21_4//:webpki", + ], +) + +# Unsupported target "badssl" with type "test" omitted + +# Unsupported target "early-data" with type "test" omitted + +# Unsupported target "test" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.tokio-stream-0.1.7.bazel b/cargo/remote/BUILD.tokio-stream-0.1.7.bazel index dff33ef..5b08034 100644 --- a/ratelimiter/cargo/remote/BUILD.tokio-stream-0.1.7.bazel +++ b/cargo/remote/BUILD.tokio-stream-0.1.7.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -51,9 +51,9 @@ rust_library( version = "0.1.7", # buildifier: leave-alone deps = [ - "@raze__futures_core__0_3_16//:futures_core", + "@raze__futures_core__0_3_17//:futures_core", "@raze__pin_project_lite__0_2_7//:pin_project_lite", - "@raze__tokio__1_9_0//:tokio", + "@raze__tokio__1_11_0//:tokio", ], ) diff --git a/cargo/remote/BUILD.tokio-tungstenite-0.15.0.bazel b/cargo/remote/BUILD.tokio-tungstenite-0.15.0.bazel new file mode 100644 index 0000000..547bc86 --- /dev/null +++ b/cargo/remote/BUILD.tokio-tungstenite-0.15.0.bazel @@ -0,0 +1,86 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT" +]) + +# Generated Targets + +# Unsupported target "autobahn-client" with type "example" omitted + +# Unsupported target "autobahn-server" with type "example" omitted + +# Unsupported target "client" with type "example" omitted + +# Unsupported target "echo-server" with type "example" omitted + +# Unsupported target "interval-server" with type "example" omitted + +# Unsupported target "server" with type "example" omitted + +rust_library( + name = "tokio_tungstenite", + srcs = glob(["**/*.rs"]), + crate_features = [ + "connect", + "default", + "rustls", + "rustls-tls", + "stream", + "tokio-rustls", + "webpki", + "webpki-roots", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.15.0", + # buildifier: leave-alone + deps = [ + "@raze__futures_util__0_3_17//:futures_util", + "@raze__log__0_4_14//:log", + "@raze__pin_project__1_0_8//:pin_project", + "@raze__rustls__0_19_1//:rustls", + "@raze__tokio__1_11_0//:tokio", + "@raze__tokio_rustls__0_22_0//:tokio_rustls", + "@raze__tungstenite__0_14_0//:tungstenite", + "@raze__webpki__0_21_4//:webpki", + "@raze__webpki_roots__0_21_1//:webpki_roots", + ], +) + +# Unsupported target "communication" with type "test" omitted + +# Unsupported target "handshakes" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.tokio-util-0.6.7.bazel b/cargo/remote/BUILD.tokio-util-0.6.8.bazel index 51fc849..63a17e8 100644 --- a/ratelimiter/cargo/remote/BUILD.tokio-util-0.6.7.bazel +++ b/cargo/remote/BUILD.tokio-util-0.6.8.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -48,15 +48,15 @@ rust_library( "cargo-raze", "manual", ], - version = "0.6.7", + version = "0.6.8", # buildifier: leave-alone deps = [ - "@raze__bytes__1_0_1//:bytes", - "@raze__futures_core__0_3_16//:futures_core", - "@raze__futures_sink__0_3_16//:futures_sink", + "@raze__bytes__1_1_0//:bytes", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_sink__0_3_17//:futures_sink", "@raze__log__0_4_14//:log", "@raze__pin_project_lite__0_2_7//:pin_project_lite", - "@raze__tokio__1_9_0//:tokio", + "@raze__tokio__1_11_0//:tokio", ], ) diff --git a/cargo/remote/BUILD.toml-0.5.8.bazel b/cargo/remote/BUILD.toml-0.5.8.bazel new file mode 100644 index 0000000..edc344c --- /dev/null +++ b/cargo/remote/BUILD.toml-0.5.8.bazel @@ -0,0 +1,63 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "decode" with type "example" omitted + +# Unsupported target "enum_external" with type "example" omitted + +# Unsupported target "toml2json" with type "example" omitted + +rust_library( + name = "toml", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.5.8", + # buildifier: leave-alone + deps = [ + "@raze__serde__1_0_130//:serde", + ], +) + +# Unsupported target "enum_external_deserialize" with type "test" omitted diff --git a/ratelimiter/cargo/remote/BUILD.tonic-0.5.0.bazel b/cargo/remote/BUILD.tonic-0.5.2.bazel index e710603..9d3e41f 100644 --- a/ratelimiter/cargo/remote/BUILD.tonic-0.5.0.bazel +++ b/cargo/remote/BUILD.tonic-0.5.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -68,25 +68,25 @@ rust_library( "cargo-raze", "manual", ], - version = "0.5.0", + version = "0.5.2", # buildifier: leave-alone deps = [ "@raze__async_stream__0_3_2//:async_stream", "@raze__base64__0_13_0//:base64", - "@raze__bytes__1_0_1//:bytes", - "@raze__futures_core__0_3_16//:futures_core", - "@raze__futures_util__0_3_16//:futures_util", - "@raze__h2__0_3_3//:h2", + "@raze__bytes__1_1_0//:bytes", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_util__0_3_17//:futures_util", + "@raze__h2__0_3_4//:h2", "@raze__http__0_2_4//:http", - "@raze__http_body__0_4_2//:http_body", - "@raze__hyper__0_14_11//:hyper", + "@raze__http_body__0_4_3//:http_body", + "@raze__hyper__0_14_12//:hyper", "@raze__hyper_timeout__0_4_1//:hyper_timeout", "@raze__percent_encoding__2_1_0//:percent_encoding", "@raze__pin_project__1_0_8//:pin_project", "@raze__prost__0_8_0//:prost", - "@raze__tokio__1_9_0//:tokio", + "@raze__tokio__1_11_0//:tokio", "@raze__tokio_stream__0_1_7//:tokio_stream", - "@raze__tokio_util__0_6_7//:tokio_util", + "@raze__tokio_util__0_6_8//:tokio_util", "@raze__tower__0_4_8//:tower", "@raze__tower_layer__0_3_1//:tower_layer", "@raze__tower_service__0_3_1//:tower_service", diff --git a/ratelimiter/cargo/remote/BUILD.tonic-build-0.5.1.bazel b/cargo/remote/BUILD.tonic-build-0.5.2.bazel index d0b3fe2..d2e17b0 100644 --- a/ratelimiter/cargo/remote/BUILD.tonic-build-0.5.1.bazel +++ b/cargo/remote/BUILD.tonic-build-0.5.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -34,10 +34,8 @@ rust_library( name = "tonic_build", srcs = glob(["**/*.rs"]), crate_features = [ - "default", "prost", "prost-build", - "rustfmt", "transport", ], crate_root = "src/lib.rs", @@ -51,12 +49,12 @@ rust_library( "cargo-raze", "manual", ], - version = "0.5.1", + version = "0.5.2", # buildifier: leave-alone deps = [ - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__prost_build__0_8_0//:prost_build", "@raze__quote__1_0_9//:quote", - "@raze__syn__1_0_74//:syn", + "@raze__syn__1_0_76//:syn", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.tower-0.4.8.bazel b/cargo/remote/BUILD.tower-0.4.8.bazel index 9ce8c4d..2fa5af3 100644 --- a/ratelimiter/cargo/remote/BUILD.tower-0.4.8.bazel +++ b/cargo/remote/BUILD.tower-0.4.8.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -70,15 +70,15 @@ rust_library( version = "0.4.8", # buildifier: leave-alone deps = [ - "@raze__futures_core__0_3_16//:futures_core", - "@raze__futures_util__0_3_16//:futures_util", + "@raze__futures_core__0_3_17//:futures_core", + "@raze__futures_util__0_3_17//:futures_util", "@raze__indexmap__1_7_0//:indexmap", "@raze__pin_project__1_0_8//:pin_project", "@raze__rand__0_8_4//:rand", "@raze__slab__0_4_4//:slab", - "@raze__tokio__1_9_0//:tokio", + "@raze__tokio__1_11_0//:tokio", "@raze__tokio_stream__0_1_7//:tokio_stream", - "@raze__tokio_util__0_6_7//:tokio_util", + "@raze__tokio_util__0_6_8//:tokio_util", "@raze__tower_layer__0_3_1//:tower_layer", "@raze__tower_service__0_3_1//:tower_service", "@raze__tracing__0_1_26//:tracing", diff --git a/ratelimiter/cargo/remote/BUILD.tower-layer-0.3.1.bazel b/cargo/remote/BUILD.tower-layer-0.3.1.bazel index de3d62f..f1204c6 100644 --- a/ratelimiter/cargo/remote/BUILD.tower-layer-0.3.1.bazel +++ b/cargo/remote/BUILD.tower-layer-0.3.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.tower-service-0.3.1.bazel b/cargo/remote/BUILD.tower-service-0.3.1.bazel index d1b1ffe..5b9e191 100644 --- a/ratelimiter/cargo/remote/BUILD.tower-service-0.3.1.bazel +++ b/cargo/remote/BUILD.tower-service-0.3.1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.tracing-0.1.26.bazel b/cargo/remote/BUILD.tracing-0.1.26.bazel index a67afef..c66b5dc 100644 --- a/ratelimiter/cargo/remote/BUILD.tracing-0.1.26.bazel +++ b/cargo/remote/BUILD.tracing-0.1.26.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -66,7 +66,7 @@ rust_library( "@raze__cfg_if__1_0_0//:cfg_if", "@raze__log__0_4_14//:log", "@raze__pin_project_lite__0_2_7//:pin_project_lite", - "@raze__tracing_core__0_1_18//:tracing_core", + "@raze__tracing_core__0_1_19//:tracing_core", ] + selects.with_or({ # cfg(target_arch = "wasm32") ( diff --git a/ratelimiter/cargo/remote/BUILD.tracing-attributes-0.1.15.bazel b/cargo/remote/BUILD.tracing-attributes-0.1.15.bazel index a976d6a..d0d79ee 100644 --- a/ratelimiter/cargo/remote/BUILD.tracing-attributes-0.1.15.bazel +++ b/cargo/remote/BUILD.tracing-attributes-0.1.15.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -49,9 +49,9 @@ rust_library( version = "0.1.15", # buildifier: leave-alone deps = [ - "@raze__proc_macro2__1_0_28//:proc_macro2", + "@raze__proc_macro2__1_0_29//:proc_macro2", "@raze__quote__1_0_9//:quote", - "@raze__syn__1_0_74//:syn", + "@raze__syn__1_0_76//:syn", ], ) diff --git a/ratelimiter/cargo/remote/BUILD.tracing-core-0.1.18.bazel b/cargo/remote/BUILD.tracing-core-0.1.19.bazel index 8dae2d2..1dfffcd 100644 --- a/ratelimiter/cargo/remote/BUILD.tracing-core-0.1.18.bazel +++ b/cargo/remote/BUILD.tracing-core-0.1.19.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -48,7 +48,7 @@ rust_library( "cargo-raze", "manual", ], - version = "0.1.18", + version = "0.1.19", # buildifier: leave-alone deps = [ "@raze__lazy_static__1_4_0//:lazy_static", diff --git a/ratelimiter/cargo/remote/BUILD.tracing-futures-0.2.5.bazel b/cargo/remote/BUILD.tracing-futures-0.2.5.bazel index 7355bfe..066b633 100644 --- a/ratelimiter/cargo/remote/BUILD.tracing-futures-0.2.5.bazel +++ b/cargo/remote/BUILD.tracing-futures-0.2.5.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.try-lock-0.2.3.bazel b/cargo/remote/BUILD.try-lock-0.2.3.bazel index 172b35e..eadfc3d 100644 --- a/ratelimiter/cargo/remote/BUILD.try-lock-0.2.3.bazel +++ b/cargo/remote/BUILD.try-lock-0.2.3.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.tungstenite-0.14.0.bazel b/cargo/remote/BUILD.tungstenite-0.14.0.bazel new file mode 100644 index 0000000..d20fc37 --- /dev/null +++ b/cargo/remote/BUILD.tungstenite-0.14.0.bazel @@ -0,0 +1,91 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "buffer" with type "bench" omitted + +# Unsupported target "autobahn-client" with type "example" omitted + +# Unsupported target "autobahn-server" with type "example" omitted + +# Unsupported target "callback-error" with type "example" omitted + +# Unsupported target "client" with type "example" omitted + +# Unsupported target "server" with type "example" omitted + +# Unsupported target "srv_accept_unmasked_frames" with type "example" omitted + +rust_library( + name = "tungstenite", + srcs = glob(["**/*.rs"]), + crate_features = [ + "rustls", + "rustls-native-certs", + "rustls-tls", + "webpki", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.14.0", + # buildifier: leave-alone + deps = [ + "@raze__base64__0_13_0//:base64", + "@raze__byteorder__1_4_3//:byteorder", + "@raze__bytes__1_1_0//:bytes", + "@raze__http__0_2_4//:http", + "@raze__httparse__1_5_1//:httparse", + "@raze__log__0_4_14//:log", + "@raze__rand__0_8_4//:rand", + "@raze__rustls__0_19_1//:rustls", + "@raze__rustls_native_certs__0_5_0//:rustls_native_certs", + "@raze__sha_1__0_9_8//:sha_1", + "@raze__thiserror__1_0_29//:thiserror", + "@raze__url__2_2_2//:url", + "@raze__utf_8__0_7_6//:utf_8", + "@raze__webpki__0_21_4//:webpki", + ], +) + +# Unsupported target "connection_reset" with type "test" omitted + +# Unsupported target "no_send_after_close" with type "test" omitted + +# Unsupported target "receive_after_init_close" with type "test" omitted diff --git a/cargo/remote/BUILD.typenum-1.14.0.bazel b/cargo/remote/BUILD.typenum-1.14.0.bazel new file mode 100644 index 0000000..6271a43 --- /dev/null +++ b/cargo/remote/BUILD.typenum-1.14.0.bazel @@ -0,0 +1,85 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "typenum_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build/main.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.14.0", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "typenum", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.14.0", + # buildifier: leave-alone + deps = [ + ":typenum_build_script", + ], +) + +# Unsupported target "test" with type "test" omitted diff --git a/cargo/remote/BUILD.unicode-bidi-0.3.6.bazel b/cargo/remote/BUILD.unicode-bidi-0.3.6.bazel new file mode 100644 index 0000000..c6ca023 --- /dev/null +++ b/cargo/remote/BUILD.unicode-bidi-0.3.6.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "unicode_bidi", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.6", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.unicode-normalization-0.1.19.bazel b/cargo/remote/BUILD.unicode-normalization-0.1.19.bazel new file mode 100644 index 0000000..f73cea8 --- /dev/null +++ b/cargo/remote/BUILD.unicode-normalization-0.1.19.bazel @@ -0,0 +1,58 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "bench" with type "bench" omitted + +rust_library( + name = "unicode_normalization", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.19", + # buildifier: leave-alone + deps = [ + "@raze__tinyvec__1_3_1//:tinyvec", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.unicode-segmentation-1.8.0.bazel b/cargo/remote/BUILD.unicode-segmentation-1.8.0.bazel index 0f8541d..dec202b 100644 --- a/ratelimiter/cargo/remote/BUILD.unicode-segmentation-1.8.0.bazel +++ b/cargo/remote/BUILD.unicode-segmentation-1.8.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.unicode-xid-0.2.2.bazel b/cargo/remote/BUILD.unicode-xid-0.2.2.bazel index b9c0947..4271032 100644 --- a/ratelimiter/cargo/remote/BUILD.unicode-xid-0.2.2.bazel +++ b/cargo/remote/BUILD.unicode-xid-0.2.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.untrusted-0.7.1.bazel b/cargo/remote/BUILD.untrusted-0.7.1.bazel new file mode 100644 index 0000000..108628a --- /dev/null +++ b/cargo/remote/BUILD.untrusted-0.7.1.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # ISC from expression "ISC" +]) + +# Generated Targets + +rust_library( + name = "untrusted", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/untrusted.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.1", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "tests" with type "test" omitted diff --git a/cargo/remote/BUILD.url-2.2.2.bazel b/cargo/remote/BUILD.url-2.2.2.bazel new file mode 100644 index 0000000..037b1ae --- /dev/null +++ b/cargo/remote/BUILD.url-2.2.2.bazel @@ -0,0 +1,63 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "parse_url" with type "bench" omitted + +rust_library( + name = "url", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.2.2", + # buildifier: leave-alone + deps = [ + "@raze__form_urlencoded__1_0_1//:form_urlencoded", + "@raze__idna__0_2_3//:idna", + "@raze__matches__0_1_9//:matches", + "@raze__percent_encoding__2_1_0//:percent_encoding", + ], +) + +# Unsupported target "data" with type "test" omitted + +# Unsupported target "unit" with type "test" omitted diff --git a/cargo/remote/BUILD.utf-8-0.7.6.bazel b/cargo/remote/BUILD.utf-8-0.7.6.bazel new file mode 100644 index 0000000..8d3b52b --- /dev/null +++ b/cargo/remote/BUILD.utf-8-0.7.6.bazel @@ -0,0 +1,66 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "from_utf8_lossy" with type "bench" omitted + +alias( + name = "utf_8", + actual = ":utf8", + tags = [ + "cargo-raze", + "manual", + ], +) + +rust_library( + name = "utf8", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.7.6", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "unit" with type "test" omitted diff --git a/cargo/remote/BUILD.version_check-0.9.3.bazel b/cargo/remote/BUILD.version_check-0.9.3.bazel new file mode 100644 index 0000000..1b5fde8 --- /dev/null +++ b/cargo/remote/BUILD.version_check-0.9.3.bazel @@ -0,0 +1,53 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "version_check", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2015", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.3", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.waker-fn-1.1.0.bazel b/cargo/remote/BUILD.waker-fn-1.1.0.bazel new file mode 100644 index 0000000..610fd48 --- /dev/null +++ b/cargo/remote/BUILD.waker-fn-1.1.0.bazel @@ -0,0 +1,53 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "waker_fn", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.1.0", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.walkdir-2.3.2.bazel b/cargo/remote/BUILD.walkdir-2.3.2.bazel new file mode 100644 index 0000000..d08c2c2 --- /dev/null +++ b/cargo/remote/BUILD.walkdir-2.3.2.bazel @@ -0,0 +1,66 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "unencumbered", # Unlicense from expression "Unlicense OR MIT" +]) + +# Generated Targets + +rust_library( + name = "walkdir", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "2.3.2", + # buildifier: leave-alone + deps = [ + "@raze__same_file__1_0_6//:same_file", + ] + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + "@raze__winapi_util__0_1_5//:winapi_util", + ], + "//conditions:default": [], + }), +) diff --git a/ratelimiter/cargo/remote/BUILD.want-0.3.0.bazel b/cargo/remote/BUILD.want-0.3.0.bazel index ff6fbb0..6e1fe2a 100644 --- a/ratelimiter/cargo/remote/BUILD.want-0.3.0.bazel +++ b/cargo/remote/BUILD.want-0.3.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/ratelimiter/cargo/remote/BUILD.wasi-0.10.2+wasi-snapshot-preview1.bazel b/cargo/remote/BUILD.wasi-0.10.0+wasi-snapshot-preview1.bazel index 9a65311..d1e5906 100644 --- a/ratelimiter/cargo/remote/BUILD.wasi-0.10.2+wasi-snapshot-preview1.bazel +++ b/cargo/remote/BUILD.wasi-0.10.0+wasi-snapshot-preview1.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -48,7 +48,7 @@ rust_library( "cargo-raze", "manual", ], - version = "0.10.2+wasi-snapshot-preview1", + version = "0.10.0+wasi-snapshot-preview1", # buildifier: leave-alone deps = [ ], diff --git a/cargo/remote/BUILD.wasi-0.9.0+wasi-snapshot-preview1.bazel b/cargo/remote/BUILD.wasi-0.9.0+wasi-snapshot-preview1.bazel new file mode 100644 index 0000000..f489b20 --- /dev/null +++ b/cargo/remote/BUILD.wasi-0.9.0+wasi-snapshot-preview1.bazel @@ -0,0 +1,55 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR (Apache-2.0 OR MIT)" +]) + +# Generated Targets + +rust_library( + name = "wasi", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.9.0+wasi-snapshot-preview1", + # buildifier: leave-alone + deps = [ + ], +) diff --git a/cargo/remote/BUILD.wasm-bindgen-0.2.76.bazel b/cargo/remote/BUILD.wasm-bindgen-0.2.76.bazel new file mode 100644 index 0000000..b43bdae --- /dev/null +++ b/cargo/remote/BUILD.wasm-bindgen-0.2.76.bazel @@ -0,0 +1,123 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "wasm_bindgen_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + "default", + "spans", + "std", + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.76", + visibility = ["//visibility:private"], + deps = [ + ] + selects.with_or({ + # cfg(target_arch = "wasm32") + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + ], + "//conditions:default": [], + }), +) + +rust_library( + name = "wasm_bindgen", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "default", + "spans", + "std", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + proc_macro_deps = [ + "@raze__wasm_bindgen_macro__0_2_76//:wasm_bindgen_macro", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.76", + # buildifier: leave-alone + deps = [ + ":wasm_bindgen_build_script", + "@raze__cfg_if__1_0_0//:cfg_if", + ] + selects.with_or({ + # cfg(target_arch = "wasm32") + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "headless" with type "test" omitted + +# Unsupported target "must_use" with type "test" omitted + +# Unsupported target "non_wasm" with type "test" omitted + +# Unsupported target "std-crate-no-std-dep" with type "test" omitted + +# Unsupported target "unwrap_throw" with type "test" omitted + +# Unsupported target "wasm" with type "test" omitted diff --git a/cargo/remote/BUILD.wasm-bindgen-backend-0.2.76.bazel b/cargo/remote/BUILD.wasm-bindgen-backend-0.2.76.bazel new file mode 100644 index 0000000..94baffb --- /dev/null +++ b/cargo/remote/BUILD.wasm-bindgen-backend-0.2.76.bazel @@ -0,0 +1,61 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "wasm_bindgen_backend", + srcs = glob(["**/*.rs"]), + crate_features = [ + "spans", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.76", + # buildifier: leave-alone + deps = [ + "@raze__bumpalo__3_7_0//:bumpalo", + "@raze__lazy_static__1_4_0//:lazy_static", + "@raze__log__0_4_14//:log", + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + "@raze__wasm_bindgen_shared__0_2_76//:wasm_bindgen_shared", + ], +) diff --git a/cargo/remote/BUILD.wasm-bindgen-macro-0.2.76.bazel b/cargo/remote/BUILD.wasm-bindgen-macro-0.2.76.bazel new file mode 100644 index 0000000..81c6bf3 --- /dev/null +++ b/cargo/remote/BUILD.wasm-bindgen-macro-0.2.76.bazel @@ -0,0 +1,58 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "wasm_bindgen_macro", + srcs = glob(["**/*.rs"]), + crate_features = [ + "spans", + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.76", + # buildifier: leave-alone + deps = [ + "@raze__quote__1_0_9//:quote", + "@raze__wasm_bindgen_macro_support__0_2_76//:wasm_bindgen_macro_support", + ], +) + +# Unsupported target "ui" with type "test" omitted diff --git a/cargo/remote/BUILD.wasm-bindgen-macro-support-0.2.76.bazel b/cargo/remote/BUILD.wasm-bindgen-macro-support-0.2.76.bazel new file mode 100644 index 0000000..9c6d63a --- /dev/null +++ b/cargo/remote/BUILD.wasm-bindgen-macro-support-0.2.76.bazel @@ -0,0 +1,59 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "wasm_bindgen_macro_support", + srcs = glob(["**/*.rs"]), + crate_features = [ + "spans", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.76", + # buildifier: leave-alone + deps = [ + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + "@raze__wasm_bindgen_backend__0_2_76//:wasm_bindgen_backend", + "@raze__wasm_bindgen_shared__0_2_76//:wasm_bindgen_shared", + ], +) diff --git a/cargo/remote/BUILD.wasm-bindgen-shared-0.2.76.bazel b/cargo/remote/BUILD.wasm-bindgen-shared-0.2.76.bazel new file mode 100644 index 0000000..1412a8f --- /dev/null +++ b/cargo/remote/BUILD.wasm-bindgen-shared-0.2.76.bazel @@ -0,0 +1,84 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets +# buildifier: disable=out-of-order-load +# buildifier: disable=load-on-top +load( + "@rules_rust//cargo:cargo_build_script.bzl", + "cargo_build_script", +) + +cargo_build_script( + name = "wasm_bindgen_shared_build_script", + srcs = glob(["**/*.rs"]), + build_script_env = { + }, + crate_features = [ + ], + crate_root = "build.rs", + data = glob(["**"]), + edition = "2018", + links = "wasm_bindgen", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.76", + visibility = ["//visibility:private"], + deps = [ + ], +) + +rust_library( + name = "wasm_bindgen_shared", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.2.76", + # buildifier: leave-alone + deps = [ + ":wasm_bindgen_shared_build_script", + ], +) diff --git a/cargo/remote/BUILD.web-sys-0.3.53.bazel b/cargo/remote/BUILD.web-sys-0.3.53.bazel new file mode 100644 index 0000000..a2007c2 --- /dev/null +++ b/cargo/remote/BUILD.web-sys-0.3.53.bazel @@ -0,0 +1,70 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +rust_library( + name = "web_sys", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + "Crypto", + "EventTarget", + "Window", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.3.53", + # buildifier: leave-alone + deps = [ + "@raze__js_sys__0_3_53//:js_sys", + "@raze__wasm_bindgen__0_2_76//:wasm_bindgen", + ] + selects.with_or({ + # cfg(target_arch = "wasm32") + ( + "@rules_rust//rust/platform:wasm32-unknown-unknown", + "@rules_rust//rust/platform:wasm32-wasi", + ): [ + ], + "//conditions:default": [], + }), +) + +# Unsupported target "wasm" with type "test" omitted diff --git a/cargo/remote/BUILD.webpki-0.21.4.bazel b/cargo/remote/BUILD.webpki-0.21.4.bazel new file mode 100644 index 0000000..2646a6d --- /dev/null +++ b/cargo/remote/BUILD.webpki-0.21.4.bazel @@ -0,0 +1,63 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "restricted", # no license +]) + +# Generated Targets + +rust_library( + name = "webpki", + srcs = glob(["**/*.rs"]), + crate_features = [ + "default", + "std", + "trust_anchor_util", + ], + crate_root = "src/webpki.rs", + crate_type = "lib", + data = [], + compile_data = glob(["*/**"]), + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.21.4", + # buildifier: leave-alone + deps = [ + "@raze__ring__0_16_20//:ring", + "@raze__untrusted__0_7_1//:untrusted", + ], +) + +# Unsupported target "dns_name_tests" with type "test" omitted + +# Unsupported target "integration" with type "test" omitted diff --git a/cargo/remote/BUILD.webpki-roots-0.21.1.bazel b/cargo/remote/BUILD.webpki-roots-0.21.1.bazel new file mode 100644 index 0000000..f8c6fa2 --- /dev/null +++ b/cargo/remote/BUILD.webpki-roots-0.21.1.bazel @@ -0,0 +1,79 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "reciprocal", # MPL-2.0 from expression "MPL-2.0" +]) + +# Generated Targets + +rust_binary( + # Prefix bin name to disambiguate from (probable) collision with lib name + # N.B.: The exact form of this is subject to change. + name = "cargo_bin_process_cert", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/bin/process_cert.rs", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.21.1", + # buildifier: leave-alone + deps = [ + ":webpki_roots", + "@raze__webpki__0_21_4//:webpki", + ], +) + +rust_library( + name = "webpki_roots", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.21.1", + # buildifier: leave-alone + deps = [ + "@raze__webpki__0_21_4//:webpki", + ], +) diff --git a/ratelimiter/cargo/remote/BUILD.which-4.2.2.bazel b/cargo/remote/BUILD.which-4.2.2.bazel index e3408aa..ad77755 100644 --- a/ratelimiter/cargo/remote/BUILD.which-4.2.2.bazel +++ b/cargo/remote/BUILD.which-4.2.2.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -52,7 +52,7 @@ rust_library( # buildifier: leave-alone deps = [ "@raze__either__1_6_1//:either", - "@raze__libc__0_2_98//:libc", + "@raze__libc__0_2_101//:libc", ] + selects.with_or({ # cfg(windows) ( diff --git a/ratelimiter/cargo/remote/BUILD.winapi-0.3.9.bazel b/cargo/remote/BUILD.winapi-0.3.9.bazel index dac5437..55afd20 100644 --- a/ratelimiter/cargo/remote/BUILD.winapi-0.3.9.bazel +++ b/cargo/remote/BUILD.winapi-0.3.9.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) @@ -43,6 +43,7 @@ cargo_build_script( }, crate_features = [ "cfg", + "consoleapi", "errhandlingapi", "evntrace", "fileapi", @@ -50,6 +51,8 @@ cargo_build_script( "in6addr", "inaddr", "ioapiset", + "lmcons", + "minschannel", "minwinbase", "minwindef", "mstcpip", @@ -57,16 +60,29 @@ cargo_build_script( "namedpipeapi", "ntdef", "ntsecapi", + "ntstatus", + "processenv", + "profileapi", + "schannel", + "securitybaseapi", + "sspi", "std", "synchapi", + "sysinfoapi", + "threadpoollegacyapiset", + "timezoneapi", "winbase", + "wincon", + "wincrypt", "windef", "winerror", "winioctl", + "winnt", "winsock2", "ws2def", "ws2ipdef", "ws2tcpip", + "wtypesbase", ], crate_root = "build.rs", data = glob(["**"]), @@ -89,6 +105,7 @@ rust_library( srcs = glob(["**/*.rs"]), crate_features = [ "cfg", + "consoleapi", "errhandlingapi", "evntrace", "fileapi", @@ -96,6 +113,8 @@ rust_library( "in6addr", "inaddr", "ioapiset", + "lmcons", + "minschannel", "minwinbase", "minwindef", "mstcpip", @@ -103,16 +122,29 @@ rust_library( "namedpipeapi", "ntdef", "ntsecapi", + "ntstatus", + "processenv", + "profileapi", + "schannel", + "securitybaseapi", + "sspi", "std", "synchapi", + "sysinfoapi", + "threadpoollegacyapiset", + "timezoneapi", "winbase", + "wincon", + "wincrypt", "windef", "winerror", "winioctl", + "winnt", "winsock2", "ws2def", "ws2ipdef", "ws2tcpip", + "wtypesbase", ], crate_root = "src/lib.rs", crate_type = "lib", diff --git a/ratelimiter/cargo/remote/BUILD.winapi-i686-pc-windows-gnu-0.4.0.bazel b/cargo/remote/BUILD.winapi-i686-pc-windows-gnu-0.4.0.bazel index 428c05d..516e7ea 100644 --- a/ratelimiter/cargo/remote/BUILD.winapi-i686-pc-windows-gnu-0.4.0.bazel +++ b/cargo/remote/BUILD.winapi-i686-pc-windows-gnu-0.4.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.winapi-util-0.1.5.bazel b/cargo/remote/BUILD.winapi-util-0.1.5.bazel new file mode 100644 index 0000000..ea3d8b8 --- /dev/null +++ b/cargo/remote/BUILD.winapi-util-0.1.5.bazel @@ -0,0 +1,64 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "unencumbered", # Unlicense from expression "Unlicense OR MIT" +]) + +# Generated Targets + +rust_library( + name = "winapi_util", + srcs = glob(["**/*.rs"]), + aliases = { + }, + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.1.5", + # buildifier: leave-alone + deps = [ + ] + selects.with_or({ + # cfg(windows) + ( + "@rules_rust//rust/platform:i686-pc-windows-msvc", + "@rules_rust//rust/platform:x86_64-pc-windows-msvc", + ): [ + "@raze__winapi__0_3_9//:winapi", + ], + "//conditions:default": [], + }), +) diff --git a/ratelimiter/cargo/remote/BUILD.winapi-x86_64-pc-windows-gnu-0.4.0.bazel b/cargo/remote/BUILD.winapi-x86_64-pc-windows-gnu-0.4.0.bazel index b8d7349..723daa5 100644 --- a/ratelimiter/cargo/remote/BUILD.winapi-x86_64-pc-windows-gnu-0.4.0.bazel +++ b/cargo/remote/BUILD.winapi-x86_64-pc-windows-gnu-0.4.0.bazel @@ -19,7 +19,7 @@ load( package(default_visibility = [ # Public for visibility by "@raze__crate__version//" targets. # - # Prefer access through "//ratelimiter/cargo", which limits external + # Prefer access through "//cargo", which limits external # visibility to explicit Cargo.toml dependencies. "//visibility:public", ]) diff --git a/cargo/remote/BUILD.yaml-rust-0.4.5.bazel b/cargo/remote/BUILD.yaml-rust-0.4.5.bazel new file mode 100644 index 0000000..528ff47 --- /dev/null +++ b/cargo/remote/BUILD.yaml-rust-0.4.5.bazel @@ -0,0 +1,62 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # MIT from expression "MIT OR Apache-2.0" +]) + +# Generated Targets + +# Unsupported target "dump_yaml" with type "example" omitted + +rust_library( + name = "yaml_rust", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "0.4.5", + # buildifier: leave-alone + deps = [ + "@raze__linked_hash_map__0_5_4//:linked_hash_map", + ], +) + +# Unsupported target "quickcheck" with type "test" omitted + +# Unsupported target "spec_test" with type "test" omitted + +# Unsupported target "test_round_trip" with type "test" omitted diff --git a/cargo/remote/BUILD.zeroize-1.4.1.bazel b/cargo/remote/BUILD.zeroize-1.4.1.bazel new file mode 100644 index 0000000..164a7fa --- /dev/null +++ b/cargo/remote/BUILD.zeroize-1.4.1.bazel @@ -0,0 +1,59 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "zeroize", + srcs = glob(["**/*.rs"]), + crate_features = [ + "zeroize_derive", + ], + crate_root = "src/lib.rs", + crate_type = "lib", + data = [], + edition = "2018", + proc_macro_deps = [ + "@raze__zeroize_derive__1_1_0//:zeroize_derive", + ], + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.4.1", + # buildifier: leave-alone + deps = [ + ], +) + +# Unsupported target "zeroize_derive" with type "test" omitted diff --git a/cargo/remote/BUILD.zeroize_derive-1.1.0.bazel b/cargo/remote/BUILD.zeroize_derive-1.1.0.bazel new file mode 100644 index 0000000..1612822 --- /dev/null +++ b/cargo/remote/BUILD.zeroize_derive-1.1.0.bazel @@ -0,0 +1,57 @@ +""" +@generated +cargo-raze crate build file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +# buildifier: disable=load +load("@bazel_skylib//lib:selects.bzl", "selects") + +# buildifier: disable=load +load( + "@rules_rust//rust:rust.bzl", + "rust_binary", + "rust_library", + "rust_test", +) + +package(default_visibility = [ + # Public for visibility by "@raze__crate__version//" targets. + # + # Prefer access through "//cargo", which limits external + # visibility to explicit Cargo.toml dependencies. + "//visibility:public", +]) + +licenses([ + "notice", # Apache-2.0 from expression "Apache-2.0 OR MIT" +]) + +# Generated Targets + +rust_library( + name = "zeroize_derive", + srcs = glob(["**/*.rs"]), + crate_features = [ + ], + crate_root = "src/lib.rs", + crate_type = "proc-macro", + data = [], + edition = "2018", + rustc_flags = [ + "--cap-lints=allow", + ], + tags = [ + "cargo-raze", + "manual", + ], + version = "1.1.0", + # buildifier: leave-alone + deps = [ + "@raze__proc_macro2__1_0_29//:proc_macro2", + "@raze__quote__1_0_9//:quote", + "@raze__syn__1_0_76//:syn", + "@raze__synstructure__0_12_5//:synstructure", + ], +) diff --git a/common/cargo/BUILD.bazel b/common/cargo/BUILD.bazel new file mode 100644 index 0000000..35f9c72 --- /dev/null +++ b/common/cargo/BUILD.bazel @@ -0,0 +1,49 @@ +""" +@generated +cargo-raze generated Bazel file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +package(default_visibility = ["//visibility:public"]) + +licenses([ + "notice", # See individual crates for specific licenses +]) + +# Aliased targets +alias( + name = "config", + actual = "@raze__config__0_11_0//:config", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "log", + actual = "@raze__log__0_4_14//:log", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "pretty_env_logger", + actual = "@raze__pretty_env_logger__0_4_0//:pretty_env_logger", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde", + actual = "@raze__serde__1_0_130//:serde", + tags = [ + "cargo-raze", + "manual", + ], +) diff --git a/common/discord/types/payloads/gateway/BUILD.bazel b/common/discord/types/payloads/gateway/BUILD.bazel deleted file mode 100644 index ce76e4a..0000000 --- a/common/discord/types/payloads/gateway/BUILD.bazel +++ /dev/null @@ -1,9 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "gateway", - srcs = ["gateway-payload.go"], - importpath = "github.com/discordnova/nova/common/discord/types/payloads/gateway", - visibility = ["//visibility:public"], - deps = ["//common/discord/types/types"], -) diff --git a/common/discord/types/payloads/gateway/commands/BUILD.bazel b/common/discord/types/payloads/gateway/commands/BUILD.bazel deleted file mode 100644 index 51dfe32..0000000 --- a/common/discord/types/payloads/gateway/commands/BUILD.bazel +++ /dev/null @@ -1,19 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "commands", - srcs = [ - "heartbeat.go", - "identify.go", - "request-guild-members.go", - "resume.go", - "update-status.go", - "update-voice-state.go", - ], - importpath = "github.com/discordnova/nova/common/discord/types/payloads/gateway/commands", - visibility = ["//visibility:public"], - deps = [ - "//common/discord/types/structures", - "//common/discord/types/types", - ], -) diff --git a/common/discord/types/payloads/gateway/commands/heartbeat.go b/common/discord/types/payloads/gateway/commands/heartbeat.go deleted file mode 100644 index ab6d810..0000000 --- a/common/discord/types/payloads/gateway/commands/heartbeat.go +++ /dev/null @@ -1,6 +0,0 @@ -package commands - -// GatewayCommandHeartbeat is used to maintain an active gateway connection. -// Must be sent every heartbeat_interval milliseconds after the Opcode 10 Hello payload is received. -// The inner d key is the last sequence number—s—received by the client. If you have not yet received one, send null. -type GatewayCommandHeartbeat int diff --git a/common/discord/types/payloads/gateway/commands/identify.go b/common/discord/types/payloads/gateway/commands/identify.go deleted file mode 100644 index b5cee3e..0000000 --- a/common/discord/types/payloads/gateway/commands/identify.go +++ /dev/null @@ -1,30 +0,0 @@ -package commands - -import ( - "github.com/discordnova/nova/common/discord/types/structures" - "github.com/discordnova/nova/common/discord/types/types" -) - -// GatewayCommandIdentifyPayload is used to trigger the initial handshake with the gateway. -type GatewayCommandIdentifyPayload struct { - // authentication token - Token string `json:"token"` - // connection properties - Properties structures.IdentifyConnectionProperties `json:"properties"` - // whether this connection supports compression of packets - // Default to false - Compress bool `json:"compress,omitempty"` - // value between 50 and 250, total number of members where the gateway will stop sending offline members in the - // guild member list - // Default to 50 - LargeThreshold int `json:"large_threshold,omitempty"` - // used for Guild Sharding. array of two integers (shard_id, num_shards) - Shard []int `json:"shard,omitempty"` - // presence structure for initial presence information - Presence GatewayCommandUpdateStatusPayload `json:"presence,omitempty"` - // enables dispatching of guild subscription events (presence and typing events) - // Default to true - GuildSubscriptions bool `json:"guild_subscriptions,omitempty"` - // the Gateway Intents you wish to receive - Intents types.GatewayIntents `json:"intents"` -} diff --git a/common/discord/types/payloads/gateway/commands/request-guild-members.go b/common/discord/types/payloads/gateway/commands/request-guild-members.go deleted file mode 100644 index 5ede0d9..0000000 --- a/common/discord/types/payloads/gateway/commands/request-guild-members.go +++ /dev/null @@ -1,35 +0,0 @@ -package commands - -// GatewayCommandRequestGuildMembersPayload is used o request all members for a guild or a list of guilds. -// When initially connecting,the gateway will only send offline members if a guild has less than the large_threshold -// members (value in the Gateway Identify). -// If a client wishes to receive additional members, they need to explicitly request them via this operation. -// The server will send Guild Members Chunk events in response with up to 1000 members per chunk until all members -// that match the request have been sent. -// Due to our privacy and infrastructural concerns with this feature, there are some limitations that apply: -// GUILD_PRESENCES intent is required to set presences = true. Otherwise, it will always be false -// GUILD_MEMBERS intent is required to request the entire member list—(query=‘’, limit=0<=n) -// You will be limited to requesting 1 guild_id per request -// Requesting a prefix (query parameter) will return a maximum of 100 members -// Requesting user_ids will continue to be limited to returning 100 members -type GatewayCommandRequestGuildMembersPayload struct { - // id of the guild to get members for - // Required: true - GuildID string `json:"guild_id"` - // string that username starts with, or an empty string to return all members - // Required: one of query or user_ids - Query string `json:"query,omitempty"` - // maximum number of members to send matching the query; a limit of 0 can be used with an empty string query to return - // all members - // Required: true when specifying query - Limit int `json:"limit,omitempty"` - // used to specify if we want the presences of the matched members - // Required: false - Presences bool `json:"presences,omitempty"` - // used to specify which users you wish to fetch - // Required: one of query or user_ids - UserIDs string `json:"user_ids,omitempty"` - // nonce to identify the Guild Members Chunk response - // Required: false - Nonce string `json:"nonce,omitempty"` -} diff --git a/common/discord/types/payloads/gateway/commands/resume.go b/common/discord/types/payloads/gateway/commands/resume.go deleted file mode 100644 index 54abbff..0000000 --- a/common/discord/types/payloads/gateway/commands/resume.go +++ /dev/null @@ -1,11 +0,0 @@ -package commands - -// GatewayCommandResumePayload is used to replay missed events when a disconnected client resumes -type GatewayCommandResumePayload struct { - // session token - Token string `json:"token"` - // session id - SessionID string `json:"session_id"` - // last sequence number received - Seq int64 `json:"seq"` -} diff --git a/common/discord/types/payloads/gateway/commands/update-status.go b/common/discord/types/payloads/gateway/commands/update-status.go deleted file mode 100644 index 1343243..0000000 --- a/common/discord/types/payloads/gateway/commands/update-status.go +++ /dev/null @@ -1,18 +0,0 @@ -package commands - -import ( - "github.com/discordnova/nova/common/discord/types/structures" - "github.com/discordnova/nova/common/discord/types/types" -) - -// GatewayCommandUpdateStatusPayload is sent by the client to indicate a presence or status update. -type GatewayCommandUpdateStatusPayload struct { - // unix time (in milliseconds) of when the client went idle, or null if the client is not idle - Since int `json:"since,omitempty"` - // null, or the user's activities - Activities []structures.Activity `json:"activities,omitempty"` - // the user's new status - Status types.UpdateStatusStatuses `json:"status"` - // whether or not the client is afk - AFK bool `json:"afk"` -} diff --git a/common/discord/types/payloads/gateway/commands/update-voice-state.go b/common/discord/types/payloads/gateway/commands/update-voice-state.go deleted file mode 100644 index 7becbcf..0000000 --- a/common/discord/types/payloads/gateway/commands/update-voice-state.go +++ /dev/null @@ -1,13 +0,0 @@ -package commands - -// GatewayCommandUpdateVoiceStatePayload is sent when a client wants to join, move, or disconnect from a voice channel. -type GatewayCommandUpdateVoiceStatePayload struct { - // id of the guild - GuildID string `json:"guild_id"` - // id of the voice channel client wants to join (null if disconnecting) - ChannelID string `json:"channel_id,omitempty"` - // is the client muted - SelfMute bool `json:"self_mute"` - // is the client deafened - SelfDeaf bool `json:"self_deaf"` -} diff --git a/common/discord/types/payloads/gateway/events/BUILD.bazel b/common/discord/types/payloads/gateway/events/BUILD.bazel deleted file mode 100644 index 839dc6a..0000000 --- a/common/discord/types/payloads/gateway/events/BUILD.bazel +++ /dev/null @@ -1,52 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "events", - srcs = [ - "channel-create.go", - "channel-delete.go", - "channel-pins-update.go", - "channel-update.go", - "guild-ban-add.go", - "guild-ban-remove.go", - "guild-create.go", - "guild-delete.go", - "guild-emojis-update.go", - "guild-integrations-update.go", - "guild-member-add.go", - "guild-member-remove.go", - "guild-member-update.go", - "guild-members-chunk.go", - "guild-role-create.go", - "guild-role-delete.go", - "guild-role-update.go", - "guild-update.go", - "hello.go", - "invalid-session.go", - "invite-create.go", - "invite-delete.go", - "message-bulk-delete.go", - "message-create.go", - "message-delete.go", - "message-reaction-add.go", - "message-reaction-remove.go", - "message-reaction-remove-all.go", - "message-reaction-remove-emoji.go", - "message-update.go", - "presence-update.go", - "ready.go", - "reconnect.go", - "resumed.go", - "typing-start.go", - "user-update.go", - "voice-server-update.go", - "voice-state-update.go", - "webhook-update.go", - ], - importpath = "github.com/discordnova/nova/common/discord/types/payloads/gateway/events", - visibility = ["//visibility:public"], - deps = [ - "//common/discord/types/structures", - "//common/discord/types/types", - ], -) diff --git a/common/discord/types/payloads/gateway/events/channel-create.go b/common/discord/types/payloads/gateway/events/channel-create.go deleted file mode 100644 index f32ff3a..0000000 --- a/common/discord/types/payloads/gateway/events/channel-create.go +++ /dev/null @@ -1,7 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventChannelCreatePayload is sent when a new guild channel is created, relevant to the current user. -// The inner payload is a channel object. -type GatewayEventChannelCreatePayload structures.Channel diff --git a/common/discord/types/payloads/gateway/events/channel-delete.go b/common/discord/types/payloads/gateway/events/channel-delete.go deleted file mode 100644 index cecd1a8..0000000 --- a/common/discord/types/payloads/gateway/events/channel-delete.go +++ /dev/null @@ -1,7 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventChannelDeletePayload is sent when a channel relevant to the current user is deleted. -// The inner payload is a channel object. -type GatewayEventChannelDeletePayload structures.Channel diff --git a/common/discord/types/payloads/gateway/events/channel-pins-update.go b/common/discord/types/payloads/gateway/events/channel-pins-update.go deleted file mode 100644 index 451130b..0000000 --- a/common/discord/types/payloads/gateway/events/channel-pins-update.go +++ /dev/null @@ -1,12 +0,0 @@ -package events - -// GatewayEventChannelPinsUpdatePayload is sent when a message is pinned or unpinned in a text channel. -// This is not sent when a pinned message is deleted. -type GatewayEventChannelPinsUpdatePayload struct { - // the id of the guild - GuildID string `json:"guild_id,omitempty"` - // the id of the channel - ChannelID string `json:"channel_id"` - // the time at which the most recent pinned message was pinned - LastPinTimestamp string `json:"last_pin_timestamp,omitempty"` -} diff --git a/common/discord/types/payloads/gateway/events/channel-update.go b/common/discord/types/payloads/gateway/events/channel-update.go deleted file mode 100644 index 28dd65c..0000000 --- a/common/discord/types/payloads/gateway/events/channel-update.go +++ /dev/null @@ -1,8 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventChannelUpdatePayload is sent when a channel is updated. The inner payload is a channel object. -// This is not sent when the field last_message_id is altered. -// To keep track of the last_message_id changes, we should listen for Message Create events. -type GatewayEventChannelUpdatePayload structures.Channel diff --git a/common/discord/types/payloads/gateway/events/guild-ban-add.go b/common/discord/types/payloads/gateway/events/guild-ban-add.go deleted file mode 100644 index 14625e9..0000000 --- a/common/discord/types/payloads/gateway/events/guild-ban-add.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildBanAddPayload is sent when a user is banned from a guild. -type GatewayEventGuildBanAddPayload struct { - // id of the guild - GuildID string `json:"guild_id"` - // the banned user - User structures.User `json:"user"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-ban-remove.go b/common/discord/types/payloads/gateway/events/guild-ban-remove.go deleted file mode 100644 index c58029a..0000000 --- a/common/discord/types/payloads/gateway/events/guild-ban-remove.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildBanRemovePayload is sent when a user is unbanned from a guild. -type GatewayEventGuildBanRemovePayload struct { - // id of the guild - GuildID string `json:"guild_id"` - // the unbanned user - User structures.User `json:"user"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-create.go b/common/discord/types/payloads/gateway/events/guild-create.go deleted file mode 100644 index 1a365ac..0000000 --- a/common/discord/types/payloads/gateway/events/guild-create.go +++ /dev/null @@ -1,12 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildCreatePayload can be sent in three different scenarios: -// When a user is initially connecting, -// to lazily load and back fill information for all unavailable guilds sent in the Ready event. -// Guilds that are unavailable due to an outage will send a Guild Delete event. -// When a Guild becomes available again to the client. -// When the current user joins a new Guild. -// The inner payload is a guild object, with all the extra fields specified. (Nothing on the doc) -type GatewayEventGuildCreatePayload structures.Guild diff --git a/common/discord/types/payloads/gateway/events/guild-delete.go b/common/discord/types/payloads/gateway/events/guild-delete.go deleted file mode 100644 index 678d68c..0000000 --- a/common/discord/types/payloads/gateway/events/guild-delete.go +++ /dev/null @@ -1,9 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildDeletePayload is sent when a guild becomes or was already unavailable due to an outage, -// or when the user leaves or is removed from a guild. -// The inner payload is an unavailable guild object. -// If the unavailable field is not set, the user was removed from the guild. -type GatewayEventGuildDeletePayload structures.Guild diff --git a/common/discord/types/payloads/gateway/events/guild-emojis-update.go b/common/discord/types/payloads/gateway/events/guild-emojis-update.go deleted file mode 100644 index 9b07ab6..0000000 --- a/common/discord/types/payloads/gateway/events/guild-emojis-update.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildEmojisUpdatePayload is sent when when a guild's emojis have been updated. -type GatewayEventGuildEmojisUpdatePayload struct { - // id of the guild - GuildID string `json:"guild_id"` - // array of emojis - Emojis []structures.Emoji `json:"emojis"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-integrations-update.go b/common/discord/types/payloads/gateway/events/guild-integrations-update.go deleted file mode 100644 index a92417a..0000000 --- a/common/discord/types/payloads/gateway/events/guild-integrations-update.go +++ /dev/null @@ -1,7 +0,0 @@ -package events - -// GatewayEventGuildIntegrationsUpdatePayload is sent when a guild integration is updated. -type GatewayEventGuildIntegrationsUpdatePayload struct { - // id of the guild whose integrations were updated - GuildID string `json:"guild_id"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-member-add.go b/common/discord/types/payloads/gateway/events/guild-member-add.go deleted file mode 100644 index e27ba84..0000000 --- a/common/discord/types/payloads/gateway/events/guild-member-add.go +++ /dev/null @@ -1,12 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildMemberAddPayload is sent when a new user joins a guild. -// The inner payload is a guild member object with an extra guild_id key -// If using Gateway Intents, the GUILD_MEMBERS intent will be required to receive this event. -type GatewayEventGuildMemberAddPayload struct { - structures.GuildMember - // id of the guild - GuildID string `json:"guild_id"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-member-remove.go b/common/discord/types/payloads/gateway/events/guild-member-remove.go deleted file mode 100644 index fae20dc..0000000 --- a/common/discord/types/payloads/gateway/events/guild-member-remove.go +++ /dev/null @@ -1,12 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildMemberRemovePayload is sent when a user is removed from a guild (leave/kick/ban). -// If using Gateway Intents, the GUILD_MEMBERS intent will be required to receive this event. -type GatewayEventGuildMemberRemovePayload struct { - // the id of the guild - GuildID string `json:"guild_id"` - // the user who was removed - User structures.User `json:"user"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-member-update.go b/common/discord/types/payloads/gateway/events/guild-member-update.go deleted file mode 100644 index 35b949a..0000000 --- a/common/discord/types/payloads/gateway/events/guild-member-update.go +++ /dev/null @@ -1,23 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildMemberUpdatePayload is sent when a guild member is updated. -// This will also fire when the user object of a guild member changes. -// If using Gateway Intents, the GUILD_MEMBERS intent will be required to receive this event. -type GatewayEventGuildMemberUpdatePayload struct { - // the id of the guild - GuildID string `json:"guild_id"` - // user role ids - Roles []string `json:"roles"` - // the user - User structures.User `json:"user"` - // nickname of the user in the guild - Nick string `json:"nick,omitempty"` - // when the user joined the guild - JoinedAt string `json:"joined_at"` - // when the user starting boosting the guild - PremiumSince string `json:"premium_since,omitempty"` - // whether the user has not yet passed the guild's Membership Screening requirements - Pending bool `json:"pending"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-members-chunk.go b/common/discord/types/payloads/gateway/events/guild-members-chunk.go deleted file mode 100644 index be2f7f1..0000000 --- a/common/discord/types/payloads/gateway/events/guild-members-chunk.go +++ /dev/null @@ -1,22 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildMembersChunkPayload is sent in response to Guild Request Members. -// You can use the chunk_index and chunk_count to calculate how many chunks are left for your request. -type GatewayEventGuildMembersChunkPayload struct { - // the id of the guild - GuildID string `json:"guild_id"` - // set of guild members - Members []structures.GuildMember `json:"members"` - // the chunk index in the expected chunks for this response (0 <= chunk_index < chunk_count) - ChunkIndex int `json:"chunk_index"` - // the total number of expected chunks for this response - ChunkCount int `json:"chunk_count"` - // if passing an invalid id to REQUEST_GUILD_MEMBERS, it will be returned here - NotFound []string `json:"not_found,omitempty"` - // if passing true to REQUEST_GUILD_MEMBERS, presences of the returned members will be here - Presences []structures.Presence `json:"presences"` - // the nonce used in the Guild Members Request - Nonce string `json:"nonce"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-role-create.go b/common/discord/types/payloads/gateway/events/guild-role-create.go deleted file mode 100644 index 6ae8a48..0000000 --- a/common/discord/types/payloads/gateway/events/guild-role-create.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildRoleCreatePayload is sent when a guild role is created. -type GatewayEventGuildRoleCreatePayload struct { - // the id of the guild - GuildID string `json:"guild_id"` - // the role created - Role structures.Role `json:"role"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-role-delete.go b/common/discord/types/payloads/gateway/events/guild-role-delete.go deleted file mode 100644 index 9eb144a..0000000 --- a/common/discord/types/payloads/gateway/events/guild-role-delete.go +++ /dev/null @@ -1,9 +0,0 @@ -package events - -// GatewayEventGuildRoleDeletePayload is sent when a guild role is updated. -type GatewayEventGuildRoleDeletePayload struct { - // the id of the guild - GuildID string `json:"guild_id"` - // id of the role - RoleID string `json:"role_id"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-role-update.go b/common/discord/types/payloads/gateway/events/guild-role-update.go deleted file mode 100644 index 21bb25a..0000000 --- a/common/discord/types/payloads/gateway/events/guild-role-update.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildRoleUpdatePayload is sent when a guild role is updated. -type GatewayEventGuildRoleUpdatePayload struct { - // the id of the guild - GuildID string `json:"guild_id"` - // the role updated - Role structures.Role `json:"role"` -} diff --git a/common/discord/types/payloads/gateway/events/guild-update.go b/common/discord/types/payloads/gateway/events/guild-update.go deleted file mode 100644 index cc127ba..0000000 --- a/common/discord/types/payloads/gateway/events/guild-update.go +++ /dev/null @@ -1,6 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventGuildUpdatePayload is sent when a guild is updated. The inner payload is a guild object. -type GatewayEventGuildUpdatePayload structures.Guild diff --git a/common/discord/types/payloads/gateway/events/hello.go b/common/discord/types/payloads/gateway/events/hello.go deleted file mode 100644 index e30ae0e..0000000 --- a/common/discord/types/payloads/gateway/events/hello.go +++ /dev/null @@ -1,9 +0,0 @@ -package events - -// GatewayEventHelloPayload is sent on connection to the websocket. -// Defines the heartbeat interval that the client should heartbeat to. -type GatewayEventHelloPayload struct { - // HeartbeatInterval is the interval (in milliseconds) - // the client should heartbeat with - HeartbeatInterval int `json:"heartbeat_interval"` -} diff --git a/common/discord/types/payloads/gateway/events/invalid-session.go b/common/discord/types/payloads/gateway/events/invalid-session.go deleted file mode 100644 index fd11f03..0000000 --- a/common/discord/types/payloads/gateway/events/invalid-session.go +++ /dev/null @@ -1,8 +0,0 @@ -package events - -// GatewayEventInvalidSessionPayload is sent to indicate one of at least three different situations:the gateway could -// not initialize a session after receiving an Opcode 2 Identify the gateway could not resume un anterior session -// after receiving an Opcode 6 Resume the gateway has invalidated an active session and is requesting client -// actionThe inner d key is a boolean that indicates whether the session may be resumable. -// See Connecting and Resuming for more information. -type GatewayEventInvalidSessionPayload bool diff --git a/common/discord/types/payloads/gateway/events/invite-create.go b/common/discord/types/payloads/gateway/events/invite-create.go deleted file mode 100644 index be14458..0000000 --- a/common/discord/types/payloads/gateway/events/invite-create.go +++ /dev/null @@ -1,32 +0,0 @@ -package events - -import ( - "github.com/discordnova/nova/common/discord/types/structures" - "github.com/discordnova/nova/common/discord/types/types" -) - -// GatewayEventInviteCreatePayload is sent when a new invite to a channel is created. -type GatewayEventInviteCreatePayload struct { - // the channel the invite is for - ChannelID string `json:"channel_id"` - // the unique invite code - Code string `json:"code"` - // the time at which the invite was created - CreatedAt string `json:"created_at"` - // the guild of the invite - GuildID string `json:"guild_id,omitempty"` - // the user that created the invite - Inviter structures.User `json:"inviter,omitempty"` - // how long the invite is valid for (in seconds) - MaxAge int `json:"max_age"` - // the maximum number of times the invite can be used - MaxUses int `json:"max_uses"` - // the target user for this invite - TargetUser structures.User `json:"target_user,omitempty"` - // the type of user target for this invite - TargetUserType types.TargetUserTypes `json:"target_user_type"` - // whether or not the invite is temporary (invited users will be kicked on disconnect unless they're assigned a role) - Temporary bool `json:"temporary"` - // how many times the invite has been used (always will be 0) - Uses int `json:"uses"` -} diff --git a/common/discord/types/payloads/gateway/events/invite-delete.go b/common/discord/types/payloads/gateway/events/invite-delete.go deleted file mode 100644 index a4ff655..0000000 --- a/common/discord/types/payloads/gateway/events/invite-delete.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -// GatewayEventInviteDeletePayload is sent when an invite is deleted. -type GatewayEventInviteDeletePayload struct { - // the channel of the invite - ChannelID string `json:"channel_id"` - // the guild of the invite - GuildID string `json:"guild_id"` - // the unique invite code - Code string `json:"code"` -} diff --git a/common/discord/types/payloads/gateway/events/message-bulk-delete.go b/common/discord/types/payloads/gateway/events/message-bulk-delete.go deleted file mode 100644 index 87ef5a6..0000000 --- a/common/discord/types/payloads/gateway/events/message-bulk-delete.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -// GatewayEventMessageBulkDeletePayload is sent when multiple messages are deleted at once. -type GatewayEventMessageBulkDeletePayload struct { - // the ids of the messages - IDs []string `json:"ids"` - // the id of the channel - ChannelID string `json:"channel_id"` - // the id of the guild - GuildID string `json:"guild_id,omitempty"` -} diff --git a/common/discord/types/payloads/gateway/events/message-create.go b/common/discord/types/payloads/gateway/events/message-create.go deleted file mode 100644 index d97952c..0000000 --- a/common/discord/types/payloads/gateway/events/message-create.go +++ /dev/null @@ -1,6 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventMessageCreatePayload is sent when a message is created. The inner payload is a message object. -type GatewayEventMessageCreatePayload structures.Message diff --git a/common/discord/types/payloads/gateway/events/message-delete.go b/common/discord/types/payloads/gateway/events/message-delete.go deleted file mode 100644 index 9d13a7d..0000000 --- a/common/discord/types/payloads/gateway/events/message-delete.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -// GatewayEventMessageDeletePayload is sent when a message is deleted. -type GatewayEventMessageDeletePayload struct { - // the id of the message - ID string `json:"id"` - // the id of the channel - ChannelID string `json:"channel_id"` - // the id of the guild - GuildID string `json:"guild_id"` -} diff --git a/common/discord/types/payloads/gateway/events/message-reaction-add.go b/common/discord/types/payloads/gateway/events/message-reaction-add.go deleted file mode 100644 index 682a74a..0000000 --- a/common/discord/types/payloads/gateway/events/message-reaction-add.go +++ /dev/null @@ -1,19 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventMessageReactionAdd is sent when a user adds a reaction to a message. -type GatewayEventMessageReactionAdd struct { - // the id of the user - UserID string `json:"user_id"` - // the id of the channel - ChannelID string `json:"channel_id"` - // the id of the message - MessageID string `json:"message_id"` - // the id of the guild - GuildID string `json:"guild_id,omitempty"` - // the member who reacted if this happened in a guild - Member structures.GuildMember `json:"member"` - // the emoji used to react - Emoji structures.Emoji `json:"emoji"` -} diff --git a/common/discord/types/payloads/gateway/events/message-reaction-remove-all.go b/common/discord/types/payloads/gateway/events/message-reaction-remove-all.go deleted file mode 100644 index 551a253..0000000 --- a/common/discord/types/payloads/gateway/events/message-reaction-remove-all.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -// GatewayEventMessageReactionRemoveAll is sent when a user explicitly removes all reactions from a message. -type GatewayEventMessageReactionRemoveAll struct { - // the id of the channel - ChannelID string `json:"channel_id"` - // the id of the message - MessageID string `json:"message_id"` - // the id of the guild - GuildID string `json:"guild_id,omitempty"` -} diff --git a/common/discord/types/payloads/gateway/events/message-reaction-remove-emoji.go b/common/discord/types/payloads/gateway/events/message-reaction-remove-emoji.go deleted file mode 100644 index b720326..0000000 --- a/common/discord/types/payloads/gateway/events/message-reaction-remove-emoji.go +++ /dev/null @@ -1,16 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventMessageReactionRemoveEmojiPayload is sent when a bot removes all instances of a given emoji from the -// reactions of a message. -type GatewayEventMessageReactionRemoveEmojiPayload struct { - // the id of the channel - ChannelID string `json:"channel_id"` - // the id of the guild - GuildID string `json:"guild_id,omitempty"` - // the id of the message - MessageID string `json:"message_id"` - // the emoji that was removed - Emoji structures.Emoji `json:"emoji"` -} diff --git a/common/discord/types/payloads/gateway/events/message-reaction-remove.go b/common/discord/types/payloads/gateway/events/message-reaction-remove.go deleted file mode 100644 index 51e6034..0000000 --- a/common/discord/types/payloads/gateway/events/message-reaction-remove.go +++ /dev/null @@ -1,17 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventMessageReactionRemove is sent when a user removes a reaction from a message. -type GatewayEventMessageReactionRemove struct { - // the id of the user - UserID string `json:"user_id"` - // the id of the channel - ChannelID string `json:"channel_id"` - // the id of the message - MessageID string `json:"message_id"` - // the id of the guild - GuildID string `json:"guild_id,omitempty"` - // the emoji used to react - Emoji structures.Emoji `json:"emoji"` -} diff --git a/common/discord/types/payloads/gateway/events/message-update.go b/common/discord/types/payloads/gateway/events/message-update.go deleted file mode 100644 index 4ae3cee..0000000 --- a/common/discord/types/payloads/gateway/events/message-update.go +++ /dev/null @@ -1,8 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventMessageUpdatePayload is sent when a message is updated. The inner payload is a message object. -// Unlike creates, message updates may contain only a subset of the full message object payload -// (but will always contain an id and channel_id). -type GatewayEventMessageUpdatePayload structures.Message diff --git a/common/discord/types/payloads/gateway/events/presence-update.go b/common/discord/types/payloads/gateway/events/presence-update.go deleted file mode 100644 index 96d9e01..0000000 --- a/common/discord/types/payloads/gateway/events/presence-update.go +++ /dev/null @@ -1,26 +0,0 @@ -package events - -import ( - "github.com/discordnova/nova/common/discord/types/structures" - "github.com/discordnova/nova/common/discord/types/types" -) - -// GatewayEventPresenceUpdatePayload is sent when a user's presence or info, such as name or avatar, is updated. -// If you are using Gateway Intents, you must specify the GUILD_PRESENCES intent in order to receive -// Presence Update events -// The user object within this event can be partial, the only field which must be sent is the id field, -// everything else is optional. Along with this limitation, no fields are required, -// and the types of the fields are not validated. -// Your client should expect any combination of fields and types within this event. -type GatewayEventPresenceUpdatePayload struct { - // the user presence is being updated for - User structures.User `json:"user"` - // id of the guild - GuildID string `json:"guild_id"` - // either "idle", "dnd", "online", or "offline" - Status types.Statuses `json:"status"` - // user's current activities - Activities []structures.Activity `json:"activities"` - // user's platform-dependent status - ClientStatus types.ClientStatuses `json:"client_status"` -} diff --git a/common/discord/types/payloads/gateway/events/ready.go b/common/discord/types/payloads/gateway/events/ready.go deleted file mode 100644 index 34b7bc0..0000000 --- a/common/discord/types/payloads/gateway/events/ready.go +++ /dev/null @@ -1,27 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventReadyPayload is the ready event is dispatched when a client has -// completed the initial handshake with the gateway (for new sessions). -// The ready event can be the largest and most complex event the gateway -// will send, as it contains all the state required for a client -// to begin interacting with the rest of the platform. -type GatewayEventReadyPayload struct { - // V is the gateway version - V int `json:"v"` - // User is information about the user including email - User structures.User `json:"user"` - // PrivateChannels is an empty array - PrivateChannels []string `json:"private_channels"` - // Guilds are the guilds the user is in - // Note: they are only sent as unavailable guilds - Guilds []structures.Guild `json:"guilds"` - // SessionID is used for resuming connections - SessionID string `json:"session_id"` - // Shard is the shard information associated with the session, if sent - // when identifying. This is an array of two integers (shard_id, num_shards) - Shard []int `json:"shard,omitempty"` - // contains id and flags - Application structures.Application `json:"application"` -} diff --git a/common/discord/types/payloads/gateway/events/reconnect.go b/common/discord/types/payloads/gateway/events/reconnect.go deleted file mode 100644 index 03e36b4..0000000 --- a/common/discord/types/payloads/gateway/events/reconnect.go +++ /dev/null @@ -1,5 +0,0 @@ -package events - -// GatewayEventReconnectPayload is the payload sent when receiving a Reconnect event -// There is nothing... -type GatewayEventReconnectPayload struct{} diff --git a/common/discord/types/payloads/gateway/events/resumed.go b/common/discord/types/payloads/gateway/events/resumed.go deleted file mode 100644 index ad9018f..0000000 --- a/common/discord/types/payloads/gateway/events/resumed.go +++ /dev/null @@ -1,5 +0,0 @@ -package events - -// GatewayEventResumedPayload is the payload sent when receiving a Resumed event -// There is nothing... -type GatewayEventResumedPayload struct{} diff --git a/common/discord/types/payloads/gateway/events/typing-start.go b/common/discord/types/payloads/gateway/events/typing-start.go deleted file mode 100644 index a892071..0000000 --- a/common/discord/types/payloads/gateway/events/typing-start.go +++ /dev/null @@ -1,17 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventTypingStartPayload is sent when a user starts typing in a channel. -type GatewayEventTypingStartPayload struct { - // id of the channel - ChannelID string `json:"channel_id"` - // id of the guild - GuildID string `json:"guild_id,omitempty"` - // id of the user - UserID string `json:"user_id"` - // unix time (in seconds) of when the user started typing - Timestamp int `json:"timestamp"` - // the member who started typing if this happened in a guild - Member structures.GuildMember `json:"member,omitempty"` -} diff --git a/common/discord/types/payloads/gateway/events/user-update.go b/common/discord/types/payloads/gateway/events/user-update.go deleted file mode 100644 index 554c4a9..0000000 --- a/common/discord/types/payloads/gateway/events/user-update.go +++ /dev/null @@ -1,6 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventUserUpdatePayload is sent when properties about the user change. -type GatewayEventUserUpdatePayload structures.User diff --git a/common/discord/types/payloads/gateway/events/voice-server-update.go b/common/discord/types/payloads/gateway/events/voice-server-update.go deleted file mode 100644 index 8de2000..0000000 --- a/common/discord/types/payloads/gateway/events/voice-server-update.go +++ /dev/null @@ -1,11 +0,0 @@ -package events - -// GatewayEventVoiceServerUpdate is sent when a guild's voice server is updated. -type GatewayEventVoiceServerUpdate struct { - // voice connection token - Token string `json:"token"` - // the guild this voice server update is for - GuildID string `json:"guild_id"` - // the voice server host - Endpoint string `json:"endpoint"` -} diff --git a/common/discord/types/payloads/gateway/events/voice-state-update.go b/common/discord/types/payloads/gateway/events/voice-state-update.go deleted file mode 100644 index afa2dac..0000000 --- a/common/discord/types/payloads/gateway/events/voice-state-update.go +++ /dev/null @@ -1,6 +0,0 @@ -package events - -import "github.com/discordnova/nova/common/discord/types/structures" - -// GatewayEventVoiceStateUpdatePayload is sent when someone joins/leaves/moves voice channels -type GatewayEventVoiceStateUpdatePayload structures.VoiceState diff --git a/common/discord/types/payloads/gateway/events/webhook-update.go b/common/discord/types/payloads/gateway/events/webhook-update.go deleted file mode 100644 index 4dc8866..0000000 --- a/common/discord/types/payloads/gateway/events/webhook-update.go +++ /dev/null @@ -1,9 +0,0 @@ -package events - -// GatewayEventWebhookUpdatePayload is sent when a guild channel's webhook is created, updated, or deleted. -type GatewayEventWebhookUpdatePayload struct { - // id of the guild - GuildID string `json:"guild_id"` - // id of the channel - ChannelID string `json:"channel_id"` -} diff --git a/common/discord/types/payloads/gateway/gateway-payload.go b/common/discord/types/payloads/gateway/gateway-payload.go deleted file mode 100644 index 07a9edc..0000000 --- a/common/discord/types/payloads/gateway/gateway-payload.go +++ /dev/null @@ -1,20 +0,0 @@ -package gateway - -import ( - "encoding/json" - - "github.com/discordnova/nova/common/discord/types/types" -) - -// Payload is the base of each payload sent to the Gateway, everything -// else is in the d property. -type Payload struct { - // Op is the opcode for the payload - Op types.GatewayOpCodes `json:"op"` - // D is the event data - D json.RawMessage `json:"d"` - // S is a sequence number used for resuming sessions and heartbeats - S int64 `json:"s"` - // T is the event name for this payload - T string `json:"t"` -} diff --git a/common/discord/types/structures/BUILD.bazel b/common/discord/types/structures/BUILD.bazel deleted file mode 100644 index 63e4e11..0000000 --- a/common/discord/types/structures/BUILD.bazel +++ /dev/null @@ -1,50 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "structures", - srcs = [ - "activity.go", - "activity-assets.go", - "activity-emoji.go", - "activity-party.go", - "activity-secrets.go", - "activity-timestamps.go", - "application.go", - "attachment.go", - "channel.go", - "channel-mention.go", - "client-status.go", - "embed.go", - "embed-author.go", - "embed-field.go", - "embed-footer.go", - "embed-image.go", - "embed-provider.go", - "embed-thumbnail.go", - "embed-video.go", - "emoji.go", - "guild.go", - "guild-member.go", - "identify-connection-properties.go", - "invite.go", - "message.go", - "message-activity.go", - "message-application.go", - "message-reference.go", - "overwrite.go", - "presence.go", - "reaction.go", - "role.go", - "role-tags.go", - "sticker.go", - "team.go", - "team-member.go", - "user.go", - "voice-state.go", - "welcome-screen.go", - "welcome-screen-channel.go", - ], - importpath = "github.com/discordnova/nova/common/discord/types/structures", - visibility = ["//visibility:public"], - deps = ["//common/discord/types/types"], -) diff --git a/common/discord/types/structures/activity-assets.go b/common/discord/types/structures/activity-assets.go deleted file mode 100644 index 220af2b..0000000 --- a/common/discord/types/structures/activity-assets.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// ActivityAssets is a representation of the assets object sent in an Activity -type ActivityAssets struct { - // the id for a large asset of the activity, usually a snowflake - LargeImage string `json:"large_image,omitempty"` - // text displayed when hovering over the large image of the activity - LargeText string `json:"large_text,omitempty"` - // the id for a small asset of the activity, usually a snowflake - SmallImage string `json:"small_image,omitempty"` - // text displayed when hovering over the small image of the activity - SmallText string `json:"small_text,omitempty"` -} diff --git a/common/discord/types/structures/activity-emoji.go b/common/discord/types/structures/activity-emoji.go deleted file mode 100644 index 8f44399..0000000 --- a/common/discord/types/structures/activity-emoji.go +++ /dev/null @@ -1,11 +0,0 @@ -package structures - -// ActivityEmoji is the representation of an Emoji object sent for Activities -type ActivityEmoji struct { - // the name of the emoji - Name string `json:"name"` - // the id of the emoji - ID string `json:"id,omitempty"` - // whether this emoji is animated - Animated bool `json:"animated,omitempty"` -} diff --git a/common/discord/types/structures/activity-party.go b/common/discord/types/structures/activity-party.go deleted file mode 100644 index 9342f9c..0000000 --- a/common/discord/types/structures/activity-party.go +++ /dev/null @@ -1,10 +0,0 @@ -package structures - -// ActivityParty is a representation of a party sent in an Activity -type ActivityParty struct { - // the id of the party - ID string `json:"id,omitempty"` - // used to show the party's current and maximum size - // This is an array of two integers (current_size, max_size) - Size []int `json:"size,omitempty"` -} diff --git a/common/discord/types/structures/activity-secrets.go b/common/discord/types/structures/activity-secrets.go deleted file mode 100644 index 1899fd7..0000000 --- a/common/discord/types/structures/activity-secrets.go +++ /dev/null @@ -1,11 +0,0 @@ -package structures - -// ActivitySecrets is a representation of the secrets object sent in an Activity -type ActivitySecrets struct { - // the secret for joining a party - Join string `json:"join,omitempty"` - // the secret for spectating a game - Spectate string `json:"spectate,omitempty"` - // the secret for a specific instanced match - Match string `json:"match,omitempty"` -} diff --git a/common/discord/types/structures/activity-timestamps.go b/common/discord/types/structures/activity-timestamps.go deleted file mode 100644 index 69922d2..0000000 --- a/common/discord/types/structures/activity-timestamps.go +++ /dev/null @@ -1,9 +0,0 @@ -package structures - -// ActivityTimestamps are the timestamps of an activity -type ActivityTimestamps struct { - // unix time (in milliseconds) of when the activity started - Start int `json:"start,omitempty"` - // unix time (in milliseconds) of when the activity ends - End int `json:"end,omitempty"` -} diff --git a/common/discord/types/structures/activity.go b/common/discord/types/structures/activity.go deleted file mode 100644 index 903d108..0000000 --- a/common/discord/types/structures/activity.go +++ /dev/null @@ -1,36 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Activity represents a presence's activity -// Bots are only able to send name, type, and optionally url. -type Activity struct { - // the activity's name - Name string `json:"name"` - // activity type - Type int `json:"type"` - // stream url, is validated when type is 1 - URL string `json:"url,omitempty"` - // unix timestamp of when the activity was added to the user's session - CreatedAt int `json:"created_at"` - // unix timestamps for start and/or end of the game - Timestamps ActivityTimestamps `json:"timestamps,omitempty"` - // application id for the game - ApplicationID string `json:"application_id,omitempty"` - // what the player is currently doing - Details string `json:"details,omitempty"` - // the user's current party status - State string `json:"state,omitempty"` - // the emoji used for a custom status - Emoji ActivityEmoji `json:"emoji,omitempty"` - // information for the current party of the player - Party ActivityParty `json:"party,omitempty"` - // images for the presence and their hover texts - Assets ActivityAssets `json:"assets,omitempty"` - // secrets for Rich Presence joining and spectating - Secrets ActivitySecrets `json:"secrets,omitempty"` - // whether or not the activity is an instanced game session - Instance bool `json:"instance,omitempty"` - // activity flags ORd together, describes what the payload includes - Flags types.ActivityFlags `json:"flags,omitempty"` -} diff --git a/common/discord/types/structures/application.go b/common/discord/types/structures/application.go deleted file mode 100644 index 80e3458..0000000 --- a/common/discord/types/structures/application.go +++ /dev/null @@ -1,38 +0,0 @@ -package structures - -// Application represents a Discord Application -type Application struct { - // the id of the app - ID string `json:"id"` - // the name of the app - Name string `json:"name"` - // the icon hash of the app - Icon string `json:"icon,omitempty"` - // the description of the app - Description string `json:"description"` - // an array of rpc origin urls, if rpc is enabled - RPCOrigins []string `json:"rpc_origins,omitempty"` - // when false only app owner can join the app's bot to guilds - BotPublic bool `json:"bot_public"` - // when true the app's bot will only join upon completion of the full oauth2 code grant flow - BotRequireCodeGrant bool `json:"bot_require_code_grant"` - // partial user object containing info on the owner of the application - Owner User `json:"owner"` - // if this application is a game sold on Discord, this field will be the summary field for the store page of its sku - Summary string `json:"summary"` - // the base64 encoded key for the GameSDK's GetTicket - VerifyKey string `json:"verify_key"` - // if the application belongs to a team, this will be a list of the members of that team - Team Team `json:"team"` - // if this application is a game sold on Discord, this field will be the guild to which it has been linked - GuildID string `json:"guild_id,omitempty"` - // if this application is a game sold on Discord, this field will be the id of the "Game SKU" that is created, - // if exists - PrimarySKUID string `json:"primary_sku_id,omitempty"` - // if this application is a game sold on Discord, this field will be the URL slug that links to the store page - Slug string `json:"slug,omitempty"` - // if this application is a game sold on Discord, this field will be the hash of the image on store embeds - CoverImage string `json:"cover_image,omitempty"` - // the application's public flags - Flags int `json:"flags"` -} diff --git a/common/discord/types/structures/attachment.go b/common/discord/types/structures/attachment.go deleted file mode 100644 index e28016f..0000000 --- a/common/discord/types/structures/attachment.go +++ /dev/null @@ -1,19 +0,0 @@ -package structures - -// Attachment is the representation of a message attachment -type Attachment struct { - // attachment id - ID string `json:"id"` - // name of file attached - Filename string `json:"filename"` - // size of file in bytes - Size int `json:"size"` - // source url of file - URL string `json:"url"` - // a proxied url of file - ProxyURL string `json:"proxy_url"` - // height of file (if image) - Height int `json:"height,omitempty"` - // width of file (if image) - Width int `json:"width,omitempty"` -} diff --git a/common/discord/types/structures/channel-mention.go b/common/discord/types/structures/channel-mention.go deleted file mode 100644 index 72634f9..0000000 --- a/common/discord/types/structures/channel-mention.go +++ /dev/null @@ -1,15 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// ChannelMention is a representation of a Channel mention -type ChannelMention struct { - // id of the channel - ID string `json:"id"` - // id of the guild containing the channel - GuildID string `json:"guild_id"` - // the type of channel - Type types.ChannelTypes `json:"type"` - // the name of the channel - Name string `json:"name"` -} diff --git a/common/discord/types/structures/channel.go b/common/discord/types/structures/channel.go deleted file mode 100644 index 5c052a9..0000000 --- a/common/discord/types/structures/channel.go +++ /dev/null @@ -1,45 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Channel represents a guild or DM channel -type Channel struct { - // the id of this channel - ID string `json:"id"` - // the type of channel - Type types.ChannelTypes `json:"type"` - // the id of the guild - GuildID string `json:"guild_id,omitempty"` - // sorting position of the channel - Position int `json:"position,omitempty"` - // explicit permission overwrites for members and roles - PermissionOverwrites []Overwrite `json:"permission_overwrites,omitempty"` - // the name of the channel (2-100 characters) - Name string `json:"name,omitempty"` - // the channel topic (0-1024 characters) - Topic string `json:"topic,omitempty"` - // whether the channel is nsfw - NSFW bool `json:"nsfw,omitempty"` - // the id of the last message sent in this channel (may not point to an existing or valid message) - LastMessageID string `json:"last_message_id,omitempty"` - // the bitrate (in bits) of the voice channel - Bitrate int `json:"bitrate,omitempty"` - // the user limit of the voice channel - UserLimit int `json:"user_limit,omitempty"` - // amount of seconds a user has to wait before sending another message (0-21600); - // bots, as well as users with the permission manage_messages or manage_channel, are unaffected - RateLimitPerUser int `json:"rate_limit_per_user,omitempty"` - // the recipients of the DM - Recipients []User `json:"recipients,omitempty"` - // icon hash - Icon string `json:"icon,omitempty"` - // id of the DM creator - OwnerID string `json:"owner_id,omitempty"` - // application id of the group DM creator if it is bot-created - ApplicationID string `json:"application_id,omitempty"` - // id of the parent category for a channel (each parent category can contain up to 50 channels) - ParentID string `json:"parent_id,omitempty"` - // when the last pinned message was pinned. This may be null in events such as GUILD_CREATE when a - // message is not pinned. - LastPinTimestamp string `json:"last_pin_timestamp,omitempty"` -} diff --git a/common/discord/types/structures/client-status.go b/common/discord/types/structures/client-status.go deleted file mode 100644 index d9bd4ad..0000000 --- a/common/discord/types/structures/client-status.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// ClientStatus is the representation of a Client Status, for sessions indication -type ClientStatus struct { - // the user's status set for an active desktop (Windows, Linux, Mac) application session - Desktop types.ClientStatuses `json:"desktop,omitempty"` - // the user's status set for an active mobile (iOS, Android) application session - Mobile types.ClientStatuses `json:"mobile,omitempty"` - // the user's status set for an active web (browser, bot account) application session - Web types.ClientStatuses `json:"web,omitempty"` -} diff --git a/common/discord/types/structures/embed-author.go b/common/discord/types/structures/embed-author.go deleted file mode 100644 index d1bfe60..0000000 --- a/common/discord/types/structures/embed-author.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// EmbedAuthor represents the author object of an embed -type EmbedAuthor struct { - // name of author - Name string `json:"name,omitempty"` - // url of author - URL string `json:"url,omitempty"` - // url of author icon (only supports http(s) and attachments) - IconURL string `json:"icon_url,omitempty"` - // a proxied url of author icon - ProxyIconURL string `json:"proxy_icon_url,omitempty"` -} diff --git a/common/discord/types/structures/embed-field.go b/common/discord/types/structures/embed-field.go deleted file mode 100644 index 09746a6..0000000 --- a/common/discord/types/structures/embed-field.go +++ /dev/null @@ -1,11 +0,0 @@ -package structures - -// EmbedField is the representation of a field in an embed -type EmbedField struct { - // name of the field - Name string `json:"name"` - // value of the field - Value string `json:"value"` - // whether or not this field should display inline - Inline bool `json:"inline,omitempty"` -} diff --git a/common/discord/types/structures/embed-footer.go b/common/discord/types/structures/embed-footer.go deleted file mode 100644 index d58341c..0000000 --- a/common/discord/types/structures/embed-footer.go +++ /dev/null @@ -1,11 +0,0 @@ -package structures - -// EmbedFooter represents the footer of an embed -type EmbedFooter struct { - // footer text - Text string `json:"text"` - // url of footer icon (only supports http(s) and attachments) - IconURL string `json:"icon_url,omitempty"` - // a proxied url of footer icon - ProxyIconURL string `json:"proxy_icon_url,omitempty"` -} diff --git a/common/discord/types/structures/embed-image.go b/common/discord/types/structures/embed-image.go deleted file mode 100644 index 1208cbe..0000000 --- a/common/discord/types/structures/embed-image.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// EmbedImage represents the image object of an embed -type EmbedImage struct { - // source url of image (only supports http(s) and attachments) - URL string `json:"url,omitempty"` - // a proxied url of the image - ProxyURL string `json:"proxy_url,omitempty"` - // height of image - Height int `json:"height,omitempty"` - // width of image - Width int `json:"width,omitempty"` -} diff --git a/common/discord/types/structures/embed-provider.go b/common/discord/types/structures/embed-provider.go deleted file mode 100644 index 8e35598..0000000 --- a/common/discord/types/structures/embed-provider.go +++ /dev/null @@ -1,9 +0,0 @@ -package structures - -// EmbedProvider represents the provider object of an embed -type EmbedProvider struct { - // name of provider - Name string `json:"name,omitempty"` - // url of provider - URL string `json:"url,omitempty"` -} diff --git a/common/discord/types/structures/embed-thumbnail.go b/common/discord/types/structures/embed-thumbnail.go deleted file mode 100644 index a6c6d1d..0000000 --- a/common/discord/types/structures/embed-thumbnail.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// EmbedThumbnail represents the thumbnail object of an embed -type EmbedThumbnail struct { - // source url of thumbnail (only supports http(s) and attachments) - URL string `json:"url,omitempty"` - // a proxied url of the thumbnail - ProxyURL string `json:"proxy_url,omitempty"` - // height of thumbnail - Height int `json:"height,omitempty"` - // width of thumbnail - Width int `json:"width,omitempty"` -} diff --git a/common/discord/types/structures/embed-video.go b/common/discord/types/structures/embed-video.go deleted file mode 100644 index 2c6ef18..0000000 --- a/common/discord/types/structures/embed-video.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// EmbedVideo represents the video object of an embed -type EmbedVideo struct { - // source url of video - URL string `json:"url,omitempty"` - // a proxied url of the video - ProxyURL string `json:"proxy_url,omitempty"` - // height of video - Height int `json:"height,omitempty"` - // width of video - Width int `json:"width,omitempty"` -} diff --git a/common/discord/types/structures/embed.go b/common/discord/types/structures/embed.go deleted file mode 100644 index c7bafe5..0000000 --- a/common/discord/types/structures/embed.go +++ /dev/null @@ -1,33 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Embed is the representation of an Embed -type Embed struct { - // title of embed - Title string `json:"title,omitempty"` - // type of embed (always "rich" for webhook embeds) - Type types.EmbedTypes `json:"type,omitempty"` - // description of embed - Description string `json:"description,omitempty"` - // url of embed - URL string `json:"url,omitempty"` - // timestamp of embed content - Timestamp string `json:"timestamp,omitempty"` - // color code of the embed - Color int `json:"color,omitempty"` - // footer information - Footer EmbedFooter `json:"footer,omitempty"` - // image information - Image EmbedImage `json:"image,omitempty"` - // thumbnail information - Thumbnail EmbedThumbnail `json:"thumbnail,omitempty"` - // video information - Video EmbedVideo `json:"video,omitempty"` - // provider information - Provider EmbedProvider `json:"provider,omitempty"` - // author information - Author EmbedAuthor `json:"author,omitempty"` - // fields information - Fields []EmbedField `json:"fields,omitempty"` -} diff --git a/common/discord/types/structures/emoji.go b/common/discord/types/structures/emoji.go deleted file mode 100644 index 1c21670..0000000 --- a/common/discord/types/structures/emoji.go +++ /dev/null @@ -1,21 +0,0 @@ -package structures - -// Emoji is a representation of a Discord Emoji -type Emoji struct { - // ID is the emoji id and can be null for default Discord emojis - ID string `json:"id,omitempty"` - // Name is the emoji name and can only be nil in Reaction Emoji objects - Name string `json:"name,omitempty"` - // roles this emoji is whitelisted to - Roles string `json:"roles,omitempty"` - // user that created this emoji - User User `json:"user,omitempty"` - // whether this emoji must be wrapped in colons - RequireColons bool `json:"require_colons,omitempty"` - // whether this emoji is managed - Managed bool `json:"managed,omitempty"` - // whether this emoji is animated - Animated bool `json:"animated,omitempty"` - // whether this emoji can be used, may be false due to loss of Server Boosts - Available bool `json:"available,omitempty"` -} diff --git a/common/discord/types/structures/guild-member.go b/common/discord/types/structures/guild-member.go deleted file mode 100644 index 4e47f98..0000000 --- a/common/discord/types/structures/guild-member.go +++ /dev/null @@ -1,27 +0,0 @@ -package structures - -// GuildMember is the representation of a Guild member -type GuildMember struct { - // the user this guild member represents - // The field user won't be included in the member object attached to MESSAGE_CREATE and MESSAGE_UPDATE gateway - // events. - User User `json:"user,omitempty"` - // this users guild nickname - Nick string `json:"nick"` - // array of role object ids - Roles []string `json:"roles"` - // when the user joined the guild - JoinedAt string `json:"joined_at"` - // when the user started boosting the guild - PremiumSince string `json:"premium_since,omitempty"` - // whether the user is deafened in voice channels - Deaf bool `json:"deaf"` - // whether the user is muted in voice channels - Mute bool `json:"mute"` - // whether the user has not yet passed the guild's Membership Screening requirements - // In GUILD_ events, pending will always be included as true or false. In non GUILD_ events which can only be - // triggered by non-pending users, pending will not be included. - Pending bool `json:"pending,omitempty"` - // total permissions of the member in the channel, including overrides, returned when in the interaction object - Permissions string `json:"permissions,omitempty"` -} diff --git a/common/discord/types/structures/guild.go b/common/discord/types/structures/guild.go deleted file mode 100644 index cad943c..0000000 --- a/common/discord/types/structures/guild.go +++ /dev/null @@ -1,117 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Guild is the representation of a Discord Guild, AKA server -type Guild struct { - // ID is the guild id - ID string `json:"id"` - // Name is the guild name (2-100 characters, excluding trailing and - // leading whitespace) - Name string `json:"name"` - // Icon is the icon hash - Icon string `json:"icon,omitempty"` - // IconHash is the icon hash, returned when in the template object - IconHash string `json:"icon_hash,omitempty"` - // Splash is the splash hash - Splash string `json:"splash,omitempty"` - // DiscoverySplash is discovery splash hash; only present for - // guilds with the "DISCOVERABLE" feature - DiscoverySplash string `json:"discovery_splash,omitempty"` - // Owner is true if the user is the owner of the guild. - // It is only sent when using the GET Current User Guilds endpoint - // and is relative to the requested user - Owner bool `json:"owner,omitempty"` - // OwnerID is the id of owner - OwnerID string `json:"owner_id,omitempty"` - // Permissions are the total permissions for the user in the guild - // (excludes overrides) - // It is only sent when using the GET Current User Guilds endpoint - // and is relative to the requested user - Permissions string `json:"permissions,omitempty"` - // Region is the voice region id for the guild - Region string `json:"region"` - // AFKChannelID is the id of the afk channel - AFKChannelID string `json:"afk_channel_id,omitempty"` - // AFKTimeout is the afk timeout in seconds - AFKTimeout int `json:"afk_timeout"` - // true if the server widget is enabled - WidgetEnabled bool `json:"widget_enabled,omitempty"` - // the channel id that the widget will generate an invite to, or null if set to no invite - WidgetChannelID string `json:"widget_channel_id,omitempty"` - // verification level required for the guild - VerificationLevel types.VerificationLevels `json:"verification_level"` - // default message notifications level - DefaultMessageNotifications types.DefaultMessageNotificationLevels `json:"default_message_notifications"` - // explicit content filter level - ExplicitContentFilter types.ExplicitContentFilterLevels `json:"explicit_content_filter"` - // roles in the guild - Roles []Role `json:"roles"` - // custom guild emojis - Emojis []Emoji `json:"emojis"` - // enabled guild features - Features []types.GuildFeatures `json:"features"` - // required MFA level for the guild - MFALevel types.MFALevels `json:"mfa_level"` - // application id of the guild creator if it is bot-created - ApplicationID string `json:"application_id,omitempty"` - // the id of the channel where guild notices such as welcome messages and boost events are posted - SystemChannelID string `json:"system_channel_id,omitempty"` - // system channel flags - SystemChannelFlags types.SystemChannelFlags `json:"system_channel_flags,omitempty"` - // the id of the channel where Community guilds can display rules and/or guidelines - RulesChannelID string `json:"rules_channel_id,omitempty"` - // when this guild was joined at - // This field is only sent within the GUILD_CREATE event - JoinedAt string `json:"joined_at,omitempty"` - // true if this is considered a large guild - // This field is only sent within the GUILD_CREATE event - Large bool `json:"large,omitempty"` - // true if this guild is unavailable due to an outage - // This field is only sent within the GUILD_CREATE event - Unavailable bool `json:"unavailable,omitempty"` - // total number of members in this guild - // This field is only sent within the GUILD_CREATE event - MemberCount int `json:"member_count,omitempty"` - // states of members currently in voice channels; lacks the guild_id key - // This field is only sent within the GUILD_CREATE event - VoiceStates []VoiceState `json:"voice_states,omitempty"` - // users in the guild - // This field is only sent within the GUILD_CREATE event - Members []GuildMember `json:"members,omitempty"` - // channels in the guild - // This field is only sent within the GUILD_CREATE event - Channels []Channel `json:"channels,omitempty"` - // presences of the members in the guild, will only include non-offline members if the size is greater than - // large threshold - // This field is only sent within the GUILD_CREATE event - Presences []Presence `json:"presences,omitempty"` - // the maximum number of presences for the guild (the default value, currently 25000, - // is in effect when null is returned) - MaxPresences int `json:"max_presences,omitempty"` - // the maximum number of members for the guild - MaxMembers int `json:"max_members,omitempty"` - // the vanity url code for the guild - VanityURLCode string `json:"vanity_url_code,omitempty"` - // the description for the guild, if the guild is discoverable - Description string `json:"description,omitempty"` - // banner hash - Banner string `json:"banner,omitempty"` - // premium tier (Server Boost level) - PremiumTier types.PremiumTiers `json:"premium_tier"` - // the number of boosts this guild currently has - PremiumSubscriptionCount int `json:"premium_subscription_count,omitempty"` - // the preferred locale of a Community guild; used in server discovery and notices from Discord; defaults to "en-US" - PreferredLocale string `json:"preferred_locale"` - // the id of the channel where admins and moderators of Community guilds receive notices from Discord - PublicUpdatesChannelID string `json:"public_updates_channel_id,omitempty"` - // the maximum amount of users in a video channel - MaxVideoChannelUsers int `json:"max_video_channel_users,omitempty"` - // approximate number of members in this guild, returned from the GET /guilds/<id> endpoint when with_counts is true - ApproximateMemberCount int `json:"approximate_member_count,omitempty"` - // approximate number of non-offline members in this guild, returned from the GET /guilds/<id> endpoint when - // with_counts is true - ApproximatePresenceCount int `json:"approximate_presence_count,omitempty"` - // the welcome screen of a Community guild, shown to new members, returned when in the invite object - WelcomeScreen WelcomeScreen `json:"welcome_screen,omitempty"` -} diff --git a/common/discord/types/structures/identify-connection-properties.go b/common/discord/types/structures/identify-connection-properties.go deleted file mode 100644 index 0c725ec..0000000 --- a/common/discord/types/structures/identify-connection-properties.go +++ /dev/null @@ -1,11 +0,0 @@ -package structures - -// IdentifyConnectionProperties is the identify connection properties object of an identify command -type IdentifyConnectionProperties struct { - // your operating system - OS string `json:"$os"` - // your library name - Browser string `json:"$browser"` - // your library name - Device string `json:"$device"` -} diff --git a/common/discord/types/structures/invite.go b/common/discord/types/structures/invite.go deleted file mode 100644 index e75f52f..0000000 --- a/common/discord/types/structures/invite.go +++ /dev/null @@ -1,23 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Invite is the representation of a Discord Invite -type Invite struct { - // the invite code (unique ID) - Code string `json:"code"` - // the guild this invite is for - Guild Guild `json:"guild,omitempty"` - // the channel this invite is for - Channel Channel `json:"channel"` - // the user who created the invite - Inviter User `json:"inviter,omitempty"` - // the target user for this invite - TargetUser User `json:"target_user,omitempty"` - // the type of user target for this invite - TargetUserType types.TargetUserTypes `json:"target_user_type,omitempty"` - // approximate count of online members (only present when target_user is set) - ApproximatePresenceCount int `json:"approximate_presence_count,omitempty"` - // approximate count of total members - ApproximateMemberCount int `json:"approximate_member_count"` -} diff --git a/common/discord/types/structures/message-activity.go b/common/discord/types/structures/message-activity.go deleted file mode 100644 index 4c8b4b1..0000000 --- a/common/discord/types/structures/message-activity.go +++ /dev/null @@ -1,11 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// MessageActivity is the message activity -type MessageActivity struct { - // type of message activity - Type types.MessageActivityTypes `json:"type"` - // party_id from a Rich Presence event - PartyID string `json:"party_id"` -} diff --git a/common/discord/types/structures/message-application.go b/common/discord/types/structures/message-application.go deleted file mode 100644 index 1b7b28e..0000000 --- a/common/discord/types/structures/message-application.go +++ /dev/null @@ -1,15 +0,0 @@ -package structures - -// MessageApplication is the application object of a message -type MessageApplication struct { - // id of the application - ID string `json:"id"` - // id of the embed's image asset - CoverImage string `json:"cover_image,omitempty"` - // application's description - Description string `json:"description"` - // id of the application's icon - Icon string `json:"icon,omitempty"` - // name of the application - Name string `json:"name"` -} diff --git a/common/discord/types/structures/message-reference.go b/common/discord/types/structures/message-reference.go deleted file mode 100644 index acec965..0000000 --- a/common/discord/types/structures/message-reference.go +++ /dev/null @@ -1,16 +0,0 @@ -package structures - -// MessageReference is the reference object of a message -type MessageReference struct { - // id of the originating message - MessageID string `json:"message_id,omitempty"` - // id of the originating message's channel - // channel_id is optional when creating a reply, but will always be present when receiving an event/response - // that includes this data model. - ChannelID string `json:"channel_id,omitempty"` - // id of the originating message's guild - GuildID string `json:"guild_id,omitempty"` - // when sending, whether to error if the referenced message doesn't exist instead of sending as a normal (non-reply) - // message, default true - FailIfNotExists bool `json:"fail_if_not_exists,omitempty"` -} diff --git a/common/discord/types/structures/message.go b/common/discord/types/structures/message.go deleted file mode 100644 index b1e2931..0000000 --- a/common/discord/types/structures/message.go +++ /dev/null @@ -1,71 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Message is the representation of a Discord Message -type Message struct { - // id of the message - ID string `json:"id"` - // id of the channel the message was sent in - ChannelID string `json:"channel_id"` - // id of the guild the message was sent in - GuildID string `json:"guild_id,omitempty"` - // the author of this message (not guaranteed to be a valid user, see below) - // The author object follows the structure of the user object, - // but is only a valid user in the case where the message is generated by a user or bot user. - // If the message is generated by a webhook, the author object corresponds to the webhook's id, username, and avatar. - // ou can tell if a message is generated by a webhook by checking for the webhook_id on the message object. - Author User `json:"author"` - // member properties for this message's author - // The member object exists in MESSAGE_CREATE and MESSAGE_UPDATE events from text-based guild channels. - // This allows bots to obtain real-time member data without requiring bots to store member state in memory. - Member GuildMember `json:"member,omitempty"` - // contents of the message - Content string `json:"content"` - // when this message was sent - Timestamp string `json:"timestamp"` - // when this message was edited (or null if never) - EditedTimestamp string `json:"edited_timestamp,omitempty"` - // whether this was a TTS message - TTS bool `json:"tts"` - // whether this message mentions everyone - MentionEveryone bool `json:"mention_everyone"` - // users specifically mentioned in the message - // The user objects in the mentions array will only have the partial member field present in MESSAGE_CREATE and - // MESSAGE_UPDATE events from text-based guild channels. - Mentions []User `json:"mentions"` - // roles specifically mentioned in this message - MentionRoles []string `json:"mention_roles"` - // channels specifically mentioned in this message - MentionChannels []ChannelMention `json:"mention_channels"` - // any attached files - Attachments []Attachment `json:"attachments"` - // any embedded content - Embeds []Embed `json:"embeds"` - // reactions to the message - Reactions []Reaction `json:"reactions,omitempty"` - // used for validating a message was sent - Nonce string `json:"nonce,omitempty"` - // whether this message is pinned - Pinned bool `json:"pinned"` - // if the message is generated by a webhook, this is the webhook's id - WebhookID string `json:"webhook_id,omitempty"` - // type of message - Type types.MessageTypes `json:"type"` - // sent with Rich Presence-related chat embeds - Activity MessageActivity `json:"activity,omitempty"` - // sent with Rich Presence-related chat embeds - Application MessageApplication `json:"application,omitempty"` - // reference data sent with cross posted messages and replies - MessageReference MessageReference `json:"message_reference,omitempty"` - // message flags combined as a bitfield - Flags types.MessageFlags `json:"flags,omitempty"` - // the stickers sent with the message (bots currently can only receive messages with stickers, not send) - Stickers []Sticker `json:"stickers"` - // the message associated with the message_reference - // This field is only returned for messages with a type of 19 (REPLY). - // If the message is a reply but the referenced_message field is not present, the backend did not attempt to fetch - // the message that was being replied to, so its state is unknown. - // If the field exists but is null, the referenced message was deleted. - ReferencedMessage *Message `json:"referenced_message,omitempty"` -} diff --git a/common/discord/types/structures/overwrite.go b/common/discord/types/structures/overwrite.go deleted file mode 100644 index de5085d..0000000 --- a/common/discord/types/structures/overwrite.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// Overwrite is a representation of Overwrite in Discord permissions system -type Overwrite struct { - // role or user id - ID string `json:"id"` - // either 0 (role) or 1 (member) - Type int `json:"type"` - // permission bit set - Allow string `json:"allow"` - // permission bit set - Deny string `json:"deny"` -} diff --git a/common/discord/types/structures/presence.go b/common/discord/types/structures/presence.go deleted file mode 100644 index 9b99322..0000000 --- a/common/discord/types/structures/presence.go +++ /dev/null @@ -1,17 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Presence is the representation of a user's presence on a guild. -type Presence struct { - // the user presence is being updated for - User User `json:"user"` - // id of the guild - GuildID string `json:"guild_id"` - // either "idle", "dnd", "online", or "offline" - Status types.Statuses `json:"status"` - // user's current activities - Activities []Activity `json:"activities"` - // user's platform-dependent status - ClientStatus ClientStatus `json:"client_status"` -} diff --git a/common/discord/types/structures/reaction.go b/common/discord/types/structures/reaction.go deleted file mode 100644 index 801ee25..0000000 --- a/common/discord/types/structures/reaction.go +++ /dev/null @@ -1,11 +0,0 @@ -package structures - -// Reaction represents a message reaction -type Reaction struct { - // times this emoji has been used to react - Count int `json:"count"` - // whether the current user reacted using this emoji - Me bool `json:"me"` - // emoji information - Emoji Emoji `json:"emoji"` -} diff --git a/common/discord/types/structures/role-tags.go b/common/discord/types/structures/role-tags.go deleted file mode 100644 index 37cad5d..0000000 --- a/common/discord/types/structures/role-tags.go +++ /dev/null @@ -1,9 +0,0 @@ -package structures - -// RoleTags is the tag a role has -type RoleTags struct { - BotID string `json:"bot_id,omitempty"` - IntegrationID string `json:"integration_id,omitempty"` - // ALWAYS NULL YET - PremiumSubscriber struct{} `json:"premium_subscriber"` -} diff --git a/common/discord/types/structures/role.go b/common/discord/types/structures/role.go deleted file mode 100644 index ffdae85..0000000 --- a/common/discord/types/structures/role.go +++ /dev/null @@ -1,14 +0,0 @@ -package structures - -// Role is a Discord Role -type Role struct { - ID string `json:"id"` - Name string `json:"name"` - Color int `json:"color"` - Hoist bool `json:"hoist"` - Position int `json:"position"` - Permissions string `json:"permissions"` - Managed bool `json:"managed"` - Mentionable bool `json:"mentionable"` - Tags RoleTags `json:"tags,omitempty"` -} diff --git a/common/discord/types/structures/sticker.go b/common/discord/types/structures/sticker.go deleted file mode 100644 index 7679800..0000000 --- a/common/discord/types/structures/sticker.go +++ /dev/null @@ -1,23 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// Sticker represents a Discord message sticker -type Sticker struct { - // id of the sticker - ID string `json:"id"` - // id of the pack the sticker is from - PackID string `json:"pack_id"` - // name of the sticker - Name string `json:"name"` - // description of the sticker - Description string `json:"description"` - // a comma-separated list of tags for the sticker - Tags string `json:"tags,omitempty"` - // sticker asset hash - Asset string `json:"asset"` - // sticker preview asset hash - PreviewAsset string `json:"preview_asset,omitempty"` - // type of sticker format - FormatType types.StickerTypes `json:"format_type"` -} diff --git a/common/discord/types/structures/team-member.go b/common/discord/types/structures/team-member.go deleted file mode 100644 index c7d10bb..0000000 --- a/common/discord/types/structures/team-member.go +++ /dev/null @@ -1,15 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// TeamMember represents a member of a Discord Team -type TeamMember struct { - // the user's membership state on the team - MembershipState types.MembershipStates `json:"membership_state"` - // will always be ["*"] - Permissions []string `json:"permissions"` - // the id of the parent team of which they are a member - TeamID string `json:"team_id"` - // the avatar, discriminator, id, and username of the user - User User `json:"user"` -} diff --git a/common/discord/types/structures/team.go b/common/discord/types/structures/team.go deleted file mode 100644 index fd4ff24..0000000 --- a/common/discord/types/structures/team.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// Team represents a Discord Team -type Team struct { - // a hash of the image of the team's icon - Icon string `json:"icon,omitempty"` - // the unique id of the team - ID string `json:"id"` - // the members of the team - Members []TeamMember `json:"members"` - // the user id of the current team owner - OwnerUserID string `json:"owner_user_id"` -} diff --git a/common/discord/types/structures/user.go b/common/discord/types/structures/user.go deleted file mode 100644 index bd423a6..0000000 --- a/common/discord/types/structures/user.go +++ /dev/null @@ -1,20 +0,0 @@ -package structures - -import "github.com/discordnova/nova/common/discord/types/types" - -// User represents the User Structure sent by the Discord API -type User struct { - ID string `json:"id"` - Username string `json:"username"` - Discriminator string `json:"discriminator"` - Avatar string `json:"avatar,omitempty"` - Bot bool `json:"bot,omitempty"` - System bool `json:"system,omitempty"` - MFAEnabled bool `json:"mfa_enabled,omitempty"` - Locale string `json:"locale,omitempty"` - Verified bool `json:"verified,omitempty"` - Email string `json:"email,omitempty"` - Flags types.UserFlags `json:"flags,omitempty"` - PremiumType types.PremiumTypes `json:"premium_type,omitempty"` - PublicFlags types.UserFlags `json:"public_flags,omitempty"` -} diff --git a/common/discord/types/structures/voice-state.go b/common/discord/types/structures/voice-state.go deleted file mode 100644 index bbc1897..0000000 --- a/common/discord/types/structures/voice-state.go +++ /dev/null @@ -1,29 +0,0 @@ -package structures - -// VoiceState is a representation of a user's voice connection status -type VoiceState struct { - // the guild id this voice state is for - GuildID string `json:"guild_id,omitempty"` - // the channel id this user is connected to - ChannelID string `json:"channel_id,omitempty"` - // the user id this voice state is for - UserID string `json:"user_id,omitempty"` - // the guild member this voice state is for - Member GuildMember `json:"member,omitempty"` - // the session id for this voice state - SessionID string `json:"session_id"` - // whether this user is deafened by the server - Deaf bool `json:"deaf"` - // whether this user is muted by the server - Mute bool `json:"mute"` - // whether this user is locally deafened - SelfDeaf bool `json:"self_deaf"` - // whether this user is locally muted - SelfMute bool `json:"self_mute"` - // whether this user is streaming using "Go Live" - SelfStream bool `json:"self_stream,omitempty"` - // whether this user's camera is enabled - SelfVideo bool `json:"self_video"` - // whether this user is muted by the current user - Suppress bool `json:"suppress"` -} diff --git a/common/discord/types/structures/welcome-screen-channel.go b/common/discord/types/structures/welcome-screen-channel.go deleted file mode 100644 index 5358aa3..0000000 --- a/common/discord/types/structures/welcome-screen-channel.go +++ /dev/null @@ -1,13 +0,0 @@ -package structures - -// WelcomeScreenChannel is a representation of a channel in a welcome screen -type WelcomeScreenChannel struct { - // the channel's id - ChannelID string `json:"channel_id"` - // the description shown for the channel - Description string `json:"description"` - // the emoji id, if the emoji is custom - EmojiID string `json:"emoji_id,omitempty"` - // the emoji name if custom, the unicode character if standard, or null if no emoji is set - EmojiName string `json:"emoji_name,omitempty"` -} diff --git a/common/discord/types/structures/welcome-screen.go b/common/discord/types/structures/welcome-screen.go deleted file mode 100644 index 528b634..0000000 --- a/common/discord/types/structures/welcome-screen.go +++ /dev/null @@ -1,9 +0,0 @@ -package structures - -// WelcomeScreen is a representation of a Guild welcome screen -type WelcomeScreen struct { - // the server description shown in the welcome screen - Description string `json:"description,omitempty"` - // the channels shown in the welcome screen, up to 5 - WelcomeChannels []WelcomeScreenChannel `json:"welcome_channels"` -} diff --git a/common/discord/types/types/BUILD.bazel b/common/discord/types/types/BUILD.bazel deleted file mode 100644 index f4f23a3..0000000 --- a/common/discord/types/types/BUILD.bazel +++ /dev/null @@ -1,36 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "types", - srcs = [ - "activity-flags.go", - "activity-types.go", - "channel-types.go", - "client-statuses.go", - "default-message-notification-levels.go", - "embed-types.go", - "explicit-content-filter-levels.go", - "gateway-close-event-codes.go", - "gateway-intents.go", - "gateway-op-codes.go", - "guild-features.go", - "membership-states.go", - "message-activity-types.go", - "message-flags.go", - "message-types.go", - "mfa-levels.go", - "premium-tiers.go", - "premium-types.go", - "statuses.go", - "sticker-types.go", - "system-channel-flags.go", - "target-user-types.go", - "update-status-statuses.go", - "user-flags.go", - "verification-levels.go", - "voice-gateway-close-event-codes.go", - "voice-gateway-op-codes.go", - ], - importpath = "github.com/discordnova/nova/common/discord/types/types", - visibility = ["//visibility:public"], -) diff --git a/common/discord/types/types/activity-flags.go b/common/discord/types/types/activity-flags.go deleted file mode 100644 index 7e00ce0..0000000 --- a/common/discord/types/types/activity-flags.go +++ /dev/null @@ -1,19 +0,0 @@ -package types - -// ActivityFlags are the flags of an activity -type ActivityFlags int - -const ( - // ActivityFlagInstance is the flag for instanced activities - ActivityFlagInstance ActivityFlags = 1 << 0 - // ActivityFlagJoin is the flag for activities we can join - ActivityFlagJoin = 1 << 1 - // ActivityFlagSpectate is the flag for activities we can spectate - ActivityFlagSpectate = 1 << 2 - // ActivityFlagJoinRequest is the flag for activities we can request to join - ActivityFlagJoinRequest = 1 << 3 - // ActivityFlagSync is the flag for sync activities - ActivityFlagSync = 1 << 4 - // ActivityFlagPlay is the flag for playable activities - ActivityFlagPlay = 1 << 5 -) diff --git a/common/discord/types/types/activity-types.go b/common/discord/types/types/activity-types.go deleted file mode 100644 index 0768b5c..0000000 --- a/common/discord/types/types/activity-types.go +++ /dev/null @@ -1,22 +0,0 @@ -package types - -// ActivityTypes are the different types for an activity -type ActivityTypes int - -const ( - // ActivityTypeGame is the "Playing {name}" activity - ActivityTypeGame ActivityTypes = 0 - // ActivityTypeStreaming is the "Streaming {details}" activity - // The streaming type currently only supports Twitch and YouTube. - // Only https://twitch.tv/ and https://youtube.com/ urls will work. - ActivityTypeStreaming = 1 - // ActivityTypeListening is the "Listening to {name}" activity - ActivityTypeListening = 2 - - /* yes, there is no 3 */ - - // ActivityTypeCustom is the "{emoji} {name}" activity - ActivityTypeCustom = 4 - // ActivityTypeCompeting is the "Competing in {name}" activity - ActivityTypeCompeting = 5 -) diff --git a/common/discord/types/types/channel-types.go b/common/discord/types/types/channel-types.go deleted file mode 100644 index 071b122..0000000 --- a/common/discord/types/types/channel-types.go +++ /dev/null @@ -1,21 +0,0 @@ -package types - -// ChannelTypes are the different types of channel -type ChannelTypes int - -const ( - // ChannelTypeGuildText is a text channel within a server - ChannelTypeGuildText ChannelTypes = 0 - // ChannelTypeDM is a direct message between users - ChannelTypeDM = 1 - // ChannelTypeGuildVoice is a voice channel within a server - ChannelTypeGuildVoice = 2 - // ChannelTypeGroupDM is a direct message between multiple users - ChannelTypeGroupDM = 3 - // ChannelTypeGuildCategory is an organizational category that contains up to 50 channels - ChannelTypeGuildCategory = 4 - // ChannelTypeGuildNews is a channel that users can follow and cross post into their own server - ChannelTypeGuildNews = 5 - // ChannelTypeGuildStore is a channel in which game developers can sell their game on Discord - ChannelTypeGuildStore = 6 -) diff --git a/common/discord/types/types/client-statuses.go b/common/discord/types/types/client-statuses.go deleted file mode 100644 index b94c0f8..0000000 --- a/common/discord/types/types/client-statuses.go +++ /dev/null @@ -1,14 +0,0 @@ -package types - -// ClientStatuses are the different client status for active sessions -type ClientStatuses string - -const ( - // ClientStatusOnline is the status for online users - ClientStatusOnline ClientStatuses = "online" - // ClientStatusIdle is the status for idle sessions - ClientStatusIdle ClientStatuses = "idle" - // ClientStatusDnD is the status for do not disturb sessions - ClientStatusDnD ClientStatuses = "dnd" - /* There is no offline: https://discord.com/developers/docs/topics/gateway#client-status-object */ -) diff --git a/common/discord/types/types/default-message-notification-levels.go b/common/discord/types/types/default-message-notification-levels.go deleted file mode 100644 index c90713b..0000000 --- a/common/discord/types/types/default-message-notification-levels.go +++ /dev/null @@ -1,11 +0,0 @@ -package types - -// DefaultMessageNotificationLevels is the notification level for a guild -type DefaultMessageNotificationLevels int - -const ( - // DefaultMessageNotificationLevelAllMessages notify on every message - DefaultMessageNotificationLevelAllMessages DefaultMessageNotificationLevels = 0 - // DefaultMessageNotificationLevelOnlyMentions notify only on mentions - DefaultMessageNotificationLevelOnlyMentions = 1 -) diff --git a/common/discord/types/types/embed-types.go b/common/discord/types/types/embed-types.go deleted file mode 100644 index 8632f03..0000000 --- a/common/discord/types/types/embed-types.go +++ /dev/null @@ -1,19 +0,0 @@ -package types - -// EmbedTypes are the different types of a Embed -type EmbedTypes string - -const ( - // EmbedTypeRich is a generic embed rendered from embed attributes - EmbedTypeRich EmbedTypes = "rich" - // EmbedTypeImage is an image embed - EmbedTypeImage = "image" - // EmbedTypeVideo is a video embed - EmbedTypeVideo = "video" - // EmbedTypeGIFV is an animated gif image embed rendered as a video embed - EmbedTypeGIFV = "gifv" - // EmbedTypeArticle is an article embed - EmbedTypeArticle = "article" - // EmbedTypeLink is a link embed - EmbedTypeLink = "link" -) diff --git a/common/discord/types/types/explicit-content-filter-levels.go b/common/discord/types/types/explicit-content-filter-levels.go deleted file mode 100644 index 8586408..0000000 --- a/common/discord/types/types/explicit-content-filter-levels.go +++ /dev/null @@ -1,13 +0,0 @@ -package types - -// ExplicitContentFilterLevels is the level for the Explicit Content -type ExplicitContentFilterLevels int - -const ( - // ExplicitContentFilterLevelDisabled disables the scan - ExplicitContentFilterLevelDisabled = 0 - // ExplicitContentFilterLevelMembersWithoutRoles scans for members without roles - ExplicitContentFilterLevelMembersWithoutRoles = 1 - // ExplicitContentFilterLevelAllMembers scans for anyone - ExplicitContentFilterLevelAllMembers = 2 -) diff --git a/common/discord/types/types/gateway-close-event-codes.go b/common/discord/types/types/gateway-close-event-codes.go deleted file mode 100644 index 86798bf..0000000 --- a/common/discord/types/types/gateway-close-event-codes.go +++ /dev/null @@ -1,52 +0,0 @@ -package types - -// GatewayCloseEventCodes is a code explaining the reason -// the gateway connection closed -type GatewayCloseEventCodes int - -// GatewayCloseEventCodes values -const ( - // GatewayCloseEventCodeUnknownError is corresponding to a - // Discord internal error - GatewayCloseEventCodeUnknownError GatewayCloseEventCodes = 4000 - // GatewayCloseEventCodeUnknownOpCode is used when an - // invalid payload for a payload or opcode was sent - GatewayCloseEventCodeUnknownOpCode = 4001 - // GatewayCloseEventCodeDecodeError is used when an invalid payload was sent - GatewayCloseEventCodeDecodeError = 4002 - // GatewayCloseEventCodeNotAuthenticated is used when a payload was - // sent prior to the Identify payload - GatewayCloseEventCodeNotAuthenticated = 4003 - // GatewayCloseEventCodeAuthenticationFailed is used when the account token - // in the Identify payload is incorrect - GatewayCloseEventCodeAuthenticationFailed = 4004 - // GatewayCloseEventCodeAlreadyAuthenticated is used when more than one - // Identify payload was sent - GatewayCloseEventCodeAlreadyAuthenticated = 4005 - - /* There is no 4006... */ - - // GatewayCloseEventCodeInvalidSeq is used when the sequence of a - // resuming payload is invalid. Need tro reconnect and start a new session - GatewayCloseEventCodeInvalidSeq = 4007 - // GatewayCloseEventCodeRateLimited is used when a rate limit applied. - GatewayCloseEventCodeRateLimited = 4008 - // GatewayCloseEventCodeSessionTimedOut is used when a session expired. - // Need to reconnect and start a new one - GatewayCloseEventCodeSessionTimedOut = 4009 - // GatewayCloseEventCodeInvalidShard is used when an invalid shard was sent - // in the Identify payload - GatewayCloseEventCodeInvalidShard = 4010 - // GatewayCloseEventCodeShardingRequired is used when a session handle too - // many guild. The connection needs more shards - GatewayCloseEventCodeShardingRequired = 4011 - // GatewayCloseEventCodeInvalidAPIVersion is used when an invalid version - // of the gateway was sent - GatewayCloseEventCodeInvalidAPIVersion = 4012 - // GatewayCloseEventCodeInvalidIntents is used when invalid intents were - // provided. - GatewayCloseEventCodeInvalidIntents = 4013 - // GatewayCloseEventCodeDisallowedIntents is used when a provided intent is - // not enabled. - GatewayCloseEventCodeDisallowedIntents = 4014 -) diff --git a/common/discord/types/types/gateway-intents.go b/common/discord/types/types/gateway-intents.go deleted file mode 100644 index 1bcec9b..0000000 --- a/common/discord/types/types/gateway-intents.go +++ /dev/null @@ -1,23 +0,0 @@ -package types - -// GatewayIntents are the Intents for the Gateway -type GatewayIntents int - -// -const ( - GatewayIntentGuilds GatewayIntents = 1 << 0 - GatewayIntentGuildMembers = 1 << 1 - GatewayIntentGuildBans = 1 << 2 - GatewayIntentGuildEmojis = 1 << 2 - GatewayIntentGuildIntegrations = 1 << 4 - GatewayIntentGuildWebhooks = 1 << 5 - GatewayIntentGuildInvites = 1 << 6 - GatewayIntentGuildVoiceStates = 1 << 7 - GatewayIntentGuildPresences = 1 << 8 - GatewayIntentGuildMessages = 1 << 9 - GatewayIntentGuildMessageReactions = 1 << 10 - GatewayIntentGuildMessageTyping = 1 << 11 - GatewayIntentDirectMessages = 1 << 12 - GatewayIntentDirectMessageReactions = 1 << 13 - GatewayIntentDirectMessageTyping = 1 << 14 -) diff --git a/common/discord/types/types/gateway-op-codes.go b/common/discord/types/types/gateway-op-codes.go deleted file mode 100644 index 1357790..0000000 --- a/common/discord/types/types/gateway-op-codes.go +++ /dev/null @@ -1,40 +0,0 @@ -package types - -// GatewayOpCodes are code tagged by the Discord Gateway to type payloads -type GatewayOpCodes int - -// Valid OpCode values -const ( - // GatewayOpCodeDispatch is when an event was dispatched. - GatewayOpCodeDispatch GatewayOpCodes = 0 - // GatewayOpCodeHeartbeat is fired periodically by the client - // to keep the connection alive. - GatewayOpCodeHeartbeat = 1 - // GatewayOpCodeIdentify starts a new session during the initial handshake. - GatewayOpCodeIdentify = 2 - // GatewayOpCodePresenceUpdate updates the client's presence. - GatewayOpCodePresenceUpdate = 3 - // GatewayOpCodeVoiceStateUpdate is used to join/leave or - // move between voice channels. - GatewayOpCodeVoiceStateUpdate = 4 - - // Yes, there is no 5 - - // GatewayOpCodeResume resumes a previous session that was disconnected. - GatewayOpCodeResume = 6 - // GatewayOpCodeReconnect announces that you should attempt to reconnect - // and resume immediately. - GatewayOpCodeReconnect = 7 - // GatewayOpCodeRequestGuildMembers requests information about offline guild - // members in a large guild. - GatewayOpCodeRequestGuildMembers = 8 - // GatewayOpCodeInvalidSession announces that the session has been invalidated and - // you should reconnect and identify/resume accordingly. - GatewayOpCodeInvalidSession = 9 - // GatewayOpCodeHello is sent immediately after connecting and contains - // the heartbeat_interval to use. - GatewayOpCodeHello = 10 - // GatewayOpCodeHeartbeatACK is sent in response to receiving a heartbeat - // to acknowledge that it has been received. - GatewayOpCodeHeartbeatACK = 11 -) diff --git a/common/discord/types/types/guild-features.go b/common/discord/types/types/guild-features.go deleted file mode 100644 index 41e488c..0000000 --- a/common/discord/types/types/guild-features.go +++ /dev/null @@ -1,40 +0,0 @@ -package types - -// GuildFeatures is the features enabled for a Guild -type GuildFeatures string - -const ( - // GuildFeatureInviteSplash is the feature where a guild can set an invite splash background - GuildFeatureInviteSplash GuildFeatures = "INVITE_SPLASH" - // GuildFeatureVIPRegions is the feature where a guild has access to set 384kbps bitrate in voice - // // (previously VIP voice servers) - GuildFeatureVIPRegions = "VIP_REGIONS" - // GuildFeatureVanityURL is the feature where a guild has access to set a vanity URL - GuildFeatureVanityURL = "VANITY_URL" - // GuildFeatureVerified is the feature where a guild is verified - GuildFeatureVerified = "VERIFIED" - // GuildFeaturePartnered is the feature where a guild is partnered - GuildFeaturePartnered = "PARTNERED" - // GuildFeatureCommunity is the feature where a guild can enable welcome screen, Membership Screening, - // and discovery, and receives community updates - GuildFeatureCommunity = "COMMUNITY" - // GuildFeatureCommerce is the feature where a guild has access to use commerce features (i.e. create store channels) - GuildFeatureCommerce = "COMMERCE" - // GuildFeatureNews is the feature where a guild has access to create news channels - GuildFeatureNews = "NEWS" - // GuildFeatureDiscoverable is the feature where a guild is able to be discovered in the directory - GuildFeatureDiscoverable = "DISCOVERABLE" - // GuildFeatureFeaturable is the feature where a guild is able to be featured in the directory - GuildFeatureFeaturable = "FEATURABLE" - // GuildFeatureAnimatedIcon is the feature where a guild has access to set an animated guild icon - GuildFeatureAnimatedIcon = "ANIMATED_ICON" - // GuildFeatureBanner is the feature where a guild has access to set a guild banner image - GuildFeatureBanner = "BANNER" - // GuildFeatureWelcomeScreenEnabled is the feature where a guild has enabled the welcome screen - GuildFeatureWelcomeScreenEnabled = "WELCOME_SCREEN_ENABLED" - // GuildFeatureMemberMemberVerificationGateEnabled is the feature where a guild has enabled Membership Screening - GuildFeatureMemberMemberVerificationGateEnabled = "MEMBER_VERIFICATION_GATE_ENABLED" - // GuildFeaturePreviewEnabled is the feature where a guild can be previewed before joining via - // Membership Screening or the directory - GuildFeaturePreviewEnabled = "PREVIEW_ENABLED" -) diff --git a/common/discord/types/types/membership-states.go b/common/discord/types/types/membership-states.go deleted file mode 100644 index 7d449e4..0000000 --- a/common/discord/types/types/membership-states.go +++ /dev/null @@ -1,11 +0,0 @@ -package types - -// MembershipStates are the different state of a membership in a Team -type MembershipStates int - -const ( - // MembershipStateInvited is the state of a pending invitation - MembershipStateInvited MembershipStates = 1 - // MembershipStateAccepted is the state of an accepted invitation - MembershipStateAccepted = 2 -) diff --git a/common/discord/types/types/message-activity-types.go b/common/discord/types/types/message-activity-types.go deleted file mode 100644 index 6dea7dd..0000000 --- a/common/discord/types/types/message-activity-types.go +++ /dev/null @@ -1,12 +0,0 @@ -package types - -// MessageActivityTypes are the types of a message activity -type MessageActivityTypes int - -// -const ( - MessageActivityTypeJoin MessageActivityTypes = 1 - MessageActivityTypeSpectate = 2 - MessageActivityTypeListen = 3 - MessageActivityTypeJoinRequest = 5 -) diff --git a/common/discord/types/types/message-flags.go b/common/discord/types/types/message-flags.go deleted file mode 100644 index 403d9dd..0000000 --- a/common/discord/types/types/message-flags.go +++ /dev/null @@ -1,20 +0,0 @@ -package types - -// MessageFlags are the flags of a message -type MessageFlags int - -const ( - // MessageFlagCrossPosted is used when this message has been published to subscribed channels ( - // via Channel Following) - MessageFlagCrossPosted MessageFlags = 1 << 0 - // MessageFlagIsCrossPost is used when this message originated from a message in another channel ( - // via Channel Following) - MessageFlagIsCrossPost = 1 << 1 - // MessageFlagSuppressEmbeds is used when not include any embeds when serializing this message - MessageFlagSuppressEmbeds = 1 << 2 - // MessageFlagSourceMessageDeleted is used when the source message for this cross post has been deleted ( - // via Channel Following) - MessageFlagSourceMessageDeleted = 1 << 3 - // MessageFlagUrgent is used when this message came from the urgent message system - MessageFlagUrgent = 1 << 4 -) diff --git a/common/discord/types/types/message-types.go b/common/discord/types/types/message-types.go deleted file mode 100644 index a05a151..0000000 --- a/common/discord/types/types/message-types.go +++ /dev/null @@ -1,25 +0,0 @@ -package types - -// MessageTypes are the types of a message -type MessageTypes int - -// -const ( - MessageTypeDefault MessageTypes = 0 - MessageTypeRecipientAdd = 1 - MessageTypeRecipientRemove = 2 - MessageTypeCall = 3 - MessageTypeChannelNameChange = 4 - MessageTypeChannelIconChange = 5 - MessageTypeChannelPinnedMessage = 6 - MessageTypeGuildMemberJoin = 7 - MessageTypeUserPremiumGuildSubscription = 8 - MessageTypeUserPremiumGuildSubscriptionTier1 = 9 - MessageTypeUserPremiumGuildSubscriptionTier2 = 10 - MessageTypeUserPremiumGuildSubscriptionTier3 = 11 - MessageTypeChannelFollowAdd = 12 - MessageTypeGuildDiscoveryDisqualified = 14 - MessageTypeGuildDiscoveryRequalified = 15 - MessageTypeReply = 19 - MessageTypeApplicationCommand = 20 -) diff --git a/common/discord/types/types/mfa-levels.go b/common/discord/types/types/mfa-levels.go deleted file mode 100644 index 3d64810..0000000 --- a/common/discord/types/types/mfa-levels.go +++ /dev/null @@ -1,11 +0,0 @@ -package types - -// MFALevels are the different level of MFA (a2f) -type MFALevels int - -const ( - // MFALevelNone is the level where MFA is not required - MFALevelNone MFALevels = 0 - // MFALevelElevated is the level where MFA is required - MFALevelElevated = 1 -) diff --git a/common/discord/types/types/premium-tiers.go b/common/discord/types/types/premium-tiers.go deleted file mode 100644 index c9004d4..0000000 --- a/common/discord/types/types/premium-tiers.go +++ /dev/null @@ -1,15 +0,0 @@ -package types - -// PremiumTiers are the different tiers of a premium on a guild (aka Boosts) -type PremiumTiers int - -const ( - // PremiumTierNone is the tier with no boosts - PremiumTierNone PremiumTiers = 0 - // PremiumTierTier1 is the first boosts tier - PremiumTierTier1 = 1 - // PremiumTierTier2 is the second boosts tier - PremiumTierTier2 = 2 - // PremiumTierTier3 is the third boosts tier - PremiumTierTier3 = 3 -) diff --git a/common/discord/types/types/premium-types.go b/common/discord/types/types/premium-types.go deleted file mode 100644 index a214dd1..0000000 --- a/common/discord/types/types/premium-types.go +++ /dev/null @@ -1,11 +0,0 @@ -package types - -// PremiumTypes is the level of premium a user has. -type PremiumTypes int - -// Values for PremiumTypes -const ( - PremiumTypeNone PremiumTypes = 0 - PremiumTypeNitroClassic = 1 - PremiumTypeNitro = 2 -) diff --git a/common/discord/types/types/statuses.go b/common/discord/types/types/statuses.go deleted file mode 100644 index 1368581..0000000 --- a/common/discord/types/types/statuses.go +++ /dev/null @@ -1,15 +0,0 @@ -package types - -// Statuses is a Presence status for a user -type Statuses string - -const ( - // StatusOnline is the status for an online user - StatusOnline Statuses = "online" - // StatusIdle is the status for an idle user - StatusIdle = "idle" - // StatusDND is the status for a user in Do not Disturb - StatusDND = "dnd" - // StatusOffline is the status for an offline or invisible user - StatusOffline = "offline" -) diff --git a/common/discord/types/types/sticker-types.go b/common/discord/types/types/sticker-types.go deleted file mode 100644 index f546406..0000000 --- a/common/discord/types/types/sticker-types.go +++ /dev/null @@ -1,11 +0,0 @@ -package types - -// StickerTypes are the types of a sticker -type StickerTypes int - -// -const ( - StickerTypePNG StickerTypes = 1 - StickerTypeAPNG = 2 - StickerTypeLottie = 3 -) diff --git a/common/discord/types/types/system-channel-flags.go b/common/discord/types/types/system-channel-flags.go deleted file mode 100644 index 6064aba..0000000 --- a/common/discord/types/types/system-channel-flags.go +++ /dev/null @@ -1,11 +0,0 @@ -package types - -// SystemChannelFlags are the flags of a channel -type SystemChannelFlags int - -const ( - // SystemChannelFlagSuppressJoinNotifications is the flag when a channel suppresses member join notifications - SystemChannelFlagSuppressJoinNotifications SystemChannelFlags = 1 << 0 - // SystemChannelFlagSuppressPremiumSubscriptions is the flag when a channel suppresses server boost notifications - SystemChannelFlagSuppressPremiumSubscriptions = 1 << 1 -) diff --git a/common/discord/types/types/target-user-types.go b/common/discord/types/types/target-user-types.go deleted file mode 100644 index 00243be..0000000 --- a/common/discord/types/types/target-user-types.go +++ /dev/null @@ -1,9 +0,0 @@ -package types - -// TargetUserTypes are the types of invite target -type TargetUserTypes int - -const ( - // TargetUserTypeStream is a stream target - TargetUserTypeStream TargetUserTypes = 1 -) diff --git a/common/discord/types/types/update-status-statuses.go b/common/discord/types/types/update-status-statuses.go deleted file mode 100644 index 39a06b4..0000000 --- a/common/discord/types/types/update-status-statuses.go +++ /dev/null @@ -1,18 +0,0 @@ -package types - -// UpdateStatusStatuses are the statuses used in a Update Status gateway command -type UpdateStatusStatuses string - -// -const ( - // UpdateStatusStatusOnline is the online status - UpdateStatusStatusOnline UpdateStatusStatuses = "online" - // UpdateStatusStatusDoNotDisturb is the Do Not Disturb status - UpdateStatusStatusDoNotDisturb = "dnd" - // UpdateStatusStatusIdle is the AFK status - UpdateStatusStatusIdle = "idle" - // UpdateStatusStatusInvisible is the Invisible status, shown as offline - UpdateStatusStatusInvisible = "invisible" - // UpdateStatusStatusOffline is the offline status - UpdateStatusStatusOffline = "offline" -) diff --git a/common/discord/types/types/user-flags.go b/common/discord/types/types/user-flags.go deleted file mode 100644 index 89292b9..0000000 --- a/common/discord/types/types/user-flags.go +++ /dev/null @@ -1,22 +0,0 @@ -package types - -// UserFlags is the flags of a User -type UserFlags int - -// Valid UserFlags -const ( - UserFlagNone UserFlags = 0 - UserFlagDiscordEmployee = 1 << 0 - UserFlagPartneredServerOwner = 1 << 1 - UserFlagHypeSquadEvents = 1 << 2 - UserFlagBugHunterLevel1 = 1 << 3 - UserFlagHouseBravery = 1 << 6 - UserFlagHouseBrilliance = 1 << 7 - UserFlagHouseBalance = 1 << 8 - UserFlagEarlySupporter = 1 << 9 - UserFlagTeamUser = 1 << 10 - UserFlagSystem = 1 << 12 - UserFlagBugHunterLevel2 = 1 << 14 - UserFlagVerifiedBot = 1 << 16 - UserFlagEarlyVerifiedBotDeveloper = 1 << 17 -) diff --git a/common/discord/types/types/verification-levels.go b/common/discord/types/types/verification-levels.go deleted file mode 100644 index 874f864..0000000 --- a/common/discord/types/types/verification-levels.go +++ /dev/null @@ -1,19 +0,0 @@ -package types - -// VerificationLevels is the verification level of a guild -type VerificationLevels int - -const ( - // VerificationLevelNone needs nothing - VerificationLevelNone VerificationLevels = 0 - // VerificationLevelLow needs members to have a verified email - VerificationLevelLow = 1 - // VerificationLevelMedium needs members to be registered on Discord for - // longer than 5 minutes - VerificationLevelMedium = 2 - // VerificationLevelHigh needs members to be a member of the server for - // longer than 10 minutes - VerificationLevelHigh = 3 - // VerificationLevelVeryHigh needs members to have a verified phone number - VerificationLevelVeryHigh = 4 -) diff --git a/common/discord/types/types/voice-gateway-close-event-codes.go b/common/discord/types/types/voice-gateway-close-event-codes.go deleted file mode 100644 index 0adfb82..0000000 --- a/common/discord/types/types/voice-gateway-close-event-codes.go +++ /dev/null @@ -1,53 +0,0 @@ -package types - -// VoiceGatewayCloseEventCodes is a code explaining the close of a connection -// to the Voice gateway -type VoiceGatewayCloseEventCodes int - -// Valid codes -const ( - // VoiceGatewayCloseEventCodeUnknownOpcode is used after sending an - // invalid Opcode - VoiceGatewayCloseEventCodeUnknownOpcode VoiceGatewayCloseEventCodes = 4001 - // VoiceGatewayCloseEventCodeFailedToDecodePayload is used after sending an - // invalid payload - VoiceGatewayCloseEventCodeFailedToDecodePayload = 4002 - // VoiceGatewayCloseEventCodeNotAuthenticated is used after sending a payload - // prior to the Identifying one. - VoiceGatewayCloseEventCodeNotAuthenticated = 4003 - // VoiceGatewayCloseEventCodeAuthenticationFailed is used after sending an - // invalid Identify payload - VoiceGatewayCloseEventCodeAuthenticationFailed = 4004 - // VoiceGatewayCloseEventCodeAlreadyAuthenticated is used when sending more - // than ono Identify payload - VoiceGatewayCloseEventCodeAlreadyAuthenticated = 4005 - // VoiceGatewayCloseEventCodeSessionNoLongerValid is used when a session is - // no longer valid - VoiceGatewayCloseEventCodeSessionNoLongerValid = 4006 - - /* there is no 4007 and 4008 */ - - // VoiceGatewayCloseEventCodeSessionTimeout is used when a session timed out - VoiceGatewayCloseEventCodeSessionTimeout = 4009 - - /* no 4010 :angry_face: */ - - // VoiceGatewayCloseEventCodeServerNotFound is used after asking for an - // invalid voice server - VoiceGatewayCloseEventCodeServerNotFound = 4011 - // VoiceGatewayCloseEventCodeUnknownProtocol is used after sending an - // unrecognized protocol - VoiceGatewayCloseEventCodeUnknownProtocol = 4012 - - /* There is no 1043!!!! */ - - // VoiceGatewayCloseEventCodeDisconnected is used when the client has - // been disconnected and should not reconnect (deleted channel, kicked...) - VoiceGatewayCloseEventCodeDisconnected = 4014 - // VoiceGatewayCloseEventCodeVoiceServerCrashed is used after a voice - // server crashed. Need to resume the connection... - VoiceGatewayCloseEventCodeVoiceServerCrashed = 4015 - // VoiceGatewayCloseEventCodeUnknownEncryptionMode is used after sending a - // payload with an unrecognized encryption - VoiceGatewayCloseEventCodeUnknownEncryptionMode = 4016 -) diff --git a/common/discord/types/types/voice-gateway-op-codes.go b/common/discord/types/types/voice-gateway-op-codes.go deleted file mode 100644 index 6167a81..0000000 --- a/common/discord/types/types/voice-gateway-op-codes.go +++ /dev/null @@ -1,37 +0,0 @@ -package types - -// VoiceGatewayOpCodes are code tagged by the Discord Gateway to type payloads -type VoiceGatewayOpCodes int - -// Valid OpCode values -const ( - // VoiceGatewayOpCodeIdentify is used to begin a voice websocket connection - VoiceGatewayOpCodeIdentify VoiceGatewayOpCodes = 0 - // VoiceGatewayOpCodeSelectProtocol is used to select the voice protocol - VoiceGatewayOpCodeSelectProtocol = 1 - // VoiceGatewayOpCodeReady is used to complete the websocket handshake - VoiceGatewayOpCodeReady = 2 - // VoiceGatewayOpCodeHeartbeat is used to keep the connection alive - VoiceGatewayOpCodeHeartbeat = 3 - // VoiceGatewayOpCodeSessionDescription is used to describe the session - VoiceGatewayOpCodeSessionDescription = 4 - // VoiceGatewayOpCodeSpeaking is used to indicate which users are speaking - VoiceGatewayOpCodeSpeaking = 5 - // VoiceGatewayOpCodeHeartbeatACK is used to acknowledge a - // received heartbeat - VoiceGatewayOpCodeHeartbeatACK = 6 - // VoiceGatewayOpCodeResume is used to resume a connection - VoiceGatewayOpCodeResume = 7 - // VoiceGatewayOpCodeHello is used to give the time to wait between sending - // heartbeats in milliseconds - VoiceGatewayOpCodeHello = 8 - // VoiceGatewayOpCodeResumed is used to acknowledge a successful - // session resume - VoiceGatewayOpCodeResumed = 9 - - /* there is no 10, 11 and 12 :/ */ - - // VoiceGatewayOpCodeClientDisconnect is used to announce the client - // has disconnected from the voice channel - VoiceGatewayOpCodeClientDisconnect = 13 -) diff --git a/common/gateway/BUILD.bazel b/common/gateway/BUILD.bazel deleted file mode 100644 index ae38896..0000000 --- a/common/gateway/BUILD.bazel +++ /dev/null @@ -1,13 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "gateway", - srcs = [ - "compressor.go", - "event-names.go", - "transporter.go", - ], - importpath = "github.com/discordnova/nova/common/gateway", - visibility = ["//visibility:public"], - deps = ["//common/discord/types/payloads/gateway"], -) diff --git a/common/gateway/compressor.go b/common/gateway/compressor.go deleted file mode 100644 index 5579d96..0000000 --- a/common/gateway/compressor.go +++ /dev/null @@ -1,16 +0,0 @@ -package gateway - -import "github.com/discordnova/nova/common/discord/types/payloads/gateway" - -// GatewayConnectionOptions is the options given to gateway when the connector is passed to it. -type GatewayConnectionOptions struct { - Encoding string - TransportCompression string -} - -// Compression is the interface that needs to be implemented by a generic compressor. -type Compression interface { - GetConnectionOptions() GatewayConnectionOptions - DecodeMessage(data []byte) (*gateway.Payload, error) - Reset() error -} diff --git a/common/gateway/event-names.go b/common/gateway/event-names.go deleted file mode 100644 index 65dfd11..0000000 --- a/common/gateway/event-names.go +++ /dev/null @@ -1,52 +0,0 @@ -package gateway - -// This is used to map the discord dispatch events -// to internal names used by the event broker. - -// TODO: Update the types of events for the gateway v9 -var EventNames = map[string]string{ - "READY": "gateway.ready", - "RESUMED": "gateway.resumed", - "RECONNECT": "gateway.reconnect", - - "CHANNEL_CREATE": "channel.create", - "CHANNEL_UPDATE": "channel.update", - "CHANNEL_DELETE": "channel.delete", - - "GUILD_CREATE": "guild.create", - "GUILD_UPDATE": "guild.update", - "GUILD_DELETE": "guild.delete", - - "GUILD_BAN_ADD": "guild.ban.add", - "GUILD_BAN_REMOVE": "guild.ban.remove", - - "GUILD_EMOJIS_UPDATE": "guild.emojis_update", - "GUILD_INTEGRATIONS_UPDATE": "guild.integrations_update", - - "GUILD_MEMBER_ADD": "guild.member.add", - "GUILD_MEMBER_REMOVE": "guild.member.remove", - "GUILD_MEMBERS_UPDATE": "guild.member.update", - - "GUILD_MEMBERS_CHUNK": "guild_members_chunk", - - "GUILD_ROLE_CREATE": "guild.role.create", - "GUILD_ROLE_UPDATE": "guild.role.update", - "GUILD_ROLE_DELETE": "guild.role.delete", - - "INVITE_CREATE": "guild.invite.create", - "INVITE_DELETE": "guild.invite.guild", - - "MESSAGE_CREATE": "message.create", - "MESSAGE_UPDATE": "message.update", - "MESSAGE_DELETE_BULK": "message.delete_bulk", - "MESSAGE_REACTION_ADD": "message.reactions.add", - "MESSAGE_REACTION_REMOVE": "message.reactions.remove", - "MESSAGE_REACTION_REMOVE_ALL": "message.reactions.remove_all", - "MESSAGE_REACTION_REMOVE_EMOJI": "message.reactions.remove_emoji", - "PRESENCE_UPDATE": "users.presence_update", - "TYPING_START": "message.typing_start", - "USER_UPDATE": "users.update", - "VOICE_STATE_UPDATE": "voice.state_update", - "VOICE_SERVER_UPDATE": "voice.server_update", - "WEBHOOKS_UPDATE": "guild.webhooks.update", -} diff --git a/common/gateway/transporter.go b/common/gateway/transporter.go deleted file mode 100644 index a71e88d..0000000 --- a/common/gateway/transporter.go +++ /dev/null @@ -1,12 +0,0 @@ -package gateway - -type PushData struct { - Data []byte - Name string -} - -// Transporter is the base interface for the transportation layer of Nova -type Transporter interface { - PushChannel() chan PushData - PullChannel() chan []byte -} diff --git a/common/go.sum b/common/go.sum deleted file mode 100644 index fc4c381..0000000 --- a/common/go.sum +++ /dev/null @@ -1,402 +0,0 @@ -cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= -cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= -github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= -github.com/Knetic/govaluate v3.0.1-0.20171022003610-9aa49832a739+incompatible/go.mod h1:r7JcOSlj0wfOMncg0iLm8Leh48TZaKVeNIfJntJ2wa0= -github.com/Shopify/sarama v1.19.0/go.mod h1:FVkBWblsNy7DGZRfXLU0O9RCGt5g3g3yEuWXgklEdEo= -github.com/Shopify/toxiproxy v2.1.4+incompatible/go.mod h1:OXgGpZ6Cli1/URJOF1DMxUHB2q5Ap20/P/eIdh4G0pI= -github.com/VividCortex/gohistogram v1.0.0/go.mod h1:Pf5mBqqDxYaXu3hDrrU+w6nw50o/4+TcAqDqk/vUH7g= -github.com/afex/hystrix-go v0.0.0-20180502004556-fa1af6a1f4f5/go.mod h1:SkGFH1ia65gfNATL8TAiHDNxPzPdmEL5uirI2Uyuz6c= -github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= -github.com/alecthomas/template v0.0.0-20190718012654-fb15b899a751/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= -github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= -github.com/alecthomas/units v0.0.0-20190717042225-c3de453c63f4/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= -github.com/alecthomas/units v0.0.0-20190924025748-f65c72e2690d/go.mod h1:rBZYJk541a8SKzHPHnH3zbiI+7dagKZ0cgpgrD7Fyho= -github.com/apache/thrift v0.12.0/go.mod h1:cp2SuWMxlEZw2r+iP2GNCdIi4C1qmUzdZFSVb+bacwQ= -github.com/apache/thrift v0.13.0/go.mod h1:cp2SuWMxlEZw2r+iP2GNCdIi4C1qmUzdZFSVb+bacwQ= -github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e/go.mod h1:3U/XgcO3hCbHZ8TKRvWD2dDTCfh9M9ya+I9JpbB7O8o= -github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY= -github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8= -github.com/aryann/difflib v0.0.0-20170710044230-e206f873d14a/go.mod h1:DAHtR1m6lCRdSC2Tm3DSWRPvIPr6xNKyeHdqDQSQT+A= -github.com/aws/aws-lambda-go v1.13.3/go.mod h1:4UKl9IzQMoD+QF79YdCuzCwp8VbmG4VAQwij/eHl5CU= -github.com/aws/aws-sdk-go v1.27.0/go.mod h1:KmX6BPdI08NWTb3/sm4ZGu5ShLoqVDhKgpiN924inxo= -github.com/aws/aws-sdk-go-v2 v0.18.0/go.mod h1:JWVYvqSMppoMJC0x5wdwiImzgXTI9FuZwxzkQq9wy+g= -github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= -github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8= -github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= -github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs= -github.com/casbin/casbin/v2 v2.1.2/go.mod h1:YcPU1XXisHhLzuxH9coDNf2FbKpjGlbCg3n9yuLkIJQ= -github.com/cenkalti/backoff v2.2.1+incompatible/go.mod h1:90ReRw6GdpyfrHakVjL/QHaoyV4aDUVVkXQJJJ3NXXM= -github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= -github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= -github.com/clbanning/x2j v0.0.0-20191024224557-825249438eec/go.mod h1:jMjuTZXRI4dUb/I5gc9Hdhagfvm9+RyrPryS/auMzxE= -github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= -github.com/cockroachdb/datadriven v0.0.0-20190809214429-80d97fb3cbaa/go.mod h1:zn76sxSg3SzpJ0PPJaLDCu+Bu0Lg3sKTORVIj19EIF8= -github.com/codahale/hdrhistogram v0.0.0-20161010025455-3a0bb77429bd/go.mod h1:sE/e/2PUdi/liOCUjSTXgM1o87ZssimdTWN964YiIeI= -github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= -github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= -github.com/coreos/go-systemd/v22 v22.3.2/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc= -github.com/coreos/pkg v0.0.0-20160727233714-3ac0863d7acf/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA= -github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= -github.com/creack/pty v1.1.7/go.mod h1:lj5s0c3V2DBrqTV7llrYr5NG6My20zk30Fl46Y7DoTY= -github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= -github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= -github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ= -github.com/dustin/go-humanize v0.0.0-20171111073723-bb3d318650d4/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= -github.com/eapache/go-resiliency v1.1.0/go.mod h1:kFI+JgMyC7bLPUVY133qvEBtVayf5mFgVsvEsIPBvNs= -github.com/eapache/go-xerial-snappy v0.0.0-20180814174437-776d5712da21/go.mod h1:+020luEh2TKB4/GOp8oxxtq0Daoen/Cii55CzbTV6DU= -github.com/eapache/queue v1.1.0/go.mod h1:6eCeP0CKFpHLu8blIFXhExK/dRa7WDZfr6jVFPTqq+I= -github.com/edsrzf/mmap-go v1.0.0/go.mod h1:YO35OhQPt3KJa3ryjFM5Bs14WD66h8eGKpfaBNrHW5M= -github.com/envoyproxy/go-control-plane v0.6.9/go.mod h1:SBwIajubJHhxtWwsL9s8ss4safvEdbitLhGGK48rN6g= -github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= -github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c= -github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4= -github.com/franela/goblin v0.0.0-20200105215937-c9ffbefa60db/go.mod h1:7dvUGVsVBjqR7JHJk0brhHOZYGmfBYOrK0ZhYMEtBr4= -github.com/franela/goreq v0.0.0-20171204163338-bcd34c9993f8/go.mod h1:ZhphrRTfi2rbfLwlschooIH4+wKKDR4Pdxhh+TRoA20= -github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= -github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= -github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= -github.com/go-kit/kit v0.9.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= -github.com/go-kit/kit v0.10.0/go.mod h1:xUsJbQ/Fp4kEt7AFgCuvyX4a71u8h9jB8tj/ORgOZ7o= -github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE= -github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk= -github.com/go-logfmt/logfmt v0.5.0/go.mod h1:wCYkCAKZfumFQihp8CzCvQ3paCTfi41vtzG1KdI/P7A= -github.com/go-sql-driver/mysql v1.4.0/go.mod h1:zAC/RDZ24gD3HViQzih4MyKcchzm+sOG5ZlKdlhCg5w= -github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= -github.com/godbus/dbus/v5 v5.0.4/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= -github.com/gogo/googleapis v1.1.0/go.mod h1:gf4bu3Q80BeJ6H1S1vYPm8/ELATdvryBaNFGgqEef3s= -github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= -github.com/gogo/protobuf v1.2.0/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= -github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= -github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= -github.com/golang/groupcache v0.0.0-20160516000752-02826c3e7903/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= -github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= -github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= -github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= -github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= -github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= -github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8= -github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA= -github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs= -github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w= -github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0= -github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= -github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= -github.com/golang/snappy v0.0.0-20180518054509-2e65f85255db/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= -github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= -github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= -github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= -github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= -github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= -github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= -github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= -github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI= -github.com/google/uuid v1.0.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= -github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= -github.com/gorilla/context v1.1.1/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg= -github.com/gorilla/mux v1.6.2/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= -github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= -github.com/gorilla/websocket v0.0.0-20170926233335-4201258b820c/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ= -github.com/grpc-ecosystem/go-grpc-middleware v1.0.1-0.20190118093823-f849b5445de4/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs= -github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk= -github.com/grpc-ecosystem/grpc-gateway v1.9.5/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY= -github.com/hashicorp/consul/api v1.3.0/go.mod h1:MmDNSzIMUjNpY/mQ398R4bk2FnqQLoPndWW5VkKPlCE= -github.com/hashicorp/consul/sdk v0.3.0/go.mod h1:VKf9jXwCTEY1QZP2MOLRhb5i/I/ssyNV1vwHyQBF0x8= -github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= -github.com/hashicorp/go-cleanhttp v0.5.1/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80= -github.com/hashicorp/go-immutable-radix v1.0.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60= -github.com/hashicorp/go-msgpack v0.5.3/go.mod h1:ahLV/dePpqEmjfWmKiqvPkv/twdG7iPBM1vqhUKIvfM= -github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= -github.com/hashicorp/go-rootcerts v1.0.0/go.mod h1:K6zTfqpRlCUIjkwsN4Z+hiSfzSTQa6eBIzfwKfwNnHU= -github.com/hashicorp/go-sockaddr v1.0.0/go.mod h1:7Xibr9yA9JjQq1JpNB2Vw7kxv8xerXegt+ozgdvDeDU= -github.com/hashicorp/go-syslog v1.0.0/go.mod h1:qPfqrKkXGihmCqbJM2mZgkZGvKG1dFdvsLplgctolz4= -github.com/hashicorp/go-uuid v1.0.0/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= -github.com/hashicorp/go-uuid v1.0.1/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= -github.com/hashicorp/go-version v1.2.0/go.mod h1:fltr4n8CU8Ke44wwGCBoEymUuxUHl09ZGVZPK5anwXA= -github.com/hashicorp/go.net v0.0.1/go.mod h1:hjKkEWcCURg++eb33jQU7oqQcI9XDCnUzHA0oac0k90= -github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= -github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= -github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64= -github.com/hashicorp/mdns v1.0.0/go.mod h1:tL+uN++7HEJ6SQLQ2/p+z2pH24WQKWjBPkE0mNTz8vQ= -github.com/hashicorp/memberlist v0.1.3/go.mod h1:ajVTdAv/9Im8oMAAj5G31PhhMCZJV2pPBoIllUwCN7I= -github.com/hashicorp/serf v0.8.2/go.mod h1:6hOLApaqBFA1NXqRQAsxw9QxuDEvNxSQRwA/JwenrHc= -github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= -github.com/hudl/fargo v1.3.0/go.mod h1:y3CKSmjA+wD2gak7sUSXTAoopbhU08POFhmITJgmKTg= -github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8= -github.com/influxdata/influxdb1-client v0.0.0-20191209144304-8bf82d3c094d/go.mod h1:qj24IKcXYK6Iy9ceXlo3Tc+vtHo9lIhSX5JddghvEPo= -github.com/jmespath/go-jmespath v0.0.0-20180206201540-c2b33e8439af/go.mod h1:Nht3zPeWKUH0NzdCt2Blrr5ys8VGpn0CEB0cQHVjt7k= -github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo= -github.com/jpillora/backoff v1.0.0/go.mod h1:J/6gKK9jxlEcS3zixgDgUAsiuZ7yrSoa/FX5e0EB2j4= -github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU= -github.com/json-iterator/go v1.1.7/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= -github.com/json-iterator/go v1.1.8/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= -github.com/json-iterator/go v1.1.10/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= -github.com/jtolds/gls v4.20.0+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU= -github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w= -github.com/julienschmidt/httprouter v1.3.0/go.mod h1:JR6WtHb+2LUe8TCKY3cZOxFyyO8IZAc4RVcycCCAKdM= -github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= -github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= -github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= -github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= -github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc= -github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= -github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= -github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= -github.com/lightstep/lightstep-tracer-common/golang/gogo v0.0.0-20190605223551-bc2310a04743/go.mod h1:qklhhLq1aX+mtWk9cPHPzaBjWImj5ULL6C7HFJtXQMM= -github.com/lightstep/lightstep-tracer-go v0.18.1/go.mod h1:jlF1pusYV4pidLvZ+XD0UBX0ZE6WURAspgAczcDHrL4= -github.com/lyft/protoc-gen-validate v0.0.13/go.mod h1:XbGvPuh87YZc5TdIa2/I4pLk0QoUACkjt2znoq26NVQ= -github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= -github.com/mattn/go-isatty v0.0.3/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= -github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= -github.com/mattn/go-runewidth v0.0.2/go.mod h1:LwmH8dsx7+W8Uxz3IHJYH5QSwggIsqBzpuz5H//U1FU= -github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= -github.com/miekg/dns v1.0.14/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg= -github.com/mitchellh/cli v1.0.0/go.mod h1:hNIlj7HEI86fIcpObd7a0FcrxTWetlwJDGcceTlRvqc= -github.com/mitchellh/go-homedir v1.0.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0= -github.com/mitchellh/go-testing-interface v1.0.0/go.mod h1:kRemZodwjscx+RGhAo8eIhFbs2+BFgRtFPeD/KE+zxI= -github.com/mitchellh/gox v0.4.0/go.mod h1:Sd9lOJ0+aimLBi73mGofS1ycjY8lL3uZM3JPS42BGNg= -github.com/mitchellh/iochan v1.0.0/go.mod h1:JwYml1nuB7xOzsp52dPpHFffvOCDupsG0QubkSMEySY= -github.com/mitchellh/mapstructure v0.0.0-20160808181253-ca63d7c062ee/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y= -github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y= -github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= -github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= -github.com/modern-go/reflect2 v0.0.0-20180701023420-4b7aa43c6742/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0= -github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0= -github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U= -github.com/mwitkow/go-conntrack v0.0.0-20190716064945-2f068394615f/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U= -github.com/nats-io/jwt v0.3.0/go.mod h1:fRYCDE99xlTsqUzISS1Bi75UBJ6ljOJQOAAu5VglpSg= -github.com/nats-io/jwt v0.3.2/go.mod h1:/euKqTS1ZD+zzjYrY7pseZrTtWQSjujC7xjPc8wL6eU= -github.com/nats-io/nats-server/v2 v2.1.2/go.mod h1:Afk+wRZqkMQs/p45uXdrVLuab3gwv3Z8C4HTBu8GD/k= -github.com/nats-io/nats.go v1.9.1/go.mod h1:ZjDU1L/7fJ09jvUSRVBR2e7+RnLiiIQyqyzEE/Zbp4w= -github.com/nats-io/nkeys v0.1.0/go.mod h1:xpnFELMwJABBLVhffcfd1MZx6VsNRFpEugbxziKVo7w= -github.com/nats-io/nkeys v0.1.3/go.mod h1:xpnFELMwJABBLVhffcfd1MZx6VsNRFpEugbxziKVo7w= -github.com/nats-io/nuid v1.0.1/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c= -github.com/oklog/oklog v0.3.2/go.mod h1:FCV+B7mhrz4o+ueLpx+KqkyXRGMWOYEvfiXtdGtbWGs= -github.com/oklog/run v1.0.0/go.mod h1:dlhp/R75TPv97u0XWUtDeV/lRKWPKSdTuV0TZvrmrQA= -github.com/olekukonko/tablewriter v0.0.0-20170122224234-a0225b3f23b5/go.mod h1:vsDQFd/mU46D+Z4whnwzcISnGGzXWMclvtLoiIKAKIo= -github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= -github.com/onsi/ginkgo v1.7.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= -github.com/onsi/gomega v1.4.3/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= -github.com/op/go-logging v0.0.0-20160315200505-970db520ece7/go.mod h1:HzydrMdWErDVzsI23lYNej1Htcns9BCg93Dk0bBINWk= -github.com/opentracing-contrib/go-observer v0.0.0-20170622124052-a52f23424492/go.mod h1:Ngi6UdF0k5OKD5t5wlmGhe/EDKPoUM3BXZSSfIuJbis= -github.com/opentracing/basictracer-go v1.0.0/go.mod h1:QfBfYuafItcjQuMwinw9GhYKwFXS9KnPs5lxoYwgW74= -github.com/opentracing/opentracing-go v1.0.2/go.mod h1:UkNAQd3GIcIGf0SeVgPpRdFStlNbqXla1AfSYxPUl2o= -github.com/opentracing/opentracing-go v1.1.0/go.mod h1:UkNAQd3GIcIGf0SeVgPpRdFStlNbqXla1AfSYxPUl2o= -github.com/openzipkin-contrib/zipkin-go-opentracing v0.4.5/go.mod h1:/wsWhb9smxSfWAKL3wpBW7V8scJMt8N8gnaMCS9E/cA= -github.com/openzipkin/zipkin-go v0.1.6/go.mod h1:QgAqvLzwWbR/WpD4A3cGpPtJrZXNIiJc5AZX7/PBEpw= -github.com/openzipkin/zipkin-go v0.2.1/go.mod h1:NaW6tEwdmWMaCDZzg8sh+IBNOxHMPnhQw8ySjnjRyN4= -github.com/openzipkin/zipkin-go v0.2.2/go.mod h1:NaW6tEwdmWMaCDZzg8sh+IBNOxHMPnhQw8ySjnjRyN4= -github.com/pact-foundation/pact-go v1.0.4/go.mod h1:uExwJY4kCzNPcHRj+hCR/HBbOOIwwtUjcrb0b5/5kLM= -github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= -github.com/pborman/uuid v1.2.0/go.mod h1:X/NO0urCmaxf9VXbdlT7C2Yzkj2IKimNn4k+gtPdI/k= -github.com/performancecopilot/speed v3.0.0+incompatible/go.mod h1:/CLtqpZ5gBg1M9iaPbIdPPGyKcA8hKdoy6hAWba7Yac= -github.com/pierrec/lz4 v1.0.2-0.20190131084431-473cd7ce01a1/go.mod h1:3/3N9NVKO0jef7pBehbT1qWhCMrIgbYNnFAZCqQ5LRc= -github.com/pierrec/lz4 v2.0.5+incompatible/go.mod h1:pdkljMzZIN41W+lC3N2tnIh5sFi+IEE17M5jbnwPHcY= -github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= -github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= -github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= -github.com/pkg/profile v1.2.1/go.mod h1:hJw3o1OdXxsrSjjVksARp5W95eeEaEfptyVZyv6JUPA= -github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= -github.com/posener/complete v1.1.1/go.mod h1:em0nMJCgc9GFtwrmVmEMR/ZL6WyhyjMBndrE9hABlRI= -github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= -github.com/prometheus/client_golang v0.9.3-0.20190127221311-3c4408c8b829/go.mod h1:p2iRAGwDERtqlqzRXnrOVns+ignqQo//hLXqYxZYVNs= -github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo= -github.com/prometheus/client_golang v1.3.0/go.mod h1:hJaj2vgQTGQmVCsAACORcieXFeDPbaTKGT+JTgUa3og= -github.com/prometheus/client_golang v1.7.1/go.mod h1:PY5Wy2awLA44sXw4AOSfFBetzPP4j5+D6mVACh+pe2M= -github.com/prometheus/client_golang v1.9.0/go.mod h1:FqZLKOZnGdFAhOK4nqGHa7D66IdsO+O441Eve7ptJDU= -github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= -github.com/prometheus/client_model v0.0.0-20190115171406-56726106282f/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= -github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= -github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= -github.com/prometheus/client_model v0.1.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= -github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= -github.com/prometheus/common v0.2.0/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= -github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= -github.com/prometheus/common v0.7.0/go.mod h1:DjGbpBbp5NYNiECxcL/VnbXCCaQpKd3tt26CguLLsqA= -github.com/prometheus/common v0.10.0/go.mod h1:Tlit/dnDKsSWFlCLTWaA1cyBgKHSMdTB80sz/V91rCo= -github.com/prometheus/common v0.15.0/go.mod h1:U+gB1OBLb1lF3O42bTCL+FK18tX9Oar16Clt/msog/s= -github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= -github.com/prometheus/procfs v0.0.0-20190117184657-bf6a532e95b1/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= -github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= -github.com/prometheus/procfs v0.0.8/go.mod h1:7Qr8sr6344vo1JqZ6HhLceV9o3AJ1Ff+GxbHq6oeK9A= -github.com/prometheus/procfs v0.1.3/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= -github.com/prometheus/procfs v0.2.0/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= -github.com/rcrowley/go-metrics v0.0.0-20181016184325-3113b8401b8a/go.mod h1:bCqnVzQkZxMG4s8nGwiZ5l3QUCyqpo9Y+/ZMZ9VjZe4= -github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg= -github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= -github.com/rs/xid v1.2.1/go.mod h1:+uKXf+4Djp6Md1KODXJxgGQPKngRmWyn10oCKFzNHOQ= -github.com/rs/zerolog v1.23.0/go.mod h1:6c7hFfxPOy7TacJc4Fcdi24/J0NKYGzjG8FWRI916Qo= -github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= -github.com/ryanuber/columnize v0.0.0-20160712163229-9b3edd62028f/go.mod h1:sm1tb6uqfes/u+d4ooFouqFdy9/2g9QGwK3SQygK0Ts= -github.com/samuel/go-zookeeper v0.0.0-20190923202752-2cc03de413da/go.mod h1:gi+0XIa01GRL2eRQVjQkKGqKF3SF9vZR/HnPullcV2E= -github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529/go.mod h1:DxrIzT+xaE7yg65j358z/aeFdxmN0P9QXhEzd20vsDc= -github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= -github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo= -github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE= -github.com/sirupsen/logrus v1.6.0/go.mod h1:7uNnSEd1DgxDLC74fIahvMZmmYsHGZGEOFrfsX/uA88= -github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc= -github.com/smartystreets/goconvey v1.6.4/go.mod h1:syvi0/a8iFYH4r/RixwvyeAJjdLS9QV7WQ/tjFTllLA= -github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM= -github.com/sony/gobreaker v0.4.1/go.mod h1:ZKptC7FHNvhBz7dN2LGjPVBz2sZJmc0/PkyDJOjmxWY= -github.com/spf13/cobra v0.0.3/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= -github.com/spf13/pflag v1.0.1/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= -github.com/streadway/amqp v0.0.0-20190404075320-75d898a42a94/go.mod h1:AZpEONHx3DKn8O/DFsRAY58/XVQiIPMTMB1SddzLXVw= -github.com/streadway/amqp v0.0.0-20190827072141-edfb9018d271/go.mod h1:AZpEONHx3DKn8O/DFsRAY58/XVQiIPMTMB1SddzLXVw= -github.com/streadway/handy v0.0.0-20190108123426-d5acb3125c2a/go.mod h1:qNTQ5P5JnDBl6z3cMAg/SywNDC5ABu5ApDIw6lUbRmI= -github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= -github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= -github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= -github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= -github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= -github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= -github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= -github.com/urfave/cli v1.22.1/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= -github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= -github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= -go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= -go.etcd.io/etcd v0.0.0-20191023171146-3cf2f69b5738/go.mod h1:dnLIgRNXwCJa5e+c6mIZCrds/GIG4ncV9HhK5PX7jPg= -go.opencensus.io v0.20.1/go.mod h1:6WKK9ahsWS3RSO+PY9ZHZUfv2irvY6gN279GOPZjmmk= -go.opencensus.io v0.20.2/go.mod h1:6WKK9ahsWS3RSO+PY9ZHZUfv2irvY6gN279GOPZjmmk= -go.opencensus.io v0.22.2/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw= -go.uber.org/atomic v1.3.2/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= -go.uber.org/atomic v1.5.0/go.mod h1:sABNBOSYdrvTF6hTgEIbc7YasKWGhgEQZyfxyTvoXHQ= -go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0= -go.uber.org/multierr v1.3.0/go.mod h1:VgVr7evmIr6uPjLBxg28wmKNXyqE9akIJ5XnfpiKl+4= -go.uber.org/tools v0.0.0-20190618225709-2cfd321de3ee/go.mod h1:vJERXedbb3MVM5f9Ejo0C68/HhF8uaILCdgjnY+goOA= -go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q= -go.uber.org/zap v1.13.0/go.mod h1:zwrFLgMcdUuIBviXEYEH1YKNaOBnKXsx2IPda5bBwHM= -golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= -golang.org/x/crypto v0.0.0-20181029021203-45a5f77698d3/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= -golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= -golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= -golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= -golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= -golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= -golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= -golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= -golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= -golang.org/x/lint v0.0.0-20190301231843-5614ed5bae6f/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= -golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= -golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= -golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc= -golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg= -golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= -golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20181023162649-9b4f9f5ad519/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20181201002055-351d144fa1fc/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20190125091013-d26f9f9a57f3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= -golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= -golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= -golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= -golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= -golang.org/x/net v0.0.0-20190813141303-74dc4d7220e7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= -golang.org/x/net v0.0.0-20200625001655-4c5254603344/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA= -golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= -golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= -golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= -golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20181026203630-95b1ffbd15a5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20181122145206-62eef0e2fa9b/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190826190057-c7b8b68b1456/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20191220142924-d4481acd189f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200106162015-b016eb3dc98e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200615200032-f1bc736245b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200625212154-ddb9806d33ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20201214210602-f9fddec55a1e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20210119212857-b64e53b001e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= -golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= -golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= -golang.org/x/time v0.0.0-20180412165947-fbb02b2291d2/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/tools v0.0.0-20180828015842-6cd1fcedba52/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= -golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= -golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= -golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= -golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= -golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= -golang.org/x/tools v0.0.0-20191029041327-9cc4af7d6b2c/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20191029190741-b9c20aec41a5/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= -golang.org/x/tools v0.0.0-20200103221440-774c71fcf114/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= -golang.org/x/tools v0.1.0/go.mod h1:xkSsbof2nBLbhDlRMhhhyNLN/zl3eTqcnHD5viDpcZ0= -golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= -golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= -golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= -golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= -google.golang.org/api v0.3.1/go.mod h1:6wY9I6uQWHQ8EM57III9mq/AjF+i8G65rmVagqKMtkk= -google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= -google.golang.org/appengine v1.2.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= -google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= -google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= -google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= -google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= -google.golang.org/genproto v0.0.0-20190530194941-fb225487d101/go.mod h1:z3L6/3dTEVtUr6QSP8miRzeRqwQOioJ9I66odjN4I7s= -google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc= -google.golang.org/grpc v1.17.0/go.mod h1:6QZJwpn2B+Zp71q/5VxRsJ6NXXVCE5NRUHRo+f3cWCs= -google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= -google.golang.org/grpc v1.20.0/go.mod h1:chYK+tFQF0nDUGJgXMSgLCQk3phJEuONr2DCgLDdAQM= -google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= -google.golang.org/grpc v1.21.0/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= -google.golang.org/grpc v1.22.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= -google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= -google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= -google.golang.org/grpc v1.26.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= -google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= -google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= -google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM= -google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE= -google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo= -google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= -gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw= -gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= -gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= -gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= -gopkg.in/cheggaaa/pb.v1 v1.0.25/go.mod h1:V/YB90LKu/1FcN3WVnfiiE5oMCibMjukxqG/qStrOgw= -gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI= -gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys= -gopkg.in/gcfg.v1 v1.2.3/go.mod h1:yesOnuUOFQAhST5vPY4nbZsb/huCgGGXlipJsBn0b3o= -gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo= -gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw= -gopkg.in/warnings.v0 v0.1.2/go.mod h1:jksf8JmL6Qr/oQM2OXTHunEvvTAsrWBLb6OOjuVWRNI= -gopkg.in/yaml.v2 v2.0.0-20170812160011-eb3733d160e7/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74= -gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -gopkg.in/yaml.v2 v2.2.5/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -honnef.co/go/tools v0.0.0-20180728063816-88497007e858/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= -honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= -honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= -honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg= -sigs.k8s.io/yaml v1.1.0/go.mod h1:UJmg0vDUVViEyp3mgSv9WPwZCDxu4rQW1olrI1uml+o= -sourcegraph.com/sourcegraph/appdash v0.0.0-20190731080439-ebfcffb1b5c0/go.mod h1:hI742Nqp5OhwiqlzhgfbWU4mW4yO10fP+LoT9WOswdU= diff --git a/common/logger.go b/common/logger.go index 31ee3db..32f02eb 100644 --- a/common/logger.go +++ b/common/logger.go @@ -1,25 +1,25 @@ -package common - -import ( - "flag" - "os" - - "github.com/rs/zerolog" - "github.com/rs/zerolog/log" -) - -var ( - debug *bool = flag.Bool("debug", false, "enables the debug mode") - pretty *bool = flag.Bool("pretty", false, "enables the pretty log messages") -) - -func SetupLogger() { - if *pretty { - log.Logger = log.Output(zerolog.ConsoleWriter{Out: os.Stderr}) - } - zerolog.TimeFieldFormat = zerolog.TimeFormatUnix - zerolog.SetGlobalLevel(zerolog.InfoLevel) - if *debug { - zerolog.SetGlobalLevel(zerolog.DebugLevel) - } -} +package common
+
+import (
+ "flag"
+ "os"
+
+ "github.com/rs/zerolog"
+ "github.com/rs/zerolog/log"
+)
+
+var (
+ debug *bool = flag.Bool("debug", false, "enables the debug mode")
+ pretty *bool = flag.Bool("pretty", false, "enables the pretty log messages")
+)
+
+func SetupLogger() {
+ if *pretty {
+ log.Logger = log.Output(zerolog.ConsoleWriter{Out: os.Stderr})
+ }
+ zerolog.TimeFieldFormat = zerolog.TimeFormatUnix
+ zerolog.SetGlobalLevel(zerolog.InfoLevel)
+ if *debug {
+ zerolog.SetGlobalLevel(zerolog.DebugLevel)
+ }
+}
diff --git a/common/prometheus.go b/common/prometheus.go index f69854b..68fc42b 100644 --- a/common/prometheus.go +++ b/common/prometheus.go @@ -1,20 +1,20 @@ -package common - -import ( - "fmt" - "net/http" - - "github.com/prometheus/client_golang/prometheus/promhttp" - "github.com/rs/zerolog/log" -) - -// CreatePrometheus creates a webserver instance that returns the metrics of the -// current program reported using promauto. -func CreatePrometheus(port int) { - http.Handle("/metrics", promhttp.Handler()) - err := http.ListenAndServe(fmt.Sprintf(":%d", port), nil) - - if err != nil { - log.Err(err).Msgf("failed to start the prometheus reporting on the port :%d", port) - } -} +package common
+
+import (
+ "fmt"
+ "net/http"
+
+ "github.com/prometheus/client_golang/prometheus/promhttp"
+ "github.com/rs/zerolog/log"
+)
+
+// CreatePrometheus creates a webserver instance that returns the metrics of the
+// current program reported using promauto.
+func CreatePrometheus(port int) {
+ http.Handle("/metrics", promhttp.Handler())
+ err := http.ListenAndServe(fmt.Sprintf(":%d", port), nil)
+
+ if err != nil {
+ log.Err(err).Msgf("failed to start the prometheus reporting on the port :%d", port)
+ }
+}
diff --git a/common/rust/BUILD.bazel b/common/rust/BUILD.bazel new file mode 100644 index 0000000..0fbd9b2 --- /dev/null +++ b/common/rust/BUILD.bazel @@ -0,0 +1,9 @@ +load("@rules_rust//rust:defs.bzl", "rust_library") +load("//cargo:crates.bzl", "all_crate_deps") + +rust_library( + name = "common", + srcs = glob(["src/**"]), + visibility = ["//visibility:public"], + deps = all_crate_deps(), +) diff --git a/common/rust/Cargo.toml b/common/rust/Cargo.toml new file mode 100644 index 0000000..ec81c4b --- /dev/null +++ b/common/rust/Cargo.toml @@ -0,0 +1,14 @@ +[package] +name = "common" +version = "0.1.0" +edition = "2018" + +[dependencies] +pretty_env_logger = "0.4" +log = { version = "0.4", features = ["std"] } +serde = { version = "1.0.8", features = ["derive"] } +config = "0.11" +hyper = { version = "0.14", features = ["full"] } +tokio = { version = "1", features = ["full"] } +prometheus = "0.12.0" +nats = "0.15.2"
\ No newline at end of file diff --git a/common/rust/cargo/BUILD.bazel b/common/rust/cargo/BUILD.bazel new file mode 100644 index 0000000..f92a2e9 --- /dev/null +++ b/common/rust/cargo/BUILD.bazel @@ -0,0 +1,85 @@ +""" +@generated +cargo-raze generated Bazel file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +package(default_visibility = ["//visibility:public"]) + +licenses([ + "notice", # See individual crates for specific licenses +]) + +# Aliased targets +alias( + name = "config", + actual = "@raze__config__0_11_0//:config", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "hyper", + actual = "@raze__hyper__0_14_12//:hyper", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "log", + actual = "@raze__log__0_4_14//:log", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "nats", + actual = "@raze__nats__0_15_2//:nats", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "pretty_env_logger", + actual = "@raze__pretty_env_logger__0_4_0//:pretty_env_logger", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "prometheus", + actual = "@raze__prometheus__0_12_0//:prometheus", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde", + actual = "@raze__serde__1_0_130//:serde", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "tokio", + actual = "@raze__tokio__1_11_0//:tokio", + tags = [ + "cargo-raze", + "manual", + ], +) diff --git a/common/rust/src/config.rs b/common/rust/src/config.rs new file mode 100644 index 0000000..c158a21 --- /dev/null +++ b/common/rust/src/config.rs @@ -0,0 +1,40 @@ +use std::env; + +use config::{Config, ConfigError, Environment, File}; +use log::info; +use serde::{Deserialize}; + + +#[derive(Debug, Deserialize, Clone)] +#[serde(bound(deserialize = "T: Deserialize<'de> + std::default::Default + Clone"))] +pub struct Settings<T> { + #[serde(skip_deserializing)] + pub config: T, + pub monitoring: crate::monitoring::MonitoringConfiguration, + pub nats: crate::nats::NatsConfiguration, +} + +impl<T> Settings<T> where T: Deserialize<'static> + std::default::Default + Clone { + pub fn new(service_name: &str) -> Result<Settings<T>, ConfigError> { + let mut default = Config::default(); + // this file my be shared with all the components + default.merge(File::with_name("config/default"))?; + let mode = env::var("ENV").unwrap_or_else(|_| "development".into()); + info!("Configuration Environment: {}", mode); + + default.merge(File::with_name(&format!("config/{}", mode)).required(false))?; + default.merge(File::with_name("config/local").required(false))?; + + // we can configure each component using environment variables + default.merge(Environment::with_prefix("NOVA").separator("_"))?; + let mut config: Settings<T> = default.clone().try_into().unwrap(); + + // try to load the config + config.config = default.get::<T>(&service_name).unwrap(); + pretty_env_logger::init(); + + // start the monitoring system if needed + crate::monitoring::start_monitoring(&config.monitoring); + Ok(config) + } +} diff --git a/common/rust/src/error.rs b/common/rust/src/error.rs new file mode 100644 index 0000000..b602940 --- /dev/null +++ b/common/rust/src/error.rs @@ -0,0 +1,12 @@ +use std::fmt; + +#[derive(Debug)] +pub struct NovaError { + pub message: String, +} + +impl fmt::Display for NovaError { + fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { + write!(f, "An error occured wihind the nova system: {}", self.message) // user-facing output + } +} diff --git a/common/rust/src/lib.rs b/common/rust/src/lib.rs new file mode 100644 index 0000000..943d7cc --- /dev/null +++ b/common/rust/src/lib.rs @@ -0,0 +1,7 @@ +/// This crate contains shared code in all the rust projects +/// It contains utilities such as monitoring, logging and more. +pub mod config; +pub mod monitoring; +pub mod nats; +pub mod payloads; +pub mod error;
\ No newline at end of file diff --git a/common/rust/src/monitoring.rs b/common/rust/src/monitoring.rs new file mode 100644 index 0000000..ded1d95 --- /dev/null +++ b/common/rust/src/monitoring.rs @@ -0,0 +1,60 @@ +use hyper::{ + Response, Body, Request, Server, + header::{CONTENT_TYPE}, + service::{make_service_fn, service_fn}, +}; +use std::net::ToSocketAddrs; +use prometheus::{Encoder, TextEncoder}; +use log::{info,error}; +use serde::Deserialize; + +#[derive(Clone, Debug, Deserialize)] +/// Options for the monitoring service +pub struct MonitoringConfiguration { + enabled: bool, + address: Option<String>, + port: Option<i32>, +} + +/// Handler for the hyper http server +async fn serve_metrics(_request: Request<Body>) -> Result<Response<Body>, hyper::Error> { + let encoder = TextEncoder::new(); + let metrics = prometheus::gather(); + + let mut buffer = vec![]; + encoder.encode(&metrics, &mut buffer).unwrap(); + + let response = Response::builder() + .status(200) + .header(CONTENT_TYPE, encoder.format_type()) + .body(Body::from(buffer)) + .unwrap(); + Ok(response) +} + +/// Starts a monitoring server on the requested port +pub fn start_monitoring(configuration: &MonitoringConfiguration) { + let config = configuration.clone(); + tokio::task::spawn(async move { + if config.enabled { + let address = format!("{}:{}", + config.address.expect("a listening address must be specified for the metrics server"), + config.port.expect("a listening port must be specified for the metrics server") + ); + info!("Starting monitoring server on {}", address); + + let listen_address = address + .to_socket_addrs() + .unwrap() + .next() + .unwrap(); + let server = Server::bind(&listen_address).serve(make_service_fn(|_| async { + Ok::<_, hyper::Error>(service_fn(serve_metrics)) + })); + + if let Err(e) = server.await { + error!("failed to start the monitoring server {}", e); + } + } + }); +}
\ No newline at end of file diff --git a/common/rust/src/nats.rs b/common/rust/src/nats.rs new file mode 100644 index 0000000..59b480c --- /dev/null +++ b/common/rust/src/nats.rs @@ -0,0 +1,62 @@ +use nats::{Options, Connection}; +use serde::Deserialize; + +#[derive(Clone, Debug, Deserialize)] +struct NatsConfigurationClientCert { + cert: String, + key: String +} +#[derive(Clone, Debug, Deserialize)] +struct NatsConfigurationTls { + mtu: Option<usize>, +} + +#[derive(Clone, Debug, Deserialize)] +pub struct NatsConfiguration { + client_cert: Option<NatsConfigurationClientCert>, + root_cert: Option<Vec<String>>, + jetstream_api_prefix: Option<String>, + max_reconnects: Option<usize>, + reconnect_buffer_size: Option<usize>, + tls: Option<NatsConfigurationTls>, + client_name: Option<String>, + tls_required: Option<bool>, + host: String, +} + +/// +impl Into<Connection> for NatsConfiguration { + fn into(self) -> Connection { + let mut options = Options::new(); + + if let Some(client_cert) = self.client_cert { + options = options.client_cert(client_cert.cert, client_cert.key); + } + + if let Some(root_certs) = self.root_cert { + for root_cert in root_certs { + options = options.add_root_certificate(root_cert); + } + } + + if let Some(jetstream_api_prefix) = self.jetstream_api_prefix { + options = options.jetstream_api_prefix(jetstream_api_prefix) + } + + options = options.max_reconnects(self.max_reconnects); + options = options.no_echo(); + options = options.reconnect_buffer_size(self.reconnect_buffer_size.unwrap_or(64 * 1024)); + options = options.tls_required(self.tls_required.unwrap_or(false)); + options = options.with_name(&self.client_name.unwrap_or("Nova".to_string())); + + + if let Some(tls) = self.tls { + let mut config = nats::rustls::ClientConfig::new(); + config.set_mtu(&tls.mtu); + // todo: more options? + options = options.tls_client_config(config); + } + + options.connect(&self.host).unwrap() + } +} diff --git a/common/rust/src/payloads.rs b/common/rust/src/payloads.rs new file mode 100644 index 0000000..6eb35c8 --- /dev/null +++ b/common/rust/src/payloads.rs @@ -0,0 +1,15 @@ +use serde::{Deserialize, Serialize}; + +/// Payload send to the nova cache queues +#[derive(Serialize, Deserialize, Debug, Clone)] +#[serde(bound(deserialize = "T: Deserialize<'de> + std::default::Default + Clone"))] +pub struct CachePayload<T> { + pub tracing: Tracing, + pub data: T +} + +#[derive(Serialize, Deserialize, Debug, Clone)] +pub struct Tracing { + pub node_id: String, + pub span: Option<String> +}
\ No newline at end of file diff --git a/docker-compose.yaml b/docker-compose.yaml new file mode 100644 index 0000000..790c5b0 --- /dev/null +++ b/docker-compose.yaml @@ -0,0 +1,10 @@ +version: "3.3" +services: + nats: + image: 'nats' + expose: + - "4222" + ports: + - "8222:8222" + - "4222:4222" + hostname: nats-server
\ No newline at end of file diff --git a/docs/README.md b/docs/README.md new file mode 100644 index 0000000..fcc815a --- /dev/null +++ b/docs/README.md @@ -0,0 +1 @@ +#Â Nova documentation
\ No newline at end of file diff --git a/docs/common.md b/docs/common.md new file mode 100644 index 0000000..3dce3ac --- /dev/null +++ b/docs/common.md @@ -0,0 +1,6 @@ +# Common packages + +Nova exposes common packages for all the different projects in the mono-repo. +Since Nova uses two different languages, it has two different common libraries, +one built in rust in [the common/rust](../common/rust) directory and one in Go +in [the common/](../common) directory.
\ No newline at end of file diff --git a/ratelimiter/cargo/remote/BUILD.bazel b/docs/components/auto-scaler.md index e69de29..e69de29 100644 --- a/ratelimiter/cargo/remote/BUILD.bazel +++ b/docs/components/auto-scaler.md diff --git a/docs/components/cache.md b/docs/components/cache.md new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/docs/components/cache.md diff --git a/docs/components/gateway.md b/docs/components/gateway.md new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/docs/components/gateway.md diff --git a/docs/components/ratelimiter.md b/docs/components/ratelimiter.md new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/docs/components/ratelimiter.md diff --git a/docs/components/webhook.md b/docs/components/webhook.md new file mode 100644 index 0000000..76361ef --- /dev/null +++ b/docs/components/webhook.md @@ -0,0 +1,8 @@ +# Webhook + +> TD;TR The webhook component is an implementation of the discord interaction webhooks; You can either use the Gateway or the Webhooks. The webhooks __require__ an external https endpoint to work. + +The webhook source code is located in the [webhook](../../webhook) folder and is implemented in Rust. It's a simple http web server which implements the webhook signature verification and deserialization. Like the gateway, the messages are redirected using the [relaying system](../common#relaying_trait). + +The signature verification is done using libsodium via the libsodium-sys trait. +Subsequently, it uses code marked as "unsafe" in rust. It's built into the binary statically. Any route can be used to receive webhook messages.
\ No newline at end of file diff --git a/docs/exemples/config.yaml b/docs/exemples/config.yaml new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/docs/exemples/config.yaml diff --git a/docs/structure.md b/docs/structure.md new file mode 100644 index 0000000..1f82ae3 --- /dev/null +++ b/docs/structure.md @@ -0,0 +1,15 @@ +# Workspace/System structure + +##Â System structure + +In the nova repository, two different types of projects exist, + +* The management projects primarly in Go \ + They manage the other components of the nova infrastructure. +* The data-path projects \ + They handle all the data transfer / management. + +###Â Gateway + +> The gateway interfaces with the discord gateway to retrive events in real time +It's implemented in rust and is in the gateway folder.
\ No newline at end of file diff --git a/gateway/BUILD b/gateway/BUILD new file mode 100644 index 0000000..542b496 --- /dev/null +++ b/gateway/BUILD @@ -0,0 +1,20 @@ +load("@rules_rust//rust:rust.bzl", "rust_binary") +load("//cargo:crates.bzl", "all_crate_deps", "crate_deps") +load("@io_bazel_rules_docker//rust:image.bzl", "rust_image") + +test_suite(name = "tests") + +rust_binary( + name = "gateway", + srcs = glob(["src/**/*.rs"]), + proc_macro_deps = crate_deps(["serde_repr", "num-derive"]), + deps = all_crate_deps() + ["//common/rust:common"], + visibility = ["//visibility:public"], +) + +rust_image( + name = "image", + binary = ":gateway", + visibility = ["//visibility:public"], + base = "//bazel:base", +) diff --git a/gateway/BUILD.bazel b/gateway/BUILD.bazel deleted file mode 100644 index 50d5b5d..0000000 --- a/gateway/BUILD.bazel +++ /dev/null @@ -1,29 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_binary", "go_library") -load("@bazel_tools//tools/build_defs/pkg:pkg.bzl", "pkg_tar") - -go_library( - name = "gateway_lib", - srcs = ["main.go"], - importpath = "github.com/discordnova/nova/gateway", - visibility = ["//visibility:public"], - deps = [ - "//common", - "//gateway/lib/gateway", - "//gateway/lib/gateway/compression", - "//gateway/lib/gateway/transporters", - "@com_github_rs_zerolog//log", - ], -) - -go_binary( - name = "gateway", - embed = [":gateway_lib"], - visibility = ["//visibility:public"], -) - -pkg_tar( - name = "gateway_pkg", - srcs = [":gateway"], - mode = "0755", - visibility = ["//visibility:public"], -) diff --git a/gateway/Cargo.toml b/gateway/Cargo.toml new file mode 100644 index 0000000..1b8e9ea --- /dev/null +++ b/gateway/Cargo.toml @@ -0,0 +1,22 @@ +[package] +name = "gateway" +version = "0.1.0" +edition = "2018" + +[dependencies] +common = { path = "../common/rust" } +tokio = { version = "1", features = ["full"] } +tokio-tungstenite = { version = "*", features = ["rustls-tls"] } +url = "2.2.2" +futures-util = "0.3.17" +futures = "0.3.17" +log = { version = "0.4", features = ["std"] } + +serde_json = { version = "1.0" } +serde = { version = "1.0", features = ["derive"] } +serde_repr = "0.1" +enumflags2 = { version = "0.7.1", features = ["serde"] } + +num-traits = "0.2" +num-derive = "0.3" +num = "0.4"
\ No newline at end of file diff --git a/gateway/README.md b/gateway/README.md index c8d72e8..0f8b76c 100644 --- a/gateway/README.md +++ b/gateway/README.md @@ -1,3 +1,3 @@ -# Gateway - +# Gateway
+
The gateway component managed the connexion with the Discord event gateway using a websocket connexion.
\ No newline at end of file diff --git a/gateway/cargo/BUILD.bazel b/gateway/cargo/BUILD.bazel new file mode 100644 index 0000000..e85683f --- /dev/null +++ b/gateway/cargo/BUILD.bazel @@ -0,0 +1,130 @@ +""" +@generated +cargo-raze generated Bazel file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +package(default_visibility = ["//visibility:public"]) + +licenses([ + "notice", # See individual crates for specific licenses +]) + +# Aliased targets +alias( + name = "enumflags2", + actual = "@raze__enumflags2__0_7_1//:enumflags2", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "futures", + actual = "@raze__futures__0_3_17//:futures", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "futures_util", + actual = "@raze__futures_util__0_3_17//:futures_util", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "log", + actual = "@raze__log__0_4_14//:log", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "num", + actual = "@raze__num__0_4_0//:num", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "num_derive", + actual = "@raze__num_derive__0_3_3//:num_derive", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "num_traits", + actual = "@raze__num_traits__0_2_14//:num_traits", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde", + actual = "@raze__serde__1_0_130//:serde", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde_json", + actual = "@raze__serde_json__1_0_67//:serde_json", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde_repr", + actual = "@raze__serde_repr__0_1_7//:serde_repr", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "tokio", + actual = "@raze__tokio__1_11_0//:tokio", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "tokio_tungstenite", + actual = "@raze__tokio_tungstenite__0_15_0//:tokio_tungstenite", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "url", + actual = "@raze__url__2_2_2//:url", + tags = [ + "cargo-raze", + "manual", + ], +) diff --git a/gateway/config/default.toml b/gateway/config/default.toml new file mode 100644 index 0000000..252ff32 --- /dev/null +++ b/gateway/config/default.toml @@ -0,0 +1,12 @@ +[monitoring] +enabled = false + +[nats] +host = "localhost" + +[gateway] +max_reconnects = 5 +reconnect_delay_growth_factor = 1.25 +reconnect_delay_minimum = 5000 +reconnect_delay_maximum = 60000 +intents = 32767
\ No newline at end of file diff --git a/gateway/lib/gateway/BUILD.bazel b/gateway/lib/gateway/BUILD.bazel deleted file mode 100644 index 14d2bac..0000000 --- a/gateway/lib/gateway/BUILD.bazel +++ /dev/null @@ -1,24 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "gateway", - srcs = [ - "gateway.go", - "options.go", - ], - importpath = "github.com/discordnova/nova/gateway/lib/gateway", - visibility = ["//gateway:__subpackages__"], - deps = [ - "//common/discord/types/payloads/gateway", - "//common/discord/types/payloads/gateway/commands", - "//common/discord/types/payloads/gateway/events", - "//common/discord/types/structures", - "//common/discord/types/types", - "//common/gateway", - "@com_github_boz_go_throttle//:go-throttle", - "@com_github_gorilla_websocket//:websocket", - "@com_github_prometheus_client_golang//prometheus", - "@com_github_prometheus_client_golang//prometheus/promauto", - "@com_github_rs_zerolog//log", - ], -) diff --git a/gateway/lib/gateway/compression/BUILD.bazel b/gateway/lib/gateway/compression/BUILD.bazel deleted file mode 100644 index 1977322..0000000 --- a/gateway/lib/gateway/compression/BUILD.bazel +++ /dev/null @@ -1,13 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "compression", - srcs = ["json-zlib.go"], - importpath = "github.com/discordnova/nova/gateway/lib/gateway/compression", - visibility = ["//gateway:__subpackages__"], - deps = [ - "//common/discord/types/payloads/gateway", - "//common/gateway", - "@com_github_rs_zerolog//log", - ], -) diff --git a/gateway/lib/gateway/compression/json-zlib.go b/gateway/lib/gateway/compression/json-zlib.go deleted file mode 100644 index 7f64bbf..0000000 --- a/gateway/lib/gateway/compression/json-zlib.go +++ /dev/null @@ -1,81 +0,0 @@ -package compression - -import ( - "bytes" - "compress/zlib" - "encoding/json" - "fmt" - "io" - - "github.com/rs/zerolog/log" - gatewayTypes "github.com/discordnova/nova/common/discord/types/payloads/gateway" - "github.com/discordnova/nova/common/gateway" -) - -// JsonZlibCompressor is the default compression interface. -type JsonZlibCompressor struct { - buffer *bytes.Buffer - reader io.ReadCloser -} - -// NewJsonZlibCompressor creates an instance of JsonZlibCompressor -func NewJsonZlibCompressor() gateway.Compression { - return &JsonZlibCompressor{ - buffer: bytes.NewBuffer([]byte{}), - } -} - -func (compressor *JsonZlibCompressor) Reset() error { - compressor.buffer.Reset() - if compressor.reader == nil { - return nil - } - err := compressor.reader.Close() - if err != nil { - return err - } - compressor.reader = nil - return nil -} - -// GetConnectionOptions gets the required options for the gateway. -func (compressor JsonZlibCompressor) GetConnectionOptions() gateway.GatewayConnectionOptions { - // Gateway options for the discord gateway. - return gateway.GatewayConnectionOptions{ - Encoding: "json", - TransportCompression: "zlib-stream", - } -} - -// DecodeMessage decodes messages using the compressor. -func (compressor *JsonZlibCompressor) DecodeMessage(data []byte) (*gatewayTypes.Payload, error) { - - // check if the message have the zlib suffix to avoid ruining our zlib context :'( - if !bytes.HasSuffix(data, []byte{0x00, 0x00, 0xff, 0xff}) { - return nil, fmt.Errorf("the gateway failed to verify the message validity due to invalid suffix") - } - - // add the data to the buffer for the decompression. - compressor.buffer.Write(data) - - // we can't create the reader without data, so we initialize on the first decompression. - if compressor.reader == nil { - reader, err := zlib.NewReader(compressor.buffer) - if err != nil { - log.Err(err).Msgf("Failed to initialize zlib reader") - } - compressor.reader = reader - } - - // we unmarshal the reader as json - inter := gatewayTypes.Payload{} - decoder := json.NewDecoder(compressor.reader) - err := decoder.Decode(&inter) - - if err != nil { - // the unmarshalling failed - return nil, err - } - - return &inter, nil -} diff --git a/gateway/lib/gateway/gateway.go b/gateway/lib/gateway/gateway.go deleted file mode 100644 index ee9d13e..0000000 --- a/gateway/lib/gateway/gateway.go +++ /dev/null @@ -1,374 +0,0 @@ -package gateway - -import ( - "encoding/json" - "fmt" - "os" - "runtime" - "time" - - "github.com/boz/go-throttle" - gatewayTypes "github.com/discordnova/nova/common/discord/types/payloads/gateway" - "github.com/discordnova/nova/common/discord/types/payloads/gateway/commands" - "github.com/discordnova/nova/common/discord/types/payloads/gateway/events" - "github.com/discordnova/nova/common/discord/types/structures" - "github.com/discordnova/nova/common/discord/types/types" - "github.com/discordnova/nova/common/gateway" - "github.com/gorilla/websocket" - "github.com/prometheus/client_golang/prometheus" - "github.com/prometheus/client_golang/prometheus/promauto" - "github.com/rs/zerolog/log" -) - -// connectionState is a struct representing a connection state -type connectionState struct { - HeartbeatInterval uint16 - Latency int64 -} - -var ( - messagesCounter = promauto.NewCounter(prometheus.CounterOpts{ - Name: "nova_gateway_messages_processed", - Help: "The total number of processed messages", - }) - - heartbeatCounter = promauto.NewCounter(prometheus.CounterOpts{ - Name: "nova_gateway_heartbeat_sent", - Help: "The total number of heartbeat sent", - }) - - latencyGauge = promauto.NewGauge(prometheus.GaugeOpts{ - Name: "nova_gateway_latency", - Help: "The round trip latency of the gateway", - }) - - reconnectionsCounter = promauto.NewCounter(prometheus.CounterOpts{ - Name: "nova_gateway_reconnections", - Help: "the number of reconnections of the gateway", - }) - - eventsCounter = promauto.NewCounter(prometheus.CounterOpts{ - Name: "nova_gateway_events", - Help: "The various events received by Nova.", - }) -) - -// GatewayConnector represents a connection to the discord gateway for a shard -type GatewayConnector struct { - // Public State - SessionState GatewayConnectorOptionsResume // The state of the session - - // Private state - connectionState connectionState // The internal state of the gateway connection. - options GatewayConnectorOptions // The connection options. - connection *websocket.Conn // The current websocket connection. - heartbeat chan struct{} // Channel for reacting to heartbeat acks - terminate chan string // Called when a gateway disconnect is requested - updateThrottle throttle.ThrottleDriver -} - -// NewGateway creates a connector instance based on the given options. -func NewGateway(options GatewayConnectorOptions) *GatewayConnector { - return &GatewayConnector{ - options: options, - SessionState: options.ResumeSession, - } -} - -// Start is used to start or reset a connection to the gateway. -func (discord *GatewayConnector) Start() { - shouldStart := true - for shouldStart { - reconnectionsCounter.Inc() - discord.connectionState = connectionState{} - _ = discord.start() - err := discord.options.Compressor.Reset() - if err != nil { - log.Fatal().Msgf("failed to reset the compressor") - } - shouldStart = *discord.options.Restart - if shouldStart { - log.Info().Msg("waiting 10s before gateway reconnection") - time.Sleep(time.Second * 10) - } - } -} - -// start is the internal routine for starting the gateway -func (discord *GatewayConnector) start() error { - // we throttle the update function to limit the amount of session state - // presisted to the session persistence interface - discord.updateThrottle = throttle.ThrottleFunc(time.Second*5, false, func() { - if discord.options.OnSessionStateUpdated != nil { - _ = discord.options.OnSessionStateUpdated(discord.SessionState) - } - }) - - // initialize the message channels - discord.heartbeat = make(chan struct{}) - discord.terminate = make(chan string) - - // since a Compressor is given to the gateway when created, we use the Connector to get - // the compression and encoding options. - comOptions := discord.options.Compressor.GetConnectionOptions() - websocketURL := fmt.Sprintf("wss://gateway.discord.gg/?v=%d&encoding=%s&compress=%s", 6, comOptions.Encoding, comOptions.TransportCompression) - - log.Info().Msgf("connecting to the gateway at url %s", websocketURL) - // we start the connection to discord. - connection, _, err := websocket.DefaultDialer.Dial(websocketURL, nil) - if err != nil { - log.Err(err).Msgf("an error occurred while connecting to the gateway") - return err - } - discord.connection = connection - defer discord.connection.Close() - - // start listening to messages on the socket. - go discord.listen() - - msg := <-discord.terminate - log.Info().Msgf("terminating the gateway: %s", msg) - - return nil -} - -// ticker starts the loop for the heartbeat checks -func (discord *GatewayConnector) ticker(interval int) { - // sends a message to heartbeat.C every time we need to send a heartbeat - heartbeat := time.NewTicker(time.Duration(interval) * time.Millisecond) - // stores if the last heartbeat succeeded - doneLastAck := true - - // executes the given code when heartbeat.C is triggered - for range heartbeat.C { - // if the server did not send the last heartbeat - if !doneLastAck { - // we need to terminate the connection - discord.terminate <- "server missed an ack and must be disconnected" - return - } - - log.Debug().Msg("Sending a heartbeat.") - - index, _ := json.Marshal(discord.SessionState.Index) - err := discord.connection.WriteJSON(gatewayTypes.Payload{ - Op: types.GatewayOpCodeHeartbeat, - D: index, - }) - - if err != nil { - discord.terminate <- fmt.Sprintf("failed to send a heartbeat: %s", err.Error()) - return - } - - heartbeatCounter.Inc() - // wait for the ack asynchronously - go func() { - start := time.Now() - doneLastAck = false - <-discord.heartbeat - doneLastAck = true - - discord.connectionState.Latency = time.Since(start).Milliseconds() - latencyGauge.Set(float64(discord.connectionState.Latency)) - - log.Info().Msgf("heartbeat completed, latency: %dms", discord.connectionState.Latency) - }() - - } -} - -// listen listens to the messages on the gateway -func (discord *GatewayConnector) listen() { - for { - _, message, err := discord.connection.ReadMessage() - - if err != nil { - discord.terminate <- fmt.Sprintf("the connection was closed by the gateway: %s", err.Error()) - return - } - - messagesCounter.Inc() - data, err := discord.options.Compressor.DecodeMessage(message) - - if err != nil || data == nil { - log.Print(err.Error()) - continue - } - - if data.S != 0 { - discord.SessionState.Index = data.S - discord.updateState(data.S, "") - } - - discord.handleMessage(data) - } -} - -func (discord *GatewayConnector) updateState(newIndex int64, sessionId string) { - discord.SessionState.Index = newIndex - if sessionId != "" { - discord.SessionState.Session = sessionId - } - discord.updateThrottle.Trigger() -} - -func (discord *GatewayConnector) handleMessage(message *gatewayTypes.Payload) { - switch message.Op { - // call the startup function - case types.GatewayOpCodeHello: - discord.hello(message) - // notify the heartbeat goroutine that a heartbeat ack was received - case types.GatewayOpCodeHeartbeatACK: - discord.heartbeat <- struct{}{} - // handles a dispatch from the gateway - case types.GatewayOpCodeDispatch: - discord.dispatch(message) - // when the session resume fails - case types.GatewayOpCodeInvalidSession: - log.Print("failed to resume the session, reconnecting") - discord.updateState(0, "") - discord.doLogin() - // when the gateway requests a reconnect - case types.GatewayOpCodeReconnect: - log.Print("the gateway requested a reconnect") - if string(message.D) != "true" { - // we may delete the session state - discord.SessionState.Index = 0 - discord.updateState(0, "") - } - discord.terminate <- "the gateway requested a reconnect" - } -} - -func (discord *GatewayConnector) doLogin() { - var payload gatewayTypes.Payload - // if we do not have to resume a session - if discord.SessionState.Session == "" { - log.Info().Msg("using identify for authentification") - data, err := json.Marshal(commands.GatewayCommandIdentifyPayload{ - Token: *discord.options.Token, - Properties: structures.IdentifyConnectionProperties{ - OS: runtime.GOOS, - Device: "Nova Discord Client", - Browser: "Nova Discord Client", - }, - Compress: true, - LargeThreshold: 1000, - Shard: []int{ - *discord.options.SelfShard, - *discord.options.TotalShard, - }, - Presence: commands.GatewayCommandUpdateStatusPayload{}, - GuildSubscriptions: *discord.options.GuildSubs, - Intents: discord.options.Intend, - }) - - if err != nil { - return - } - - payload = gatewayTypes.Payload{ - Op: types.GatewayOpCodeIdentify, - D: data, - } - } else { - log.Info().Msg("resuming session") - data, err := json.Marshal(commands.GatewayCommandResumePayload{ - Token: *discord.options.Token, - SessionID: discord.SessionState.Session, - Seq: discord.SessionState.Index, - }) - - if err != nil { - return - } - payload = gatewayTypes.Payload{ - Op: types.GatewayOpCodeResume, - D: data, - } - } - - err := discord.connection.WriteJSON(payload) - if err != nil { - log.Err(err).Msgf("failed send the identify payload") - } -} - -func (discord *GatewayConnector) hello(message *gatewayTypes.Payload) { - - data := &events.GatewayEventHelloPayload{} - err := json.Unmarshal(message.D, &data) - if err != nil { - discord.terminate <- fmt.Sprintf("invalid payload: %s", err.Error()) - } - - // start the heartbeat goroutine - log.Debug().Msgf("hello recevied, heartbeating every %d ms", data.HeartbeatInterval) - go discord.ticker(data.HeartbeatInterval) - - // login - discord.doLogin() -} - -type NovaMessage struct { - Data json.RawMessage `json:"data"` - Tracing struct { - NodeName string `json:"node_name"` - } `json:"tracing"` -} - -func (discord *GatewayConnector) dispatch(message *gatewayTypes.Payload) { - // since this is juste a event gateway, we do not care about the content of the events - // except the ready, resumed, reconnect event we use to update the session_id, the other events are forwarded to the transporter - if message.T == "READY" { - event := events.GatewayEventReadyPayload{} - err := json.Unmarshal(message.D, &event) - - log.Info().Msgf("logged in as %s", event.User.Username) - - if err != nil { - discord.terminate <- "invalid ready event" - return - } - - discord.updateState(discord.SessionState.Index, event.SessionID) - return - } - - newName := gateway.EventNames[message.T] - - if newName == "" { - log.Error().Msgf("unknown event name: %s", newName) - return - } - - name, err := os.Hostname() - - if err != nil { - log.Err(err).Msgf("failed to get the hostname") - return - } - - data, err := json.Marshal(NovaMessage{ - Data: message.D, - Tracing: struct { - NodeName string `json:"node_name"` - }{ - NodeName: name, - }, - }) - - if err != nil { - log.Err(err).Msg("failed to serialize the outgoing nova message") - } - - discord.options.Transporter.PushChannel() <- gateway.PushData{ - Data: data, - Name: newName, - } - - if err != nil { - log.Err(err).Msg("failed to send the event to the nova event broker") - } -} diff --git a/gateway/lib/gateway/options.go b/gateway/lib/gateway/options.go deleted file mode 100644 index 3ca90a6..0000000 --- a/gateway/lib/gateway/options.go +++ /dev/null @@ -1,34 +0,0 @@ -package gateway - -import ( - "github.com/discordnova/nova/common/discord/types/types" - "github.com/discordnova/nova/common/gateway" -) - -// GatewayConnectorOptionsResume represents the options for reconnecting the gateway. -type GatewayConnectorOptionsResume struct { - Session string `json:"session_id"` // The session id of the older session we want to resume. - Index int64 `json:"index"` // The index of the last packet recevied by the older session. -} - -// GatewayConnectorOptionsSharding represents the options for sharding the gateway. -type GatewayConnectorOptionsSharding struct { - TotalShards int `json:"total_shards"` // The total amount of shards - CurrentShard int `json:"current_shard"` // The shard we want to connect to. -} - -// GatewayConnectorOptions is the options given to the GatewayConnector when creating it. -type GatewayConnectorOptions struct { - Token *string // The token of the bot - SelfShard *int // The shard of the current connector - TotalShard *int // The total count of shards - Intend types.GatewayIntents // The bitflags for the indents. - GuildSubs *bool // Should the guild_subscriptions be enabled - ResumeSession GatewayConnectorOptionsResume // Is specified, the gateway will try to resume a connection. - Compressor gateway.Compression // The compressor given to the gateway that determine the connection method and compression used. - Transporter gateway.Transporter // The interface where we send the data. - Restart *bool // Should the gateway restart upon failure. - - OnSessionStateUpdated func(state GatewayConnectorOptionsResume) error // When the session state is called, we call this function - SessionUpdateFrequency *int -} diff --git a/gateway/lib/gateway/transporters/BUILD.bazel b/gateway/lib/gateway/transporters/BUILD.bazel deleted file mode 100644 index c5fcb2f..0000000 --- a/gateway/lib/gateway/transporters/BUILD.bazel +++ /dev/null @@ -1,13 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "transporters", - srcs = ["rabbitmq.go"], - importpath = "github.com/discordnova/nova/gateway/lib/gateway/transporters", - visibility = ["//gateway:__subpackages__"], - deps = [ - "//common/gateway", - "@com_github_rs_zerolog//log", - "@com_github_streadway_amqp//:amqp", - ], -) diff --git a/gateway/lib/gateway/transporters/rabbitmq.go b/gateway/lib/gateway/transporters/rabbitmq.go deleted file mode 100644 index 1a163ad..0000000 --- a/gateway/lib/gateway/transporters/rabbitmq.go +++ /dev/null @@ -1,76 +0,0 @@ -package transporters - -import ( - "time" - - "github.com/discordnova/nova/common/gateway" - "github.com/rs/zerolog/log" - "github.com/streadway/amqp" -) - -type RabbitMqTransporter struct { - pullChannel chan []byte - pushChannel chan gateway.PushData -} - -// NewRabbitMqTransporter creates a rabbitmq transporter using a given url -func NewRabbitMqTransporter(url string) (gateway.Transporter, error) { - log.Info().Msg("connecting to the transporter using rabbitmq...") - conn, err := amqp.Dial(url) - - if err != nil { - return nil, err - } - - send, err := conn.Channel() - - if err != nil { - return nil, err - } - - err = send.ExchangeDeclare( - "nova_gateway_dispatch", - "topic", - true, - false, - false, - true, - nil, - ) - - if err != nil { - return nil, err - } - - pullChannel, pushChannel := make(chan []byte), make(chan gateway.PushData) - - go func() { - for { - data := <-pushChannel - send.Publish( - "nova_gateway_dispatch", - data.Name, - false, - false, - amqp.Publishing{ - Priority: 1, - Timestamp: time.Now(), - Type: data.Name, - Body: data.Data, - }, - ) - } - }() - - return &RabbitMqTransporter{ - pullChannel: pullChannel, - pushChannel: pushChannel, - }, nil -} - -func (t RabbitMqTransporter) PushChannel() chan gateway.PushData { - return t.pushChannel -} -func (t RabbitMqTransporter) PullChannel() chan []byte { - return t.pullChannel -} diff --git a/gateway/main.go b/gateway/main.go deleted file mode 100644 index d0857fc..0000000 --- a/gateway/main.go +++ /dev/null @@ -1,68 +0,0 @@ -package main - -import ( - "flag" - - "github.com/discordnova/nova/common" - "github.com/discordnova/nova/gateway/lib/gateway" - "github.com/discordnova/nova/gateway/lib/gateway/compression" - "github.com/discordnova/nova/gateway/lib/gateway/transporters" - "github.com/rs/zerolog/log" -) - -var ( - settings = gateway.GatewayConnectorOptions{ - Token: flag.String("token", "", "the discord token for the websocket connection"), - Restart: flag.Bool("restart", true, "should the gateway be restarted if an error occurs"), - GuildSubs: flag.Bool("guild-subscriptions", true, "should the guild subscription gateway flag set to true"), - SelfShard: flag.Int("shard", 0, "the shard id of this instance"), - TotalShard: flag.Int("shard-count", 1, "the total amount of shard"), - SessionUpdateFrequency: flag.Int("session-persist-frequence", 10, "the frequency of session persistence"), - } - - compressor = flag.String("compressor", "json-zlib", "the compressor used to connect") - transporter = flag.String("transporter", "rabbitmq", "the compressor used to connect") - monitoring = flag.Int("prometheus-port", 9000, "is this flag is set, a prometheus metrics endpoint will be exposed") - url = flag.String("transporter-url", "", "the url needed for rabbitmq to function") -) - -func validate(settings *gateway.GatewayConnectorOptions) { - if *settings.SelfShard > *settings.TotalShard { - log.Fatal().Msg("invalid config: the shard id must be inferior than the total shard value") - } else if *settings.SessionUpdateFrequency == 0 { - log.Fatal().Msg("invalid config: the session update frequency muse be greater than 0") - } else if *settings.Token == "" { - log.Fatal().Msg("invalid config: invalid token provided") - } else if *settings.TotalShard == 0 { - log.Fatal().Msg("invalid config: the total number of shards muse be greater than 0") - } -} - -func main() { - flag.Parse() - common.SetupLogger() - - if monitoring != nil { - go common.CreatePrometheus(*monitoring) - log.Debug().Msg("prometheus server called") - } - - if *compressor == "json-zlib" { - settings.Compressor = compression.NewJsonZlibCompressor() - } else { - log.Fatal().Msgf("unknown compressor specified: %s", *compressor) - } - - if *transporter == "rabbitmq" { - trns, err := transporters.NewRabbitMqTransporter(*url) - if err != nil { - log.Fatal().Msgf("failed to initialize the transporter: %s", err.Error()) - } - settings.Transporter = trns - } - - validate(&settings) - - gateway := gateway.NewGateway(settings) - gateway.Start() -} diff --git a/gateway/src/connection/mod.rs b/gateway/src/connection/mod.rs new file mode 100644 index 0000000..c60068a --- /dev/null +++ b/gateway/src/connection/mod.rs @@ -0,0 +1,36 @@ +use tokio::net::TcpStream; +use tokio_tungstenite::{MaybeTlsStream, WebSocketStream, connect_async, tungstenite::http::Request}; + +use crate::{error::GatewayError, utils::get_gateway_url}; + +mod stream; +mod utils; + +/// Underlying representation of a Discord event stream +/// that streams the Event payloads to the shard structure +pub struct Connection { + /// The channel given by tokio_tungstenite that represents the websocket connection + connection: Option<WebSocketStream<MaybeTlsStream<TcpStream>>>, +} + +impl Connection { + pub fn new() -> Self { + Connection { connection: None } + } + + pub async fn start(&mut self) -> Result<(), GatewayError> { + let request = Request::builder() + .uri(get_gateway_url(false, "json", 9)) + .body(()) + .unwrap(); + + let connection_result = connect_async(request).await; + // we connect outselves to the websocket server + if let Err(err) = connection_result { + Err(GatewayError::from(err)) + } else { + self.connection = Some(connection_result.unwrap().0); + Ok(()) + } + } +}
\ No newline at end of file diff --git a/gateway/src/connection/stream.rs b/gateway/src/connection/stream.rs new file mode 100644 index 0000000..767feec --- /dev/null +++ b/gateway/src/connection/stream.rs @@ -0,0 +1,99 @@ +use crate::{error::GatewayError, payloads::gateway::BaseMessage}; + +use super::Connection; +use futures::{FutureExt, Sink, SinkExt, Stream, StreamExt}; +use log::info; +use serde::Serialize; +use std::{ + pin::Pin, + task::{Context, Poll}, +}; +use tokio_tungstenite::tungstenite::Message; + +/// Implementation of the Stream trait for the Connection +impl Stream for Connection { + type Item = Result<crate::payloads::gateway::Message, GatewayError>; + + fn poll_next(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Option<Self::Item>> { + // first, when a poll is called, we check if the connection is still open + if let Some(conn) = &mut self.connection { + // we need to wait poll the message using the tokio_tungstenite stream + let message = conn.poll_next_unpin(cx); + + match message { + Poll::Ready(packet) => { + // if data is available, we can continue + match packet { + Some(result) => match result { + Ok(message) => { + match Box::pin(self._handle_message(&message)).poll_unpin(cx) { + Poll::Ready(data) => match data { + Ok(d) => Poll::Ready(Some(Ok(d))), + Err(e) => Poll::Ready(Some(Err(e))), + }, + // unknown behaviour? + Poll::Pending => unreachable!(), + } + } + Err(e) => Poll::Ready(Some(Err(GatewayError::from(e)))), + }, + // if no message is available, we return none, it's the end of the stream + None => { + info!("tokio_tungstenite stream finished successfully"); + let _ = Box::pin(conn.close(None)).poll_unpin(cx); + self.connection = None; + Poll::Ready(None) + } + } + } + // if the message is pending, we return the same result + Poll::Pending => Poll::Pending, + } + } else { + Poll::Ready(None) + } + } +} + +/// Implementation of the Sink trait for the Connection +impl<T: Serialize> Sink<BaseMessage<T>> for Connection { + type Error = tokio_tungstenite::tungstenite::Error; + + #[allow(dead_code)] + fn poll_ready(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> { + if let Some(conn) = &mut self.connection { + // a connection exists, we can send data + conn.poll_ready_unpin(cx) + } else { + Poll::Pending + } + } + + #[allow(dead_code)] + fn start_send(mut self: Pin<&mut Self>, item: BaseMessage<T>) -> Result<(), Self::Error> { + if let Some(conn) = &mut self.connection { + let message = serde_json::to_string(&item); + conn.start_send_unpin(Message::Text(message.unwrap())) + .unwrap(); + } + Ok(()) + } + + #[allow(dead_code)] + fn poll_flush(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> { + if let Some(conn) = &mut self.connection { + conn.poll_flush_unpin(cx) + } else { + Poll::Pending + } + } + + #[allow(dead_code)] + fn poll_close(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> { + if let Some(conn) = &mut self.connection { + conn.poll_close_unpin(cx) + } else { + Poll::Pending + } + } +} diff --git a/gateway/src/connection/utils.rs b/gateway/src/connection/utils.rs new file mode 100644 index 0000000..fb07229 --- /dev/null +++ b/gateway/src/connection/utils.rs @@ -0,0 +1,42 @@ +use std::str::from_utf8; +use tokio_tungstenite::tungstenite::Message; +use log::info; + +use crate::error::GatewayError; + +use super::Connection; + +impl Connection { + + /// Handles the websocket events and calls the _handle_discord_message function for the deserialization. + pub(super) async fn _handle_message( + &mut self, + data: &Message, + ) -> Result<crate::payloads::gateway::Message, GatewayError> { + match data { + Message::Text(text) => self._handle_discord_message(&text).await, + Message::Binary(message) => { + match from_utf8(message) { + Ok(data) => self._handle_discord_message(data).await, + Err(err) => Err(GatewayError::from(err.to_string())), + } + }, + Message::Close(close_frame) => { + info!("Discord connection closed {:?}", close_frame); + Err(GatewayError::from("connection closed".to_string())) + }, + _ => Err(GatewayError::from(format!("unknown variant of message specified to the handler {}", data).to_string())), + } + } + + /// Handle the decompression and deserialization process of a discord payload. + pub(super) async fn _handle_discord_message( + &mut self, + raw_message: &str, + ) -> Result<crate::payloads::gateway::Message, GatewayError> { + match serde_json::from_str(raw_message) { + Ok(message) => Ok(message), + Err(err) => Err(GatewayError::from(err.to_string())), + } + } +} diff --git a/gateway/src/error.rs b/gateway/src/error.rs new file mode 100644 index 0000000..603caab --- /dev/null +++ b/gateway/src/error.rs @@ -0,0 +1,24 @@ +use common::error::NovaError; + +#[derive(Debug)] +pub struct GatewayError(NovaError); + +impl From<tokio_tungstenite::tungstenite::Error> for GatewayError { + fn from(e: tokio_tungstenite::tungstenite::Error) -> Self { + GatewayError { + 0: NovaError { + message: e.to_string(), + }, + } + } +} + +impl From<String> for GatewayError { + fn from(e: String) -> Self { + GatewayError { + 0: NovaError { + message: e, + }, + } + } +} diff --git a/gateway/src/main.rs b/gateway/src/main.rs new file mode 100644 index 0000000..4c42c7a --- /dev/null +++ b/gateway/src/main.rs @@ -0,0 +1,19 @@ +use common::config::Settings; +use shard::{Shard, ShardConfig}; +#[macro_use] +extern crate num_derive; + +pub mod connection; +mod error; +mod utils; +mod shard; +mod payloads; + + + +#[tokio::main] +async fn main() { + let settings: Settings<ShardConfig> = Settings::new("gateway").unwrap(); + let mut shard = Shard::new(settings.config); + shard.start().await; +} diff --git a/gateway/src/management/mod.rs b/gateway/src/management/mod.rs new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/gateway/src/management/mod.rs diff --git a/gateway/src/payloads/dispatch.rs b/gateway/src/payloads/dispatch.rs new file mode 100644 index 0000000..be5f237 --- /dev/null +++ b/gateway/src/payloads/dispatch.rs @@ -0,0 +1,48 @@ +use futures::io::Read; +use log::info; +use serde::{Deserialize, Deserializer, Serialize}; + +use serde_json::Value; + +use super::gateway::BaseMessage; + +#[derive(Serialize, Deserialize, Clone, Debug, PartialEq)] +pub struct Ready { + #[serde(rename = "v")] + pub version: u64, + pub user: Value, + pub guilds: Vec<Value>, + pub session_id: String, + pub shard: Option<[i64;2]>, + pub application: Value, +} + +#[derive(Clone, Debug, PartialEq, Deserialize)] +#[serde(tag = "t", content = "d")] +pub enum FakeDispatch { + #[serde(rename = "READY")] + Ready(Ready), + Other(Value), +} + +#[derive(Clone, Debug, PartialEq)] +pub enum Dispatch { + Ready(Ready), + Other(BaseMessage<Value>) +} + +impl<'de> Deserialize<'de> for Dispatch { + fn deserialize<D>(d: D) -> Result<Self, D::Error> + where + D: Deserializer<'de>, + { + // todo: error handling + let value = Value::deserialize(d)?; + + if value.get("t").unwrap() == "READY" { + Ok(Dispatch::Ready(Ready::deserialize(value.get("d").unwrap()).unwrap())) + } else { + Ok(Dispatch::Other(BaseMessage::deserialize(value).unwrap())) + } + } +}
\ No newline at end of file diff --git a/gateway/src/payloads/events/mod.rs b/gateway/src/payloads/events/mod.rs new file mode 100644 index 0000000..3fef2d9 --- /dev/null +++ b/gateway/src/payloads/events/mod.rs @@ -0,0 +1 @@ +pub mod ready;
\ No newline at end of file diff --git a/gateway/src/payloads/events/ready.rs b/gateway/src/payloads/events/ready.rs new file mode 100644 index 0000000..a5ec291 --- /dev/null +++ b/gateway/src/payloads/events/ready.rs @@ -0,0 +1,13 @@ +use serde::Deserialize; +use serde_json::Value; + +#[derive(Deserialize, Clone, Debug, PartialEq)] +pub struct Ready { + #[serde(rename = "v")] + pub version: u64, + pub user: Value, + pub guilds: Vec<Value>, + pub session_id: String, + pub shard: Option<[i64;2]>, + pub application: Value, +} diff --git a/gateway/src/payloads/events/resume.rs b/gateway/src/payloads/events/resume.rs new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/gateway/src/payloads/events/resume.rs diff --git a/gateway/src/payloads/gateway.rs b/gateway/src/payloads/gateway.rs new file mode 100644 index 0000000..6ec2285 --- /dev/null +++ b/gateway/src/payloads/gateway.rs @@ -0,0 +1,82 @@ +use super::{dispatch::Dispatch, opcodes::{OpCodes, hello::Hello}}; +use serde::{Deserialize, Serialize}; +use serde_json::Value; +use serde::de::Error; + +#[derive(Serialize, Deserialize, PartialEq, Debug, Clone)] +#[serde(bound(deserialize = "T: Deserialize<'de> + std::fmt::Debug"))] +pub struct BaseMessage<T> { + pub t: Option<String>, + #[serde(rename = "s")] + pub sequence: Option<u64>, + pub op: OpCodes, + #[serde(rename = "d")] + pub data: T, +} + +#[derive(Debug)] +pub enum Message { + Dispatch(BaseMessage<Dispatch>), + Reconnect(BaseMessage<()>), + InvalidSession(BaseMessage<bool>), + Hello(BaseMessage<Hello>), + HeartbeatACK(BaseMessage<()>), +} + +impl<'de> serde::Deserialize<'de> for Message { + fn deserialize<D: serde::Deserializer<'de>>(d: D) -> Result<Self, D::Error> where D::Error : Error { + let value = Value::deserialize(d)?; + let val = value.get("op").and_then(Value::as_u64).unwrap(); + + if let Some(op) = num::FromPrimitive::from_u64(val) { + match op { + OpCodes::Dispatch => { + // todo: remove unwrap + let t = Some(value.get("t").unwrap().to_string()); + let sequence = value.get("s").unwrap().as_u64(); + + // we need to find a better solution than clone + match serde_json::from_value(value) { + Ok(data) => { + Ok(Message::Dispatch(BaseMessage { + op, + t, + sequence, + data + })) + }, + Err(e) => Err(Error::custom(e)), + } + }, + + OpCodes::Reconnect => { + match BaseMessage::deserialize(value) { + Ok(data) => Ok(Message::Reconnect(data)), + Err(e) => Err(Error::custom(e)), + } + }, + OpCodes::InvalidSession => { + match BaseMessage::deserialize(value) { + Ok(data) => Ok(Message::InvalidSession(data)), + Err(e) => Err(Error::custom(e)), + } + }, + OpCodes::Hello => { + match BaseMessage::deserialize(value) { + Ok(data) => Ok(Message::Hello(data)), + Err(e) => Err(Error::custom(e)), + } + }, + OpCodes::HeartbeatACK => { + match BaseMessage::deserialize(value) { + Ok(data) => Ok(Message::HeartbeatACK(data)), + Err(e) => Err(Error::custom(e)), + } + }, + _ => panic!("Cannot convert"), + } + } else { + Err(Error::custom("unknown opcode")) + } + } +} diff --git a/gateway/src/payloads/mod.rs b/gateway/src/payloads/mod.rs new file mode 100644 index 0000000..e9849a7 --- /dev/null +++ b/gateway/src/payloads/mod.rs @@ -0,0 +1,4 @@ +pub mod opcodes; +pub mod dispatch; +pub mod gateway; +pub mod events; diff --git a/gateway/src/payloads/opcodes/hello.rs b/gateway/src/payloads/opcodes/hello.rs new file mode 100644 index 0000000..3d8fd0f --- /dev/null +++ b/gateway/src/payloads/opcodes/hello.rs @@ -0,0 +1,8 @@ +use serde::{Serialize, Deserialize}; + +/// The first message sent by the gateway to initialize the heartbeating +#[derive(Debug, Serialize, Deserialize)] +pub struct Hello { + #[serde(rename = "heartbeat_interval")] + pub heartbeat_interval: u64 +} diff --git a/gateway/src/payloads/opcodes/identify.rs b/gateway/src/payloads/opcodes/identify.rs new file mode 100644 index 0000000..5929c33 --- /dev/null +++ b/gateway/src/payloads/opcodes/identify.rs @@ -0,0 +1,47 @@ +use enumflags2::{BitFlags, bitflags}; +use serde::{Deserialize, Serialize}; +use super::presence::PresenceUpdate; + + +#[bitflags] +#[repr(u16)] +#[derive(Clone, Copy, Debug)] +pub enum Intents { + Guilds = 1 << 0, + GuildMembers = 1 << 1, + GuildBans = 1 << 2, + GuildEmojisAndStickers = 1 << 3, + GuildIntegrations = 1 << 4, + GuildWebhoks = 1 << 5, + GuildInvites = 1 << 6, + GuildVoiceStates = 1 << 7, + GuildPresences = 1 << 8, + GuildMessages = 1 << 9, + GuildMessagesReactions = 1 << 10, + GuildMessageTyping = 1 << 11, + DirectMessages = 1 << 12, + DirectMessagesReactions = 1 << 13, + DirectMessageTyping = 1 << 14, +} + +#[derive(Debug, Serialize, Deserialize)] +pub struct IdentifyProprerties { + #[serde(rename = "$os")] + pub os: String, + #[serde(rename = "$browser")] + pub browser: String, + #[serde(rename = "$device")] + pub device: String, +} + +/// Messages sent by the shard to log-in to the gateway. +#[derive(Debug, Serialize, Deserialize)] +pub struct Identify { + pub token: String, + pub properties: IdentifyProprerties, + pub compress: Option<bool>, + pub large_threshold: Option<u64>, + pub shard: Option<[u64; 2]>, + pub presence: Option<PresenceUpdate>, + pub intents: BitFlags<Intents>, +}
\ No newline at end of file diff --git a/gateway/src/payloads/opcodes/mod.rs b/gateway/src/payloads/opcodes/mod.rs new file mode 100644 index 0000000..cfa453a --- /dev/null +++ b/gateway/src/payloads/opcodes/mod.rs @@ -0,0 +1,22 @@ +pub mod hello; +pub mod identify; +pub mod resume; +pub mod presence; +use serde_repr::{Deserialize_repr, Serialize_repr}; + +#[derive(Serialize_repr, Deserialize_repr, PartialEq, Debug, Clone, FromPrimitive, ToPrimitive)] +#[repr(u8)] + +pub enum OpCodes { + Dispatch = 0, + Heartbeat = 1, + Identify = 2, + PresenceUpdate = 3, + VoiceStateUpdate = 4, + Resume = 6, + Reconnect = 7, + RequestGuildMembers = 8, + InvalidSession = 9, + Hello = 10, + HeartbeatACK = 11, +}
\ No newline at end of file diff --git a/gateway/src/payloads/opcodes/presence.rs b/gateway/src/payloads/opcodes/presence.rs new file mode 100644 index 0000000..a6c5773 --- /dev/null +++ b/gateway/src/payloads/opcodes/presence.rs @@ -0,0 +1,63 @@ +use serde_repr::{Deserialize_repr, Serialize_repr}; +use serde::{Deserialize, Serialize}; +#[derive(Serialize_repr, Deserialize_repr, Debug)] +#[repr(u8)] +pub enum ActivityType { + Game = 0, + Streaming = 1, + Listening = 2, + Watching = 3, + Custom = 4, + Competing = 5 +} + +#[derive(Serialize, Deserialize, Debug)] +pub struct ActivityTimestamps { + start: u64, + end: u64, +} + +#[derive(Serialize, Deserialize, Debug)] +pub struct ActivityEmoji { + name: String, + id: Option<String>, + animated: Option<bool> +} + +#[derive(Serialize, Deserialize, Debug)] +pub struct Activity { + name: String, + #[serde(rename = "type")] + t: ActivityType, + + url: Option<String>, + created_at: i64, + timestamp: Option<ActivityTimestamps>, + application_id: Option<String>, + details: Option<String>, + state: Option<String>, + emoji: Option<ActivityEmoji>, + // todo: implement more +} + +#[derive(Serialize, Deserialize, Debug)] +pub enum PresenceStatus { + #[serde(rename = "online")] + Online, + #[serde(rename = "dnd")] + Dnd, + #[serde(rename = "idle")] + Idle, + #[serde(rename = "invisible")] + Invisible, + #[serde(rename = "offline")] + Offline +} + +#[derive(Serialize, Deserialize, Debug)] +pub struct PresenceUpdate { + since: u64, + activities: Vec<Activity>, + status: PresenceStatus, + afk: bool, +} diff --git a/gateway/src/payloads/opcodes/resume.rs b/gateway/src/payloads/opcodes/resume.rs new file mode 100644 index 0000000..e1bba91 --- /dev/null +++ b/gateway/src/payloads/opcodes/resume.rs @@ -0,0 +1,8 @@ +use serde::{Deserialize, Serialize}; + +#[derive(Debug, Serialize, Deserialize)] +pub struct Resume { + pub token: String, + pub session_id: String, + pub seq: u64, +}
\ No newline at end of file diff --git a/gateway/src/shard/actions.rs b/gateway/src/shard/actions.rs new file mode 100644 index 0000000..86e5f98 --- /dev/null +++ b/gateway/src/shard/actions.rs @@ -0,0 +1,128 @@ +use std::env; + +use futures::SinkExt; +use log::{debug, error, info}; +use serde::Serialize; +use serde_json::Value; +use std::fmt::Debug; + +use crate::{ + error::GatewayError, + payloads::{ + gateway::BaseMessage, + opcodes::{ + identify::{Identify, IdentifyProprerties}, + presence::PresenceUpdate, + resume::Resume, + OpCodes, + }, + }, +}; + +use super::Shard; + +/// Implement the available actions for nova in the gateway. +impl Shard { + /// sends a message through the websocket + pub async fn _send<T: Serialize + Debug>( + &mut self, + message: BaseMessage<T>, + ) -> Result<(), GatewayError> { + debug!("Senging message {:?}", message); + if let Some(connection) = &mut self.connection { + if let Err(e) = connection.conn.send(message).await { + error!("failed to send message {:?}", e); + Err(GatewayError::from(e)) + } else { + Ok(()) + } + } else { + Err(GatewayError::from("no open connection".to_string())) + } + } + + pub async fn _identify(&mut self) -> Result<(), GatewayError> { + if let Some(state) = self.state.clone() { + info!("Using session"); + self._send(BaseMessage { + t: None, + sequence: None, + op: OpCodes::Resume, + data: Resume { + token: self.config.token.clone(), + seq: state.sequence, + session_id: state.session_id.clone(), + }, + }) + .await + } else { + info!("Sending login"); + self._send(BaseMessage { + t: None, + sequence: None, + op: OpCodes::Identify, + data: Identify { + token: self.config.token.clone(), + intents: self.config.intents, + properties: IdentifyProprerties { + os: env::consts::OS.to_string(), + browser: "Nova".to_string(), + device: "Nova".to_string(), + }, + shard: Some([0, 2]), + compress: Some(false), + large_threshold: Some(500), + presence: None, + }, + }) + .await + } + } + + pub async fn _disconnect(&mut self) {} + + /// Updates the presence of the current shard. + #[allow(dead_code)] + pub async fn presence_update(&mut self, update: PresenceUpdate) -> Result<(), GatewayError> { + self._send(BaseMessage { + t: None, + sequence: None, + op: OpCodes::PresenceUpdate, + data: update, + }) + .await + } + /// Updates the voice status of the current shard in a certain channel. + #[allow(dead_code)] + pub async fn voice_state_update(&mut self) -> Result<(), GatewayError> { + self._send(BaseMessage { + t: None, + sequence: None, + op: OpCodes::VoiceStateUpdate, + // todo: proper payload for this + data: Value::Null, + }) + .await + } + /// Ask discord for more informations about offline guild members. + #[allow(dead_code)] + pub async fn request_guild_members(&mut self) -> Result<(), GatewayError> { + self._send(BaseMessage { + t: None, + sequence: None, + op: OpCodes::RequestGuildMembers, + // todo: proper payload for this + data: Value::Null, + }) + .await + } + + pub async fn _send_heartbeat(&mut self) -> Result<(), GatewayError> { + self._send(BaseMessage { + t: None, + sequence: None, + op: OpCodes::Heartbeat, + data: self.state.as_ref().unwrap().sequence + }).await + } +} diff --git a/gateway/src/shard/connection.rs b/gateway/src/shard/connection.rs new file mode 100644 index 0000000..0d66286 --- /dev/null +++ b/gateway/src/shard/connection.rs @@ -0,0 +1,194 @@ +use std::{cmp::min, convert::TryInto, time::Duration}; + +use crate::{connection::Connection, error::GatewayError, payloads::{ + dispatch::Dispatch, + gateway::{BaseMessage, Message}, + }, shard::state::SessionState}; + +use super::{state::ConnectionState, ConnectionWithState, Shard}; +use futures::StreamExt; +use log::{error, info}; +use tokio::{select, time::{Instant, sleep}}; + +impl Shard { + pub async fn start(self: &mut Self) { + let mut reconnects = 1; + info!("Starting shard"); + + while reconnects < self.config.max_reconnects { + info!("Starting connection for shard"); + self._shard_task().await; + // when the shard got disconnected, the shard task ends + reconnects += 1; + + // wait reconnects min(max(reconnects * reconnect_delay_growth_factor, reconnect_delay_minimum),reconnect_delay_maximum) + if reconnects < self.config.max_reconnects { + let time = min( + self.config.reconnect_delay_maximum, + self.config.reconnect_delay_minimum * (((reconnects - 1) as f32) * self.config.reconnect_delay_growth_factor) as usize, + ); + info!( + "The shard got disconnected, waiting for reconnect ({}ms)", + time + ); + sleep(Duration::from_millis(time.try_into().unwrap())).await; + } + } + info!( + "The shard got disconnected too many times and reached the maximum {}", + self.config.max_reconnects + ); + } + + async fn _shard_task(&mut self) { + // create the new connection + let mut connection = Connection::new(); + connection.start().await.unwrap(); + self.connection = Some(ConnectionWithState { + conn: connection, + state: ConnectionState::new(), + }); + + loop { + if let Some(connection) = &mut self.connection { + if let Some(timer) = &mut connection.state.interval { + select!( + payload = connection.conn.next() => { + match payload { + Some(data) => match data { + Ok(message) => self._handle(&message).await, + Err(error) => { + error!("An error occured while being connected to Discord: {:?}", error); + return; + }, + }, + None => { + info!("Connection terminated"); + return; + }, + } + }, + _ = timer.tick() => match self._do_heartbeat().await { + Ok(_) => {}, + Err(e) => { + info!("error occured: {:?}", e); + return; + }, + } + ) + } else { + select!( + payload = connection.conn.next() => { + match payload { + Some(data) => match data { + Ok(message) => self._handle(&message).await, + Err(error) => { + error!("An error occured while being connected to Discord: {:?}", error); + return; + }, + }, + None => { + info!("Connection terminated"); + return; + }, + } + } + ) + } + + } + } + } + + async fn _do_heartbeat(&mut self) -> Result<(), GatewayError> { + info!("heartbeat sent"); + if let Some(conn) = &mut self.connection { + if !conn.state.last_heartbeat_acknowledged { + error!("we missed a hertbeat"); + Err(GatewayError::from("a hertbeat was dropped, we need to restart the connection".to_string())) + } else { + conn.state.last_heartbeat_acknowledged = false; + conn.state.last_heartbeat_time = Instant::now(); + self._send_heartbeat().await + } + } else { + unreachable!() + } + } + + fn _util_set_seq(&mut self, seq: Option<u64>) { + if let Some(seq) = seq { + if let Some(state) = &mut self.state { + state.sequence = seq; + } + } + } + + async fn _handle(&mut self, message: &Message) { + match message { + Message::Dispatch(msg) => { + self._util_set_seq(msg.sequence); + self._dispatch(&msg).await; + } + // we need to reconnect to the gateway + Message::Reconnect(msg) => { + self._util_set_seq(msg.sequence); + info!("Gateway disconnect requested"); + self._disconnect().await; + } + Message::InvalidSession(msg) => { + self._util_set_seq(msg.sequence); + info!("invalid session"); + let data = msg.data; + if !data { + info!("Session removed"); + // reset the session data + self.state = None; + if let Err(e) = self._identify().await { + error!("Error while sending identify: {:?}", e); + } + } + } + Message::HeartbeatACK(msg) => { + info!("Heartbeat ack received"); + self._util_set_seq(msg.sequence); + if let Some(conn) = &mut self.connection { + conn.state.last_heartbeat_acknowledged = true; + let latency = Instant::now() - conn.state.last_heartbeat_time; + info!("Latency updated {}ms", latency.as_millis()); + } + } + Message::Hello(msg) => { + info!("Server hello received"); + self._util_set_seq(msg.sequence); + if let Some(conn) = &mut self.connection { + conn.state.interval = Some(tokio::time::interval_at( + Instant::now() + Duration::from_millis(msg.data.heartbeat_interval), + Duration::from_millis(msg.data.heartbeat_interval), + )); + } + + if let Err(e) = self._identify().await { + error!("error while sending identify: {:?}", e); + } + }, + } + } + + async fn _dispatch(&mut self, dispatch: &BaseMessage<Dispatch>) { + match &dispatch.data { + Dispatch::Ready(ready) => { + info!("Received gateway dispatch ready"); + info!( + "Logged in as {}", + ready.user.get("username").unwrap().to_string() + ); + self.state = Some(SessionState { + sequence: dispatch.sequence.unwrap(), + session_id: ready.session_id.clone(), + }); + } + Dispatch::Other(data) => { } + } + } +} diff --git a/gateway/src/shard/mod.rs b/gateway/src/shard/mod.rs new file mode 100644 index 0000000..b458451 --- /dev/null +++ b/gateway/src/shard/mod.rs @@ -0,0 +1,50 @@ +use enumflags2::BitFlags; +use serde::{Deserialize, Serialize}; +use crate::{connection::Connection, payloads::opcodes::identify::Intents}; +use self::state::{ConnectionState, SessionState}; +mod actions; +mod connection; +mod state; + +#[derive(Debug, Deserialize, Serialize, Default, Clone)] +pub struct Sharding { + pub total_shards: i64, + pub current_shard: i64 +} + + +#[derive(Debug, Deserialize, Serialize, Default, Clone)] +pub struct ShardConfig { + pub max_reconnects: usize, + pub reconnect_delay_growth_factor: f32, + pub reconnect_delay_minimum: usize, + pub reconnect_delay_maximum: usize, + pub token: String, + + pub large_threshold: Option<u64>, + pub shard: Option<Sharding>, + pub intents: BitFlags<Intents> +} + +struct ConnectionWithState { + conn: Connection, + state: ConnectionState, +} + +/// Represents a shard & all the reconnection logic related to it +pub struct Shard { + connection: Option<ConnectionWithState>, + state: Option<SessionState>, + config: ShardConfig +} + +impl Shard { + /// Creates a new shard instance + pub fn new(config: ShardConfig) -> Self { + Shard { + connection: None, + state: None, + config, + } + } +} diff --git a/gateway/src/shard/state.rs b/gateway/src/shard/state.rs new file mode 100644 index 0000000..34b7acc --- /dev/null +++ b/gateway/src/shard/state.rs @@ -0,0 +1,35 @@ +use tokio::time::{Instant, Interval}; + +/// This struct represents the state of a session +#[derive(Clone, Debug)] +pub struct SessionState { + pub sequence: u64, + pub session_id: String, +} + +impl Default for SessionState { + fn default() -> Self { + Self { + sequence: Default::default(), + session_id: Default::default(), + } + } +} + +/// This struct represents the state of a connection +#[derive(Debug)] +pub struct ConnectionState { + pub last_heartbeat_acknowledged: bool, + pub last_heartbeat_time: Instant, + pub interval: Option<Interval>, + +} +impl ConnectionState { + pub fn new() -> Self { + Self { + last_heartbeat_acknowledged: true, + last_heartbeat_time: Instant::now(), + interval: None, + } + } +}
\ No newline at end of file diff --git a/gateway/src/utils.rs b/gateway/src/utils.rs new file mode 100644 index 0000000..48a9aed --- /dev/null +++ b/gateway/src/utils.rs @@ -0,0 +1,8 @@ +/// Formats a url of connection to the gateway +pub fn get_gateway_url (compress: bool, encoding: &str, v: i16) -> String { + return format!( + "wss://gateway.discord.gg/?v={}&encoding={}&compress={}", + v, encoding, + if compress { "zlib-stream" } else { "" } + ); +}
\ No newline at end of file @@ -4,13 +4,11 @@ go 1.16 require ( github.com/TwinProduction/go-color v1.0.0 - github.com/boz/go-throttle v0.0.0-20160922054636-fdc4eab740c1 github.com/go-git/go-git/v5 v5.4.2 github.com/golang/protobuf v1.5.2 // indirect - github.com/gorilla/websocket v1.4.2 github.com/prometheus/client_golang v1.9.0 github.com/rs/zerolog v1.23.0 github.com/spf13/cobra v0.0.3 - github.com/streadway/amqp v1.0.0 golang.org/x/sys v0.0.0-20210510120138-977fb7262007 // indirect + google.golang.org/protobuf v1.27.1 // indirect ) @@ -3,7 +3,6 @@ cloud.google.com/go v0.34.0 h1:eOI3/cP2VTU6uZLDYAoic+eyzzB9YyGmJ7eIjl8rOPg= cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= -github.com/DataDog/datadog-go v2.2.0+incompatible/go.mod h1:LButxg5PwREeZtORoXG3tL4fMGNddJ+vMq1mwgfaqoQ= github.com/Knetic/govaluate v3.0.1-0.20171022003610-9aa49832a739+incompatible h1:1G1pk05UrOh0NlF1oeaaix1x8XzrfjIDK47TY0Zehcw= github.com/Knetic/govaluate v3.0.1-0.20171022003610-9aa49832a739+incompatible/go.mod h1:r7JcOSlj0wfOMncg0iLm8Leh48TZaKVeNIfJntJ2wa0= github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= @@ -39,8 +38,6 @@ github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e h1:QEF07wC0T1rKkctt1 github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e/go.mod h1:3U/XgcO3hCbHZ8TKRvWD2dDTCfh9M9ya+I9JpbB7O8o= github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da h1:8GUt8eRujhVEGZFFEjBj46YV4rDjvGrNxb0KMWYkL2I= github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY= -github.com/armon/go-metrics v0.0.0-20190430140413-ec5e00d3c878 h1:EFSB7Zo9Eg91v7MJPVsifUysc/wPdN+NOnVe6bWbdBM= -github.com/armon/go-metrics v0.0.0-20190430140413-ec5e00d3c878/go.mod h1:3AMJUQhVx52RsWOnlkpikZr01T/yAVN2gn0861vByNg= github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310 h1:BUAU3CGlLvorLI26FmByPp2eC2qla6E1Tw+scpcg/to= github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8= github.com/armon/go-socks5 v0.0.0-20160902184237-e75332964ef5 h1:0CwZNZbxp69SHPdPJAN/hZIm0C4OItdklCFmMRWYpio= @@ -59,8 +56,6 @@ github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM= github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= github.com/bgentry/speakeasy v0.1.0 h1:ByYyxL9InA1OWqxJqqp2A5pYHUrCiAL6K3J+LKSsQkY= github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs= -github.com/boz/go-throttle v0.0.0-20160922054636-fdc4eab740c1 h1:1fx+RA5lk1ZkzPAUP7DEgZnVHYxEcHO77vQO/V8z/2Q= -github.com/boz/go-throttle v0.0.0-20160922054636-fdc4eab740c1/go.mod h1:z0nyIb42Zs97wyX1V+8MbEFhHeTw1OgFQfR6q57ZuHc= github.com/casbin/casbin/v2 v2.1.2 h1:bTwon/ECRx9dwBy2ewRVr5OiqjeXSGiTUY74sDPQi/g= github.com/casbin/casbin/v2 v2.1.2/go.mod h1:YcPU1XXisHhLzuxH9coDNf2FbKpjGlbCg3n9yuLkIJQ= github.com/cenkalti/backoff v2.2.1+incompatible h1:tNowT99t7UNflLxfYYSlKYsBpXdEet03Pg2g16Swow4= @@ -69,8 +64,6 @@ github.com/census-instrumentation/opencensus-proto v0.2.1 h1:glEXhBS5PSLLv4IXzLA github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= github.com/cespare/xxhash/v2 v2.1.1 h1:6MnRN8NT7+YBpUIWxHtefFZOKTAPgGjpQSxqLNn0+qY= github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= -github.com/circonus-labs/circonus-gometrics v2.3.1+incompatible/go.mod h1:nmEj6Dob7S7YxXgwXpfOuvO54S+tGdZdw9fuRZt25Ag= -github.com/circonus-labs/circonusllhist v0.1.3/go.mod h1:kMXHVDlOchFAehlya5ePtbp5jckzBHf4XRpQvBOLI+I= github.com/clbanning/x2j v0.0.0-20191024224557-825249438eec h1:EdRZT3IeKQmfCSrgo8SZ8V3MEnskuJP0wCYNpe+aiXo= github.com/clbanning/x2j v0.0.0-20191024224557-825249438eec/go.mod h1:jMjuTZXRI4dUb/I5gc9Hdhagfvm9+RyrPryS/auMzxE= github.com/client9/misspell v0.3.4 h1:ta993UF76GwbvJcIo3Y68y/M3WxlpEHPWIGDkJYwzJI= @@ -147,7 +140,6 @@ github.com/go-logfmt/logfmt v0.5.0 h1:TrB8swr/68K7m9CcGut2g3UOihhbcbiMAYiuTXdEih github.com/go-logfmt/logfmt v0.5.0/go.mod h1:wCYkCAKZfumFQihp8CzCvQ3paCTfi41vtzG1KdI/P7A= github.com/go-sql-driver/mysql v1.4.0 h1:7LxgVwFb2hIQtMm87NdgAVfXjnt4OePseqT1tKx+opk= github.com/go-sql-driver/mysql v1.4.0/go.mod h1:zAC/RDZ24gD3HViQzih4MyKcchzm+sOG5ZlKdlhCg5w= -github.com/go-sql-driver/mysql v1.6.0/go.mod h1:DCzpHaOWr8IXmIStZouvnhqoel9Qv2LBy8hT2VhHyBg= github.com/go-stack/stack v1.8.0 h1:5SgMzNM5HxrEjV0ww2lTmX6E2Izsfxas4+YHWRs3Lsk= github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= github.com/godbus/dbus/v5 v5.0.4 h1:9349emZab16e7zQvpmsbtjc18ykshndd8y2PG3sgJbA= @@ -158,8 +150,6 @@ github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7a github.com/gogo/protobuf v1.2.0/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= -github.com/gogo/protobuf v1.3.2 h1:Ov1cvc58UF3b5XjBnZv7+opcTcQFZebYjWzi34vdm4Q= -github.com/gogo/protobuf v1.3.2/go.mod h1:P1XiOD3dCwIKUDQYPy72D8LYyHL2YPYrpS2s69NZV8Q= github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= github.com/golang/groupcache v0.0.0-20160516000752-02826c3e7903/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= @@ -189,7 +179,6 @@ github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5a github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= -github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= github.com/google/go-cmp v0.5.5 h1:Khx7svrCpmxxtHBq5j2mp/xVjsi8hQMfNLvJFAlrGgU= github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= github.com/google/gofuzz v1.0.0 h1:A8PeW59pxE9IoFRqBp37U+mSNaQoZ46F1f0f863XSXw= @@ -205,9 +194,8 @@ github.com/gorilla/context v1.1.1/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51 github.com/gorilla/mux v1.6.2/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gorilla/mux v1.7.3 h1:gnP5JzjVOuiZD07fKKToCAOjS0yOpj/qPETTXCCS6hw= github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= +github.com/gorilla/websocket v0.0.0-20170926233335-4201258b820c h1:Lh2aW+HnU2Nbe1gqD9SOJLJxW1jBMmQOktN2acDyJk8= github.com/gorilla/websocket v0.0.0-20170926233335-4201258b820c/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ= -github.com/gorilla/websocket v1.4.2 h1:+/TMaTYc4QFitKJxsQ7Yye35DkWvkdLcvGKqM+x0Ufc= -github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= github.com/grpc-ecosystem/go-grpc-middleware v1.0.1-0.20190118093823-f849b5445de4 h1:z53tR0945TRRQO/fLEVPI6SMv7ZflF0TEaTAoU7tOzg= github.com/grpc-ecosystem/go-grpc-middleware v1.0.1-0.20190118093823-f849b5445de4/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs= github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0 h1:Ovs26xHkKqVztRpIrF/92BcuyuQ/YW4NSIpoGtfXNho= @@ -220,22 +208,14 @@ github.com/hashicorp/consul/sdk v0.3.0 h1:UOxjlb4xVNF93jak1mzzoBatyFju9nrkxpVwIp github.com/hashicorp/consul/sdk v0.3.0/go.mod h1:VKf9jXwCTEY1QZP2MOLRhb5i/I/ssyNV1vwHyQBF0x8= github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= -github.com/hashicorp/go-cleanhttp v0.5.0/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80= github.com/hashicorp/go-cleanhttp v0.5.1 h1:dH3aiDG9Jvb5r5+bYHsikaOUIpcM0xvgMXVoDkXMzJM= github.com/hashicorp/go-cleanhttp v0.5.1/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80= -github.com/hashicorp/go-hclog v0.9.1/go.mod h1:5CU+agLiy3J7N7QjHK5d05KxGsuXiQLrjA0H7acj2lQ= -github.com/hashicorp/go-hclog v0.16.2 h1:K4ev2ib4LdQETX5cSZBG0DVLk1jwGqSPXBjdah3veNs= -github.com/hashicorp/go-hclog v0.16.2/go.mod h1:whpDNt7SSdeAju8AWKIWsul05p54N/39EeqMAyrmvFQ= github.com/hashicorp/go-immutable-radix v1.0.0 h1:AKDB1HM5PWEA7i4nhcpwOrO2byshxBjXVn/J/3+z5/0= github.com/hashicorp/go-immutable-radix v1.0.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60= github.com/hashicorp/go-msgpack v0.5.3 h1:zKjpN5BK/P5lMYrLmBHdBULWbJ0XpYR+7NGzqkZzoD4= github.com/hashicorp/go-msgpack v0.5.3/go.mod h1:ahLV/dePpqEmjfWmKiqvPkv/twdG7iPBM1vqhUKIvfM= -github.com/hashicorp/go-msgpack v0.5.5/go.mod h1:ahLV/dePpqEmjfWmKiqvPkv/twdG7iPBM1vqhUKIvfM= -github.com/hashicorp/go-msgpack v1.1.5 h1:9byZdVjKTe5mce63pRVNP1L7UAmdHOTEMGehn6KvJWs= -github.com/hashicorp/go-msgpack v1.1.5/go.mod h1:gWVc3sv/wbDmR3rQsj1CAktEZzoz1YNK9NfGLXJ69/4= github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o= github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= -github.com/hashicorp/go-retryablehttp v0.5.3/go.mod h1:9B5zBasrRhHXnJnui7y6sL7es7NDiJgTc6Er0maI1Xs= github.com/hashicorp/go-rootcerts v1.0.0 h1:Rqb66Oo1X/eSV1x66xbDccZjhJigjg0+e82kpwzSwCI= github.com/hashicorp/go-rootcerts v1.0.0/go.mod h1:K6zTfqpRlCUIjkwsN4Z+hiSfzSTQa6eBIzfwKfwNnHU= github.com/hashicorp/go-sockaddr v1.0.0 h1:GeH6tui99pF4NJgfnhp+L6+FfobzVW3Ah46sLo0ICXs= @@ -258,8 +238,6 @@ github.com/hashicorp/mdns v1.0.0 h1:WhIgCr5a7AaVH6jPUwjtRuuE7/RDufnUvzIr48smyxs= github.com/hashicorp/mdns v1.0.0/go.mod h1:tL+uN++7HEJ6SQLQ2/p+z2pH24WQKWjBPkE0mNTz8vQ= github.com/hashicorp/memberlist v0.1.3 h1:EmmoJme1matNzb+hMpDuR/0sbJSUisxyqBGG676r31M= github.com/hashicorp/memberlist v0.1.3/go.mod h1:ajVTdAv/9Im8oMAAj5G31PhhMCZJV2pPBoIllUwCN7I= -github.com/hashicorp/raft v1.3.1 h1:zDT8ke8y2aP4wf9zPTB2uSIeavJ3Hx/ceY4jxI2JxuY= -github.com/hashicorp/raft v1.3.1/go.mod h1:4Ak7FSPnuvmb0GV6vgIAJ4vYT4bek9bb6Q+7HVbyzqM= github.com/hashicorp/serf v0.8.2 h1:YZ7UKsJv+hKjqGVUUbtE3HNj79Eln2oQ75tniF6iPt0= github.com/hashicorp/serf v0.8.2/go.mod h1:6hOLApaqBFA1NXqRQAsxw9QxuDEvNxSQRwA/JwenrHc= github.com/hpcloud/tail v1.0.0 h1:nfCOvKYfkgYP8hkirhJocXT2+zOD8yUNjXaWfTlyFKI= @@ -296,11 +274,8 @@ github.com/kevinburke/ssh_config v0.0.0-20201106050909-4977a11b4351 h1:DowS9hvgy github.com/kevinburke/ssh_config v0.0.0-20201106050909-4977a11b4351/go.mod h1:CT57kijsi8u/K/BOFA39wgDQJ9CxiF4nAY/ojJ6r6mM= github.com/kisielk/errcheck v1.1.0 h1:ZqfnKyx9KGpRcW04j5nnPDgRgoXUeLh2YFBeFzphcA0= github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= -github.com/kisielk/errcheck v1.5.0/go.mod h1:pFxgyoBC7bSaBwPgfKdkLd5X25qrDl4LWUI2bnpBCr8= github.com/kisielk/gotool v1.0.0 h1:AV2c/EiW3KqPNT9ZKl07ehoAGi4C5/01Cfbblndcapg= github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= -github.com/klauspost/compress v1.11.12 h1:famVnQVu7QwryBN4jNseQdUKES71ZAOnB6UQQJPZvqk= -github.com/klauspost/compress v1.11.12/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs= github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/konsorten/go-windows-terminal-sequences v1.0.3 h1:CE8S1cTafDpPvMhIxNJKvHsGVBgn1xWYf1NbHQhywc8= github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= @@ -314,7 +289,6 @@ github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY= github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE= -github.com/lib/pq v1.10.2/go.mod h1:AlVN5x4E4T544tWzH6hKfbfQvm3HdbOxrmggDNAPY9o= github.com/lightstep/lightstep-tracer-common/golang/gogo v0.0.0-20190605223551-bc2310a04743 h1:143Bb8f8DuGWck/xpNUOckBVYfFbBTnLevfRZ1aVVqo= github.com/lightstep/lightstep-tracer-common/golang/gogo v0.0.0-20190605223551-bc2310a04743/go.mod h1:qklhhLq1aX+mtWk9cPHPzaBjWImj5ULL6C7HFJtXQMM= github.com/lightstep/lightstep-tracer-go v0.18.1 h1:vi1F1IQ8N7hNWytK9DpJsUfQhGuNSc19z330K6vl4zk= @@ -325,22 +299,15 @@ github.com/matryer/is v1.2.0 h1:92UTHpy8CDwaJ08GqLDzhhuixiBUUD1p3AU6PHddz4A= github.com/matryer/is v1.2.0/go.mod h1:2fLPjFQM9rhQ15aVEtbuwhJinnOqrmgXPNdZsdwlWXA= github.com/mattn/go-colorable v0.0.9 h1:UVL0vNpWh04HeJXV0KLcaT7r06gOH2l4OW6ddYRUIY4= github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= -github.com/mattn/go-colorable v0.1.4 h1:snbPLB8fVfU9iwbbo30TPtbLRzwWu6aJS6Xh4eaaviA= -github.com/mattn/go-colorable v0.1.4/go.mod h1:U0ppj6V5qS13XJ6of8GYAs25YV2eR4EVcfRqFIhoBtE= github.com/mattn/go-isatty v0.0.3/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= github.com/mattn/go-isatty v0.0.4 h1:bnP0vzxcAdeI1zdubAl5PjU6zsERjGZb7raWodagDYs= github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= -github.com/mattn/go-isatty v0.0.8/go.mod h1:Iq45c/XA43vh69/j3iqttzPXn0bhXyGjM0Hdxcsrc5s= -github.com/mattn/go-isatty v0.0.10 h1:qxFzApOv4WsAL965uUPIsXzAKCZxN2p9UqdhFS4ZW10= -github.com/mattn/go-isatty v0.0.10/go.mod h1:qgIWMr58cqv1PHHyhnkY9lrL7etaEgOFcMEpPG5Rm84= github.com/mattn/go-runewidth v0.0.2 h1:UnlwIPBGaTZfPQ6T1IGzPI0EkYAQmT9fAEJ/poFC63o= github.com/mattn/go-runewidth v0.0.2/go.mod h1:LwmH8dsx7+W8Uxz3IHJYH5QSwggIsqBzpuz5H//U1FU= github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0jegS5sx/RkqARlsWZ6pIwiU= github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= github.com/miekg/dns v1.0.14 h1:9jZdLNd/P4+SfEJ0TNyxYpsK8N4GtfylBLqtbYN1sbA= github.com/miekg/dns v1.0.14/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg= -github.com/minio/highwayhash v1.0.1 h1:dZ6IIu8Z14VlC0VpfKofAhCy74wu/Qb5gcn52yWoz/0= -github.com/minio/highwayhash v1.0.1/go.mod h1:BQskDq+xkJ12lmlUUi7U0M5Swg3EWR+dLTk+kldvVxY= github.com/mitchellh/cli v1.0.0 h1:iGBIsUe3+HZ/AD/Vd7DErOt5sU9fa8Uj7A2s1aggv1Y= github.com/mitchellh/cli v1.0.0/go.mod h1:hNIlj7HEI86fIcpObd7a0FcrxTWetlwJDGcceTlRvqc= github.com/mitchellh/go-homedir v1.0.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0= @@ -367,31 +334,15 @@ github.com/mwitkow/go-conntrack v0.0.0-20190716064945-2f068394615f/go.mod h1:qRW github.com/nats-io/jwt v0.3.0/go.mod h1:fRYCDE99xlTsqUzISS1Bi75UBJ6ljOJQOAAu5VglpSg= github.com/nats-io/jwt v0.3.2 h1:+RB5hMpXUUA2dfxuhBTEkMOrYmM+gKIZYS1KjSostMI= github.com/nats-io/jwt v0.3.2/go.mod h1:/euKqTS1ZD+zzjYrY7pseZrTtWQSjujC7xjPc8wL6eU= -github.com/nats-io/jwt v1.2.2 h1:w3GMTO969dFg+UOKTmmyuu7IGdusK+7Ytlt//OYH/uU= -github.com/nats-io/jwt v1.2.2/go.mod h1:/xX356yQA6LuXI9xWW7mZNpxgF2mBmGecH+Fj34sP5Q= -github.com/nats-io/jwt/v2 v2.0.3 h1:i/O6cmIsjpcQyWDYNcq2JyZ3/VTF8SJ4JWluI5OhpvI= -github.com/nats-io/jwt/v2 v2.0.3/go.mod h1:VRP+deawSXyhNjXmxPCHskrR6Mq50BqpEI5SEcNiGlY= github.com/nats-io/nats-server/v2 v2.1.2 h1:i2Ly0B+1+rzNZHHWtD4ZwKi+OU5l+uQo1iDHZ2PmiIc= github.com/nats-io/nats-server/v2 v2.1.2/go.mod h1:Afk+wRZqkMQs/p45uXdrVLuab3gwv3Z8C4HTBu8GD/k= -github.com/nats-io/nats-server/v2 v2.3.3 h1:4++7wFzqYwATPWN1FD9l492TGxdtzDoT0moz2yh7BWg= -github.com/nats-io/nats-server/v2 v2.3.3/go.mod h1:3mtbaN5GkCo/Z5T3nNj0I0/W1fPkKzLiDC6jjWJKp98= -github.com/nats-io/nats-streaming-server v0.22.1 h1:YKDdLAWZud3UnEBvUPaYppMxSDuh+9czTCDriq19tJY= -github.com/nats-io/nats-streaming-server v0.22.1/go.mod h1:1WpVkVV5NyZbHuGGxkaPWopLFnxNthO/TK/BkzFdnPE= github.com/nats-io/nats.go v1.9.1 h1:ik3HbLhZ0YABLto7iX80pZLPw/6dx3T+++MZJwLnMrQ= github.com/nats-io/nats.go v1.9.1/go.mod h1:ZjDU1L/7fJ09jvUSRVBR2e7+RnLiiIQyqyzEE/Zbp4w= -github.com/nats-io/nats.go v1.11.0/go.mod h1:BPko4oXsySz4aSWeFgOHLZs3G4Jq4ZAyE6/zMCxRT6w= -github.com/nats-io/nats.go v1.11.1-0.20210623165838-4b75fc59ae30 h1:9GqilBhZaR3xYis0JgMlJjNw933WIobdjKhilXm+Vls= -github.com/nats-io/nats.go v1.11.1-0.20210623165838-4b75fc59ae30/go.mod h1:BPko4oXsySz4aSWeFgOHLZs3G4Jq4ZAyE6/zMCxRT6w= github.com/nats-io/nkeys v0.1.0/go.mod h1:xpnFELMwJABBLVhffcfd1MZx6VsNRFpEugbxziKVo7w= github.com/nats-io/nkeys v0.1.3 h1:6JrEfig+HzTH85yxzhSVbjHRJv9cn0p6n3IngIcM5/k= github.com/nats-io/nkeys v0.1.3/go.mod h1:xpnFELMwJABBLVhffcfd1MZx6VsNRFpEugbxziKVo7w= -github.com/nats-io/nkeys v0.2.0/go.mod h1:XdZpAbhgyyODYqjTawOnIOI7VlbKSarI9Gfy1tqEu/s= -github.com/nats-io/nkeys v0.3.0 h1:cgM5tL53EvYRU+2YLXIK0G2mJtK12Ft9oeooSZMA2G8= -github.com/nats-io/nkeys v0.3.0/go.mod h1:gvUNGjVcM2IPr5rCsRsC6Wb3Hr2CQAm08dsxtV6A5y4= github.com/nats-io/nuid v1.0.1 h1:5iA8DT8V7q8WK2EScv2padNa/rTESc1KdnPw4TC2paw= github.com/nats-io/nuid v1.0.1/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c= -github.com/nats-io/stan.go v0.10.0 h1:trLFZNWJ3bLpD3dxEv5kFNBPsc+QqygjfDOfqh3hqg4= -github.com/nats-io/stan.go v0.10.0/go.mod h1:0jEuBXKauB1HHJswHM/lx05K48TJ1Yxj6VIfM4k+aB4= github.com/niemeyer/pretty v0.0.0-20200227124842-a10e7caefd8e h1:fD57ERR4JtEqsWbfPhv4DMiApHyliiK5xCTNVSPiaAs= github.com/niemeyer/pretty v0.0.0-20200227124842-a10e7caefd8e/go.mod h1:zD1mROLANZcx1PVRCS0qkT7pwLkGfwJo4zjcN/Tysno= github.com/oklog/oklog v0.3.2 h1:wVfs8F+in6nTBMkA7CbRw+zZMIB7nNM825cM1wuzoTk= @@ -424,7 +375,6 @@ github.com/pact-foundation/pact-go v1.0.4 h1:OYkFijGHoZAYbOIb1LWXrwKQbMMRUv1oQ89 github.com/pact-foundation/pact-go v1.0.4/go.mod h1:uExwJY4kCzNPcHRj+hCR/HBbOOIwwtUjcrb0b5/5kLM= github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c h1:Lgl0gzECD8GnQ5QCWA8o6BtfL6mDH5rQgM4/fX3avOs= github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= -github.com/pascaldekloe/goe v0.1.0/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= github.com/pborman/uuid v1.2.0 h1:J7Q5mO4ysT1dv8hyrUGHb9+ooztCXu1D8MY8DZYsu3g= github.com/pborman/uuid v1.2.0/go.mod h1:X/NO0urCmaxf9VXbdlT7C2Yzkj2IKimNn4k+gtPdI/k= github.com/performancecopilot/speed v3.0.0+incompatible h1:2WnRzIquHa5QxaJKShDkLM+sc0JPuwhXzK8OYOyt3Vg= @@ -443,7 +393,6 @@ github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZN github.com/posener/complete v1.1.1 h1:ccV59UEOTzVDnDUEFdT95ZzHVZ+5+158q8+SJb2QV5w= github.com/posener/complete v1.1.1/go.mod h1:em0nMJCgc9GFtwrmVmEMR/ZL6WyhyjMBndrE9hABlRI= github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= -github.com/prometheus/client_golang v0.9.2/go.mod h1:OsXs2jCmiKlQ1lTBmv21f2mNfw4xf/QclQDMrYNZzcM= github.com/prometheus/client_golang v0.9.3-0.20190127221311-3c4408c8b829/go.mod h1:p2iRAGwDERtqlqzRXnrOVns+ignqQo//hLXqYxZYVNs= github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo= github.com/prometheus/client_golang v1.3.0/go.mod h1:hJaj2vgQTGQmVCsAACORcieXFeDPbaTKGT+JTgUa3og= @@ -457,7 +406,6 @@ github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1: github.com/prometheus/client_model v0.1.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= github.com/prometheus/client_model v0.2.0 h1:uq5h0d+GuxiXLJLNABMgp2qUWDPiLvgCzz2dUR+/W/M= github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= -github.com/prometheus/common v0.0.0-20181126121408-4724e9255275/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= github.com/prometheus/common v0.2.0/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= github.com/prometheus/common v0.7.0/go.mod h1:DjGbpBbp5NYNiECxcL/VnbXCCaQpKd3tt26CguLLsqA= @@ -465,15 +413,12 @@ github.com/prometheus/common v0.10.0/go.mod h1:Tlit/dnDKsSWFlCLTWaA1cyBgKHSMdTB8 github.com/prometheus/common v0.15.0 h1:4fgOnadei3EZvgRwxJ7RMpG1k1pOZth5Pc13tyspaKM= github.com/prometheus/common v0.15.0/go.mod h1:U+gB1OBLb1lF3O42bTCL+FK18tX9Oar16Clt/msog/s= github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= -github.com/prometheus/procfs v0.0.0-20181204211112-1dc9a6cbc91a/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/prometheus/procfs v0.0.0-20190117184657-bf6a532e95b1/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= github.com/prometheus/procfs v0.0.8/go.mod h1:7Qr8sr6344vo1JqZ6HhLceV9o3AJ1Ff+GxbHq6oeK9A= github.com/prometheus/procfs v0.1.3/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= github.com/prometheus/procfs v0.2.0 h1:wH4vA7pcjKuZzjF7lM8awk4fnuJO6idemZXoKnULUx4= github.com/prometheus/procfs v0.2.0/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= -github.com/prometheus/procfs v0.7.1 h1:TlEtJq5GvGqMykEwWzbZWjjztF86swFhsPix1i0bkgA= -github.com/prometheus/procfs v0.7.1/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA= github.com/rcrowley/go-metrics v0.0.0-20181016184325-3113b8401b8a h1:9ZKAASQSHhDYGoxY8uLVpewe1GDZ2vu2Tr/vTdVAkFQ= github.com/rcrowley/go-metrics v0.0.0-20181016184325-3113b8401b8a/go.mod h1:bCqnVzQkZxMG4s8nGwiZ5l3QUCyqpo9Y+/ZMZ9VjZe4= github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af h1:gu+uRPtBe88sKxUCEXRoeCvVG90TJmwhiqRpvdhQFng= @@ -514,9 +459,8 @@ github.com/spf13/cobra v0.0.3/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3 github.com/spf13/pflag v1.0.1 h1:aCvUg6QPl3ibpQUxyLkrEkCHtPqYJL4x9AuhqVqFis4= github.com/spf13/pflag v1.0.1/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= github.com/streadway/amqp v0.0.0-20190404075320-75d898a42a94/go.mod h1:AZpEONHx3DKn8O/DFsRAY58/XVQiIPMTMB1SddzLXVw= +github.com/streadway/amqp v0.0.0-20190827072141-edfb9018d271 h1:WhxRHzgeVGETMlmVfqhRn8RIeeNoPr2Czh33I4Zdccw= github.com/streadway/amqp v0.0.0-20190827072141-edfb9018d271/go.mod h1:AZpEONHx3DKn8O/DFsRAY58/XVQiIPMTMB1SddzLXVw= -github.com/streadway/amqp v1.0.0 h1:kuuDrUJFZL1QYL9hUNuCxNObNzB0bV/ZG5jV3RWAQgo= -github.com/streadway/amqp v1.0.0/go.mod h1:AZpEONHx3DKn8O/DFsRAY58/XVQiIPMTMB1SddzLXVw= github.com/streadway/handy v0.0.0-20190108123426-d5acb3125c2a h1:AhmOdSHeswKHBjhsLs/7+1voOxT+LLrSk/Nxvk35fug= github.com/streadway/handy v0.0.0-20190108123426-d5acb3125c2a/go.mod h1:qNTQ5P5JnDBl6z3cMAg/SywNDC5ABu5ApDIw6lUbRmI= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= @@ -529,7 +473,6 @@ github.com/stretchr/testify v1.7.0 h1:nwc3DEeHmmLAfoZucVR881uASk0Mfjw8xYJ99tb5Cc github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8 h1:ndzgwNDnKIqyCvHTXaCqh9KlOWKvBry6nuXMJmonVsE= github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= -github.com/tv42/httpunix v0.0.0-20150427012821-b75d8614f926/go.mod h1:9ESjWnEqriFuLhtthL60Sar/7RFoluCcXsuvEwTV5KM= github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= github.com/urfave/cli v1.22.1 h1:+mkCCcOFKPnCmVYVcURKps1Xe+3zP90gSYGNfRkjoIY= github.com/urfave/cli v1.22.1/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= @@ -537,13 +480,10 @@ github.com/xanzy/ssh-agent v0.3.0 h1:wUMzuKtKilRgBAD1sUb8gOwwRr2FGoBVumcjoOACClI github.com/xanzy/ssh-agent v0.3.0/go.mod h1:3s9xbODqPuuhK9JV1R321M/FlMZSBvE5aY6eAcqrDh0= github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2 h1:eY9dn8+vbi4tKz5Qo6v2eYzo7kUS51QINcR5jNpbZS8= github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= -github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= github.com/yuin/goldmark v1.2.1 h1:ruQGxdhGHe7FWOJPT0mKs5+pD2Xs1Bm/kdGlHO04FmM= github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk= go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= -go.etcd.io/bbolt v1.3.6 h1:/ecaJf0sk1l4l6V4awd65v2C3ILy7MSj+s/x1ADCIMU= -go.etcd.io/bbolt v1.3.6/go.mod h1:qXsaaIqmgQH0T+OPdb99Bf+PKfBBQVAdyD6TY9G8XM4= go.etcd.io/etcd v0.0.0-20191023171146-3cf2f69b5738 h1:VcrIfasaLFkyjk6KNlXQSzO+B0fZcnECiDrKJsfxka0= go.etcd.io/etcd v0.0.0-20191023171146-3cf2f69b5738/go.mod h1:dnLIgRNXwCJa5e+c6mIZCrds/GIG4ncV9HhK5PX7jPg= go.opencensus.io v0.20.1/go.mod h1:6WKK9ahsWS3RSO+PY9ZHZUfv2irvY6gN279GOPZjmmk= @@ -568,15 +508,10 @@ golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACk golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= -golang.org/x/crypto v0.0.0-20200323165209-0ec3e9974c59/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= -golang.org/x/crypto v0.0.0-20210314154223-e6e6c4f2bb5b/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4= golang.org/x/crypto v0.0.0-20210322153248-0c34fe9e7dc2/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4= golang.org/x/crypto v0.0.0-20210421170649-83a5a9bb288b h1:7mWr3k41Qtv8XlltBkDkl8LoP3mpSgBW8BUoxtEdbXg= golang.org/x/crypto v0.0.0-20210421170649-83a5a9bb288b/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4= -golang.org/x/crypto v0.0.0-20210616213533-5ff15b29337e/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= -golang.org/x/crypto v0.0.0-20210711020723-a769d52b0f97 h1:/UOmuWzQfxxo9UtlXMwuQU8CMgg1eZXqTRwkSQJWKOI= -golang.org/x/crypto v0.0.0-20210711020723-a769d52b0f97/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= golang.org/x/exp v0.0.0-20190121172915-509febef88a4 h1:c2HOrn5iMezYjSlGPncknSEr/8x5LELb/ilJbXi9DEA= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= @@ -587,7 +522,6 @@ golang.org/x/lint v0.0.0-20190930215403-16217165b5de h1:5hukYrvBGR8/eNkX5mdUezrA golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc= golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg= -golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.3.0 h1:RM4zey1++hCTbCVQfnWeKs9/IEsaBLA8vTkd0WVtmH4= golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= @@ -606,7 +540,6 @@ golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190813141303-74dc4d7220e7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= -golang.org/x/net v0.0.0-20200226121028-0de0cce0169b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20200625001655-4c5254603344/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA= golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= @@ -623,7 +556,6 @@ golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9 h1:SQFwaSi55rU7vdNs9Yr0Z324VNlrF+0wMqRXT4St8ck= golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -632,9 +564,7 @@ golang.org/x/sys v0.0.0-20181026203630-95b1ffbd15a5/go.mod h1:STP8DvDyc/dI5b8T5h golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181122145206-62eef0e2fa9b/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20190130150945-aca44879d564/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/sys v0.0.0-20190222072716-a9d3bda3a223/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -642,27 +572,21 @@ golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190826190057-c7b8b68b1456/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20191008105621-543471e840be/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191220142924-d4481acd189f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200106162015-b016eb3dc98e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200615200032-f1bc736245b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200625212154-ddb9806d33ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200923182605-d9f96fdee20d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20201214210602-f9fddec55a1e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210119212857-b64e53b001e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210320140829-1e4c9ba3b0c4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210324051608-47abb6519492/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210502180810-71e4cd670f79/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210510120138-977fb7262007 h1:gG67DSER+11cZvqIMb8S8bt0vZtiN6xWYARwirrOSfE= golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c h1:F1jZWGFhYfh0Ci55sIpILtKKK8p3i2/krTr0H1rg74I= -golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1 h1:v+OssWQX+hTHEmOBgwxdZxK4zHq3yOs8F9J7mk0PY8E= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -672,8 +596,6 @@ golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= golang.org/x/time v0.0.0-20180412165947-fbb02b2291d2/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20191024005414-555d28b269f0 h1:/5xXl8Y5W96D+TtHSlonuFqGHIWVuyCkGJLwGh9JJFs= golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20200416051211-89c76fbcd5d1 h1:NusfzzA6yGQ+ua51ck7E3omNUX/JuqbFSaRGqU8CcLI= -golang.org/x/time v0.0.0-20200416051211-89c76fbcd5d1/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20180828015842-6cd1fcedba52/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= @@ -682,15 +604,12 @@ golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3 golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= -golang.org/x/tools v0.0.0-20190424220101-1e8e1cfdf96b/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= golang.org/x/tools v0.0.0-20191029041327-9cc4af7d6b2c/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191029190741-b9c20aec41a5/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= golang.org/x/tools v0.0.0-20200103221440-774c71fcf114/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= -golang.org/x/tools v0.0.0-20200619180055-7c47624df98f/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= -golang.org/x/tools v0.0.0-20210106214847-113979e3529a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/tools v0.1.0 h1:po9/4sTYwZU9lPhi1tOrb4hCv3qrhiQ77LZfGa2OjwY= golang.org/x/tools v0.1.0/go.mod h1:xkSsbof2nBLbhDlRMhhhyNLN/zl3eTqcnHD5viDpcZ0= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= @@ -727,8 +646,9 @@ google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miE google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo= google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= google.golang.org/protobuf v1.26.0-rc.1/go.mod h1:jlhhOSvTdKEhbULTjvd4ARK9grFBp09yW+WbY/TyQbw= -google.golang.org/protobuf v1.26.0 h1:bxAC2xTBsZGibn2RTntX0oH50xLsqy1OxA9tTL3p/lk= google.golang.org/protobuf v1.26.0/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc= +google.golang.org/protobuf v1.27.1 h1:SnqbnDw1V7RiZcXPx5MEeqPv2s79L9i7BJUlG/+RurQ= +google.golang.org/protobuf v1.27.1/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc= gopkg.in/alecthomas/kingpin.v2 v2.2.6 h1:jMFz6MfLP0/4fUyZle81rXUoxOBFi19VUFKVDOQfozc= gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= diff --git a/novactl/BUILD.bazel b/novactl/BUILD.bazel index 3e31e23..5c5a33c 100644 --- a/novactl/BUILD.bazel +++ b/novactl/BUILD.bazel @@ -1,5 +1,7 @@ load("@io_bazel_rules_go//go:def.bzl", "go_binary", "go_library") -load("@bazel_tools//tools/build_defs/pkg:pkg.bzl", "pkg_tar") +load("@io_bazel_rules_docker//go:image.bzl", "go_image") + +test_suite(name = "tests") go_library( name = "novactl_lib", @@ -18,9 +20,8 @@ go_binary( visibility = ["//visibility:public"], ) -pkg_tar( - name = "novactl_pkg", - srcs = [":novactl"], - mode = "0755", +go_image( + name = "image", + embed = [":novactl_lib"], visibility = ["//visibility:public"], ) diff --git a/novactl/README.md b/novactl/README.md index a0fe3d5..480524a 100644 --- a/novactl/README.md +++ b/novactl/README.md @@ -1,3 +1,3 @@ -# Novactl - +# Novactl
+
Novactl is a simple command-line utility used to interact with your nova projects, and the nova infrastructure.
\ No newline at end of file diff --git a/novactl/cmd/init.go b/novactl/cmd/init.go index ff796c6..47a5559 100644 --- a/novactl/cmd/init.go +++ b/novactl/cmd/init.go @@ -16,7 +16,7 @@ import ( var (
InitializeCommand = &cobra.Command{
Use: "init",
- Short: "Initialize a newnova based project",
+ Short: "Initialize a new nova based project",
Run: initNovaRepo,
}
)
diff --git a/novactl/cmd/version.go b/novactl/cmd/version.go index ea74e5b..cea4f1b 100644 --- a/novactl/cmd/version.go +++ b/novactl/cmd/version.go @@ -1,20 +1,20 @@ -package cmd - -import ( - "fmt" - - "github.com/discordnova/nova/novactl/lib" - "github.com/spf13/cobra" -) - -var ( - VersionCommand = &cobra.Command{ - Use: "version", - Short: "Returns the version of the CLI", - Run: version, - } -) - -func version(cmd *cobra.Command, args []string) { - fmt.Println(fmt.Sprintf("Nova version: %s", lib.VERSION)) -} +package cmd
+
+import (
+ "fmt"
+
+ "github.com/discordnova/nova/novactl/lib"
+ "github.com/spf13/cobra"
+)
+
+var (
+ VersionCommand = &cobra.Command{
+ Use: "version",
+ Short: "Returns the version of the CLI",
+ Run: version,
+ }
+)
+
+func version(cmd *cobra.Command, args []string) {
+ fmt.Println(fmt.Sprintf("Nova version: %s", lib.VERSION))
+}
diff --git a/novactl/lib/BUILD.bazel b/novactl/lib/BUILD.bazel index 47eed09..1dd62b7 100644 --- a/novactl/lib/BUILD.bazel +++ b/novactl/lib/BUILD.bazel @@ -1,4 +1,4 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") +load("@io_bazel_rules_go//go:def.bzl", "go_library", "go_test") go_library( name = "lib", @@ -6,3 +6,9 @@ go_library( importpath = "github.com/discordnova/nova/novactl/lib", visibility = ["//visibility:public"], ) + +go_test( + name = "lib_test", + srcs = ["version_test.go"], + deps = [":lib"], +) diff --git a/novactl/lib/version_test.go b/novactl/lib/version_test.go new file mode 100644 index 0000000..665780f --- /dev/null +++ b/novactl/lib/version_test.go @@ -0,0 +1,13 @@ +package lib_test
+
+import (
+ "testing"
+
+ "github.com/discordnova/nova/novactl/lib"
+)
+
+func TestVersion(t *testing.T) {
+ if lib.VERSION != "0.0.1" {
+ t.Fatalf("Version number do not match %s", lib.VERSION)
+ }
+}
diff --git a/novalet/BUILD.bazel b/novalet/BUILD.bazel deleted file mode 100644 index ba72f56..0000000 --- a/novalet/BUILD.bazel +++ /dev/null @@ -1,22 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_binary", "go_library") -load("@bazel_tools//tools/build_defs/pkg:pkg.bzl", "pkg_tar") - -go_library( - name = "novalet_lib", - srcs = ["main.go"], - importpath = "github.com/discordnova/nova/novalet", - visibility = ["//visibility:private"], -) - -go_binary( - name = "novalet", - embed = [":novalet_lib"], - visibility = ["//visibility:public"], -) - -pkg_tar( - name = "novalet_pkg", - srcs = [":novalet"], - mode = "0755", - visibility = ["//visibility:public"], -) diff --git a/novalet/lib/BUILD.bazel b/novalet/lib/BUILD.bazel deleted file mode 100644 index 9655784..0000000 --- a/novalet/lib/BUILD.bazel +++ /dev/null @@ -1,12 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_library") - -go_library( - name = "lib", - srcs = ["internal_transporter.go"], - importpath = "github.com/discordnova/nova/novalet/lib", - visibility = ["//visibility:public"], - deps = [ - "//common/gateway", - "@com_github_rs_zerolog//log", - ], -) diff --git a/novalet/lib/internal_transporter.go b/novalet/lib/internal_transporter.go deleted file mode 100644 index 87e708e..0000000 --- a/novalet/lib/internal_transporter.go +++ /dev/null @@ -1,37 +0,0 @@ -package lib - -import ( - "github.com/discordnova/nova/common/gateway" - "github.com/rs/zerolog/log" -) - -type InternalTransporter struct { - pullChannel chan []byte - pushChannel chan gateway.PushData -} - -// NewRabbitMqTransporter creates a rabbitmq transporter using a given url -func NewInternalTransporter() (gateway.Transporter, error) { - log.Info().Msg("using the memory transporter") - - pullChannel, pushChannel := make(chan []byte), make(chan gateway.PushData) - - go func() { - for { - // TODO(matthieu): Implement push channel for the internal transporter. - <-pushChannel - } - }() - - return &InternalTransporter{ - pullChannel: pullChannel, - pushChannel: pushChannel, - }, nil -} - -func (t InternalTransporter) PushChannel() chan gateway.PushData { - return t.pushChannel -} -func (t InternalTransporter) PullChannel() chan []byte { - return t.pullChannel -} diff --git a/novalet/lib/nats_standalone.go b/novalet/lib/nats_standalone.go deleted file mode 100644 index ec8c50d..0000000 --- a/novalet/lib/nats_standalone.go +++ /dev/null @@ -1,19 +0,0 @@ -package lib
-
-import (
- stand "github.com/nats-io/nats-streaming-server/server"
-)
-
-type NatsStandalone struct {
- streamingServer *stand.StanServer
-}
-
-func NewNatsStandalone() *NatsStandalone {
- server, err := stand.RunServer("standalone_server")
- if err != nil {
- panic("failed to start the server")
- }
- return &NatsStandalone{
- streamingServer: server,
- }
-}
diff --git a/novalet/main.go b/novalet/main.go deleted file mode 100644 index b54711d..0000000 --- a/novalet/main.go +++ /dev/null @@ -1,16 +0,0 @@ -package main
-
-import (
- websocketLib "github.com/discordnova/nova/gateway/lib/gateway"
- "github.com/discordnova/nova/novalet/lib"
-)
-
-func main() {
- go lib.NewNatsStandalone()
- transporter, _ := lib.NewInternalTransporter()
- websocket := websocketLib.NewGateway(websocketLib.GatewayConnectorOptions{
- Transporter: transporter,
- })
-
- go websocket.Start()
-}
diff --git a/ratelimiter/BUILD b/ratelimiter/BUILD new file mode 100644 index 0000000..4a122e1 --- /dev/null +++ b/ratelimiter/BUILD @@ -0,0 +1,36 @@ +load("@rules_rust//rust:rust.bzl", "rust_binary") +load("@rules_rust//cargo:cargo_build_script.bzl", "cargo_build_script") +load("//cargo:crates.bzl", "all_crate_deps", "crate_deps") +load("@io_bazel_rules_docker//rust:image.bzl", "rust_image") + +test_suite(name = "tests") + +cargo_build_script( + name = "build_script", + srcs = ["build.rs"], + build_script_env = { + "PROTOC": "$(location @com_google_protobuf//:protoc)", + }, + data = [ + "//ratelimiter/proto:nova.ratelimit.v1.proto", + ] + [ + "@com_google_protobuf//:protoc", + "@com_google_protobuf//:protobuf_headers", + ], + deps = all_crate_deps() + crate_deps(["tonic-build"]), +) + +rust_binary( + name = "ratelimiter", + srcs = ["src/main.rs"], + deps = all_crate_deps() + [":build_script"], + visibility = ["//visibility:public"], +) + +rust_image( + name = "image", + srcs = ["src/main.rs"], + deps = all_crate_deps() + [":build_script"], + visibility = ["//visibility:public"], + base = "//bazel:base", +)
\ No newline at end of file diff --git a/ratelimiter/BUILD.bazel b/ratelimiter/BUILD.bazel deleted file mode 100644 index 287e00d..0000000 --- a/ratelimiter/BUILD.bazel +++ /dev/null @@ -1,25 +0,0 @@ -load("@rules_rust//cargo:cargo_build_script.bzl", "cargo_build_script") -load("@rules_rust//rust:rust.bzl", "rust_binary") -load("@bazel_tools//tools/build_defs/pkg:pkg.bzl", "pkg_tar") - -cargo_build_script( - name = "build_script", - srcs = ["build.rs"], - deps = [ - "//ratelimiter/cargo:tonic_build", - ], -) - -rust_binary( - name = "ratelimiter", - srcs = ["src/main.rs"], -) - -# TODO: Add testing, and the shared library. - -pkg_tar( - name = "ratelimiter_pkg", - srcs = [":ratelimiter"], - mode = "0755", - visibility = ["//visibility:public"], -) diff --git a/ratelimiter/Cargo.lock b/ratelimiter/Cargo.lock deleted file mode 100644 index 29c9b57..0000000 --- a/ratelimiter/Cargo.lock +++ /dev/null @@ -1,832 +0,0 @@ -# This file is automatically @generated by Cargo. -# It is not intended for manual editing. -version = 3 - -[[package]] -name = "anyhow" -version = "1.0.42" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "595d3cfa7a60d4555cb5067b99f07142a08ea778de5cf993f7b75c7d8fabc486" - -[[package]] -name = "async-stream" -version = "0.3.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "171374e7e3b2504e0e5236e3b59260560f9fe94bfe9ac39ba5e4e929c5590625" -dependencies = [ - "async-stream-impl", - "futures-core", -] - -[[package]] -name = "async-stream-impl" -version = "0.3.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "648ed8c8d2ce5409ccd57453d9d1b214b342a0d69376a6feda1fd6cae3299308" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "async-trait" -version = "0.1.51" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "44318e776df68115a881de9a8fd1b9e53368d7a4a5ce4cc48517da3393233a5e" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "autocfg" -version = "1.0.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cdb031dd78e28731d87d56cc8ffef4a8f36ca26c38fe2de700543e627f8a464a" - -[[package]] -name = "base64" -version = "0.13.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "904dfeac50f3cdaba28fc6f57fdcddb75f49ed61346676a78c4ffe55877802fd" - -[[package]] -name = "bitflags" -version = "1.2.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693" - -[[package]] -name = "bytes" -version = "1.0.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b700ce4376041dcd0a327fd0097c41095743c4c8af8887265942faf1100bd040" - -[[package]] -name = "cfg-if" -version = "1.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd" - -[[package]] -name = "either" -version = "1.6.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e78d4f1cc4ae33bbfc157ed5d5a5ef3bc29227303d595861deb238fcec4e9457" - -[[package]] -name = "fixedbitset" -version = "0.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "37ab347416e802de484e4d03c7316c48f1ecb56574dfd4a46a80f173ce1de04d" - -[[package]] -name = "fnv" -version = "1.0.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1" - -[[package]] -name = "futures-channel" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "74ed2411805f6e4e3d9bc904c95d5d423b89b3b25dc0250aa74729de20629ff9" -dependencies = [ - "futures-core", -] - -[[package]] -name = "futures-core" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "af51b1b4a7fdff033703db39de8802c673eb91855f2e0d47dcf3bf2c0ef01f99" - -[[package]] -name = "futures-sink" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c0f30aaa67363d119812743aa5f33c201a7a66329f97d1a887022971feea4b53" - -[[package]] -name = "futures-task" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bbe54a98670017f3be909561f6ad13e810d9a51f3f061b902062ca3da80799f2" - -[[package]] -name = "futures-util" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "67eb846bfd58e44a8481a00049e82c43e0ccb5d61f8dc071057cb19249dd4d78" -dependencies = [ - "autocfg", - "futures-core", - "futures-task", - "pin-project-lite", - "pin-utils", -] - -[[package]] -name = "getrandom" -version = "0.2.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7fcd999463524c52659517fe2cea98493cfe485d10565e7b0fb07dbba7ad2753" -dependencies = [ - "cfg-if", - "libc", - "wasi", -] - -[[package]] -name = "h2" -version = "0.3.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "825343c4eef0b63f541f8903f395dc5beb362a979b5799a84062527ef1e37726" -dependencies = [ - "bytes", - "fnv", - "futures-core", - "futures-sink", - "futures-util", - "http", - "indexmap", - "slab", - "tokio", - "tokio-util", - "tracing", -] - -[[package]] -name = "hashbrown" -version = "0.11.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ab5ef0d4909ef3724cc8cce6ccc8572c5c817592e9285f5464f8e86f8bd3726e" - -[[package]] -name = "heck" -version = "0.3.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6d621efb26863f0e9924c6ac577e8275e5e6b77455db64ffa6c65c904e9e132c" -dependencies = [ - "unicode-segmentation", -] - -[[package]] -name = "hermit-abi" -version = "0.1.19" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "62b467343b94ba476dcb2500d242dadbb39557df889310ac77c5d99100aaac33" -dependencies = [ - "libc", -] - -[[package]] -name = "http" -version = "0.2.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "527e8c9ac747e28542699a951517aa9a6945af506cd1f2e1b53a576c17b6cc11" -dependencies = [ - "bytes", - "fnv", - "itoa", -] - -[[package]] -name = "http-body" -version = "0.4.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "399c583b2979440c60be0821a6199eca73bc3c8dcd9d070d75ac726e2c6186e5" -dependencies = [ - "bytes", - "http", - "pin-project-lite", -] - -[[package]] -name = "httparse" -version = "1.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f3a87b616e37e93c22fb19bcd386f02f3af5ea98a25670ad0fce773de23c5e68" - -[[package]] -name = "httpdate" -version = "1.0.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6456b8a6c8f33fee7d958fcd1b60d55b11940a79e63ae87013e6d22e26034440" - -[[package]] -name = "hyper" -version = "0.14.11" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0b61cf2d1aebcf6e6352c97b81dc2244ca29194be1b276f5d8ad5c6330fffb11" -dependencies = [ - "bytes", - "futures-channel", - "futures-core", - "futures-util", - "h2", - "http", - "http-body", - "httparse", - "httpdate", - "itoa", - "pin-project-lite", - "socket2", - "tokio", - "tower-service", - "tracing", - "want", -] - -[[package]] -name = "hyper-timeout" -version = "0.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bbb958482e8c7be4bc3cf272a766a2b0bf1a6755e7a6ae777f017a31d11b13b1" -dependencies = [ - "hyper", - "pin-project-lite", - "tokio", - "tokio-io-timeout", -] - -[[package]] -name = "indexmap" -version = "1.7.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bc633605454125dec4b66843673f01c7df2b89479b32e0ed634e43a91cff62a5" -dependencies = [ - "autocfg", - "hashbrown", -] - -[[package]] -name = "itertools" -version = "0.10.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "69ddb889f9d0d08a67338271fa9b62996bc788c7796a5c18cf057420aaed5eaf" -dependencies = [ - "either", -] - -[[package]] -name = "itoa" -version = "0.4.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dd25036021b0de88a0aff6b850051563c6516d0bf53f8638938edbb9de732736" - -[[package]] -name = "lazy_static" -version = "1.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" - -[[package]] -name = "libc" -version = "0.2.98" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "320cfe77175da3a483efed4bc0adc1968ca050b098ce4f2f1c13a56626128790" - -[[package]] -name = "log" -version = "0.4.14" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710" -dependencies = [ - "cfg-if", -] - -[[package]] -name = "memchr" -version = "2.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b16bd47d9e329435e309c58469fe0791c2d0d1ba96ec0954152a5ae2b04387dc" - -[[package]] -name = "mio" -version = "0.7.13" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8c2bdb6314ec10835cd3293dd268473a835c02b7b352e788be788b3c6ca6bb16" -dependencies = [ - "libc", - "log", - "miow", - "ntapi", - "winapi", -] - -[[package]] -name = "miow" -version = "0.3.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b9f1c5b025cda876f66ef43a113f91ebc9f4ccef34843000e0adf6ebbab84e21" -dependencies = [ - "winapi", -] - -[[package]] -name = "multimap" -version = "0.8.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e5ce46fe64a9d73be07dcbe690a38ce1b293be448fd8ce1e6c1b8062c9f72c6a" - -[[package]] -name = "ntapi" -version = "0.3.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3f6bb902e437b6d86e03cce10a7e2af662292c5dfef23b65899ea3ac9354ad44" -dependencies = [ - "winapi", -] - -[[package]] -name = "num_cpus" -version = "1.13.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "05499f3756671c15885fee9034446956fff3f243d6077b91e5767df161f766b3" -dependencies = [ - "hermit-abi", - "libc", -] - -[[package]] -name = "percent-encoding" -version = "2.1.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d4fd5641d01c8f18a23da7b6fe29298ff4b55afcccdf78973b24cf3175fee32e" - -[[package]] -name = "petgraph" -version = "0.5.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "467d164a6de56270bd7c4d070df81d07beace25012d5103ced4e9ff08d6afdb7" -dependencies = [ - "fixedbitset", - "indexmap", -] - -[[package]] -name = "pin-project" -version = "1.0.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "576bc800220cc65dac09e99e97b08b358cfab6e17078de8dc5fee223bd2d0c08" -dependencies = [ - "pin-project-internal", -] - -[[package]] -name = "pin-project-internal" -version = "1.0.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6e8fe8163d14ce7f0cdac2e040116f22eac817edabff0be91e8aff7e9accf389" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "pin-project-lite" -version = "0.2.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8d31d11c69a6b52a174b42bdc0c30e5e11670f90788b2c471c31c1d17d449443" - -[[package]] -name = "pin-utils" -version = "0.1.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" - -[[package]] -name = "ppv-lite86" -version = "0.2.10" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ac74c624d6b2d21f425f752262f42188365d7b8ff1aff74c82e45136510a4857" - -[[package]] -name = "proc-macro2" -version = "1.0.28" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5c7ed8b8c7b886ea3ed7dde405212185f423ab44682667c8c6dd14aa1d9f6612" -dependencies = [ - "unicode-xid", -] - -[[package]] -name = "prost" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "de5e2533f59d08fcf364fd374ebda0692a70bd6d7e66ef97f306f45c6c5d8020" -dependencies = [ - "bytes", - "prost-derive", -] - -[[package]] -name = "prost-build" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "355f634b43cdd80724ee7848f95770e7e70eefa6dcf14fea676216573b8fd603" -dependencies = [ - "bytes", - "heck", - "itertools", - "log", - "multimap", - "petgraph", - "prost", - "prost-types", - "tempfile", - "which", -] - -[[package]] -name = "prost-derive" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "600d2f334aa05acb02a755e217ef1ab6dea4d51b58b7846588b747edec04efba" -dependencies = [ - "anyhow", - "itertools", - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "prost-types" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "603bbd6394701d13f3f25aada59c7de9d35a6a5887cfc156181234a44002771b" -dependencies = [ - "bytes", - "prost", -] - -[[package]] -name = "quote" -version = "1.0.9" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c3d0b9745dc2debf507c8422de05d7226cc1f0644216dfdfead988f9b1ab32a7" -dependencies = [ - "proc-macro2", -] - -[[package]] -name = "rand" -version = "0.8.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2e7573632e6454cf6b99d7aac4ccca54be06da05aca2ef7423d22d27d4d4bcd8" -dependencies = [ - "libc", - "rand_chacha", - "rand_core", - "rand_hc", -] - -[[package]] -name = "rand_chacha" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88" -dependencies = [ - "ppv-lite86", - "rand_core", -] - -[[package]] -name = "rand_core" -version = "0.6.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d34f1408f55294453790c48b2f1ebbb1c5b4b7563eb1f418bcfcfdbb06ebb4e7" -dependencies = [ - "getrandom", -] - -[[package]] -name = "rand_hc" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d51e9f596de227fda2ea6c84607f5558e196eeaf43c986b724ba4fb8fdf497e7" -dependencies = [ - "rand_core", -] - -[[package]] -name = "redox_syscall" -version = "0.2.10" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8383f39639269cde97d255a32bdb68c047337295414940c68bdd30c2e13203ff" -dependencies = [ - "bitflags", -] - -[[package]] -name = "remove_dir_all" -version = "0.5.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3acd125665422973a33ac9d3dd2df85edad0f4ae9b00dafb1a05e43a9f5ef8e7" -dependencies = [ - "winapi", -] - -[[package]] -name = "rest-ratelimiter" -version = "0.1.0" -dependencies = [ - "prost", - "tokio", - "tonic", - "tonic-build", -] - -[[package]] -name = "slab" -version = "0.4.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c307a32c1c5c437f38c7fd45d753050587732ba8628319fbdf12a7e289ccc590" - -[[package]] -name = "socket2" -version = "0.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "765f090f0e423d2b55843402a07915add955e7d60657db13707a159727326cad" -dependencies = [ - "libc", - "winapi", -] - -[[package]] -name = "syn" -version = "1.0.74" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1873d832550d4588c3dbc20f01361ab00bfe741048f71e3fecf145a7cc18b29c" -dependencies = [ - "proc-macro2", - "quote", - "unicode-xid", -] - -[[package]] -name = "tempfile" -version = "3.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dac1c663cfc93810f88aed9b8941d48cabf856a1b111c29a40439018d870eb22" -dependencies = [ - "cfg-if", - "libc", - "rand", - "redox_syscall", - "remove_dir_all", - "winapi", -] - -[[package]] -name = "tokio" -version = "1.9.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4b7b349f11a7047e6d1276853e612d152f5e8a352c61917887cc2169e2366b4c" -dependencies = [ - "autocfg", - "bytes", - "libc", - "memchr", - "mio", - "num_cpus", - "pin-project-lite", - "tokio-macros", - "winapi", -] - -[[package]] -name = "tokio-io-timeout" -version = "1.1.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "90c49f106be240de154571dd31fbe48acb10ba6c6dd6f6517ad603abffa42de9" -dependencies = [ - "pin-project-lite", - "tokio", -] - -[[package]] -name = "tokio-macros" -version = "1.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "54473be61f4ebe4efd09cec9bd5d16fa51d70ea0192213d754d2d500457db110" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "tokio-stream" -version = "0.1.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7b2f3f698253f03119ac0102beaa64f67a67e08074d03a22d18784104543727f" -dependencies = [ - "futures-core", - "pin-project-lite", - "tokio", -] - -[[package]] -name = "tokio-util" -version = "0.6.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1caa0b0c8d94a049db56b5acf8cba99dc0623aab1b26d5b5f5e2d945846b3592" -dependencies = [ - "bytes", - "futures-core", - "futures-sink", - "log", - "pin-project-lite", - "tokio", -] - -[[package]] -name = "tonic" -version = "0.5.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b584f064fdfc50017ec39162d5aebce49912f1eb16fd128e04b7f4ce4907c7e5" -dependencies = [ - "async-stream", - "async-trait", - "base64", - "bytes", - "futures-core", - "futures-util", - "h2", - "http", - "http-body", - "hyper", - "hyper-timeout", - "percent-encoding", - "pin-project", - "prost", - "prost-derive", - "tokio", - "tokio-stream", - "tokio-util", - "tower", - "tower-layer", - "tower-service", - "tracing", - "tracing-futures", -] - -[[package]] -name = "tonic-build" -version = "0.5.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d12faebbe071b06f486be82cc9318350814fdd07fcb28f3690840cd770599283" -dependencies = [ - "proc-macro2", - "prost-build", - "quote", - "syn", -] - -[[package]] -name = "tower" -version = "0.4.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f60422bc7fefa2f3ec70359b8ff1caff59d785877eb70595904605bcc412470f" -dependencies = [ - "futures-core", - "futures-util", - "indexmap", - "pin-project", - "rand", - "slab", - "tokio", - "tokio-stream", - "tokio-util", - "tower-layer", - "tower-service", - "tracing", -] - -[[package]] -name = "tower-layer" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "343bc9466d3fe6b0f960ef45960509f84480bf4fd96f92901afe7ff3df9d3a62" - -[[package]] -name = "tower-service" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "360dfd1d6d30e05fda32ace2c8c70e9c0a9da713275777f5a4dbb8a1893930c6" - -[[package]] -name = "tracing" -version = "0.1.26" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "09adeb8c97449311ccd28a427f96fb563e7fd31aabf994189879d9da2394b89d" -dependencies = [ - "cfg-if", - "log", - "pin-project-lite", - "tracing-attributes", - "tracing-core", -] - -[[package]] -name = "tracing-attributes" -version = "0.1.15" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c42e6fa53307c8a17e4ccd4dc81cf5ec38db9209f59b222210375b54ee40d1e2" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "tracing-core" -version = "0.1.18" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a9ff14f98b1a4b289c6248a023c1c2fa1491062964e9fed67ab29c4e4da4a052" -dependencies = [ - "lazy_static", -] - -[[package]] -name = "tracing-futures" -version = "0.2.5" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "97d095ae15e245a057c8e8451bab9b3ee1e1f68e9ba2b4fbc18d0ac5237835f2" -dependencies = [ - "pin-project", - "tracing", -] - -[[package]] -name = "try-lock" -version = "0.2.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "59547bce71d9c38b83d9c0e92b6066c4253371f15005def0c30d9657f50c7642" - -[[package]] -name = "unicode-segmentation" -version = "1.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8895849a949e7845e06bd6dc1aa51731a103c42707010a5b591c0038fb73385b" - -[[package]] -name = "unicode-xid" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8ccb82d61f80a663efe1f787a51b16b5a51e3314d6ac365b08639f52387b33f3" - -[[package]] -name = "want" -version = "0.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0" -dependencies = [ - "log", - "try-lock", -] - -[[package]] -name = "wasi" -version = "0.10.2+wasi-snapshot-preview1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fd6fbd9a79829dd1ad0cc20627bf1ed606756a7f77edff7b66b7064f9cb327c6" - -[[package]] -name = "which" -version = "4.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ea187a8ef279bc014ec368c27a920da2024d2a711109bfbe3440585d5cf27ad9" -dependencies = [ - "either", - "lazy_static", - "libc", -] - -[[package]] -name = "winapi" -version = "0.3.9" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419" -dependencies = [ - "winapi-i686-pc-windows-gnu", - "winapi-x86_64-pc-windows-gnu", -] - -[[package]] -name = "winapi-i686-pc-windows-gnu" -version = "0.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" - -[[package]] -name = "winapi-x86_64-pc-windows-gnu" -version = "0.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" diff --git a/ratelimiter/Cargo.toml b/ratelimiter/Cargo.toml index 5050c0b..873017c 100644 --- a/ratelimiter/Cargo.toml +++ b/ratelimiter/Cargo.toml @@ -1,22 +1,20 @@ -[package] -name = "rest-ratelimiter" -version = "0.1.0" -edition = "2018" - -[dependencies] -tonic = "0.5" -prost = "0.8" -tokio = { version = "1.0", features = ["macros", "rt-multi-thread"] } - -[[bin]] -name = "rest-ratelimiter" -path = "src/main.rs" - -[dev-dependencies] -tonic-build = "0.5" - -[package.metadata.raze] -workspace_path = "//ratelimiter/cargo" -genmode = "Remote" -default_gen_buildrs = true -package_aliases_dir = "cargo" +[package]
+name = "rest-ratelimiter"
+version = "0.1.0"
+edition = "2018"
+
+[dependencies]
+tonic = "0.5"
+prost = "0.8"
+tokio = { version = "1", features = ["full"] }
+
+[[bin]]
+name = "rest-ratelimiter"
+path = "src/main.rs"
+
+[build-dependencies]
+tonic-build = { version = "0.5", features = ["transport", "prost"], default-features = false }
+
+[dev-dependencies]
+tonic-build = { version = "0.5", features = ["transport", "prost"], default-features = false }
+
diff --git a/ratelimiter/README.md b/ratelimiter/README.md index fcc86f2..a6e400e 100644 --- a/ratelimiter/README.md +++ b/ratelimiter/README.md @@ -1,5 +1,5 @@ -# Ratelimiter - -This is an implementation of the ratelimiting service described in the `proto/nova.ratelimit.v1.proto`. -The library is divied in two part, a Rust library, built as a static library, and a rust executable that implements +# Ratelimiter
+
+This is an implementation of the ratelimiting service described in the `proto/nova.ratelimit.v1.proto`.
+The library is divied in two part, a Rust library, built as a static library, and a rust executable that implements
the rate limiting algorithm. A FFI interface is exposed by the Rust static library for use in the nova-lite component.
\ No newline at end of file diff --git a/ratelimiter/build.rs b/ratelimiter/build.rs index a1cee90..e0a62ca 100644 --- a/ratelimiter/build.rs +++ b/ratelimiter/build.rs @@ -1,4 +1,4 @@ -fn main() -> Result<(), Box<dyn std::error::Error>> { - tonic_build::compile_protos("proto/nova.ratelimit.v1.proto").unwrap(); - Ok(()) +fn main() -> Result<(), Box<dyn std::error::Error>> {
+ tonic_build::compile_protos("proto/nova.ratelimit.v1.proto").unwrap();
+ Ok(())
}
\ No newline at end of file diff --git a/ratelimiter/cargo/BUILD.bazel b/ratelimiter/cargo/BUILD.bazel index 8ee6ef6..ab46977 100644 --- a/ratelimiter/cargo/BUILD.bazel +++ b/ratelimiter/cargo/BUILD.bazel @@ -23,7 +23,7 @@ alias( alias( name = "tokio", - actual = "@raze__tokio__1_9_0//:tokio", + actual = "@raze__tokio__1_11_0//:tokio", tags = [ "cargo-raze", "manual", @@ -32,7 +32,7 @@ alias( alias( name = "tonic", - actual = "@raze__tonic__0_5_0//:tonic", + actual = "@raze__tonic__0_5_2//:tonic", tags = [ "cargo-raze", "manual", @@ -41,17 +41,9 @@ alias( alias( name = "tonic_build", - actual = "@raze__tonic_build__0_5_1//:tonic_build", + actual = "@raze__tonic_build__0_5_2//:tonic_build", tags = [ "cargo-raze", "manual", ], ) - -# Export file for Stardoc support -exports_files( - [ - "crates.bzl", - ], - visibility = ["//visibility:public"], -) diff --git a/ratelimiter/cargo/Cargo.raze.lock b/ratelimiter/cargo/Cargo.raze.lock deleted file mode 100644 index a9162d7..0000000 --- a/ratelimiter/cargo/Cargo.raze.lock +++ /dev/null @@ -1,830 +0,0 @@ -# This file is automatically @generated by Cargo. -# It is not intended for manual editing. -[[package]] -name = "anyhow" -version = "1.0.42" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "595d3cfa7a60d4555cb5067b99f07142a08ea778de5cf993f7b75c7d8fabc486" - -[[package]] -name = "async-stream" -version = "0.3.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "171374e7e3b2504e0e5236e3b59260560f9fe94bfe9ac39ba5e4e929c5590625" -dependencies = [ - "async-stream-impl", - "futures-core", -] - -[[package]] -name = "async-stream-impl" -version = "0.3.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "648ed8c8d2ce5409ccd57453d9d1b214b342a0d69376a6feda1fd6cae3299308" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "async-trait" -version = "0.1.51" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "44318e776df68115a881de9a8fd1b9e53368d7a4a5ce4cc48517da3393233a5e" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "autocfg" -version = "1.0.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cdb031dd78e28731d87d56cc8ffef4a8f36ca26c38fe2de700543e627f8a464a" - -[[package]] -name = "base64" -version = "0.13.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "904dfeac50f3cdaba28fc6f57fdcddb75f49ed61346676a78c4ffe55877802fd" - -[[package]] -name = "bitflags" -version = "1.2.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693" - -[[package]] -name = "bytes" -version = "1.0.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b700ce4376041dcd0a327fd0097c41095743c4c8af8887265942faf1100bd040" - -[[package]] -name = "cfg-if" -version = "1.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd" - -[[package]] -name = "either" -version = "1.6.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e78d4f1cc4ae33bbfc157ed5d5a5ef3bc29227303d595861deb238fcec4e9457" - -[[package]] -name = "fixedbitset" -version = "0.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "37ab347416e802de484e4d03c7316c48f1ecb56574dfd4a46a80f173ce1de04d" - -[[package]] -name = "fnv" -version = "1.0.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1" - -[[package]] -name = "futures-channel" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "74ed2411805f6e4e3d9bc904c95d5d423b89b3b25dc0250aa74729de20629ff9" -dependencies = [ - "futures-core", -] - -[[package]] -name = "futures-core" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "af51b1b4a7fdff033703db39de8802c673eb91855f2e0d47dcf3bf2c0ef01f99" - -[[package]] -name = "futures-sink" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c0f30aaa67363d119812743aa5f33c201a7a66329f97d1a887022971feea4b53" - -[[package]] -name = "futures-task" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bbe54a98670017f3be909561f6ad13e810d9a51f3f061b902062ca3da80799f2" - -[[package]] -name = "futures-util" -version = "0.3.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "67eb846bfd58e44a8481a00049e82c43e0ccb5d61f8dc071057cb19249dd4d78" -dependencies = [ - "autocfg", - "futures-core", - "futures-task", - "pin-project-lite", - "pin-utils", -] - -[[package]] -name = "getrandom" -version = "0.2.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7fcd999463524c52659517fe2cea98493cfe485d10565e7b0fb07dbba7ad2753" -dependencies = [ - "cfg-if", - "libc", - "wasi", -] - -[[package]] -name = "h2" -version = "0.3.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "825343c4eef0b63f541f8903f395dc5beb362a979b5799a84062527ef1e37726" -dependencies = [ - "bytes", - "fnv", - "futures-core", - "futures-sink", - "futures-util", - "http", - "indexmap", - "slab", - "tokio", - "tokio-util", - "tracing", -] - -[[package]] -name = "hashbrown" -version = "0.11.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ab5ef0d4909ef3724cc8cce6ccc8572c5c817592e9285f5464f8e86f8bd3726e" - -[[package]] -name = "heck" -version = "0.3.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6d621efb26863f0e9924c6ac577e8275e5e6b77455db64ffa6c65c904e9e132c" -dependencies = [ - "unicode-segmentation", -] - -[[package]] -name = "hermit-abi" -version = "0.1.19" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "62b467343b94ba476dcb2500d242dadbb39557df889310ac77c5d99100aaac33" -dependencies = [ - "libc", -] - -[[package]] -name = "http" -version = "0.2.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "527e8c9ac747e28542699a951517aa9a6945af506cd1f2e1b53a576c17b6cc11" -dependencies = [ - "bytes", - "fnv", - "itoa", -] - -[[package]] -name = "http-body" -version = "0.4.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "60daa14be0e0786db0f03a9e57cb404c9d756eed2b6c62b9ea98ec5743ec75a9" -dependencies = [ - "bytes", - "http", - "pin-project-lite", -] - -[[package]] -name = "httparse" -version = "1.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f3a87b616e37e93c22fb19bcd386f02f3af5ea98a25670ad0fce773de23c5e68" - -[[package]] -name = "httpdate" -version = "1.0.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6456b8a6c8f33fee7d958fcd1b60d55b11940a79e63ae87013e6d22e26034440" - -[[package]] -name = "hyper" -version = "0.14.11" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0b61cf2d1aebcf6e6352c97b81dc2244ca29194be1b276f5d8ad5c6330fffb11" -dependencies = [ - "bytes", - "futures-channel", - "futures-core", - "futures-util", - "h2", - "http", - "http-body", - "httparse", - "httpdate", - "itoa", - "pin-project-lite", - "socket2", - "tokio", - "tower-service", - "tracing", - "want", -] - -[[package]] -name = "hyper-timeout" -version = "0.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bbb958482e8c7be4bc3cf272a766a2b0bf1a6755e7a6ae777f017a31d11b13b1" -dependencies = [ - "hyper", - "pin-project-lite", - "tokio", - "tokio-io-timeout", -] - -[[package]] -name = "indexmap" -version = "1.7.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bc633605454125dec4b66843673f01c7df2b89479b32e0ed634e43a91cff62a5" -dependencies = [ - "autocfg", - "hashbrown", -] - -[[package]] -name = "itertools" -version = "0.10.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "69ddb889f9d0d08a67338271fa9b62996bc788c7796a5c18cf057420aaed5eaf" -dependencies = [ - "either", -] - -[[package]] -name = "itoa" -version = "0.4.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dd25036021b0de88a0aff6b850051563c6516d0bf53f8638938edbb9de732736" - -[[package]] -name = "lazy_static" -version = "1.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" - -[[package]] -name = "libc" -version = "0.2.98" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "320cfe77175da3a483efed4bc0adc1968ca050b098ce4f2f1c13a56626128790" - -[[package]] -name = "log" -version = "0.4.14" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710" -dependencies = [ - "cfg-if", -] - -[[package]] -name = "memchr" -version = "2.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b16bd47d9e329435e309c58469fe0791c2d0d1ba96ec0954152a5ae2b04387dc" - -[[package]] -name = "mio" -version = "0.7.13" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8c2bdb6314ec10835cd3293dd268473a835c02b7b352e788be788b3c6ca6bb16" -dependencies = [ - "libc", - "log", - "miow", - "ntapi", - "winapi", -] - -[[package]] -name = "miow" -version = "0.3.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b9f1c5b025cda876f66ef43a113f91ebc9f4ccef34843000e0adf6ebbab84e21" -dependencies = [ - "winapi", -] - -[[package]] -name = "multimap" -version = "0.8.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e5ce46fe64a9d73be07dcbe690a38ce1b293be448fd8ce1e6c1b8062c9f72c6a" - -[[package]] -name = "ntapi" -version = "0.3.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3f6bb902e437b6d86e03cce10a7e2af662292c5dfef23b65899ea3ac9354ad44" -dependencies = [ - "winapi", -] - -[[package]] -name = "num_cpus" -version = "1.13.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "05499f3756671c15885fee9034446956fff3f243d6077b91e5767df161f766b3" -dependencies = [ - "hermit-abi", - "libc", -] - -[[package]] -name = "percent-encoding" -version = "2.1.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d4fd5641d01c8f18a23da7b6fe29298ff4b55afcccdf78973b24cf3175fee32e" - -[[package]] -name = "petgraph" -version = "0.5.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "467d164a6de56270bd7c4d070df81d07beace25012d5103ced4e9ff08d6afdb7" -dependencies = [ - "fixedbitset", - "indexmap", -] - -[[package]] -name = "pin-project" -version = "1.0.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "576bc800220cc65dac09e99e97b08b358cfab6e17078de8dc5fee223bd2d0c08" -dependencies = [ - "pin-project-internal", -] - -[[package]] -name = "pin-project-internal" -version = "1.0.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6e8fe8163d14ce7f0cdac2e040116f22eac817edabff0be91e8aff7e9accf389" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "pin-project-lite" -version = "0.2.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8d31d11c69a6b52a174b42bdc0c30e5e11670f90788b2c471c31c1d17d449443" - -[[package]] -name = "pin-utils" -version = "0.1.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" - -[[package]] -name = "ppv-lite86" -version = "0.2.10" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ac74c624d6b2d21f425f752262f42188365d7b8ff1aff74c82e45136510a4857" - -[[package]] -name = "proc-macro2" -version = "1.0.28" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5c7ed8b8c7b886ea3ed7dde405212185f423ab44682667c8c6dd14aa1d9f6612" -dependencies = [ - "unicode-xid", -] - -[[package]] -name = "prost" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "de5e2533f59d08fcf364fd374ebda0692a70bd6d7e66ef97f306f45c6c5d8020" -dependencies = [ - "bytes", - "prost-derive", -] - -[[package]] -name = "prost-build" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "355f634b43cdd80724ee7848f95770e7e70eefa6dcf14fea676216573b8fd603" -dependencies = [ - "bytes", - "heck", - "itertools", - "log", - "multimap", - "petgraph", - "prost", - "prost-types", - "tempfile", - "which", -] - -[[package]] -name = "prost-derive" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "600d2f334aa05acb02a755e217ef1ab6dea4d51b58b7846588b747edec04efba" -dependencies = [ - "anyhow", - "itertools", - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "prost-types" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "603bbd6394701d13f3f25aada59c7de9d35a6a5887cfc156181234a44002771b" -dependencies = [ - "bytes", - "prost", -] - -[[package]] -name = "quote" -version = "1.0.9" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c3d0b9745dc2debf507c8422de05d7226cc1f0644216dfdfead988f9b1ab32a7" -dependencies = [ - "proc-macro2", -] - -[[package]] -name = "rand" -version = "0.8.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2e7573632e6454cf6b99d7aac4ccca54be06da05aca2ef7423d22d27d4d4bcd8" -dependencies = [ - "libc", - "rand_chacha", - "rand_core", - "rand_hc", -] - -[[package]] -name = "rand_chacha" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88" -dependencies = [ - "ppv-lite86", - "rand_core", -] - -[[package]] -name = "rand_core" -version = "0.6.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d34f1408f55294453790c48b2f1ebbb1c5b4b7563eb1f418bcfcfdbb06ebb4e7" -dependencies = [ - "getrandom", -] - -[[package]] -name = "rand_hc" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d51e9f596de227fda2ea6c84607f5558e196eeaf43c986b724ba4fb8fdf497e7" -dependencies = [ - "rand_core", -] - -[[package]] -name = "redox_syscall" -version = "0.2.10" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8383f39639269cde97d255a32bdb68c047337295414940c68bdd30c2e13203ff" -dependencies = [ - "bitflags", -] - -[[package]] -name = "remove_dir_all" -version = "0.5.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3acd125665422973a33ac9d3dd2df85edad0f4ae9b00dafb1a05e43a9f5ef8e7" -dependencies = [ - "winapi", -] - -[[package]] -name = "rest-ratelimiter" -version = "0.1.0" -dependencies = [ - "prost", - "tokio", - "tonic", - "tonic-build", -] - -[[package]] -name = "slab" -version = "0.4.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c307a32c1c5c437f38c7fd45d753050587732ba8628319fbdf12a7e289ccc590" - -[[package]] -name = "socket2" -version = "0.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "765f090f0e423d2b55843402a07915add955e7d60657db13707a159727326cad" -dependencies = [ - "libc", - "winapi", -] - -[[package]] -name = "syn" -version = "1.0.74" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1873d832550d4588c3dbc20f01361ab00bfe741048f71e3fecf145a7cc18b29c" -dependencies = [ - "proc-macro2", - "quote", - "unicode-xid", -] - -[[package]] -name = "tempfile" -version = "3.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dac1c663cfc93810f88aed9b8941d48cabf856a1b111c29a40439018d870eb22" -dependencies = [ - "cfg-if", - "libc", - "rand", - "redox_syscall", - "remove_dir_all", - "winapi", -] - -[[package]] -name = "tokio" -version = "1.9.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4b7b349f11a7047e6d1276853e612d152f5e8a352c61917887cc2169e2366b4c" -dependencies = [ - "autocfg", - "bytes", - "libc", - "memchr", - "mio", - "num_cpus", - "pin-project-lite", - "tokio-macros", - "winapi", -] - -[[package]] -name = "tokio-io-timeout" -version = "1.1.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "90c49f106be240de154571dd31fbe48acb10ba6c6dd6f6517ad603abffa42de9" -dependencies = [ - "pin-project-lite", - "tokio", -] - -[[package]] -name = "tokio-macros" -version = "1.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "54473be61f4ebe4efd09cec9bd5d16fa51d70ea0192213d754d2d500457db110" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "tokio-stream" -version = "0.1.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7b2f3f698253f03119ac0102beaa64f67a67e08074d03a22d18784104543727f" -dependencies = [ - "futures-core", - "pin-project-lite", - "tokio", -] - -[[package]] -name = "tokio-util" -version = "0.6.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1caa0b0c8d94a049db56b5acf8cba99dc0623aab1b26d5b5f5e2d945846b3592" -dependencies = [ - "bytes", - "futures-core", - "futures-sink", - "log", - "pin-project-lite", - "tokio", -] - -[[package]] -name = "tonic" -version = "0.5.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b584f064fdfc50017ec39162d5aebce49912f1eb16fd128e04b7f4ce4907c7e5" -dependencies = [ - "async-stream", - "async-trait", - "base64", - "bytes", - "futures-core", - "futures-util", - "h2", - "http", - "http-body", - "hyper", - "hyper-timeout", - "percent-encoding", - "pin-project", - "prost", - "prost-derive", - "tokio", - "tokio-stream", - "tokio-util", - "tower", - "tower-layer", - "tower-service", - "tracing", - "tracing-futures", -] - -[[package]] -name = "tonic-build" -version = "0.5.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d12faebbe071b06f486be82cc9318350814fdd07fcb28f3690840cd770599283" -dependencies = [ - "proc-macro2", - "prost-build", - "quote", - "syn", -] - -[[package]] -name = "tower" -version = "0.4.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f60422bc7fefa2f3ec70359b8ff1caff59d785877eb70595904605bcc412470f" -dependencies = [ - "futures-core", - "futures-util", - "indexmap", - "pin-project", - "rand", - "slab", - "tokio", - "tokio-stream", - "tokio-util", - "tower-layer", - "tower-service", - "tracing", -] - -[[package]] -name = "tower-layer" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "343bc9466d3fe6b0f960ef45960509f84480bf4fd96f92901afe7ff3df9d3a62" - -[[package]] -name = "tower-service" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "360dfd1d6d30e05fda32ace2c8c70e9c0a9da713275777f5a4dbb8a1893930c6" - -[[package]] -name = "tracing" -version = "0.1.26" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "09adeb8c97449311ccd28a427f96fb563e7fd31aabf994189879d9da2394b89d" -dependencies = [ - "cfg-if", - "log", - "pin-project-lite", - "tracing-attributes", - "tracing-core", -] - -[[package]] -name = "tracing-attributes" -version = "0.1.15" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c42e6fa53307c8a17e4ccd4dc81cf5ec38db9209f59b222210375b54ee40d1e2" -dependencies = [ - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "tracing-core" -version = "0.1.18" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a9ff14f98b1a4b289c6248a023c1c2fa1491062964e9fed67ab29c4e4da4a052" -dependencies = [ - "lazy_static", -] - -[[package]] -name = "tracing-futures" -version = "0.2.5" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "97d095ae15e245a057c8e8451bab9b3ee1e1f68e9ba2b4fbc18d0ac5237835f2" -dependencies = [ - "pin-project", - "tracing", -] - -[[package]] -name = "try-lock" -version = "0.2.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "59547bce71d9c38b83d9c0e92b6066c4253371f15005def0c30d9657f50c7642" - -[[package]] -name = "unicode-segmentation" -version = "1.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8895849a949e7845e06bd6dc1aa51731a103c42707010a5b591c0038fb73385b" - -[[package]] -name = "unicode-xid" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8ccb82d61f80a663efe1f787a51b16b5a51e3314d6ac365b08639f52387b33f3" - -[[package]] -name = "want" -version = "0.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0" -dependencies = [ - "log", - "try-lock", -] - -[[package]] -name = "wasi" -version = "0.10.2+wasi-snapshot-preview1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fd6fbd9a79829dd1ad0cc20627bf1ed606756a7f77edff7b66b7064f9cb327c6" - -[[package]] -name = "which" -version = "4.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ea187a8ef279bc014ec368c27a920da2024d2a711109bfbe3440585d5cf27ad9" -dependencies = [ - "either", - "lazy_static", - "libc", -] - -[[package]] -name = "winapi" -version = "0.3.9" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419" -dependencies = [ - "winapi-i686-pc-windows-gnu", - "winapi-x86_64-pc-windows-gnu", -] - -[[package]] -name = "winapi-i686-pc-windows-gnu" -version = "0.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" - -[[package]] -name = "winapi-x86_64-pc-windows-gnu" -version = "0.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" diff --git a/ratelimiter/cargo/crates.bzl b/ratelimiter/cargo/crates.bzl deleted file mode 100644 index 39d19c1..0000000 --- a/ratelimiter/cargo/crates.bzl +++ /dev/null @@ -1,872 +0,0 @@ -""" -@generated -cargo-raze generated Bazel file. - -DO NOT EDIT! Replaced on runs of cargo-raze -""" - -load("@bazel_tools//tools/build_defs/repo:git.bzl", "new_git_repository") # buildifier: disable=load -load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive") # buildifier: disable=load -load("@bazel_tools//tools/build_defs/repo:utils.bzl", "maybe") # buildifier: disable=load - -def raze_fetch_remote_crates(): - """This function defines a collection of repos and should be called in a WORKSPACE file""" - maybe( - http_archive, - name = "raze__anyhow__1_0_42", - url = "https://crates.io/api/v1/crates/anyhow/1.0.42/download", - type = "tar.gz", - sha256 = "595d3cfa7a60d4555cb5067b99f07142a08ea778de5cf993f7b75c7d8fabc486", - strip_prefix = "anyhow-1.0.42", - build_file = Label("//ratelimiter/cargo/remote:BUILD.anyhow-1.0.42.bazel"), - ) - - maybe( - http_archive, - name = "raze__async_stream__0_3_2", - url = "https://crates.io/api/v1/crates/async-stream/0.3.2/download", - type = "tar.gz", - sha256 = "171374e7e3b2504e0e5236e3b59260560f9fe94bfe9ac39ba5e4e929c5590625", - strip_prefix = "async-stream-0.3.2", - build_file = Label("//ratelimiter/cargo/remote:BUILD.async-stream-0.3.2.bazel"), - ) - - maybe( - http_archive, - name = "raze__async_stream_impl__0_3_2", - url = "https://crates.io/api/v1/crates/async-stream-impl/0.3.2/download", - type = "tar.gz", - sha256 = "648ed8c8d2ce5409ccd57453d9d1b214b342a0d69376a6feda1fd6cae3299308", - strip_prefix = "async-stream-impl-0.3.2", - build_file = Label("//ratelimiter/cargo/remote:BUILD.async-stream-impl-0.3.2.bazel"), - ) - - maybe( - http_archive, - name = "raze__async_trait__0_1_51", - url = "https://crates.io/api/v1/crates/async-trait/0.1.51/download", - type = "tar.gz", - sha256 = "44318e776df68115a881de9a8fd1b9e53368d7a4a5ce4cc48517da3393233a5e", - strip_prefix = "async-trait-0.1.51", - build_file = Label("//ratelimiter/cargo/remote:BUILD.async-trait-0.1.51.bazel"), - ) - - maybe( - http_archive, - name = "raze__autocfg__1_0_1", - url = "https://crates.io/api/v1/crates/autocfg/1.0.1/download", - type = "tar.gz", - sha256 = "cdb031dd78e28731d87d56cc8ffef4a8f36ca26c38fe2de700543e627f8a464a", - strip_prefix = "autocfg-1.0.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.autocfg-1.0.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__base64__0_13_0", - url = "https://crates.io/api/v1/crates/base64/0.13.0/download", - type = "tar.gz", - sha256 = "904dfeac50f3cdaba28fc6f57fdcddb75f49ed61346676a78c4ffe55877802fd", - strip_prefix = "base64-0.13.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.base64-0.13.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__bitflags__1_2_1", - url = "https://crates.io/api/v1/crates/bitflags/1.2.1/download", - type = "tar.gz", - sha256 = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693", - strip_prefix = "bitflags-1.2.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.bitflags-1.2.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__bytes__1_0_1", - url = "https://crates.io/api/v1/crates/bytes/1.0.1/download", - type = "tar.gz", - sha256 = "b700ce4376041dcd0a327fd0097c41095743c4c8af8887265942faf1100bd040", - strip_prefix = "bytes-1.0.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.bytes-1.0.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__cfg_if__1_0_0", - url = "https://crates.io/api/v1/crates/cfg-if/1.0.0/download", - type = "tar.gz", - sha256 = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd", - strip_prefix = "cfg-if-1.0.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.cfg-if-1.0.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__either__1_6_1", - url = "https://crates.io/api/v1/crates/either/1.6.1/download", - type = "tar.gz", - sha256 = "e78d4f1cc4ae33bbfc157ed5d5a5ef3bc29227303d595861deb238fcec4e9457", - strip_prefix = "either-1.6.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.either-1.6.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__fixedbitset__0_2_0", - url = "https://crates.io/api/v1/crates/fixedbitset/0.2.0/download", - type = "tar.gz", - sha256 = "37ab347416e802de484e4d03c7316c48f1ecb56574dfd4a46a80f173ce1de04d", - strip_prefix = "fixedbitset-0.2.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.fixedbitset-0.2.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__fnv__1_0_7", - url = "https://crates.io/api/v1/crates/fnv/1.0.7/download", - type = "tar.gz", - sha256 = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1", - strip_prefix = "fnv-1.0.7", - build_file = Label("//ratelimiter/cargo/remote:BUILD.fnv-1.0.7.bazel"), - ) - - maybe( - http_archive, - name = "raze__futures_channel__0_3_16", - url = "https://crates.io/api/v1/crates/futures-channel/0.3.16/download", - type = "tar.gz", - sha256 = "74ed2411805f6e4e3d9bc904c95d5d423b89b3b25dc0250aa74729de20629ff9", - strip_prefix = "futures-channel-0.3.16", - build_file = Label("//ratelimiter/cargo/remote:BUILD.futures-channel-0.3.16.bazel"), - ) - - maybe( - http_archive, - name = "raze__futures_core__0_3_16", - url = "https://crates.io/api/v1/crates/futures-core/0.3.16/download", - type = "tar.gz", - sha256 = "af51b1b4a7fdff033703db39de8802c673eb91855f2e0d47dcf3bf2c0ef01f99", - strip_prefix = "futures-core-0.3.16", - build_file = Label("//ratelimiter/cargo/remote:BUILD.futures-core-0.3.16.bazel"), - ) - - maybe( - http_archive, - name = "raze__futures_sink__0_3_16", - url = "https://crates.io/api/v1/crates/futures-sink/0.3.16/download", - type = "tar.gz", - sha256 = "c0f30aaa67363d119812743aa5f33c201a7a66329f97d1a887022971feea4b53", - strip_prefix = "futures-sink-0.3.16", - build_file = Label("//ratelimiter/cargo/remote:BUILD.futures-sink-0.3.16.bazel"), - ) - - maybe( - http_archive, - name = "raze__futures_task__0_3_16", - url = "https://crates.io/api/v1/crates/futures-task/0.3.16/download", - type = "tar.gz", - sha256 = "bbe54a98670017f3be909561f6ad13e810d9a51f3f061b902062ca3da80799f2", - strip_prefix = "futures-task-0.3.16", - build_file = Label("//ratelimiter/cargo/remote:BUILD.futures-task-0.3.16.bazel"), - ) - - maybe( - http_archive, - name = "raze__futures_util__0_3_16", - url = "https://crates.io/api/v1/crates/futures-util/0.3.16/download", - type = "tar.gz", - sha256 = "67eb846bfd58e44a8481a00049e82c43e0ccb5d61f8dc071057cb19249dd4d78", - strip_prefix = "futures-util-0.3.16", - build_file = Label("//ratelimiter/cargo/remote:BUILD.futures-util-0.3.16.bazel"), - ) - - maybe( - http_archive, - name = "raze__getrandom__0_2_3", - url = "https://crates.io/api/v1/crates/getrandom/0.2.3/download", - type = "tar.gz", - sha256 = "7fcd999463524c52659517fe2cea98493cfe485d10565e7b0fb07dbba7ad2753", - strip_prefix = "getrandom-0.2.3", - build_file = Label("//ratelimiter/cargo/remote:BUILD.getrandom-0.2.3.bazel"), - ) - - maybe( - http_archive, - name = "raze__h2__0_3_3", - url = "https://crates.io/api/v1/crates/h2/0.3.3/download", - type = "tar.gz", - sha256 = "825343c4eef0b63f541f8903f395dc5beb362a979b5799a84062527ef1e37726", - strip_prefix = "h2-0.3.3", - build_file = Label("//ratelimiter/cargo/remote:BUILD.h2-0.3.3.bazel"), - ) - - maybe( - http_archive, - name = "raze__hashbrown__0_11_2", - url = "https://crates.io/api/v1/crates/hashbrown/0.11.2/download", - type = "tar.gz", - sha256 = "ab5ef0d4909ef3724cc8cce6ccc8572c5c817592e9285f5464f8e86f8bd3726e", - strip_prefix = "hashbrown-0.11.2", - build_file = Label("//ratelimiter/cargo/remote:BUILD.hashbrown-0.11.2.bazel"), - ) - - maybe( - http_archive, - name = "raze__heck__0_3_3", - url = "https://crates.io/api/v1/crates/heck/0.3.3/download", - type = "tar.gz", - sha256 = "6d621efb26863f0e9924c6ac577e8275e5e6b77455db64ffa6c65c904e9e132c", - strip_prefix = "heck-0.3.3", - build_file = Label("//ratelimiter/cargo/remote:BUILD.heck-0.3.3.bazel"), - ) - - maybe( - http_archive, - name = "raze__hermit_abi__0_1_19", - url = "https://crates.io/api/v1/crates/hermit-abi/0.1.19/download", - type = "tar.gz", - sha256 = "62b467343b94ba476dcb2500d242dadbb39557df889310ac77c5d99100aaac33", - strip_prefix = "hermit-abi-0.1.19", - build_file = Label("//ratelimiter/cargo/remote:BUILD.hermit-abi-0.1.19.bazel"), - ) - - maybe( - http_archive, - name = "raze__http__0_2_4", - url = "https://crates.io/api/v1/crates/http/0.2.4/download", - type = "tar.gz", - sha256 = "527e8c9ac747e28542699a951517aa9a6945af506cd1f2e1b53a576c17b6cc11", - strip_prefix = "http-0.2.4", - build_file = Label("//ratelimiter/cargo/remote:BUILD.http-0.2.4.bazel"), - ) - - maybe( - http_archive, - name = "raze__http_body__0_4_2", - url = "https://crates.io/api/v1/crates/http-body/0.4.2/download", - type = "tar.gz", - sha256 = "60daa14be0e0786db0f03a9e57cb404c9d756eed2b6c62b9ea98ec5743ec75a9", - strip_prefix = "http-body-0.4.2", - build_file = Label("//ratelimiter/cargo/remote:BUILD.http-body-0.4.2.bazel"), - ) - - maybe( - http_archive, - name = "raze__httparse__1_4_1", - url = "https://crates.io/api/v1/crates/httparse/1.4.1/download", - type = "tar.gz", - sha256 = "f3a87b616e37e93c22fb19bcd386f02f3af5ea98a25670ad0fce773de23c5e68", - strip_prefix = "httparse-1.4.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.httparse-1.4.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__httpdate__1_0_1", - url = "https://crates.io/api/v1/crates/httpdate/1.0.1/download", - type = "tar.gz", - sha256 = "6456b8a6c8f33fee7d958fcd1b60d55b11940a79e63ae87013e6d22e26034440", - strip_prefix = "httpdate-1.0.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.httpdate-1.0.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__hyper__0_14_11", - url = "https://crates.io/api/v1/crates/hyper/0.14.11/download", - type = "tar.gz", - sha256 = "0b61cf2d1aebcf6e6352c97b81dc2244ca29194be1b276f5d8ad5c6330fffb11", - strip_prefix = "hyper-0.14.11", - build_file = Label("//ratelimiter/cargo/remote:BUILD.hyper-0.14.11.bazel"), - ) - - maybe( - http_archive, - name = "raze__hyper_timeout__0_4_1", - url = "https://crates.io/api/v1/crates/hyper-timeout/0.4.1/download", - type = "tar.gz", - sha256 = "bbb958482e8c7be4bc3cf272a766a2b0bf1a6755e7a6ae777f017a31d11b13b1", - strip_prefix = "hyper-timeout-0.4.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.hyper-timeout-0.4.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__indexmap__1_7_0", - url = "https://crates.io/api/v1/crates/indexmap/1.7.0/download", - type = "tar.gz", - sha256 = "bc633605454125dec4b66843673f01c7df2b89479b32e0ed634e43a91cff62a5", - strip_prefix = "indexmap-1.7.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.indexmap-1.7.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__itertools__0_10_1", - url = "https://crates.io/api/v1/crates/itertools/0.10.1/download", - type = "tar.gz", - sha256 = "69ddb889f9d0d08a67338271fa9b62996bc788c7796a5c18cf057420aaed5eaf", - strip_prefix = "itertools-0.10.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.itertools-0.10.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__itoa__0_4_7", - url = "https://crates.io/api/v1/crates/itoa/0.4.7/download", - type = "tar.gz", - sha256 = "dd25036021b0de88a0aff6b850051563c6516d0bf53f8638938edbb9de732736", - strip_prefix = "itoa-0.4.7", - build_file = Label("//ratelimiter/cargo/remote:BUILD.itoa-0.4.7.bazel"), - ) - - maybe( - http_archive, - name = "raze__lazy_static__1_4_0", - url = "https://crates.io/api/v1/crates/lazy_static/1.4.0/download", - type = "tar.gz", - sha256 = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646", - strip_prefix = "lazy_static-1.4.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.lazy_static-1.4.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__libc__0_2_98", - url = "https://crates.io/api/v1/crates/libc/0.2.98/download", - type = "tar.gz", - sha256 = "320cfe77175da3a483efed4bc0adc1968ca050b098ce4f2f1c13a56626128790", - strip_prefix = "libc-0.2.98", - build_file = Label("//ratelimiter/cargo/remote:BUILD.libc-0.2.98.bazel"), - ) - - maybe( - http_archive, - name = "raze__log__0_4_14", - url = "https://crates.io/api/v1/crates/log/0.4.14/download", - type = "tar.gz", - sha256 = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710", - strip_prefix = "log-0.4.14", - build_file = Label("//ratelimiter/cargo/remote:BUILD.log-0.4.14.bazel"), - ) - - maybe( - http_archive, - name = "raze__memchr__2_4_0", - url = "https://crates.io/api/v1/crates/memchr/2.4.0/download", - type = "tar.gz", - sha256 = "b16bd47d9e329435e309c58469fe0791c2d0d1ba96ec0954152a5ae2b04387dc", - strip_prefix = "memchr-2.4.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.memchr-2.4.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__mio__0_7_13", - url = "https://crates.io/api/v1/crates/mio/0.7.13/download", - type = "tar.gz", - sha256 = "8c2bdb6314ec10835cd3293dd268473a835c02b7b352e788be788b3c6ca6bb16", - strip_prefix = "mio-0.7.13", - build_file = Label("//ratelimiter/cargo/remote:BUILD.mio-0.7.13.bazel"), - ) - - maybe( - http_archive, - name = "raze__miow__0_3_7", - url = "https://crates.io/api/v1/crates/miow/0.3.7/download", - type = "tar.gz", - sha256 = "b9f1c5b025cda876f66ef43a113f91ebc9f4ccef34843000e0adf6ebbab84e21", - strip_prefix = "miow-0.3.7", - build_file = Label("//ratelimiter/cargo/remote:BUILD.miow-0.3.7.bazel"), - ) - - maybe( - http_archive, - name = "raze__multimap__0_8_3", - url = "https://crates.io/api/v1/crates/multimap/0.8.3/download", - type = "tar.gz", - sha256 = "e5ce46fe64a9d73be07dcbe690a38ce1b293be448fd8ce1e6c1b8062c9f72c6a", - strip_prefix = "multimap-0.8.3", - build_file = Label("//ratelimiter/cargo/remote:BUILD.multimap-0.8.3.bazel"), - ) - - maybe( - http_archive, - name = "raze__ntapi__0_3_6", - url = "https://crates.io/api/v1/crates/ntapi/0.3.6/download", - type = "tar.gz", - sha256 = "3f6bb902e437b6d86e03cce10a7e2af662292c5dfef23b65899ea3ac9354ad44", - strip_prefix = "ntapi-0.3.6", - build_file = Label("//ratelimiter/cargo/remote:BUILD.ntapi-0.3.6.bazel"), - ) - - maybe( - http_archive, - name = "raze__num_cpus__1_13_0", - url = "https://crates.io/api/v1/crates/num_cpus/1.13.0/download", - type = "tar.gz", - sha256 = "05499f3756671c15885fee9034446956fff3f243d6077b91e5767df161f766b3", - strip_prefix = "num_cpus-1.13.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.num_cpus-1.13.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__percent_encoding__2_1_0", - url = "https://crates.io/api/v1/crates/percent-encoding/2.1.0/download", - type = "tar.gz", - sha256 = "d4fd5641d01c8f18a23da7b6fe29298ff4b55afcccdf78973b24cf3175fee32e", - strip_prefix = "percent-encoding-2.1.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.percent-encoding-2.1.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__petgraph__0_5_1", - url = "https://crates.io/api/v1/crates/petgraph/0.5.1/download", - type = "tar.gz", - sha256 = "467d164a6de56270bd7c4d070df81d07beace25012d5103ced4e9ff08d6afdb7", - strip_prefix = "petgraph-0.5.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.petgraph-0.5.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__pin_project__1_0_8", - url = "https://crates.io/api/v1/crates/pin-project/1.0.8/download", - type = "tar.gz", - sha256 = "576bc800220cc65dac09e99e97b08b358cfab6e17078de8dc5fee223bd2d0c08", - strip_prefix = "pin-project-1.0.8", - build_file = Label("//ratelimiter/cargo/remote:BUILD.pin-project-1.0.8.bazel"), - ) - - maybe( - http_archive, - name = "raze__pin_project_internal__1_0_8", - url = "https://crates.io/api/v1/crates/pin-project-internal/1.0.8/download", - type = "tar.gz", - sha256 = "6e8fe8163d14ce7f0cdac2e040116f22eac817edabff0be91e8aff7e9accf389", - strip_prefix = "pin-project-internal-1.0.8", - build_file = Label("//ratelimiter/cargo/remote:BUILD.pin-project-internal-1.0.8.bazel"), - ) - - maybe( - http_archive, - name = "raze__pin_project_lite__0_2_7", - url = "https://crates.io/api/v1/crates/pin-project-lite/0.2.7/download", - type = "tar.gz", - sha256 = "8d31d11c69a6b52a174b42bdc0c30e5e11670f90788b2c471c31c1d17d449443", - strip_prefix = "pin-project-lite-0.2.7", - build_file = Label("//ratelimiter/cargo/remote:BUILD.pin-project-lite-0.2.7.bazel"), - ) - - maybe( - http_archive, - name = "raze__pin_utils__0_1_0", - url = "https://crates.io/api/v1/crates/pin-utils/0.1.0/download", - type = "tar.gz", - sha256 = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184", - strip_prefix = "pin-utils-0.1.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.pin-utils-0.1.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__ppv_lite86__0_2_10", - url = "https://crates.io/api/v1/crates/ppv-lite86/0.2.10/download", - type = "tar.gz", - sha256 = "ac74c624d6b2d21f425f752262f42188365d7b8ff1aff74c82e45136510a4857", - strip_prefix = "ppv-lite86-0.2.10", - build_file = Label("//ratelimiter/cargo/remote:BUILD.ppv-lite86-0.2.10.bazel"), - ) - - maybe( - http_archive, - name = "raze__proc_macro2__1_0_28", - url = "https://crates.io/api/v1/crates/proc-macro2/1.0.28/download", - type = "tar.gz", - sha256 = "5c7ed8b8c7b886ea3ed7dde405212185f423ab44682667c8c6dd14aa1d9f6612", - strip_prefix = "proc-macro2-1.0.28", - build_file = Label("//ratelimiter/cargo/remote:BUILD.proc-macro2-1.0.28.bazel"), - ) - - maybe( - http_archive, - name = "raze__prost__0_8_0", - url = "https://crates.io/api/v1/crates/prost/0.8.0/download", - type = "tar.gz", - sha256 = "de5e2533f59d08fcf364fd374ebda0692a70bd6d7e66ef97f306f45c6c5d8020", - strip_prefix = "prost-0.8.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.prost-0.8.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__prost_build__0_8_0", - url = "https://crates.io/api/v1/crates/prost-build/0.8.0/download", - type = "tar.gz", - sha256 = "355f634b43cdd80724ee7848f95770e7e70eefa6dcf14fea676216573b8fd603", - strip_prefix = "prost-build-0.8.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.prost-build-0.8.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__prost_derive__0_8_0", - url = "https://crates.io/api/v1/crates/prost-derive/0.8.0/download", - type = "tar.gz", - sha256 = "600d2f334aa05acb02a755e217ef1ab6dea4d51b58b7846588b747edec04efba", - strip_prefix = "prost-derive-0.8.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.prost-derive-0.8.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__prost_types__0_8_0", - url = "https://crates.io/api/v1/crates/prost-types/0.8.0/download", - type = "tar.gz", - sha256 = "603bbd6394701d13f3f25aada59c7de9d35a6a5887cfc156181234a44002771b", - strip_prefix = "prost-types-0.8.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.prost-types-0.8.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__quote__1_0_9", - url = "https://crates.io/api/v1/crates/quote/1.0.9/download", - type = "tar.gz", - sha256 = "c3d0b9745dc2debf507c8422de05d7226cc1f0644216dfdfead988f9b1ab32a7", - strip_prefix = "quote-1.0.9", - build_file = Label("//ratelimiter/cargo/remote:BUILD.quote-1.0.9.bazel"), - ) - - maybe( - http_archive, - name = "raze__rand__0_8_4", - url = "https://crates.io/api/v1/crates/rand/0.8.4/download", - type = "tar.gz", - sha256 = "2e7573632e6454cf6b99d7aac4ccca54be06da05aca2ef7423d22d27d4d4bcd8", - strip_prefix = "rand-0.8.4", - build_file = Label("//ratelimiter/cargo/remote:BUILD.rand-0.8.4.bazel"), - ) - - maybe( - http_archive, - name = "raze__rand_chacha__0_3_1", - url = "https://crates.io/api/v1/crates/rand_chacha/0.3.1/download", - type = "tar.gz", - sha256 = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88", - strip_prefix = "rand_chacha-0.3.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.rand_chacha-0.3.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__rand_core__0_6_3", - url = "https://crates.io/api/v1/crates/rand_core/0.6.3/download", - type = "tar.gz", - sha256 = "d34f1408f55294453790c48b2f1ebbb1c5b4b7563eb1f418bcfcfdbb06ebb4e7", - strip_prefix = "rand_core-0.6.3", - build_file = Label("//ratelimiter/cargo/remote:BUILD.rand_core-0.6.3.bazel"), - ) - - maybe( - http_archive, - name = "raze__rand_hc__0_3_1", - url = "https://crates.io/api/v1/crates/rand_hc/0.3.1/download", - type = "tar.gz", - sha256 = "d51e9f596de227fda2ea6c84607f5558e196eeaf43c986b724ba4fb8fdf497e7", - strip_prefix = "rand_hc-0.3.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.rand_hc-0.3.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__redox_syscall__0_2_10", - url = "https://crates.io/api/v1/crates/redox_syscall/0.2.10/download", - type = "tar.gz", - sha256 = "8383f39639269cde97d255a32bdb68c047337295414940c68bdd30c2e13203ff", - strip_prefix = "redox_syscall-0.2.10", - build_file = Label("//ratelimiter/cargo/remote:BUILD.redox_syscall-0.2.10.bazel"), - ) - - maybe( - http_archive, - name = "raze__remove_dir_all__0_5_3", - url = "https://crates.io/api/v1/crates/remove_dir_all/0.5.3/download", - type = "tar.gz", - sha256 = "3acd125665422973a33ac9d3dd2df85edad0f4ae9b00dafb1a05e43a9f5ef8e7", - strip_prefix = "remove_dir_all-0.5.3", - build_file = Label("//ratelimiter/cargo/remote:BUILD.remove_dir_all-0.5.3.bazel"), - ) - - maybe( - http_archive, - name = "raze__slab__0_4_4", - url = "https://crates.io/api/v1/crates/slab/0.4.4/download", - type = "tar.gz", - sha256 = "c307a32c1c5c437f38c7fd45d753050587732ba8628319fbdf12a7e289ccc590", - strip_prefix = "slab-0.4.4", - build_file = Label("//ratelimiter/cargo/remote:BUILD.slab-0.4.4.bazel"), - ) - - maybe( - http_archive, - name = "raze__socket2__0_4_1", - url = "https://crates.io/api/v1/crates/socket2/0.4.1/download", - type = "tar.gz", - sha256 = "765f090f0e423d2b55843402a07915add955e7d60657db13707a159727326cad", - strip_prefix = "socket2-0.4.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.socket2-0.4.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__syn__1_0_74", - url = "https://crates.io/api/v1/crates/syn/1.0.74/download", - type = "tar.gz", - sha256 = "1873d832550d4588c3dbc20f01361ab00bfe741048f71e3fecf145a7cc18b29c", - strip_prefix = "syn-1.0.74", - build_file = Label("//ratelimiter/cargo/remote:BUILD.syn-1.0.74.bazel"), - ) - - maybe( - http_archive, - name = "raze__tempfile__3_2_0", - url = "https://crates.io/api/v1/crates/tempfile/3.2.0/download", - type = "tar.gz", - sha256 = "dac1c663cfc93810f88aed9b8941d48cabf856a1b111c29a40439018d870eb22", - strip_prefix = "tempfile-3.2.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tempfile-3.2.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__tokio__1_9_0", - url = "https://crates.io/api/v1/crates/tokio/1.9.0/download", - type = "tar.gz", - sha256 = "4b7b349f11a7047e6d1276853e612d152f5e8a352c61917887cc2169e2366b4c", - strip_prefix = "tokio-1.9.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tokio-1.9.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__tokio_io_timeout__1_1_1", - url = "https://crates.io/api/v1/crates/tokio-io-timeout/1.1.1/download", - type = "tar.gz", - sha256 = "90c49f106be240de154571dd31fbe48acb10ba6c6dd6f6517ad603abffa42de9", - strip_prefix = "tokio-io-timeout-1.1.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tokio-io-timeout-1.1.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__tokio_macros__1_3_0", - url = "https://crates.io/api/v1/crates/tokio-macros/1.3.0/download", - type = "tar.gz", - sha256 = "54473be61f4ebe4efd09cec9bd5d16fa51d70ea0192213d754d2d500457db110", - strip_prefix = "tokio-macros-1.3.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tokio-macros-1.3.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__tokio_stream__0_1_7", - url = "https://crates.io/api/v1/crates/tokio-stream/0.1.7/download", - type = "tar.gz", - sha256 = "7b2f3f698253f03119ac0102beaa64f67a67e08074d03a22d18784104543727f", - strip_prefix = "tokio-stream-0.1.7", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tokio-stream-0.1.7.bazel"), - ) - - maybe( - http_archive, - name = "raze__tokio_util__0_6_7", - url = "https://crates.io/api/v1/crates/tokio-util/0.6.7/download", - type = "tar.gz", - sha256 = "1caa0b0c8d94a049db56b5acf8cba99dc0623aab1b26d5b5f5e2d945846b3592", - strip_prefix = "tokio-util-0.6.7", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tokio-util-0.6.7.bazel"), - ) - - maybe( - http_archive, - name = "raze__tonic__0_5_0", - url = "https://crates.io/api/v1/crates/tonic/0.5.0/download", - type = "tar.gz", - sha256 = "b584f064fdfc50017ec39162d5aebce49912f1eb16fd128e04b7f4ce4907c7e5", - strip_prefix = "tonic-0.5.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tonic-0.5.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__tonic_build__0_5_1", - url = "https://crates.io/api/v1/crates/tonic-build/0.5.1/download", - type = "tar.gz", - sha256 = "d12faebbe071b06f486be82cc9318350814fdd07fcb28f3690840cd770599283", - strip_prefix = "tonic-build-0.5.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tonic-build-0.5.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__tower__0_4_8", - url = "https://crates.io/api/v1/crates/tower/0.4.8/download", - type = "tar.gz", - sha256 = "f60422bc7fefa2f3ec70359b8ff1caff59d785877eb70595904605bcc412470f", - strip_prefix = "tower-0.4.8", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tower-0.4.8.bazel"), - ) - - maybe( - http_archive, - name = "raze__tower_layer__0_3_1", - url = "https://crates.io/api/v1/crates/tower-layer/0.3.1/download", - type = "tar.gz", - sha256 = "343bc9466d3fe6b0f960ef45960509f84480bf4fd96f92901afe7ff3df9d3a62", - strip_prefix = "tower-layer-0.3.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tower-layer-0.3.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__tower_service__0_3_1", - url = "https://crates.io/api/v1/crates/tower-service/0.3.1/download", - type = "tar.gz", - sha256 = "360dfd1d6d30e05fda32ace2c8c70e9c0a9da713275777f5a4dbb8a1893930c6", - strip_prefix = "tower-service-0.3.1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tower-service-0.3.1.bazel"), - ) - - maybe( - http_archive, - name = "raze__tracing__0_1_26", - url = "https://crates.io/api/v1/crates/tracing/0.1.26/download", - type = "tar.gz", - sha256 = "09adeb8c97449311ccd28a427f96fb563e7fd31aabf994189879d9da2394b89d", - strip_prefix = "tracing-0.1.26", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tracing-0.1.26.bazel"), - ) - - maybe( - http_archive, - name = "raze__tracing_attributes__0_1_15", - url = "https://crates.io/api/v1/crates/tracing-attributes/0.1.15/download", - type = "tar.gz", - sha256 = "c42e6fa53307c8a17e4ccd4dc81cf5ec38db9209f59b222210375b54ee40d1e2", - strip_prefix = "tracing-attributes-0.1.15", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tracing-attributes-0.1.15.bazel"), - ) - - maybe( - http_archive, - name = "raze__tracing_core__0_1_18", - url = "https://crates.io/api/v1/crates/tracing-core/0.1.18/download", - type = "tar.gz", - sha256 = "a9ff14f98b1a4b289c6248a023c1c2fa1491062964e9fed67ab29c4e4da4a052", - strip_prefix = "tracing-core-0.1.18", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tracing-core-0.1.18.bazel"), - ) - - maybe( - http_archive, - name = "raze__tracing_futures__0_2_5", - url = "https://crates.io/api/v1/crates/tracing-futures/0.2.5/download", - type = "tar.gz", - sha256 = "97d095ae15e245a057c8e8451bab9b3ee1e1f68e9ba2b4fbc18d0ac5237835f2", - strip_prefix = "tracing-futures-0.2.5", - build_file = Label("//ratelimiter/cargo/remote:BUILD.tracing-futures-0.2.5.bazel"), - ) - - maybe( - http_archive, - name = "raze__try_lock__0_2_3", - url = "https://crates.io/api/v1/crates/try-lock/0.2.3/download", - type = "tar.gz", - sha256 = "59547bce71d9c38b83d9c0e92b6066c4253371f15005def0c30d9657f50c7642", - strip_prefix = "try-lock-0.2.3", - build_file = Label("//ratelimiter/cargo/remote:BUILD.try-lock-0.2.3.bazel"), - ) - - maybe( - http_archive, - name = "raze__unicode_segmentation__1_8_0", - url = "https://crates.io/api/v1/crates/unicode-segmentation/1.8.0/download", - type = "tar.gz", - sha256 = "8895849a949e7845e06bd6dc1aa51731a103c42707010a5b591c0038fb73385b", - strip_prefix = "unicode-segmentation-1.8.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.unicode-segmentation-1.8.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__unicode_xid__0_2_2", - url = "https://crates.io/api/v1/crates/unicode-xid/0.2.2/download", - type = "tar.gz", - sha256 = "8ccb82d61f80a663efe1f787a51b16b5a51e3314d6ac365b08639f52387b33f3", - strip_prefix = "unicode-xid-0.2.2", - build_file = Label("//ratelimiter/cargo/remote:BUILD.unicode-xid-0.2.2.bazel"), - ) - - maybe( - http_archive, - name = "raze__want__0_3_0", - url = "https://crates.io/api/v1/crates/want/0.3.0/download", - type = "tar.gz", - sha256 = "1ce8a968cb1cd110d136ff8b819a556d6fb6d919363c61534f6860c7eb172ba0", - strip_prefix = "want-0.3.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.want-0.3.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__wasi__0_10_2_wasi_snapshot_preview1", - url = "https://crates.io/api/v1/crates/wasi/0.10.2+wasi-snapshot-preview1/download", - type = "tar.gz", - sha256 = "fd6fbd9a79829dd1ad0cc20627bf1ed606756a7f77edff7b66b7064f9cb327c6", - strip_prefix = "wasi-0.10.2+wasi-snapshot-preview1", - build_file = Label("//ratelimiter/cargo/remote:BUILD.wasi-0.10.2+wasi-snapshot-preview1.bazel"), - ) - - maybe( - http_archive, - name = "raze__which__4_2_2", - url = "https://crates.io/api/v1/crates/which/4.2.2/download", - type = "tar.gz", - sha256 = "ea187a8ef279bc014ec368c27a920da2024d2a711109bfbe3440585d5cf27ad9", - strip_prefix = "which-4.2.2", - build_file = Label("//ratelimiter/cargo/remote:BUILD.which-4.2.2.bazel"), - ) - - maybe( - http_archive, - name = "raze__winapi__0_3_9", - url = "https://crates.io/api/v1/crates/winapi/0.3.9/download", - type = "tar.gz", - sha256 = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419", - strip_prefix = "winapi-0.3.9", - build_file = Label("//ratelimiter/cargo/remote:BUILD.winapi-0.3.9.bazel"), - ) - - maybe( - http_archive, - name = "raze__winapi_i686_pc_windows_gnu__0_4_0", - url = "https://crates.io/api/v1/crates/winapi-i686-pc-windows-gnu/0.4.0/download", - type = "tar.gz", - sha256 = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6", - strip_prefix = "winapi-i686-pc-windows-gnu-0.4.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.winapi-i686-pc-windows-gnu-0.4.0.bazel"), - ) - - maybe( - http_archive, - name = "raze__winapi_x86_64_pc_windows_gnu__0_4_0", - url = "https://crates.io/api/v1/crates/winapi-x86_64-pc-windows-gnu/0.4.0/download", - type = "tar.gz", - sha256 = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f", - strip_prefix = "winapi-x86_64-pc-windows-gnu-0.4.0", - build_file = Label("//ratelimiter/cargo/remote:BUILD.winapi-x86_64-pc-windows-gnu-0.4.0.bazel"), - ) diff --git a/ratelimiter/lib/lib.rs b/ratelimiter/lib/lib.rs deleted file mode 100644 index 6eda7c4..0000000 --- a/ratelimiter/lib/lib.rs +++ /dev/null @@ -1 +0,0 @@ -// Some implementation here.
\ No newline at end of file diff --git a/ratelimiter/proto/BUILD.bazel b/ratelimiter/proto/BUILD.bazel index c37c39f..247554e 100644 --- a/ratelimiter/proto/BUILD.bazel +++ b/ratelimiter/proto/BUILD.bazel @@ -1,24 +1 @@ -load("@rules_proto//proto:defs.bzl", "proto_library") -load("@io_bazel_rules_go//go:def.bzl", "go_library") -load("@io_bazel_rules_go//proto:def.bzl", "go_proto_library") - -proto_library( - name = "nova_ratelimit_v1_proto", - srcs = ["nova.ratelimit.v1.proto"], - visibility = ["//visibility:public"], -) - -go_proto_library( - name = "nova_ratelimit_v1_go_proto", - compilers = ["@io_bazel_rules_go//proto:go_grpc"], - importpath = "github.com/discordnova/nova/ratelimiter/proto", - proto = ":nova_ratelimit_v1_proto", - visibility = ["//visibility:public"], -) - -go_library( - name = "proto", - embed = [":nova_ratelimit_v1_go_proto"], - importpath = "github.com/discordnova/nova/ratelimiter/proto", - visibility = ["//visibility:public"], -) +exports_files(["nova.ratelimit.v1.proto"]) diff --git a/ratelimiter/src/main.rs b/ratelimiter/src/main.rs index daa1da5..633af68 100644 --- a/ratelimiter/src/main.rs +++ b/ratelimiter/src/main.rs @@ -1,5 +1,45 @@ -// Some implementation of the gRPC service using the shared library. - -fn main () { - println!("Hello world!") +// Some implementation of the gRPC service using the shared library.
+
+pub mod ratelimit_pb {
+ tonic::include_proto!("nova.ratelimit.v1");
+}
+
+use ratelimit_pb::ratelimit_service_server::{RatelimitService, RatelimitServiceServer};
+use ratelimit_pb::{CreateBucketData, RatelimitResponse, RatelimitRequest};
+use tonic::{Request, Status, Response};
+use tonic::transport::Server;
+use std::error::Error;
+
+#[derive(Default)]
+pub struct MyRatelimitService {}
+
+#[tonic::async_trait]
+impl RatelimitService for MyRatelimitService {
+ async fn get_ratelimit_status(
+ &self,
+ _request: Request<RatelimitRequest>
+ ) -> Result<Response<RatelimitResponse>, Status> {
+ return Err(Status::not_found("Not implmented"))
+ }
+ async fn create_bucket(
+ &self,
+ _request: Request<CreateBucketData>
+ ) ->Result<Response<CreateBucketData>, Status> {
+ return Err(tonic::Status::not_found("Not implmented"))
+ }
+}
+
+#[tokio::main]
+async fn main() -> Result<(), Box<dyn Error>> {
+ let addr = "[::1]:50051".parse().unwrap();
+ let service = MyRatelimitService::default();
+
+ println!("GreeterServer listening on {}", addr);
+
+ Server::builder()
+ .add_service(RatelimitServiceServer::new(service))
+ .serve(addr)
+ .await?;
+
+ Ok(())
}
\ No newline at end of file diff --git a/webhook/BUILD b/webhook/BUILD new file mode 100644 index 0000000..f29da5f --- /dev/null +++ b/webhook/BUILD @@ -0,0 +1,24 @@ +load("@rules_rust//rust:rust.bzl", "rust_binary", "rust_test") +load("//cargo:crates.bzl", "all_crate_deps") +load("@io_bazel_rules_docker//rust:image.bzl", "rust_image") + +test_suite(name = "tests") + +rust_binary( + name = "webhook", + srcs = glob(["src/**"]), + deps = all_crate_deps() + ["//common/rust:common"], + visibility = ["//visibility:public"], +) + +rust_test( + name = "webhook_test", + crate = ":webhook" +) + +rust_image( + name = "image", + binary = ":webhook", + visibility = ["//visibility:public"], + base = "//bazel:base", +) diff --git a/webhook/BUILD.bazel b/webhook/BUILD.bazel deleted file mode 100644 index 9f908a2..0000000 --- a/webhook/BUILD.bazel +++ /dev/null @@ -1,22 +0,0 @@ -load("@io_bazel_rules_go//go:def.bzl", "go_binary", "go_library") -load("@bazel_tools//tools/build_defs/pkg:pkg.bzl", "pkg_tar") - -go_library( - name = "webhook_lib", - srcs = ["main.go"], - importpath = "github.com/discordnova/nova/webhook", - visibility = ["//visibility:private"], -) - -go_binary( - name = "webhook", - embed = [":webhook_lib"], - visibility = ["//visibility:public"], -) - -pkg_tar( - name = "webhook_pkg", - srcs = [":webhook"], - mode = "0755", - visibility = ["//visibility:public"], -) diff --git a/webhook/Cargo.toml b/webhook/Cargo.toml new file mode 100644 index 0000000..045c710 --- /dev/null +++ b/webhook/Cargo.toml @@ -0,0 +1,20 @@ +[package] +name = "webhook" +version = "0.1.0" +edition = "2018" + +[dependencies] +hyper = { version = "0.14", features = ["full"] } +tokio = { version = "1", features = ["full"] } +log = { version = "0.4", features = ["std"] } +config = "0.11" +serde = { version = "1.0.8", features = ["derive"] } +libsodium-sys = "0.2.7" +hex = "0.4.3" +serde_json = { version = "1.0" } +common = { path = "../common/rust" } +nats = "0.15.2" + +[[bin]] +name = "webhook" +path = "src/main.rs" diff --git a/webhook/README.md b/webhook/README.md new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/webhook/README.md diff --git a/webhook/cargo/BUILD.bazel b/webhook/cargo/BUILD.bazel new file mode 100644 index 0000000..e035ab6 --- /dev/null +++ b/webhook/cargo/BUILD.bazel @@ -0,0 +1,94 @@ +""" +@generated +cargo-raze generated Bazel file. + +DO NOT EDIT! Replaced on runs of cargo-raze +""" + +package(default_visibility = ["//visibility:public"]) + +licenses([ + "notice", # See individual crates for specific licenses +]) + +# Aliased targets +alias( + name = "config", + actual = "@raze__config__0_11_0//:config", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "hex", + actual = "@raze__hex__0_4_3//:hex", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "hyper", + actual = "@raze__hyper__0_14_12//:hyper", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "libsodium_sys", + actual = "@raze__libsodium_sys__0_2_7//:libsodium_sys", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "log", + actual = "@raze__log__0_4_14//:log", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "nats", + actual = "@raze__nats__0_15_2//:nats", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde", + actual = "@raze__serde__1_0_130//:serde", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "serde_json", + actual = "@raze__serde_json__1_0_67//:serde_json", + tags = [ + "cargo-raze", + "manual", + ], +) + +alias( + name = "tokio", + actual = "@raze__tokio__1_11_0//:tokio", + tags = [ + "cargo-raze", + "manual", + ], +) diff --git a/webhook/go.mod b/webhook/go.mod deleted file mode 100644 index bb3c79d..0000000 --- a/webhook/go.mod +++ /dev/null @@ -1,3 +0,0 @@ -module github.com/discordnova/nova/webhook - -go 1.16 diff --git a/webhook/main.go b/webhook/main.go deleted file mode 100644 index 750d231..0000000 --- a/webhook/main.go +++ /dev/null @@ -1,8 +0,0 @@ -package main
-
-import "fmt"
-
-func main() {
- fmt.Println("Helle world, webhook!")
- fmt.Println("In the future, this will be used to receive http based events")
-}
diff --git a/webhook/src/config.rs b/webhook/src/config.rs new file mode 100644 index 0000000..eead97b --- /dev/null +++ b/webhook/src/config.rs @@ -0,0 +1,19 @@ +use serde::Deserialize; + +#[derive(Debug, Deserialize, Clone, Default)] +pub struct ServerSettings { + pub port: u16, + pub address: String, +} + +#[derive(Debug, Deserialize, Clone, Default)] +pub struct Discord { + pub public_key: String, + pub client_id: u32, +} + +#[derive(Debug, Deserialize, Clone, Default)] +pub struct Config { + pub server: ServerSettings, + pub discord: Discord, +}
\ No newline at end of file diff --git a/webhook/src/handler/handler.rs b/webhook/src/handler/handler.rs new file mode 100644 index 0000000..b993aaa --- /dev/null +++ b/webhook/src/handler/handler.rs @@ -0,0 +1,126 @@ +use super::{signature::validate_signature, types::Interaction}; +use crate::config::Config; +use hyper::{Body, Method, Request, Response, StatusCode, body::{to_bytes, Bytes}, service::Service}; +use log::{error, info, trace}; +use nats::Connection; +use serde::{Deserialize, Serialize}; +use std::{future::Future, io::{Error, ErrorKind}, pin::Pin, str::from_utf8, sync::Arc, task::{Context, Poll}}; + +/// Hyper service used to handle the discord webhooks +#[derive(Clone)] +pub struct HandlerService { + pub config: Config, + pub nats: Arc<Connection>, +} + +impl HandlerService { + async fn check_request(&self, req: Request<Body>) -> Result<Bytes, Error> { + if req.method() == Method::POST { + let headers = req.headers().clone(); + let signature = headers.get("X-Signature-Ed25519"); + let timestamp = headers.get("X-Signature-Timestamp"); + if let (Some(timestamp), Some(signature)) = (timestamp, signature) { + if let Ok(data) = to_bytes(req.into_body()).await { + let contatenated_data = [timestamp.as_bytes().to_vec(), data.to_vec()].concat(); + if let Ok(signature_str) = &signature.to_str() { + if validate_signature( + &self.config.discord.public_key, + &contatenated_data, + signature_str, + ) { + Ok(data) + } else { + Err(Error::new( + ErrorKind::InvalidData, + "invalid signature specified", + )) + } + } else { + Err(Error::new( + ErrorKind::BrokenPipe, + "failed to read signature", + )) + } + } else { + Err(Error::new(ErrorKind::BrokenPipe, "unable to read body")) + } + } else { + Err(Error::new(ErrorKind::InvalidData, "missing headers")) + } + } else { + Err(Error::new(ErrorKind::InvalidData, "invalid method")) + } + } +} + +#[derive(Debug, Serialize, Deserialize)] +pub struct Ping { + #[serde(rename = "type")] + t: i32 +} + +/// Implementation of the service +impl Service<Request<Body>> for HandlerService { + type Response = Response<Body>; + type Error = hyper::Error; + type Future = Pin<Box<dyn Future<Output = Result<Self::Response, Self::Error>> + Send>>; + + fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> { + Poll::Ready(Ok(())) + } + + fn call(&mut self, req: Request<Body>) -> Self::Future { + let self_clone = self.clone(); + + Box::pin(async move { + match self_clone.check_request(req).await { + Ok(data) => { + let value: Interaction = serde_json::from_str(from_utf8(&data).unwrap()).unwrap(); + trace!("received value: {:?}", value); + + match value.t { + 1 => { + info!("sending pong"); + // a ping must be responded with another ping + return Ok(Response::builder().header("Content-Type", "application/json").body(serde_json::to_string(&Ping { + t: 1 + }).unwrap().into()).unwrap()); + }, + _ => { + let payload = serde_json::to_string(&common::payloads::CachePayload { + tracing: common::payloads::Tracing { + node_id: "".to_string(), + span: None, + }, + data: value, + }).unwrap(); + + match self_clone.nats.request("nova.cache.dispatch.interaction", payload) { + Ok(response) => { + Ok( + Response::builder() + .header("Content-Type", "application/json") + .body(from_utf8(&response.data).unwrap().to_string().into()) + .unwrap() + ) + }, + Err(error) => { + error!("failed to request nats: {}", error); + Ok( + Response::builder() + .status(500) + .body("an internal server error occured".to_string().into()) + .unwrap() + ) + } + } + }, + } + }, + Err(error) => { + Ok(Response::builder().status(StatusCode::UNAUTHORIZED).body(error.to_string().into()).unwrap()) + } + } + }) + } +} diff --git a/webhook/src/handler/make_service.rs b/webhook/src/handler/make_service.rs new file mode 100644 index 0000000..96b203d --- /dev/null +++ b/webhook/src/handler/make_service.rs @@ -0,0 +1,28 @@ +use std::{future::{Ready, ready}, sync::Arc, task::{Context, Poll}}; +use hyper::service::Service; +use nats::Connection; +use crate::config::Config; +use super::handler::HandlerService; + + +pub struct MakeSvc { + pub settings: Config, + pub nats: Arc<Connection>, +} + +impl<T> Service<T> for MakeSvc { + type Response = HandlerService; + type Error = std::io::Error; + type Future = Ready<Result<Self::Response, Self::Error>>; + + fn poll_ready(&mut self, _cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> { + Ok(()).into() + } + + fn call(&mut self, _: T) -> Self::Future { + ready(Ok(HandlerService { + config: self.settings.clone(), + nats: self.nats.clone(), + })) + } +} diff --git a/webhook/src/handler/mod.rs b/webhook/src/handler/mod.rs new file mode 100644 index 0000000..490c580 --- /dev/null +++ b/webhook/src/handler/mod.rs @@ -0,0 +1,4 @@ +pub mod make_service; +mod signature; +mod handler; +mod types;
\ No newline at end of file diff --git a/webhook/src/handler/signature.rs b/webhook/src/handler/signature.rs new file mode 100644 index 0000000..5af6b63 --- /dev/null +++ b/webhook/src/handler/signature.rs @@ -0,0 +1,65 @@ +use libsodium_sys::crypto_sign_ed25519_verify_detached; + +/// Checks the signature of a given data using the hex signature and the public key. +pub fn validate_signature(hex_public_key: &str, data: &Vec<u8>, hex_signature: &str) -> bool { + // First, we need to check if the signature & private key is valid base64. + let signature_result = hex::decode(hex_signature); + let public_key_result = hex::decode(hex_public_key); + + if signature_result.is_ok() && public_key_result.is_ok() { + // Since we now have the signatures in u8 vectors. We will initialize all the + // parameters for the ffi call to sodium. + let signature_pointer = signature_result.unwrap(); + let private_key_pointer = public_key_result.unwrap(); + + let data_pointer = data.as_ptr(); + let data_len = data.len() as u64; + + // A ffi call is considered unsafe by the Rust compiler + // we assume all the parameters are correct for the call + unsafe { + // If the signature is valid, sodium will return 0 + return crypto_sign_ed25519_verify_detached( + signature_pointer.as_ptr(), + data_pointer, + data_len, + private_key_pointer.as_ptr(), + ) == 0; + } + } + false +} + +#[cfg(test)] +mod test { + use crate::handler::signature::validate_signature; + + + #[test] + fn validate_signature_test() { + let signature = "543ec3547d57f9ddb1ec4c5c36503ebf288ffda3da3d510764c9a49c2abb57690ef974c63d174771bdd2481de1066966f57abbec12a3ec171b9f6e2373837002"; + let public_key = "eefe0c24473737cb2035232e3b4eb91c206f0a14684168f3503f7d8316058d6f"; + let content = "message de test incroyable".as_bytes().to_vec(); + assert!(validate_signature(public_key, &content, signature)) + } + + #[test] + fn validate_signature_reverse_test() { + let signature = "543ec3547d57f9ddb1ec4c5c36503ebf288ffda3da3d510764c9a49c2abb57690ef974c63d174771bdd2481de1066966f57abbec12a3ec171b9f6e2373837002"; + let public_key = "c029eea18437292c87c62aec34e7d1bd4e38fe6126f3f7c446de6375dc666044"; + let content = "ceci est un test qui ne fonctionnera pas!" + .as_bytes() + .to_vec(); + assert!(!validate_signature(public_key, &content, signature)) + } + + #[test] + fn invalid_hex() { + let signature = "zzz"; + let public_key = "zzz"; + let content = "ceci est un test qui ne fonctionnera pas!" + .as_bytes() + .to_vec(); + assert!(!validate_signature(public_key, &content, signature)) + } +} diff --git a/webhook/src/handler/types.rs b/webhook/src/handler/types.rs new file mode 100644 index 0000000..4cba12a --- /dev/null +++ b/webhook/src/handler/types.rs @@ -0,0 +1,10 @@ +use serde::{Serialize, Deserialize}; +use serde_json::Value; + +#[derive(Debug, Deserialize, Clone, Default, Serialize)] +pub struct Interaction { + #[serde(rename = "type")] + pub t: i16, + pub data: Option<Value>, +} + diff --git a/webhook/src/main.rs b/webhook/src/main.rs new file mode 100644 index 0000000..c127c2c --- /dev/null +++ b/webhook/src/main.rs @@ -0,0 +1,34 @@ +use std::{net::ToSocketAddrs, sync::Arc};
+mod handler;
+mod config;
+use crate::handler::make_service::MakeSvc;
+
+use hyper::Server;
+use log::{info, error};
+use common::config::Settings;
+use crate::config::Config;
+
+#[tokio::main]
+async fn main() {
+ let settings: Settings<Config> = Settings::new("webhook").unwrap();
+
+ let addr = format!("{}:{}", settings.config.server.address, settings.config.server.port)
+ .to_socket_addrs()
+ .unwrap()
+ .next()
+ .unwrap();
+
+ info!(
+ "Starting server on {}:{}",
+ settings.config.server.address, settings.config.server.port
+ );
+
+ let server = Server::bind(&addr).serve(MakeSvc {
+ settings: settings.config.clone(),
+ nats: Arc::new(settings.nats.into()),
+ });
+
+ if let Err(e) = server.await {
+ error!("server error: {}", e);
+ }
+}
|